NPASS Compound

Natural Product: NPC135904

Natural Product ID	NPC135904
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JYQWZASHCQTVLM-AQYGZFFOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	21607574
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 16.2098 0.7002 1.9652 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5698 2.0572 1.7808 C 0 0 1 0 0 0 0 0 0 0 0 0 16.0593 2.5925 0.4513 C 0 0 1 0 0 0 0 0 0 0 0 0 15.3924 3.8874 0.0880 C 0 0 2 0 0 0 0 0 0 0 0 0 13.9039 3.7453 0.3161 C 0 0 2 0 0 0 0 0 0 0 0 0 13.5997 2.3059 0.6109 C 0 0 1 0 0 0 0 0 0 0 0 0 14.2034 1.9331 1.8281 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2238 2.1378 0.6778 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7017 1.2327 -0.2077 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6185 1.8335 -1.0202 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1655 0.8924 -2.1514 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3162 1.6300 -3.0082 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5478 2.2927 -0.3106 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9157 1.4116 0.5110 C 0 0 2 0 0 0 0 0 0 0 0 0 9.8093 0.4978 1.2935 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0672 0.1034 0.6040 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9503 -0.9890 -0.2503 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1985 1.2061 2.4506 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9714 0.7652 -0.2396 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6670 0.9490 0.0767 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7966 0.1511 -0.8648 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0789 0.5153 -2.2884 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8742 0.6151 -3.1544 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6621 -0.1200 -2.7402 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8047 -0.6696 -1.3673 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4189 0.2882 -0.5705 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5786 -1.1537 -0.8361 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4480 -2.4798 -0.4697 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4484 -3.2058 -0.6189 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1812 -3.0795 0.0868 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5323 -4.4975 0.3384 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0439 -5.5515 -0.5571 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5636 -5.0503 -1.8549 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6077 -4.6720 -2.8537 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2475 -6.1917 -2.4956 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4617 -3.9422 -1.6449 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0722 -2.7952 -0.8982 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8743 -1.9269 -0.1732 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0994 -0.7271 -0.6337 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0283 0.2452 0.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1720 -0.6097 0.4542 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4232 0.1844 0.7017 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2691 1.2980 1.6802 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7923 0.8367 -0.6388 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0928 0.4010 -1.1929 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2706 0.4360 -0.2433 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9149 -0.2418 1.0321 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2528 0.5697 2.2443 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8149 -1.4939 1.1312 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5334 -0.7680 0.9811 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1903 -1.7212 2.1133 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9506 -2.4755 1.7008 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7250 -1.5654 1.5081 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4499 -0.9522 2.8467 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5249 -2.3352 1.0833 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9137 -3.7893 1.2003 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3120 -2.2592 2.0458 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0076 -2.3412 1.3920 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7782 1.7180 -0.1176 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9974 1.8878 -0.7675 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0217 2.3439 0.2583 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0285 3.8558 0.1748 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6578 4.4263 0.0340 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9830 3.8457 -1.1793 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8099 2.8769 -1.7292 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9685 4.1029 1.2232 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7767 4.4548 1.1715 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2921 1.9018 -0.0449 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9350 1.1740 0.9086 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.2705 1.6632 1.3510 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.2689 0.5000 1.4536 C 0 0 2 0 0 0 0 0 0 0 0 0 -14.4859 -0.0005 0.0517 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.0972 -0.2268 -0.5475 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.9878 0.6700 -1.7356 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.0974 0.3762 -2.5573 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1031 -0.1174 0.3874 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.2356 -1.1726 0.0254 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.4131 0.9251 2.0835 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.2152 2.1819 2.6631 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4680 -1.1940 -3.6251 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5343 1.9885 -3.2166 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9208 -0.4549 -2.8283 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1759 4.1411 -0.7999 O 0 0 0 0 0 0 0 0 0 0 0 0 15.5735 4.0843 -1.2812 O 0 0 0 0 0 0 0 0 0 0 0 0 17.4289 2.8918 0.6401 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7625 0.0876 2.7511 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2151 0.1238 0.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2921 0.8424 2.2259 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9227 2.7149 2.5972 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9975 1.8434 -0.3398 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7571 4.7441 0.6808 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5727 4.4105 1.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9791 1.6707 -0.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4626 0.7800 -0.8794 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0313 2.7094 -1.5718 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0383 0.6024 -2.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5611 0.0598 -1.7928 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2507 1.0954 -3.8405 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3425 2.0086 1.2701 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2866 -0.4542 1.5833 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8856 -0.1839 1.3303 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8047 -1.1155 -0.7054 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5663 0.5877 3.1342 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4135 2.0231 -0.0922 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3657 0.7130 1.0998 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9755 -0.9488 -0.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6798 1.4589 -2.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1199 0.3582 -4.2235 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7388 0.5060 -2.8178 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5258 -1.5436 -1.4236 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1934 -4.7768 1.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6569 -4.6489 0.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2037 -6.1236 -0.0876 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8718 -6.3030 -0.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6299 -4.9554 -2.5666 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4440 -5.1520 -3.8640 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5358 -3.5815 -3.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3812 -6.0418 -3.5699 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2479 -7.1563 -2.2832 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2287 -6.2131 -1.9829 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7262 -3.6805 -2.7281 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4274 -4.3678 -1.3142 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5607 -2.1707 -1.7189 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6096 -0.3382 -1.5507 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5202 0.7479 0.8873 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2920 1.0901 -0.6487 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4387 -1.2575 -0.4396 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7629 2.2393 1.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1869 1.5885 1.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6854 1.1456 2.6729 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0357 0.5844 -1.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7906 1.9357 -0.5826 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0454 -0.6133 -1.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3488 1.0927 -2.0229 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0707 -0.1280 -0.8232 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8037 0.1713 3.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0860 1.6590 2.1321 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3628 0.4693 2.4269 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3902 -2.3110 0.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9154 -1.8020 2.2002 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7850 -1.2041 0.6929 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5260 -1.4749 0.0840 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0071 -2.5063 2.0638 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2273 -1.3180 3.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8336 -3.2716 2.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2081 -2.7839 0.6382 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0229 -1.7798 3.4912 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3771 -0.6913 3.4315 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8642 -0.0367 2.8508 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1383 -4.5175 0.9925 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0304 -3.9193 2.3329 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8220 -4.1067 0.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3103 -1.2669 2.5877 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3946 -3.0033 2.8613 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7086 -2.8771 2.1088 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5152 -1.3218 1.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3263 0.9710 -1.2886 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7145 2.0559 1.2773 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5667 4.0910 -0.7918 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7220 5.5369 -0.0395 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0295 3.3630 -0.8105 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7129 4.6320 -1.9211 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3913 4.6989 1.9178 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5280 4.1696 2.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3173 1.0266 1.8416 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7167 2.4520 0.7360 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7443 -0.3082 2.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0525 0.7754 -0.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0792 -1.2720 -0.9172 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0979 0.5005 -2.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1131 1.7514 -1.4764 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7758 1.0938 -2.5254 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0997 -1.0347 0.4453 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4667 0.4551 2.9736 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3124 2.3226 2.9832 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2238 -1.3074 -4.2288 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3366 2.5563 -3.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9257 -0.4024 -3.8341 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2846 4.4472 -0.5016 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2406 4.9786 -1.5379 H 0 0 0 0 0 0 0 0 0 0 0 0 17.7214 3.3754 -0.1931 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 14 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 2 0 30 28 1 6 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 33 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 1 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 47 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 1 53 55 1 0 55 56 1 6 55 57 1 0 57 58 1 0 46 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 62 67 1 0 61 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 72 77 1 0 71 78 1 0 70 79 1 0 24 80 1 0 23 81 1 0 22 82 1 0 5 83 1 0 4 84 1 0 3 85 1 0 7 2 1 0 16 9 1 0 26 21 1 0 58 30 1 0 65 60 1 0 76 69 1 0 37 30 1 0 55 38 1 0 53 41 1 0 50 42 1 0 1 86 1 0 1 87 1 0 1 88 1 0 2 89 1 1 3 90 1 6 4 91 1 1 5 92 1 1 6 93 1 6 9 94 1 6 10 95 1 6 11 96 1 0 11 97 1 0 12 98 1 0 14 99 1 1 15100 1 1 16101 1 1 17102 1 0 18103 1 0 20104 1 0 20105 1 0 21106 1 6 22107 1 1 23108 1 6 24109 1 1 25110 1 6 31111 1 0 31112 1 0 32113 1 0 32114 1 0 34115 1 0 34116 1 0 34117 1 0 35118 1 0 35119 1 0 35120 1 0 36121 1 0 36122 1 0 37123 1 6 39124 1 0 40125 1 0 40126 1 0 41127 1 6 43128 1 0 43129 1 0 43130 1 0 44131 1 0 44132 1 0 45133 1 0 45134 1 0 46135 1 6 48136 1 0 48137 1 0 48138 1 0 49139 1 0 49140 1 0 49141 1 0 50142 1 6 51143 1 0 51144 1 0 52145 1 0 52146 1 0 54147 1 0 54148 1 0 54149 1 0 56150 1 0 56151 1 0 56152 1 0 57153 1 0 57154 1 0 58155 1 0 58156 1 0 60157 1 6 61158 1 1 62159 1 6 63160 1 6 64161 1 0 64162 1 0 66163 1 0 67164 1 0 69165 1 1 70166 1 6 71167 1 1 72168 1 6 73169 1 6 74170 1 0 74171 1 0 75172 1 0 77173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 M END

Standard InCHIKey	JYQWZASHCQTVLM-AQYGZFFOSA-N
Standard InCHI	InChI=1S/C59H96O26/c1-24-34(63)38(67)42(71)49(78-24)83-46-29(21-61)80-48(45(74)41(46)70)77-23-30-37(66)40(69)44(73)51(81-30)85-53(75)59-17-15-54(2,3)19-26(59)25-9-10-32-56(6)13-12-33(55(4,5)31(56)11-14-58(32,8)57(25,7)16-18-59)82-52-47(35(64)27(62)22-76-52)84-50-43(72)39(68)36(65)28(20-60)79-50/h9,24,26-52,60-74H,10-23H2,1-8H3/t24-,26-,27-,28+,29+,30+,31-,32+,33-,34-,35-,36+,37+,38+,39-,40-,41+,42+,43+,44+,45+,46+,47+,48+,49-,50-,51-,52-,56-,57+,58+,59-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)[C@@]12CCC(C)(C)C[C@H]2C2=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]2(C)CC1)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1220.62	Volume:	1166.728 ? Van der Waals volume.
Dense:	1.046	LogP:	0.8 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.675 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.89 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	57.0
TPSA:	412.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.051	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.191	Fsp³:	0.949
MCE-18:	217.043 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.803	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.302	Promiscuous compounds:	0.069

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.854	MDCK Permeability:	-4.993
Pgp-inhibitor:	0.0	Pgp-substrate:	0.446
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.952	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.033	MRP1:	0.001
Plasma Protein Binding (PPB):	64.846%	Volume Distribution (VD):	-0.291
Fu:	17.547% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.003
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.521
HLM stability:	0.012 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.871

Half-life (T1/2):

4.275

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.002
Human Hepatotoxicity (H-HT):	0.787	Drug-induced Liver Injury (DILI):	0.985
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.015	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.75	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.365	RPMI-8226 Immunitoxicity:	0.408
A549 Cytotoxicity:	0.953	Hek293 Cytotoxicity:	0.291
BCF:	1.658 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.769 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.263 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.454 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25841	Caulophyllum thalictroides	Species	Berberidaceae	Eukaryota	underground parts	n.a.	n.a.	PMID[19449879]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[31301930]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO25841	Caulophyllum thalictroides	Species	Berberidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25841	Caulophyllum thalictroides	Species	Berberidaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	>	50000.0	nM	PMID[31301930]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC135904 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24326
0.1-0.2	21371
0.2-0.3	2723
0.3-0.4	780
0.4-0.5	362
0.5-0.6	60
0.6-0.7	79
0.7-0.8	0
0.8-0.85	11
0.85-0.9	12
0.9-0.95	5
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9703	High Similarity	NPC60557
0.9703	High Similarity	NPC67857
0.9266	High Similarity	NPC305981
0.9182	High Similarity	NPC261506
0.9182	High Similarity	NPC4328
0.9083	High Similarity	NPC41061
0.9083	High Similarity	NPC227551
0.8952	High Similarity	NPC76972
0.8952	High Similarity	NPC469782
0.8952	High Similarity	NPC204414
0.8812	High Similarity	NPC63159
0.875	High Similarity	NPC236638
0.875	High Similarity	NPC294453
0.8571	High Similarity	NPC295823
0.8571	High Similarity	NPC174720
0.8571	High Similarity	NPC475467
0.8515	High Similarity	NPC112352
0.8509	High Similarity	NPC298034
0.8509	High Similarity	NPC71065
0.8496	Intermediate Similarity	NPC43550
0.8448	Intermediate Similarity	NPC250247
0.844	Intermediate Similarity	NPC165204
0.8407	Intermediate Similarity	NPC258617
0.8349	Intermediate Similarity	NPC79643
0.8125	Intermediate Similarity	NPC475160
0.8125	Intermediate Similarity	NPC100639
0.8125	Intermediate Similarity	NPC473714
0.8103	Intermediate Similarity	NPC202828
0.8103	Intermediate Similarity	NPC119592
0.8036	Intermediate Similarity	NPC123199
0.7982	Intermediate Similarity	NPC481080
0.7928	Intermediate Similarity	NPC475287
0.7899	Intermediate Similarity	NPC220160
0.7895	Intermediate Similarity	NPC488560
0.789	Intermediate Similarity	NPC241909
0.7863	Intermediate Similarity	NPC65105
0.7759	Intermediate Similarity	NPC476068
0.7759	Intermediate Similarity	NPC57484
0.7745	Intermediate Similarity	NPC48499
0.7719	Intermediate Similarity	NPC155410
0.7692	Intermediate Similarity	NPC110633
0.7636	Intermediate Similarity	NPC481079
0.7593	Intermediate Similarity	NPC148417
0.757	Intermediate Similarity	NPC104071
0.75	Intermediate Similarity	NPC102439
0.75	Intermediate Similarity	NPC481081
0.75	Intermediate Similarity	NPC46665
0.75	Intermediate Similarity	NPC481078
0.7417	Intermediate Similarity	NPC293330
0.7355	Intermediate Similarity	NPC136768
0.7241	Intermediate Similarity	NPC192600
0.7222	Intermediate Similarity	NPC469946
0.7143	Intermediate Similarity	NPC469778
0.7101	Intermediate Similarity	NPC469776
0.7091	Intermediate Similarity	NPC160415
0.7071	Intermediate Similarity	NPC32723
0.7059	Intermediate Similarity	NPC470218
0.704	Intermediate Similarity	NPC224381
0.7027	Intermediate Similarity	NPC480475
0.7021	Intermediate Similarity	NPC481323
0.6972	Remote Similarity	NPC295371
0.696	Remote Similarity	NPC70809
0.6923	Remote Similarity	NPC135334
0.6918	Remote Similarity	NPC295941
0.6903	Remote Similarity	NPC297263
0.6875	Remote Similarity	NPC481324
0.6833	Remote Similarity	NPC475209
0.6789	Remote Similarity	NPC235405
0.6754	Remote Similarity	NPC222580
0.6752	Remote Similarity	NPC31838
0.6752	Remote Similarity	NPC187290
0.6727	Remote Similarity	NPC249848
0.6727	Remote Similarity	NPC107966
0.6726	Remote Similarity	NPC251768
0.6724	Remote Similarity	NPC301449
0.6724	Remote Similarity	NPC601290
0.6667	Remote Similarity	NPC475591
0.6667	Remote Similarity	NPC236870
0.6667	Remote Similarity	NPC235438
0.6667	Remote Similarity	NPC29069
0.664	Remote Similarity	NPC475514
0.662	Remote Similarity	NPC469775
0.6609	Remote Similarity	NPC475504
0.6599	Remote Similarity	NPC469777
0.6597	Remote Similarity	NPC469774
0.6587	Remote Similarity	NPC161717
0.6579	Remote Similarity	NPC10607
0.6579	Remote Similarity	NPC164389
0.6565	Remote Similarity	NPC480422
0.656	Remote Similarity	NPC286457
0.6549	Remote Similarity	NPC192791
0.6525	Remote Similarity	NPC80986
0.6491	Remote Similarity	NPC30735
0.6467	Remote Similarity	NPC469772
0.6463	Remote Similarity	NPC100925
0.646	Remote Similarity	NPC161674
0.6422	Remote Similarity	NPC214484
0.6387	Remote Similarity	NPC480473
0.6387	Remote Similarity	NPC480474
0.6382	Remote Similarity	NPC469773
0.6372	Remote Similarity	NPC39211
0.6339	Remote Similarity	NPC475516
0.6333	Remote Similarity	NPC104137
0.6333	Remote Similarity	NPC26626
0.6293	Remote Similarity	NPC101744
0.6293	Remote Similarity	NPC173859
0.6293	Remote Similarity	NPC148603
0.6283	Remote Similarity	NPC473373
0.6273	Remote Similarity	NPC90856
0.625	Remote Similarity	NPC470876
0.6239	Remote Similarity	NPC68175
0.6218	Remote Similarity	NPC114484
0.6207	Remote Similarity	NPC309714
0.6174	Remote Similarity	NPC263756
0.616	Remote Similarity	NPC251263
0.616	Remote Similarity	NPC480419
0.6129	Remote Similarity	NPC123522
0.6121	Remote Similarity	NPC223301
0.6121	Remote Similarity	NPC171544
0.6111	Remote Similarity	NPC283417
0.6111	Remote Similarity	NPC471550
0.6111	Remote Similarity	NPC200049
0.6094	Remote Similarity	NPC21691
0.6083	Remote Similarity	NPC281148
0.6083	Remote Similarity	NPC104372
0.6066	Remote Similarity	NPC36831
0.6047	Remote Similarity	NPC473452
0.6047	Remote Similarity	NPC480418
0.6045	Remote Similarity	NPC102505
0.6045	Remote Similarity	NPC488514
0.6034	Remote Similarity	NPC76497
0.6034	Remote Similarity	NPC213674
0.6032	Remote Similarity	NPC219180
0.6028	Remote Similarity	NPC472268
0.6017	Remote Similarity	NPC40775
0.6017	Remote Similarity	NPC488526
0.6017	Remote Similarity	NPC473459
0.6	Remote Similarity	NPC134835
0.6	Remote Similarity	NPC128925
0.5971	Remote Similarity	NPC489208
0.5957	Remote Similarity	NPC297950
0.5948	Remote Similarity	NPC470512
0.5948	Remote Similarity	NPC157868
0.5935	Remote Similarity	NPC473826
0.5926	Remote Similarity	NPC480417
0.5923	Remote Similarity	NPC13998
0.592	Remote Similarity	NPC268184
0.5906	Remote Similarity	NPC309907
0.5897	Remote Similarity	NPC473343
0.5891	Remote Similarity	NPC85154
0.5887	Remote Similarity	NPC470915
0.5882	Remote Similarity	NPC159309
0.5882	Remote Similarity	NPC86222
0.5865	Remote Similarity	NPC309223
0.5833	Remote Similarity	NPC45606
0.5833	Remote Similarity	NPC237503
0.5827	Remote Similarity	NPC475899
0.582	Remote Similarity	NPC73318
0.5814	Remote Similarity	NPC47995
0.5814	Remote Similarity	NPC54636
0.5794	Remote Similarity	NPC167383
0.5769	Remote Similarity	NPC4749
0.5766	Remote Similarity	NPC489209
0.5746	Remote Similarity	NPC302543
0.5738	Remote Similarity	NPC469821
0.5736	Remote Similarity	NPC191827
0.5726	Remote Similarity	NPC187618
0.5726	Remote Similarity	NPC96641
0.5726	Remote Similarity	NPC163183
0.5726	Remote Similarity	NPC127056
0.5703	Remote Similarity	NPC133818
0.5703	Remote Similarity	NPC470911
0.5702	Remote Similarity	NPC204458
0.5685	Remote Similarity	NPC220838
0.5683	Remote Similarity	NPC33012
0.568	Remote Similarity	NPC207738
0.5674	Remote Similarity	NPC475368
0.5667	Remote Similarity	NPC117714
0.5656	Remote Similarity	NPC257468
0.5652	Remote Similarity	NPC1046
0.5652	Remote Similarity	NPC78046
0.5641	Remote Similarity	NPC56713
0.5629	Remote Similarity	NPC472269
0.5612	Remote Similarity	NPC8524
0.561	Remote Similarity	NPC64715
0.561	Remote Similarity	NPC601659
0.5593	Remote Similarity	NPC150400
0.5537	Remote Similarity	NPC109588
0.5537	Remote Similarity	NPC30289
0.5528	Remote Similarity	NPC470514
0.5528	Remote Similarity	NPC470513
0.5526	Remote Similarity	NPC209894
0.552	Remote Similarity	NPC324875
0.552	Remote Similarity	NPC292677
0.5512	Remote Similarity	NPC815
0.55	Remote Similarity	NPC80843
0.5492	Remote Similarity	NPC305267
0.5492	Remote Similarity	NPC232237
0.5481	Remote Similarity	NPC471385

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC135904 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7685
0.1-0.2	1408
0.2-0.3	48
0.3-0.4	9
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data