NPASS Compound

Natural Product: NPC470915

Natural Product ID	NPC470915
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Beta-D-Glucopyranosyl(1->6)-(2'-Angeloyl)-Beta-D-Glucopyranosyl-28-O-Beta-D-Glucopyranosyl(1->6)[Alpha-L-Rhamnopyranosyl(1->2)-Beta-D-Glucopyranosyl]-16-Deoxybarringtogenol C
IUPAC Name	[(2R,3R,4S,5S,6R)-2-[[(3S,4aR,6aR,6bS,8aR,9R,10R,12aS,14aR,14bR)-8a-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-9,10-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] (Z)-2-methylbut-2-enoate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2313348
PubChem CID	57337699
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 200209 0 0 0 0 0 0 0 0999 V2000 -8.1612 3.5348 -6.5434 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9558 3.5032 -5.4131 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1952 2.0326 -5.0554 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9668 1.4687 -4.8116 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8814 0.8585 -3.5871 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6211 0.2731 -3.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8641 -1.0740 -3.1473 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6343 -1.8799 -2.8924 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9035 -1.3562 -1.8795 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1840 -1.6236 -0.6015 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0708 -0.4320 0.1334 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1916 -0.5237 1.2004 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8767 0.8210 1.8396 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0007 0.5102 3.0510 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6972 -0.1006 2.6663 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8538 0.9032 1.9041 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6592 1.3687 0.7861 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0444 1.5871 -0.3532 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3666 1.4333 -0.6867 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1585 1.0682 0.5074 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4578 0.2463 1.4738 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1140 -1.1683 1.1458 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3450 0.1587 2.7394 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6554 -0.5147 2.3352 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3302 0.4982 1.4421 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5799 0.6300 0.1478 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6417 -0.5282 -0.7770 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2096 1.8056 -0.5727 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6700 1.9741 -0.3776 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4278 0.7592 0.0872 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7862 0.3231 1.3881 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3862 1.2854 2.4421 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3146 -1.0329 1.7911 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5772 -0.2092 -0.8505 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8238 -0.5946 -1.2322 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1531 -0.1431 -2.5364 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3399 -0.7911 -2.9030 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1880 -0.0393 -3.8660 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6109 1.1868 -3.4415 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3528 1.2082 -2.2915 C 0 0 2 0 0 0 0 0 0 0 0 0 9.6301 1.9304 -1.3501 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1105 1.9243 -0.0790 C 0 0 2 0 0 0 0 0 0 0 0 0 9.6232 3.1797 0.6770 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1055 4.2862 -0.0395 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5634 1.7460 0.1263 C 0 0 2 0 0 0 0 0 0 0 0 0 12.4166 1.6367 -1.0881 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6825 1.9202 -2.3922 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4725 1.4738 -3.4172 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5609 2.4368 -1.0274 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8427 0.6929 1.0432 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8865 -2.1270 -3.4732 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0225 -2.7757 -2.4521 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0021 -2.0612 -1.1023 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1067 -2.4537 -0.3131 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0252 -3.2862 0.7615 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8922 -3.7419 1.0767 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2303 -3.6220 1.5052 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4223 -3.1521 1.1951 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5910 -2.2203 0.0222 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1378 -4.5467 2.6628 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7204 -2.8978 -2.9150 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9970 -2.8936 -3.8175 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1140 1.6398 0.8392 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3182 3.1216 0.8981 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6717 3.5441 1.4028 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0654 2.8589 2.6675 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1333 1.3993 2.3669 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5150 0.6692 3.5042 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3460 3.2920 3.0185 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6684 5.0378 1.6538 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7533 3.2897 0.3615 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5004 1.9474 2.9253 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3691 -2.4424 -0.2885 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5667 -3.5502 -1.2846 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9692 -3.3390 -2.6195 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8550 -4.1149 -2.8884 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9441 -3.8537 -1.3754 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1807 -3.1176 0.9542 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2605 -3.0830 1.7924 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9290 -2.4072 3.0046 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0325 -2.1874 3.7782 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4458 -0.7297 3.6929 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2008 -3.0859 3.5547 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8380 -4.4509 3.0819 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6056 -4.4967 2.2457 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6627 -5.4103 1.2179 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9077 -4.9776 2.3509 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8556 -3.2114 4.8017 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1189 1.9017 -2.5077 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5966 2.2512 -2.5771 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1806 1.9349 -3.9198 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.8955 0.7319 -3.9138 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8072 3.5961 -2.2853 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8944 1.4239 -1.2374 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6675 3.8421 -7.3503 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4387 3.9824 -4.5528 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9721 3.9351 -5.5743 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6560 1.5033 -5.9194 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6988 0.1190 -3.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4059 -1.4781 -4.0735 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5933 -1.2072 -2.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0235 -1.8665 -3.8249 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3185 -2.2469 -0.1547 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2672 -0.9880 0.7292 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5684 -1.2646 1.9031 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5330 -0.2696 3.6583 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9389 1.3763 3.7428 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9201 -1.0184 2.1243 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1945 -0.3643 3.6497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6947 1.9427 -1.1894 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8069 2.4157 -1.0706 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5199 0.7700 -1.5823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3778 2.0536 1.0408 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7420 -1.2674 0.4530 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1035 -1.6510 2.1607 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9185 -1.8109 0.7730 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8840 -0.4433 3.5085 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6423 1.1846 3.0207 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5509 -1.4939 1.9020 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2261 -0.5744 3.2940 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1290 1.4944 1.9535 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1720 -1.4132 -0.4333 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5868 -0.7733 -1.1133 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1106 -0.2656 -1.7853 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9973 1.7605 -1.6741 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7386 2.7740 -0.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9317 2.8529 0.2621 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1280 2.2382 -1.3771 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4809 1.1314 0.3238 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8437 2.2442 2.3041 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2875 0.8595 3.4439 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4486 1.4823 2.1670 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4227 -1.0522 1.8101 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0356 -1.2191 2.8625 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8409 -1.8571 1.2401 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5699 -0.0618 -0.6053 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9024 -1.0502 -1.9842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5497 0.1409 -4.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0341 -0.6614 -4.2622 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4994 0.1913 -1.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5985 1.0727 0.4622 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5367 3.2293 0.7469 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1123 3.2289 1.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4734 4.9937 0.5160 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9560 2.6519 0.6868 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8191 0.5801 -1.1049 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4873 3.0068 -2.4567 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3407 1.9375 -3.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3148 1.9712 -0.5948 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7896 0.4802 0.9648 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2710 -1.8705 -4.3805 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4251 -3.7913 -2.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1045 -2.5363 -0.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2891 -3.4436 1.7979 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3359 -2.7675 -0.9204 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0665 -1.2697 0.1526 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6791 -1.9873 -0.0620 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1206 -5.0313 2.8787 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4071 -5.3594 2.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9022 -3.9410 3.5573 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5543 -2.3138 -3.6907 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2658 -2.6093 -4.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5749 1.3579 -0.1600 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2363 3.6011 -0.1059 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5623 3.6636 1.5035 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3975 3.0954 3.5184 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9423 1.2372 1.6190 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8874 1.2904 4.2025 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3174 3.8436 3.8533 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0549 5.2159 2.5664 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2829 5.5719 0.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6899 5.4167 1.8861 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7585 3.2746 0.8218 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7569 4.1184 -0.3941 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5493 2.3115 -0.1438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3622 2.5632 3.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1962 1.3905 3.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2939 2.6332 2.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3482 -1.9426 -0.2065 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0933 -4.4886 -0.8692 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7379 -3.6005 -3.3948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6941 -4.2599 -3.8462 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0907 -4.5677 -2.0588 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1384 -2.6079 1.3688 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6844 -2.3120 4.8519 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5663 -0.7037 3.8024 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9533 -0.0904 4.4312 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2346 -0.3702 2.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9574 -2.5731 2.9103 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7157 -5.0930 4.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7387 -4.7705 2.9329 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4895 -5.9200 1.2664 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7515 -4.5195 2.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9835 -2.2942 5.1722 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5430 2.8258 -2.6694 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1889 1.6742 -1.8209 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9666 2.7193 -4.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3406 0.6492 -3.0553 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3247 3.7266 -1.4520 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5003 0.6497 -1.0928 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 13 12 1 6 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 30 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 37 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 0 55 57 1 0 57 58 2 0 58 59 1 0 57 60 1 0 52 61 1 0 51 62 1 0 17 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 65 70 1 0 65 71 1 0 16 72 1 1 10 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 73 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 81 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 84 87 1 0 83 88 1 0 5 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 90 93 1 0 89 94 1 0 91 3 1 0 75 8 1 0 85 79 1 0 63 13 1 0 67 13 1 0 21 16 1 0 31 25 1 0 53 35 1 0 26 20 1 0 47 40 1 0 1 95 1 0 2 96 1 0 2 97 1 0 3 98 1 6 5 99 1 6 7100 1 0 7101 1 0 8102 1 6 10103 1 1 12104 1 0 12105 1 0 14106 1 0 14107 1 0 15108 1 0 15109 1 0 18110 1 0 19111 1 0 19112 1 0 20113 1 1 22114 1 0 22115 1 0 22116 1 0 23117 1 0 23118 1 0 24119 1 0 24120 1 0 25121 1 1 27122 1 0 27123 1 0 27124 1 0 28125 1 0 28126 1 0 29127 1 0 29128 1 0 30129 1 1 32130 1 0 32131 1 0 32132 1 0 33133 1 0 33134 1 0 33135 1 0 35136 1 1 37137 1 1 38138 1 0 38139 1 0 40140 1 1 42141 1 1 43142 1 0 43143 1 0 44144 1 0 45145 1 1 46146 1 6 47147 1 6 48148 1 0 49149 1 0 50150 1 0 51151 1 6 52152 1 1 53153 1 1 58154 1 0 59155 1 0 59156 1 0 59157 1 0 60158 1 0 60159 1 0 60160 1 0 61161 1 0 62162 1 0 63163 1 6 64164 1 0 64165 1 0 66166 1 1 67167 1 6 68168 1 0 69169 1 0 70170 1 0 70171 1 0 70172 1 0 71173 1 0 71174 1 0 71175 1 0 72176 1 0 72177 1 0 72178 1 0 73179 1 1 74180 1 1 75181 1 6 76182 1 0 77183 1 0 79184 1 6 81185 1 1 82186 1 0 82187 1 0 82188 1 0 83189 1 6 84190 1 1 85191 1 1 86192 1 0 87193 1 0 88194 1 0 89195 1 6 90196 1 1 91197 1 6 92198 1 0 93199 1 0 94200 1 0 M END

Standard InCHIKey	JWVDWATXDMOTGW-SONRVINNSA-N
Standard InCHI	InChI=1S/C65H106O29/c1-11-26(2)54(83)93-51-46(77)41(72)33(24-85-56-48(79)44(75)39(70)31(22-67)89-56)91-59(51)92-36-15-16-62(8)34(61(36,6)7)14-17-64(10)35(62)13-12-28-29-20-60(4,5)52(81)53(82)65(29,19-18-63(28,64)9)25-86-58-50(94-57-49(80)42(73)37(68)27(3)87-57)45(76)40(71)32(90-58)23-84-55-47(78)43(74)38(69)30(21-66)88-55/h11-12,27,29-53,55-59,66-82H,13-25H2,1-10H3/b26-11-/t27-,29-,30+,31+,32+,33+,34-,35+,36-,37-,38+,39+,40+,41+,42+,43-,44-,45-,46-,47+,48+,49+,50+,51+,52-,53-,55+,56+,57-,58+,59-,62-,63+,64+,65-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC[C@@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H](C5(C)C)O[C@@H]5O[C@H](CO[C@@H]6O[C@H](CO)[C@H]([C@@H]([C@H]6O)O)O)[C@H]([C@@H]([C@H]5OC(=O)/C(=CC)/C)O)O)[C@@H]3CC([C@H]([C@@H]4O)O)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1350.68	Volume:	1294.238 ? Van der Waals volume.
Dense:	1.044	LogP:	-0.308 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.882 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.748 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	58.0
TPSA:	462.51 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	17.0	Rings:	10.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.029	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.704	Fsp³:	0.923
MCE-18:	223.04 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.691	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.333	Promiscuous compounds:	0.164

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.477	MDCK Permeability:	-5.211
Pgp-inhibitor:	0.0	Pgp-substrate:	0.631
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.995
20% Bioavailability (F20%):	0.996	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.018	MRP1:	0.001
Plasma Protein Binding (PPB):	57.152%	Volume Distribution (VD):	-0.245
Fu:	18.289% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	0.884
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.007

Half-life (T1/2):

4.914

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.38	Drug-induced Liver Injury (DILI):	0.696
AMES Toxicity:	0.984	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.353	Drug-induced Nephrotoxicity:	0.987
Genotoxicity:	0.039	RPMI-8226 Immunitoxicity:	0.524
A549 Cytotoxicity:	0.975	Hek293 Cytotoxicity:	0.72
BCF:	1.384 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.716 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.371 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.401 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	100000.0	nM	PMID[17517504]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	100000.0	nM	PMID[20558060]
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	100000.0	nM	PMID[1965200]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470915 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22063
0.1-0.2	22985
0.2-0.3	3429
0.3-0.4	747
0.4-0.5	450
0.5-0.6	149
0.6-0.7	8
0.7-0.8	0
0.8-0.85	3
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8846	High Similarity	NPC470911
0.8586	High Similarity	NPC173859
0.8218	Intermediate Similarity	NPC148603
0.8182	Intermediate Similarity	NPC470512
0.8	Intermediate Similarity	NPC470517
0.7453	Intermediate Similarity	NPC470515
0.6909	Remote Similarity	NPC470514
0.6909	Remote Similarity	NPC470513
0.6579	Remote Similarity	NPC481079
0.6491	Remote Similarity	NPC470914
0.6239	Remote Similarity	NPC470516
0.6218	Remote Similarity	NPC185466
0.6186	Remote Similarity	NPC207738
0.6034	Remote Similarity	NPC123796
0.5965	Remote Similarity	NPC112352
0.5948	Remote Similarity	NPC63159
0.5887	Remote Similarity	NPC135904
0.5772	Remote Similarity	NPC473824
0.5763	Remote Similarity	NPC257468
0.5726	Remote Similarity	NPC151543
0.5726	Remote Similarity	NPC79643
0.5714	Remote Similarity	NPC471435
0.5714	Remote Similarity	NPC471434
0.5714	Remote Similarity	NPC48499
0.5703	Remote Similarity	NPC484061
0.5703	Remote Similarity	NPC484062
0.569	Remote Similarity	NPC488573
0.569	Remote Similarity	NPC488572
0.5674	Remote Similarity	NPC329893
0.5664	Remote Similarity	NPC220838
0.5645	Remote Similarity	NPC60557
0.5645	Remote Similarity	NPC67857
0.5635	Remote Similarity	NPC603137
0.563	Remote Similarity	NPC470913
0.562	Remote Similarity	NPC291903
0.5614	Remote Similarity	NPC25605
0.5603	Remote Similarity	NPC469946
0.5593	Remote Similarity	NPC164389
0.5593	Remote Similarity	NPC480475
0.5591	Remote Similarity	NPC475140
0.5573	Remote Similarity	NPC484059
0.5573	Remote Similarity	NPC484060
0.5573	Remote Similarity	NPC43550
0.5546	Remote Similarity	NPC148417
0.5537	Remote Similarity	NPC78034
0.553	Remote Similarity	NPC305981
0.552	Remote Similarity	NPC268184
0.552	Remote Similarity	NPC610204
0.5512	Remote Similarity	NPC123199
0.5508	Remote Similarity	NPC160415
0.55	Remote Similarity	NPC222580
0.5496	Remote Similarity	NPC258617
0.5492	Remote Similarity	NPC477076
0.5489	Remote Similarity	NPC261506
0.5489	Remote Similarity	NPC4328
0.5486	Remote Similarity	NPC329878
0.5484	Remote Similarity	NPC606553
0.547	Remote Similarity	NPC161674
0.5462	Remote Similarity	NPC57484
0.5462	Remote Similarity	NPC46665
0.544	Remote Similarity	NPC475119
0.5433	Remote Similarity	NPC165204
0.5426	Remote Similarity	NPC47995
0.5426	Remote Similarity	NPC277212
0.5426	Remote Similarity	NPC30279
0.5426	Remote Similarity	NPC46823
0.5411	Remote Similarity	NPC300655
0.5403	Remote Similarity	NPC36831
0.5403	Remote Similarity	NPC609281
0.5397	Remote Similarity	NPC607904
0.5391	Remote Similarity	NPC219180
0.5379	Remote Similarity	NPC41061
0.5379	Remote Similarity	NPC470876
0.5379	Remote Similarity	NPC227551
0.5372	Remote Similarity	NPC297263
0.5368	Remote Similarity	NPC250247
0.5366	Remote Similarity	NPC477079
0.5351	Remote Similarity	NPC164194
0.5328	Remote Similarity	NPC119794
0.5317	Remote Similarity	NPC288205
0.5317	Remote Similarity	NPC51465
0.5312	Remote Similarity	NPC471384
0.5303	Remote Similarity	NPC265841
0.5302	Remote Similarity	NPC478559
0.5302	Remote Similarity	NPC478560
0.5299	Remote Similarity	NPC136768
0.5299	Remote Similarity	NPC127056
0.5294	Remote Similarity	NPC220160
0.5294	Remote Similarity	NPC478066
0.5289	Remote Similarity	NPC105800
0.5289	Remote Similarity	NPC139044
0.5289	Remote Similarity	NPC162574
0.528	Remote Similarity	NPC31838
0.528	Remote Similarity	NPC481078
0.5274	Remote Similarity	NPC45606
0.5271	Remote Similarity	NPC609305
0.5267	Remote Similarity	NPC222951
0.5263	Remote Similarity	NPC271610
0.5242	Remote Similarity	NPC323359
0.5242	Remote Similarity	NPC606145
0.5234	Remote Similarity	NPC123522
0.5231	Remote Similarity	NPC475160
0.5231	Remote Similarity	NPC470218
0.5231	Remote Similarity	NPC473714
0.5214	Remote Similarity	NPC56713
0.521	Remote Similarity	NPC76497
0.5207	Remote Similarity	NPC251768
0.5203	Remote Similarity	NPC196874
0.52	Remote Similarity	NPC488564
0.52	Remote Similarity	NPC295823
0.52	Remote Similarity	NPC174720
0.52	Remote Similarity	NPC475467
0.52	Remote Similarity	NPC477077
0.5192	Remote Similarity	NPC319719
0.5188	Remote Similarity	NPC110633
0.5185	Remote Similarity	NPC236638
0.5185	Remote Similarity	NPC294453
0.5182	Remote Similarity	NPC224381
0.5169	Remote Similarity	NPC14630
0.5156	Remote Similarity	NPC475287
0.5156	Remote Similarity	NPC76972
0.5156	Remote Similarity	NPC252657
0.5156	Remote Similarity	NPC88311
0.5156	Remote Similarity	NPC469782
0.5156	Remote Similarity	NPC204414
0.5156	Remote Similarity	NPC610461
0.5154	Remote Similarity	NPC166422
0.5147	Remote Similarity	NPC309223
0.5128	Remote Similarity	NPC12288
0.5126	Remote Similarity	NPC488561
0.5124	Remote Similarity	NPC114304
0.5124	Remote Similarity	NPC309714
0.512	Remote Similarity	NPC324875
0.512	Remote Similarity	NPC292677
0.5115	Remote Similarity	NPC100639
0.5111	Remote Similarity	NPC65105
0.5083	Remote Similarity	NPC263756
0.5083	Remote Similarity	NPC213674
0.5082	Remote Similarity	NPC171741
0.5081	Remote Similarity	NPC158367
0.5081	Remote Similarity	NPC253611
0.5081	Remote Similarity	NPC486563
0.5081	Remote Similarity	NPC488782
0.5081	Remote Similarity	NPC484832
0.5079	Remote Similarity	NPC187618
0.5079	Remote Similarity	NPC120116
0.5079	Remote Similarity	NPC470477
0.5078	Remote Similarity	NPC172365
0.5075	Remote Similarity	NPC286457
0.5074	Remote Similarity	NPC481081
0.5042	Remote Similarity	NPC473373
0.5041	Remote Similarity	NPC192791
0.5041	Remote Similarity	NPC68175
0.504	Remote Similarity	NPC114692
0.5039	Remote Similarity	NPC313110
0.5039	Remote Similarity	NPC104137
0.5039	Remote Similarity	NPC26626
0.5038	Remote Similarity	NPC71391
0.5038	Remote Similarity	NPC192765
0.5036	Remote Similarity	NPC298034
0.5036	Remote Similarity	NPC71065
0.5034	Remote Similarity	NPC43589
0.5031	Remote Similarity	NPC488202

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470915 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7476
0.1-0.2	1615
0.2-0.3	53
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data