NPASS Compound

Natural Product: NPC609763

Natural Product ID	NPC609763
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IEJFXRHTMBOACN-PSOHZYGXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL5267370
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 144151 0 0 0 0 0 0 0 0999 V2000 1.9640 4.4139 2.2889 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8718 3.3398 2.2165 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4350 4.1584 2.2527 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9177 2.5455 3.4496 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2861 1.1028 3.3335 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7730 0.4437 2.0750 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7317 0.5912 1.9978 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4132 1.1449 2.8872 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4441 0.0999 0.8989 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8266 0.2159 0.8024 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4829 -0.9975 0.7364 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 -0.9292 0.8786 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6297 -1.7741 -0.0773 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3993 -3.1196 -0.0249 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1492 -3.5631 -0.3759 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1604 -4.4567 -1.4377 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9308 -5.5810 -1.1974 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3806 -5.4147 -1.5954 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0048 -6.6436 -1.2816 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8037 -6.0616 0.2376 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8880 -7.4525 0.3301 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5152 -5.6229 0.8581 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4639 -6.1111 2.1594 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4507 -4.1286 0.8408 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0790 -3.7926 0.7813 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4024 0.4602 0.9225 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4955 0.9205 2.2587 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7421 1.4626 0.0449 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4667 1.8733 -1.0449 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7404 3.2175 -1.0737 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0888 3.5441 -0.9680 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1600 4.9298 -0.7892 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4367 5.3795 -0.1382 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3745 6.7799 -0.0205 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0179 5.6186 -2.1163 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2290 6.7627 -1.9457 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2439 4.6899 -3.0483 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1736 3.7510 -3.5319 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1648 3.9648 -2.2376 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2445 4.9294 -1.8359 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3263 1.0281 -0.3635 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5112 2.1291 -0.5477 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1085 -1.0159 2.0166 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0603 -1.4031 0.9282 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2660 -0.5564 0.9535 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0482 -0.8578 2.1858 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8342 0.8833 0.8394 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8163 1.7572 0.5974 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2534 1.4025 0.4372 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4321 -0.0111 0.0777 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6005 -0.3275 -0.8367 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5243 0.2293 -2.1953 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8205 0.2765 -0.1421 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0996 -0.0435 -0.8159 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1805 -1.3768 -1.4637 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3962 -1.2631 -2.8598 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1168 -2.3544 -1.1135 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9127 -3.2305 -2.3637 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6106 -3.3099 -0.0950 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7717 -3.2132 0.3336 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7771 -4.2973 0.3677 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7875 -1.8195 -0.7240 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6126 -2.5107 -1.3475 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3900 -2.2081 -0.5086 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1781 -0.7362 -0.2697 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5269 -0.2009 -1.5234 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4161 1.2050 0.9444 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0274 2.6413 0.9239 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9394 3.9908 2.5644 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6375 5.2280 2.9693 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0536 4.8163 1.2556 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8341 4.2105 3.2875 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1701 3.6672 1.5586 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3005 5.1746 1.8893 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6512 2.9918 4.1960 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0406 2.5860 4.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3718 1.0439 3.3786 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8650 0.5364 4.2001 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1836 0.7455 1.7347 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0577 -1.3662 1.9028 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7238 -1.6033 0.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3662 -1.4254 -1.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5379 -2.7045 -0.7017 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5231 -6.3953 -1.8341 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3870 -5.3790 -2.7170 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8770 -4.5684 -1.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8689 -6.5261 -0.8537 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6603 -5.6229 0.7979 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8100 -7.7447 0.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6743 -6.0141 0.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4039 -7.0970 2.1262 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8183 -3.6908 1.7831 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5743 -4.2241 1.4897 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4709 0.3778 0.5967 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5051 1.9248 2.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5449 2.3819 0.6756 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2709 3.6517 -0.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3264 5.2068 -0.0893 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3441 5.1036 -0.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5025 4.9992 0.9137 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5058 7.0544 0.3735 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9704 5.9035 -2.5695 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6843 6.6344 -1.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7521 5.2301 -3.8619 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0406 4.2132 -3.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6433 3.2781 -2.9366 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6473 5.0912 -2.6148 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4485 0.4048 -1.2745 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3619 2.3692 -1.4894 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3576 -1.3525 3.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1517 -1.5764 1.7716 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5116 -1.4376 -0.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3771 -2.4614 1.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6014 0.0157 2.6027 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3424 -1.1207 3.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6667 -1.7783 2.1056 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4846 2.7980 0.5180 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7489 1.7121 1.4018 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6563 2.1309 -0.3018 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7823 -0.5026 1.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5018 0.6982 -2.5259 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3279 -0.5233 -3.0148 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7910 1.0443 -2.3562 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7102 1.4000 -0.1437 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7921 -0.0031 0.9431 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9199 0.1408 -0.0584 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3150 0.7372 -1.6045 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1669 -1.8253 -1.1207 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6015 -1.3904 -3.3913 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1933 -2.8181 -3.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9160 -3.4483 -2.8283 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5323 -4.2301 -2.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0676 -5.0554 0.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6777 -2.0225 0.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3850 -2.2076 -2.3776 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7122 -3.6210 -1.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4276 -2.8287 0.3820 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5133 -2.5832 -1.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5273 0.8760 -1.6359 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4609 -0.5230 -1.5969 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0085 -0.7279 -2.4020 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9442 0.7121 0.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 2.6447 0.4524 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6103 3.1657 0.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 12 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 28 41 1 0 41 42 1 0 6 43 1 0 43 44 1 0 44 45 1 0 45 46 1 1 45 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 6 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 55 57 1 0 57 58 1 6 57 59 1 0 59 60 2 0 59 61 1 0 57 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 6 47 67 1 0 67 68 1 0 68 2 1 0 67 6 1 0 41 10 1 0 65 45 1 0 24 15 1 0 39 30 1 0 65 50 1 0 62 51 1 0 1 69 1 0 1 70 1 0 1 71 1 0 3 72 1 0 3 73 1 0 3 74 1 0 4 75 1 0 4 76 1 0 5 77 1 0 5 78 1 0 10 79 1 1 12 80 1 1 13 81 1 0 13 82 1 0 15 83 1 6 17 84 1 6 18 85 1 0 18 86 1 0 19 87 1 0 20 88 1 1 21 89 1 0 22 90 1 6 23 91 1 0 24 92 1 1 25 93 1 0 26 94 1 6 27 95 1 0 28 96 1 1 30 97 1 1 32 98 1 1 33 99 1 0 33100 1 0 34101 1 0 35102 1 6 36103 1 0 37104 1 6 38105 1 0 39106 1 6 40107 1 0 41108 1 6 42109 1 0 43110 1 0 43111 1 0 44112 1 0 44113 1 0 46114 1 0 46115 1 0 46116 1 0 48117 1 0 49118 1 0 49119 1 0 50120 1 1 52121 1 0 52122 1 0 52123 1 0 53124 1 0 53125 1 0 54126 1 0 54127 1 0 55128 1 1 56129 1 0 58130 1 0 58131 1 0 58132 1 0 61133 1 0 62134 1 1 63135 1 0 63136 1 0 64137 1 0 64138 1 0 66139 1 0 66140 1 0 66141 1 0 67142 1 6 68143 1 0 68144 1 0 M END

Standard InCHIKey	IEJFXRHTMBOACN-PSOHZYGXSA-N
Standard InCHI	InChI=1S/C48H76O20/c1-43(2)13-15-48(16-14-45(4)21(22(48)17-43)7-8-26-44(3)11-10-28(51)47(6,41(60)61)27(44)9-12-46(26,45)5)42(62)68-40-36(59)37(67-39-35(58)33(56)30(53)24(19-50)65-39)31(54)25(66-40)20-63-38-34(57)32(55)29(52)23(18-49)64-38/h7,22-40,49-59H,8-20H2,1-6H3,(H,60,61)/t22-,23+,24+,25+,26+,27+,28-,29+,30+,31+,32-,33-,34+,35+,36+,37-,38+,39-,40-,44+,45+,46+,47-,48-/m0/s1
SMILES	CC1(C)CC[C@]2(C(=O)O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@H]3O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)[C@@](C)(C(=O)O)[C@@H]5CC[C@]43C)[C@@H]2C1

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO48981	Dianthus superbus var.longicalycinus (MAXIM.) WILL	Genus	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC609763 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21216
0.1-0.2	23865
0.2-0.3	3555
0.3-0.4	832
0.4-0.5	259
0.5-0.6	106
0.6-0.7	18
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.898	High Similarity	NPC75287
0.7928	Intermediate Similarity	NPC135849
0.7455	Intermediate Similarity	NPC191827
0.7451	Intermediate Similarity	NPC473459
0.6939	Remote Similarity	NPC209894
0.6833	Remote Similarity	NPC51564
0.6635	Remote Similarity	NPC150400
0.6569	Remote Similarity	NPC29069
0.6505	Remote Similarity	NPC48499
0.6293	Remote Similarity	NPC79643
0.6182	Remote Similarity	NPC159309
0.6182	Remote Similarity	NPC86222
0.6147	Remote Similarity	NPC223301
0.6147	Remote Similarity	NPC171544
0.6122	Remote Similarity	NPC167383
0.6111	Remote Similarity	NPC295371
0.6106	Remote Similarity	NPC104372
0.6075	Remote Similarity	NPC475516
0.605	Remote Similarity	NPC123199
0.6033	Remote Similarity	NPC481080
0.6	Remote Similarity	NPC470218
0.6	Remote Similarity	NPC237503
0.5983	Remote Similarity	NPC476992
0.5982	Remote Similarity	NPC63159
0.5968	Remote Similarity	NPC65105
0.5968	Remote Similarity	NPC43550
0.5965	Remote Similarity	NPC114484
0.5893	Remote Similarity	NPC251768
0.5887	Remote Similarity	NPC41061
0.5887	Remote Similarity	NPC227551
0.5868	Remote Similarity	NPC475160
0.5868	Remote Similarity	NPC473714
0.5854	Remote Similarity	NPC476068
0.5812	Remote Similarity	NPC481078
0.5804	Remote Similarity	NPC104071
0.5798	Remote Similarity	NPC300419
0.5794	Remote Similarity	NPC305981
0.5794	Remote Similarity	NPC481081
0.5766	Remote Similarity	NPC473343
0.5752	Remote Similarity	NPC102439
0.5748	Remote Similarity	NPC261506
0.5748	Remote Similarity	NPC298034
0.5748	Remote Similarity	NPC71065
0.5748	Remote Similarity	NPC4328
0.5736	Remote Similarity	NPC250247
0.5727	Remote Similarity	NPC473373
0.5726	Remote Similarity	NPC69811
0.5714	Remote Similarity	NPC192791
0.569	Remote Similarity	NPC281148
0.5688	Remote Similarity	NPC11035
0.5676	Remote Similarity	NPC473884
0.5676	Remote Similarity	NPC157868
0.5652	Remote Similarity	NPC475504
0.5641	Remote Similarity	NPC301449
0.5641	Remote Similarity	NPC601290
0.5635	Remote Similarity	NPC258617
0.5614	Remote Similarity	NPC40775
0.5591	Remote Similarity	NPC293330
0.5575	Remote Similarity	NPC242840
0.5565	Remote Similarity	NPC475591
0.5565	Remote Similarity	NPC236870
0.5556	Remote Similarity	NPC214484
0.5546	Remote Similarity	NPC187290
0.5536	Remote Similarity	NPC39211
0.5526	Remote Similarity	NPC109588
0.5526	Remote Similarity	NPC309714
0.5508	Remote Similarity	NPC481079
0.5504	Remote Similarity	NPC476991
0.5487	Remote Similarity	NPC469946
0.5481	Remote Similarity	NPC306746
0.5462	Remote Similarity	NPC96641
0.5462	Remote Similarity	NPC163183
0.544	Remote Similarity	NPC488560
0.5439	Remote Similarity	NPC112352
0.5433	Remote Similarity	NPC473645
0.5426	Remote Similarity	NPC202828
0.5426	Remote Similarity	NPC119592
0.5426	Remote Similarity	NPC236638
0.5426	Remote Similarity	NPC294453
0.5403	Remote Similarity	NPC135904
0.5397	Remote Similarity	NPC487505
0.5391	Remote Similarity	NPC30735
0.5385	Remote Similarity	NPC222580
0.5366	Remote Similarity	NPC192600
0.536	Remote Similarity	NPC100639
0.5357	Remote Similarity	NPC235405
0.5333	Remote Similarity	NPC295823
0.5333	Remote Similarity	NPC174720
0.5333	Remote Similarity	NPC241909
0.5333	Remote Similarity	NPC475467
0.5333	Remote Similarity	NPC199457
0.531	Remote Similarity	NPC249848
0.531	Remote Similarity	NPC107966
0.5303	Remote Similarity	NPC478823
0.5303	Remote Similarity	NPC478824
0.5299	Remote Similarity	NPC235438
0.5285	Remote Similarity	NPC475287
0.5283	Remote Similarity	NPC68419
0.5271	Remote Similarity	NPC484942
0.5268	Remote Similarity	NPC136877
0.5254	Remote Similarity	NPC297263
0.5225	Remote Similarity	NPC270667
0.5221	Remote Similarity	NPC139894
0.5214	Remote Similarity	NPC10607
0.5214	Remote Similarity	NPC46665
0.5207	Remote Similarity	NPC80986
0.52	Remote Similarity	NPC323341
0.5164	Remote Similarity	NPC31838
0.5161	Remote Similarity	NPC60557
0.5161	Remote Similarity	NPC76972
0.5161	Remote Similarity	NPC469782
0.5161	Remote Similarity	NPC67857
0.5161	Remote Similarity	NPC204414
0.5159	Remote Similarity	NPC166422
0.5159	Remote Similarity	NPC219180
0.5159	Remote Similarity	NPC155410
0.514	Remote Similarity	NPC604133
0.5135	Remote Similarity	NPC90856
0.5126	Remote Similarity	NPC146563
0.5113	Remote Similarity	NPC70809
0.5111	Remote Similarity	NPC478825
0.5108	Remote Similarity	NPC475368
0.5085	Remote Similarity	NPC473383
0.5085	Remote Similarity	NPC180550
0.5085	Remote Similarity	NPC35405
0.5082	Remote Similarity	NPC481030
0.5042	Remote Similarity	NPC470515
0.5036	Remote Similarity	NPC478822

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC609763 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6641
0.1-0.2	2447
0.2-0.3	56
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data