NPASS Compound

Natural Product: NPC295823

Natural Product ID	NPC295823
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	28-O-Alpha-L-Rhamnopyranosyl-(1->4)-O-Beta-D-Glucopyranosyl-(1->6)-O-Beta-D-Glucopyranosyloleanate 3-O-Beta-D-Xylopyranoside
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2391933
PubChem CID	71697453
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 160168 0 0 0 0 0 0 0 0999 V2000 -10.5477 3.6165 -0.6223 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5467 3.2756 0.2796 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1733 1.8426 0.1079 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1445 1.5467 1.0084 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4227 0.4150 0.5789 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7629 -0.1718 1.6451 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3935 -0.0263 1.6431 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7611 -0.7334 0.5114 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3769 -0.5170 0.4037 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0068 -0.8765 -0.8822 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6546 -1.3202 -0.9010 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6462 -0.6335 -1.5054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0320 0.4679 -2.0539 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7916 -1.0352 -1.5812 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4796 0.0410 -2.3617 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5246 0.8153 -1.6229 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5116 -0.0805 -1.0279 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8125 -1.0515 -0.0947 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5334 -1.7118 0.7932 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0115 -1.5863 0.9702 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5473 -0.4149 0.2165 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5134 0.6141 -0.0846 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7829 1.1027 1.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0517 1.8592 -0.7375 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2745 2.3555 0.0055 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2992 1.2467 -0.0779 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8618 0.1074 0.7548 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8680 0.2514 2.2221 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8876 -1.0032 0.4407 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1944 -0.5614 0.9910 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7251 0.7043 0.3526 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7090 1.7182 0.0289 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7822 2.8925 0.9878 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0544 2.3310 -1.3311 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6777 1.1973 1.2071 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9813 1.0701 0.8084 C 0 0 2 0 0 0 0 0 0 0 0 0 12.7140 0.1928 1.6164 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0383 0.5801 1.6590 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5781 0.9746 0.3150 C 0 0 2 0 0 0 0 0 0 0 0 0 13.9098 2.2460 -0.1196 C 0 0 1 0 0 0 0 0 0 0 0 0 12.6406 2.4141 0.7096 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8232 3.2802 -0.0020 O 0 0 0 0 0 0 0 0 0 0 0 0 14.7409 3.3578 -0.0234 O 0 0 0 0 0 0 0 0 0 0 0 0 14.3358 -0.0003 -0.6219 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3507 -1.2175 -0.1806 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7849 -2.4109 0.4974 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8752 -3.6813 -0.3055 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5678 -3.4444 -1.6035 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9150 -2.3511 -2.3657 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6702 -4.7531 0.4675 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4739 -4.3186 -0.5659 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2655 -0.7887 -2.1188 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8864 -1.8402 -1.5875 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6383 -2.8084 -0.6985 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8439 -2.2609 0.6809 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9476 -2.6803 1.3516 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0405 -4.0715 -0.6655 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7246 -1.2560 -2.5546 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2304 -0.5279 -0.2070 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7190 -0.5153 0.0507 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.2604 0.8548 0.4230 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4808 1.0974 -0.1511 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4440 1.1516 0.8537 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.2903 0.0501 0.6609 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3572 0.3420 -0.1754 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.0604 -0.9831 -0.4582 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.3495 1.2640 0.4529 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.6099 2.2804 1.2838 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1738 2.4447 0.8112 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5727 3.3329 1.7041 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.6692 1.9471 2.6202 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.0742 1.8943 -0.5698 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1098 -1.4951 0.9635 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9777 -0.3725 -1.5977 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1745 3.7570 -1.5287 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6441 3.8771 0.0118 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8572 3.4851 1.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8121 1.6921 -0.9506 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6344 0.8741 -0.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1334 1.0527 1.5798 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0036 -0.3784 2.6315 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2100 -0.4823 -0.4336 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0439 0.0940 -1.4667 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7983 -0.3547 -3.3521 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7318 0.8473 -2.6860 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0056 1.5239 -0.9589 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0135 1.4737 -2.4020 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0116 -2.3965 1.4409 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4452 -2.5302 0.5515 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2983 -1.6078 2.0387 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8614 -0.8551 -0.7877 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1712 2.1085 1.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6990 1.3399 0.9294 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7405 0.3902 1.9783 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2895 2.6642 -0.6567 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3002 1.7457 -1.7878 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6850 3.2028 -0.6172 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0458 2.6976 1.0124 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1922 0.8526 -1.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0019 -0.7795 2.6785 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7318 0.8151 2.6293 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9844 0.6636 2.7041 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9939 -1.1303 -0.6578 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6118 -1.9585 0.8838 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2011 -0.4770 2.0971 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9067 -1.4233 0.8009 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2835 0.3198 -0.5541 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9199 2.9631 1.6738 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7790 3.8592 0.4290 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6743 2.8389 1.6429 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9142 1.7621 -1.7315 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3865 3.3788 -1.2582 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2319 2.1955 -2.0667 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9971 0.6008 -0.1992 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1752 1.3622 2.4200 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6222 -0.3085 2.0027 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6623 1.1885 0.4359 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5723 2.2064 -1.1821 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8741 2.8396 1.7100 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5278 4.0478 0.5701 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3129 3.3357 0.7866 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9664 -0.8259 -0.2038 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9303 -0.3264 0.3856 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1311 -2.4740 1.5290 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3301 -2.2341 0.6207 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6561 -3.2545 -1.4966 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4347 -4.3773 -2.2090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0649 -2.6363 -2.7970 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5621 -2.1772 -3.2804 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3497 -5.7714 0.1706 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7529 -4.5872 0.3504 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3950 -4.6229 1.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1478 -4.2252 0.3124 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3052 -5.4061 -0.7068 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9198 -3.9104 -1.4877 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5393 -1.8374 -1.8869 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1341 -0.1775 -2.4983 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6683 -0.8974 -3.0746 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2128 -2.5026 -2.2150 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6432 -2.9549 -1.1580 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9199 -2.5384 1.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3068 -3.5056 0.9652 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8536 -4.3615 0.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5802 -1.7622 -2.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9218 -1.5794 -0.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2108 -0.7785 -0.9220 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3468 0.8090 1.5517 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9943 1.0136 1.8731 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9939 0.7258 -1.1448 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3979 -1.6782 -1.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0508 -0.8354 -0.9300 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2529 -1.4586 0.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0563 0.6441 1.0482 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0999 3.2767 1.1446 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1558 2.9344 -0.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8019 3.1451 2.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7879 2.7540 3.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.9930 1.5641 -0.6107 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8517 -2.3672 0.5376 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1422 0.1479 -1.6703 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 1 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 31 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 18 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 47 51 1 0 17 52 1 6 10 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 5 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 60 73 1 0 59 74 1 0 61 3 1 0 69 63 1 0 55 8 1 0 49 14 1 0 45 14 1 0 22 17 1 0 32 26 1 0 41 36 1 0 27 21 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 6 5 79 1 6 7 80 1 0 7 81 1 0 8 82 1 6 10 83 1 6 15 84 1 0 15 85 1 0 16 86 1 0 16 87 1 0 19 88 1 0 20 89 1 0 20 90 1 0 21 91 1 6 23 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 25 97 1 0 25 98 1 0 26 99 1 6 28100 1 0 28101 1 0 28102 1 0 29103 1 0 29104 1 0 30105 1 0 30106 1 0 31107 1 6 33108 1 0 33109 1 0 33110 1 0 34111 1 0 34112 1 0 34113 1 0 36114 1 6 38115 1 0 38116 1 0 39117 1 1 40118 1 6 41119 1 1 42120 1 0 43121 1 0 44122 1 0 45123 1 1 46124 1 0 46125 1 0 48126 1 0 48127 1 0 49128 1 0 49129 1 0 50130 1 0 50131 1 0 50132 1 0 51133 1 0 51134 1 0 51135 1 0 52136 1 0 52137 1 0 52138 1 0 53139 1 6 54140 1 6 55141 1 1 56142 1 0 57143 1 0 58144 1 0 59145 1 1 60146 1 6 61147 1 1 63148 1 1 65149 1 6 66150 1 0 66151 1 0 66152 1 0 67153 1 1 68154 1 1 69155 1 6 70156 1 0 71157 1 0 72158 1 0 73159 1 0 74160 1 0 M END

Standard InCHIKey	XPZZGRWYXQODIS-DONWFASLSA-N
Standard InCHI	InChI=1S/C53H86O21/c1-23-32(56)35(59)39(63)45(69-23)73-42-27(20-54)70-43(41(65)37(42)61)68-22-28-34(58)36(60)40(64)46(71-28)74-47(66)53-17-15-48(2,3)19-25(53)24-9-10-30-50(6)13-12-31(72-44-38(62)33(57)26(55)21-67-44)49(4,5)29(50)11-14-52(30,8)51(24,7)16-18-53/h9,23,25-46,54-65H,10-22H2,1-8H3/t23-,25-,26+,27+,28+,29-,30+,31-,32-,33-,34+,35+,36-,37+,38+,39+,40+,41+,42+,43+,44-,45-,46-,50-,51+,52+,53-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H](C5(C)C)O[C@@H]5OC[C@H]([C@@H]([C@H]5O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1058.57	Volume:	1027.557 ? Van der Waals volume.
Dense:	1.03	LogP:	1.745 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.513 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.411 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	51.0
TPSA:	333.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.075	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.693	Fsp³:	0.943
MCE-18:	194.369 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.883	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.203	Promiscuous compounds:	0.067

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.422	MDCK Permeability:	-5.11
Pgp-inhibitor:	0.0	Pgp-substrate:	0.37
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.988
20% Bioavailability (F20%):	0.935	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.023	MRP1:	0.002
Plasma Protein Binding (PPB):	68.845%	Volume Distribution (VD):	-0.308
Fu:	16.264% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.005	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.991
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.419
HLM stability:	0.044 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.411

Half-life (T1/2):

3.816

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.701	Drug-induced Liver Injury (DILI):	0.933
AMES Toxicity:	0.917	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.025	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.447	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.166	RPMI-8226 Immunitoxicity:	0.29
A549 Cytotoxicity:	0.741	Hek293 Cytotoxicity:	0.2
BCF:	1.84 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.951 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.418 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.643 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25457	Anemone anhuiensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25457	Anemone anhuiensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25457	Anemone anhuiensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1083	Cell line	A-375	Homo sapiens	IC50	=	13500.0	nM	PMID[23639650]
NPT81	Cell line	A549	Homo sapiens	IC50	=	11900.0	nM	PMID[23639650]
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	5700.0	nM	PMID[23639650]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC295823 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22229
0.1-0.2	23273
0.2-0.3	2965
0.3-0.4	812
0.4-0.5	337
0.5-0.6	79
0.6-0.7	71
0.7-0.8	0
0.8-0.85	11
0.85-0.9	4
0.9-0.95	2
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC174720
1.0	High Similarity	NPC475467
0.9184	High Similarity	NPC241909
0.9126	High Similarity	NPC488560
0.8824	High Similarity	NPC60557
0.8824	High Similarity	NPC67857
0.8679	High Similarity	NPC481080
0.8571	High Similarity	NPC135904
0.8491	Intermediate Similarity	NPC475160
0.8491	Intermediate Similarity	NPC473714
0.8455	Intermediate Similarity	NPC236638
0.8455	Intermediate Similarity	NPC294453
0.8158	Intermediate Similarity	NPC250247
0.8113	Intermediate Similarity	NPC76972
0.8113	Intermediate Similarity	NPC469782
0.8113	Intermediate Similarity	NPC204414
0.81	Intermediate Similarity	NPC104071
0.8091	Intermediate Similarity	NPC476068
0.802	Intermediate Similarity	NPC102439
0.7965	Intermediate Similarity	NPC305981
0.7938	Intermediate Similarity	NPC48499
0.7895	Intermediate Similarity	NPC261506
0.7895	Intermediate Similarity	NPC4328
0.787	Intermediate Similarity	NPC192600
0.781	Intermediate Similarity	NPC481079
0.7807	Intermediate Similarity	NPC202828
0.7807	Intermediate Similarity	NPC119592
0.7788	Intermediate Similarity	NPC41061
0.7788	Intermediate Similarity	NPC227551
0.7788	Intermediate Similarity	NPC258617
0.7767	Intermediate Similarity	NPC148417
0.7719	Intermediate Similarity	NPC43550
0.7636	Intermediate Similarity	NPC165204
0.7624	Intermediate Similarity	NPC295371
0.7568	Intermediate Similarity	NPC155410
0.75	Intermediate Similarity	NPC100639
0.7429	Intermediate Similarity	NPC63159
0.735	Intermediate Similarity	NPC481081
0.7288	Intermediate Similarity	NPC298034
0.7288	Intermediate Similarity	NPC71065
0.7257	Intermediate Similarity	NPC123199
0.7241	Intermediate Similarity	NPC110633
0.7167	Intermediate Similarity	NPC224381
0.7155	Intermediate Similarity	NPC57484
0.7143	Intermediate Similarity	NPC112352
0.7119	Intermediate Similarity	NPC65105
0.708	Intermediate Similarity	NPC79643
0.7059	Intermediate Similarity	NPC136768
0.7048	Intermediate Similarity	NPC469946
0.6923	Remote Similarity	NPC235405
0.6891	Remote Similarity	NPC475514
0.6885	Remote Similarity	NPC220160
0.6875	Remote Similarity	NPC473826
0.6863	Remote Similarity	NPC90856
0.6857	Remote Similarity	NPC249848
0.6857	Remote Similarity	NPC107966
0.6852	Remote Similarity	NPC46665
0.6803	Remote Similarity	NPC70809
0.6789	Remote Similarity	NPC235438
0.6727	Remote Similarity	NPC297263
0.6726	Remote Similarity	NPC481078
0.6726	Remote Similarity	NPC187290
0.6697	Remote Similarity	NPC101744
0.6696	Remote Similarity	NPC475287
0.6667	Remote Similarity	NPC480422
0.6635	Remote Similarity	NPC29069
0.6606	Remote Similarity	NPC30735
0.6604	Remote Similarity	NPC475516
0.6579	Remote Similarity	NPC31838
0.6569	Remote Similarity	NPC128925
0.6549	Remote Similarity	NPC301449
0.6549	Remote Similarity	NPC601290
0.6538	Remote Similarity	NPC214484
0.6481	Remote Similarity	NPC39211
0.6475	Remote Similarity	NPC469776
0.6471	Remote Similarity	NPC470218
0.6389	Remote Similarity	NPC473373
0.6372	Remote Similarity	NPC134835
0.6356	Remote Similarity	NPC123522
0.6338	Remote Similarity	NPC32723
0.632	Remote Similarity	NPC309223
0.6316	Remote Similarity	NPC114484
0.6294	Remote Similarity	NPC481323
0.6294	Remote Similarity	NPC469778
0.629	Remote Similarity	NPC293330
0.626	Remote Similarity	NPC286457
0.625	Remote Similarity	NPC475209
0.6226	Remote Similarity	NPC204458
0.6216	Remote Similarity	NPC223301
0.6216	Remote Similarity	NPC171544
0.6207	Remote Similarity	NPC135334
0.6195	Remote Similarity	NPC475591
0.6195	Remote Similarity	NPC236870
0.6174	Remote Similarity	NPC281148
0.6174	Remote Similarity	NPC73318
0.6174	Remote Similarity	NPC104372
0.6168	Remote Similarity	NPC1046
0.6168	Remote Similarity	NPC78046
0.6164	Remote Similarity	NPC481324
0.614	Remote Similarity	NPC222580
0.6126	Remote Similarity	NPC76497
0.6124	Remote Similarity	NPC102505
0.6124	Remote Similarity	NPC480417
0.6124	Remote Similarity	NPC488514
0.6116	Remote Similarity	NPC480419
0.6106	Remote Similarity	NPC40775
0.6106	Remote Similarity	NPC10607
0.6106	Remote Similarity	NPC251768
0.6106	Remote Similarity	NPC488526
0.6103	Remote Similarity	NPC472268
0.608	Remote Similarity	NPC470876
0.6068	Remote Similarity	NPC80986
0.6036	Remote Similarity	NPC157868
0.6029	Remote Similarity	NPC297950
0.6017	Remote Similarity	NPC104137
0.6017	Remote Similarity	NPC26626
0.6014	Remote Similarity	NPC469775
0.6	Remote Similarity	NPC480418
0.6	Remote Similarity	NPC13998
0.6	Remote Similarity	NPC295941
0.5982	Remote Similarity	NPC263756
0.5982	Remote Similarity	NPC213674
0.5965	Remote Similarity	NPC159309
0.5965	Remote Similarity	NPC164389
0.5965	Remote Similarity	NPC473459
0.5965	Remote Similarity	NPC86222
0.5948	Remote Similarity	NPC601659
0.5946	Remote Similarity	NPC173583
0.5943	Remote Similarity	NPC256798
0.5929	Remote Similarity	NPC192791
0.5917	Remote Similarity	NPC114287
0.5906	Remote Similarity	NPC161717
0.589	Remote Similarity	NPC469774
0.5877	Remote Similarity	NPC160415
0.5841	Remote Similarity	NPC161674
0.5826	Remote Similarity	NPC173859
0.5826	Remote Similarity	NPC148603
0.5826	Remote Similarity	NPC480475
0.5812	Remote Similarity	NPC469821
0.5804	Remote Similarity	NPC480420
0.5786	Remote Similarity	NPC45606
0.5776	Remote Similarity	NPC105800
0.5772	Remote Similarity	NPC475899
0.5772	Remote Similarity	NPC100925
0.5769	Remote Similarity	NPC237503
0.5748	Remote Similarity	NPC473452
0.5728	Remote Similarity	NPC167383
0.5702	Remote Similarity	NPC473343
0.5695	Remote Similarity	NPC469777
0.5692	Remote Similarity	NPC302543
0.5685	Remote Similarity	NPC472269
0.5641	Remote Similarity	NPC68175
0.5636	Remote Similarity	NPC189884
0.5636	Remote Similarity	NPC138334
0.562	Remote Similarity	NPC475368
0.5591	Remote Similarity	NPC85154
0.5584	Remote Similarity	NPC469772
0.5575	Remote Similarity	NPC139894
0.5556	Remote Similarity	NPC232237
0.5556	Remote Similarity	NPC191827
0.5513	Remote Similarity	NPC469773
0.5478	Remote Similarity	NPC473884
0.5478	Remote Similarity	NPC470512
0.5478	Remote Similarity	NPC488516
0.547	Remote Similarity	NPC109588
0.547	Remote Similarity	NPC117714
0.547	Remote Similarity	NPC309714
0.547	Remote Similarity	NPC30289
0.5462	Remote Similarity	NPC475504
0.5455	Remote Similarity	NPC209894
0.5447	Remote Similarity	NPC11242
0.5441	Remote Similarity	NPC8524
0.5433	Remote Similarity	NPC283417
0.5433	Remote Similarity	NPC471550
0.5433	Remote Similarity	NPC200049
0.5426	Remote Similarity	NPC21691
0.5424	Remote Similarity	NPC104400
0.5424	Remote Similarity	NPC10320
0.5417	Remote Similarity	NPC220838
0.541	Remote Similarity	NPC96641
0.541	Remote Similarity	NPC480473
0.541	Remote Similarity	NPC163183
0.541	Remote Similarity	NPC480474
0.5405	Remote Similarity	NPC161434
0.5401	Remote Similarity	NPC33012
0.5391	Remote Similarity	NPC58448
0.5391	Remote Similarity	NPC47995
0.5391	Remote Similarity	NPC150400
0.5385	Remote Similarity	NPC242840
0.5366	Remote Similarity	NPC207738
0.536	Remote Similarity	NPC300419
0.5357	Remote Similarity	NPC489208
0.5349	Remote Similarity	NPC4749
0.5333	Remote Similarity	NPC609763
0.5289	Remote Similarity	NPC484832
0.5276	Remote Similarity	NPC470911
0.525	Remote Similarity	NPC470515
0.5246	Remote Similarity	NPC37134
0.5242	Remote Similarity	NPC36831

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC295823 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7496
0.1-0.2	1597
0.2-0.3	49
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data