NPASS Compound

Natural Product: NPC478824

Natural Product ID	NPC478824
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YWHKEVIZIAGDJH-IEJCCLIMSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44445351
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 199209 0 0 0 0 0 0 0 0999 V2000 -0.9794 -1.5613 5.6763 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3529 -0.7221 4.4976 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2123 0.4743 4.9083 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0317 1.5773 3.8471 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8314 0.9363 2.5093 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6112 0.0301 2.4999 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2406 -0.1898 3.8475 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3952 0.7359 1.8325 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1751 0.2954 0.7637 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0047 -0.8440 0.3437 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1485 1.3149 0.2557 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2303 2.4400 -0.2999 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2832 1.7033 -1.2250 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9638 0.9649 -2.3160 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1419 1.8975 -3.4999 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0372 -0.0968 -2.8097 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2095 0.2300 -1.9682 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9875 0.9030 -0.8774 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1987 0.1595 -0.4712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5749 -0.9167 -1.1637 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7609 -1.7534 -0.8754 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6661 -0.9787 0.0509 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9492 -1.7227 0.3946 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7519 -3.1200 0.8562 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6906 -1.8030 -0.9518 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1480 -2.0061 -0.8384 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7757 -1.0512 0.1612 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1581 -1.1418 1.5090 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4672 -2.3972 2.2626 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6881 -0.8547 1.3573 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9221 -0.7155 2.6181 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6587 0.0713 2.3608 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8890 -0.4327 1.1720 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9271 -1.5377 1.7069 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9763 0.6669 0.7144 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0229 1.0274 1.8744 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9219 1.9177 1.3896 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6015 1.9695 0.3434 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4643 1.9145 -0.7287 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6787 -0.0187 2.3340 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2847 -0.1838 3.4191 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4618 1.2726 1.8359 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1352 -1.1833 0.0710 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7403 -0.0660 -0.4476 C 0 0 1 0 0 0 0 0 0 0 0 0 13.9251 0.3570 0.3465 C 0 0 1 0 0 0 0 0 0 0 0 0 14.2608 1.7880 -0.1117 C 0 0 2 0 0 0 0 0 0 0 0 0 14.3170 1.8482 -1.6012 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4247 0.9100 -2.3315 C 0 0 1 0 0 0 0 0 0 0 0 0 13.8851 0.8418 -3.7747 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9935 0.1879 -4.6045 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2448 -0.3315 -1.7557 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9036 3.1578 -1.9578 O 0 0 0 0 0 0 0 0 0 0 0 0 15.5212 2.1488 0.3698 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7836 0.3158 1.7036 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5411 -3.3181 -0.6757 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9995 0.3139 2.1228 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3471 0.6614 0.8467 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4551 1.7488 0.8132 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0929 1.6752 -0.5769 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8740 0.3688 -0.5853 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1797 -0.6076 0.2899 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4497 -2.0481 -0.1138 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7772 -0.4248 0.1289 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2166 0.6227 -0.2905 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0624 0.2204 -1.2812 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2655 -0.5278 -0.7602 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9450 -1.1110 -1.9746 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4232 0.0291 -2.8366 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2410 0.9601 -3.1012 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5854 1.3750 -1.9723 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9282 -0.4351 -4.0584 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2037 0.0697 -4.2213 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3100 0.9289 -5.4718 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.7711 0.8027 -5.8333 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.9479 0.5456 -7.3202 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2732 -0.6149 -7.7023 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.2380 -0.3560 -5.0023 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0856 -0.9664 -4.5009 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.4715 1.9698 -5.5237 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9117 2.2265 -5.2279 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9660 -1.9920 -1.6588 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9982 -1.4125 0.2543 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6020 -1.0862 1.4458 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5782 -0.7795 2.5248 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9478 -1.4630 3.8231 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3940 -1.3875 4.1740 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2559 -1.5425 2.9716 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.3863 -2.5299 3.2593 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1742 -2.1056 4.3322 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5266 -2.0258 1.9068 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6927 -2.4110 5.1015 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5051 -2.7893 3.8231 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3832 0.5719 2.7265 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0619 1.6177 -1.5028 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8842 2.9909 0.9114 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0115 2.4234 4.2279 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7802 0.9985 6.1111 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6118 -0.9063 6.4916 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8334 -2.1994 5.9712 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1445 -2.2431 5.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9157 -1.3193 3.7568 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2667 0.1910 4.9202 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9809 2.1390 3.8622 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6158 1.7119 1.7222 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7569 -0.9451 2.0251 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8151 3.1481 -0.8832 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6920 2.8538 0.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3366 0.9708 -0.6374 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4336 2.4119 -1.6514 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4644 2.9035 -3.2305 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7306 1.4712 -4.3080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1026 2.0233 -3.9272 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8665 0.3669 -3.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4982 -0.5218 -1.8990 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4928 -0.9031 -3.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9723 -0.8196 -1.7548 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8546 0.2452 -2.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3836 1.8557 -1.3567 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9425 -1.1968 -2.0151 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3113 -1.8871 -1.8525 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4393 -2.7272 -0.5447 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0401 -0.1289 -0.5888 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4921 -3.2525 1.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0635 -3.6474 0.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7247 -3.6499 0.7363 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2197 -2.6360 -1.5176 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5266 -0.8326 -1.5041 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5833 -1.6927 -1.8392 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5237 -0.0209 -0.2338 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2749 -2.2235 3.0398 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8972 -3.1934 1.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6262 -2.7932 2.8651 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6617 0.1785 0.8857 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5470 -0.0812 3.3141 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6820 -1.6298 3.1517 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0092 -0.0414 3.2516 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9499 1.1386 2.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9299 -1.4423 1.2708 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2918 -2.5431 1.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8334 -1.4433 2.8096 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6806 0.1726 2.4375 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6563 1.6546 2.5608 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1904 2.9475 1.1864 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1825 1.9717 2.2561 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7764 2.6827 -0.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0439 2.5330 1.1939 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9630 2.0115 -1.5920 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8800 2.0644 2.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0536 0.7753 -0.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8381 -0.2411 0.0408 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4472 2.4319 0.2514 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3705 1.7977 -1.9542 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3995 1.3706 -2.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9087 0.3972 -3.8522 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9883 1.8955 -4.1336 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4071 0.8566 -5.0229 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6268 3.8037 -1.9122 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8620 2.8637 -0.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6808 1.2462 2.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4912 -3.4736 -0.8109 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5041 1.1722 0.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1470 1.5141 1.6197 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6872 2.5651 -0.7209 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8602 -0.0350 -1.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4851 -0.4678 1.3536 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6296 -2.1480 -1.1789 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6007 -2.7193 0.1501 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2989 -2.4245 0.5264 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6160 -0.3456 -2.1168 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9689 0.2930 -0.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1410 -1.6204 -2.5702 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1713 0.6389 -2.3036 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5558 0.3926 -3.7408 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5735 1.8482 -3.6936 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5445 0.7059 -3.3813 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7131 0.4535 -6.2924 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0419 0.4149 -7.4942 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6076 1.4407 -7.8584 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8236 -1.3966 -7.4807 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9043 0.0084 -4.1820 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8027 -1.0493 -5.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.3833 1.7178 -5.2095 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7003 2.7411 -4.9188 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5789 -2.7165 -1.1106 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1845 -0.1466 1.2859 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6212 -1.2182 2.1840 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3511 -0.9284 4.6240 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6112 -0.4015 4.6653 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7555 -0.5764 2.7391 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9666 -3.5129 3.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0376 -2.6845 2.3853 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5247 -1.1983 4.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8370 -2.0685 6.0117 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9727 -3.3227 4.5064 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7329 0.8515 3.6216 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6142 2.4702 -1.6370 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5621 3.1417 1.8249 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2997 1.9809 4.7577 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2083 0.5649 6.8938 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 2 0 11 9 1 1 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 1 33 35 1 0 35 36 1 0 36 37 1 0 35 38 1 6 38 39 1 0 28 40 1 0 40 41 2 0 40 42 1 0 27 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 47 52 1 0 46 53 1 0 45 54 1 0 26 55 1 0 5 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 60 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 77 78 1 0 74 79 1 1 73 80 1 0 67 81 1 0 66 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 87 90 1 0 86 91 1 0 85 92 1 0 84 93 1 0 59 94 1 0 58 95 1 0 4 96 1 0 3 97 1 0 7 2 1 0 37 11 1 0 51 44 1 0 63 57 1 0 70 65 1 0 78 72 1 0 90 83 1 0 18 11 1 0 35 19 1 0 33 22 1 0 30 23 1 0 1 98 1 0 1 99 1 0 1100 1 0 2101 1 6 3102 1 1 4103 1 6 5104 1 6 6105 1 6 12106 1 0 12107 1 0 13108 1 0 13109 1 0 15110 1 0 15111 1 0 15112 1 0 16113 1 0 16114 1 0 16115 1 0 17116 1 0 17117 1 0 18118 1 0 20119 1 0 21120 1 0 21121 1 0 22122 1 0 24123 1 0 24124 1 0 24125 1 0 25126 1 0 25127 1 0 26128 1 6 27129 1 6 29130 1 0 29131 1 0 29132 1 0 30133 1 6 31134 1 0 31135 1 0 32136 1 0 32137 1 0 34138 1 0 34139 1 0 34140 1 0 36141 1 0 36142 1 0 37143 1 0 37144 1 0 38145 1 0 38146 1 0 39147 1 0 42148 1 0 44149 1 6 45150 1 1 46151 1 1 47152 1 6 48153 1 6 49154 1 0 49155 1 0 50156 1 0 52157 1 0 53158 1 0 54159 1 0 55160 1 0 57161 1 6 58162 1 1 59163 1 6 60164 1 6 61165 1 1 62166 1 0 62167 1 0 62168 1 0 65169 1 6 66170 1 1 67171 1 6 68172 1 1 69173 1 0 69174 1 0 72175 1 1 73176 1 6 75177 1 0 75178 1 0 76179 1 0 77180 1 0 77181 1 0 79182 1 0 80183 1 0 81184 1 0 83185 1 6 84186 1 6 85187 1 1 86188 1 1 87189 1 6 88190 1 0 88191 1 0 89192 1 0 91193 1 0 92194 1 0 93195 1 0 94196 1 0 95197 1 0 96198 1 0 97199 1 0 M END

Standard InCHIKey	YWHKEVIZIAGDJH-IEJCCLIMSA-N
Standard InCHI	InChI=1S/C64H102O33/c1-24-34(70)40(76)47(95-50-44(80)41(77)45(25(2)89-50)93-53-46(94-51-42(78)38(74)35(71)29(18-65)90-51)37(73)31(20-86-53)92-55-48(81)64(85,22-68)23-87-55)54(88-24)97-57(84)62-13-12-58(3,4)16-27(62)26-8-9-32-59(5)17-28(69)49(96-52-43(79)39(75)36(72)30(19-66)91-52)61(7,56(82)83)33(59)10-11-60(32,6)63(26,21-67)15-14-62/h8,24-25,27-55,65-81,85H,9-23H2,1-7H3,(H,82,83)/t24-,25+,27?,28-,29-,30+,31+,32?,33+,34+,35+,36+,37-,38+,39-,40+,41+,42-,43+,44-,45+,46+,47-,48-,49-,50+,51+,52-,53-,54+,55-,59+,60+,61-,62-,63-,64+/m0/s1
SMILES	C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OC(=O)[C@@]12CCC(C)(C)CC2C2=CCC3[C@@]4(C)C[C@@H]([C@@H]([C@](C)([C@@H]4CC[C@@]3(C)[C@@]2(CC1)CO)C(=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O[C@@H]1[C@H]([C@H]([C@@H]([C@@H](C)O1)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O[C@H]1[C@@H]([C@@](CO)(CO1)O)O)O)O[C@@H]1[C@H]([C@@H]([C@@H]([C@H](CO)O1)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1398.63	Volume:	1303.547 ? Van der Waals volume.
Dense:	1.073	LogP:	-1.072 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.195 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.193 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	63.0
TPSA:	529.27 ? Topological Polar Surface Area.	H-Bond Acceptor:	33.0
H-Bond Donor:	19.0	Rings:	11.0
Heavy Atoms:	33.0

MedChem Properties

QED Drug-Likeness Score:	0.037	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.933	Fsp³:	0.938
MCE-18:	245.548 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.647	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.043 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.368	Promiscuous compounds:	0.357

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.743	MDCK Permeability:	-4.693
Pgp-inhibitor:	0.0	Pgp-substrate:	0.829
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.654	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.071
Plasma Protein Binding (PPB):	64.331%	Volume Distribution (VD):	-0.329
Fu:	22.523% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.082
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.582

Half-life (T1/2):

5.313

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.818	Drug-induced Liver Injury (DILI):	0.917
AMES Toxicity:	0.977	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.01	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.55	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.317	RPMI-8226 Immunitoxicity:	0.376
A549 Cytotoxicity:	0.953	Hek293 Cytotoxicity:	0.291
BCF:	0.472 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.435 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.297 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.007 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7712	Nylandtia spinosa	Species	Polygalaceae	Eukaryota	Roots	n.a.	n.a.	PMID[17927264]
NPO7712	Nylandtia spinosa	Species	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7712	Nylandtia spinosa	Species	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT393	Cell line	HCT-116	Homo sapiens	IC50	>	5.0	ug.mL-1	PMID[17927264]
NPT139	Cell line	HT-29	Homo sapiens	IC50	>	5.0	ug.mL-1	PMID[17927264]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478824 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23992
0.1-0.2	22102
0.2-0.3	2819
0.3-0.4	661
0.4-0.5	253
0.5-0.6	22
0.6-0.7	3
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8374	Intermediate Similarity	NPC478825
0.7778	Intermediate Similarity	NPC478823
0.7769	Intermediate Similarity	NPC478822
0.6977	Remote Similarity	NPC484942
0.6615	Remote Similarity	NPC487505
0.6565	Remote Similarity	NPC484943
0.5852	Remote Similarity	NPC191827
0.5789	Remote Similarity	NPC300419
0.5758	Remote Similarity	NPC75287
0.5683	Remote Similarity	NPC473645
0.5563	Remote Similarity	NPC135849
0.5373	Remote Similarity	NPC488564
0.5368	Remote Similarity	NPC213952
0.5303	Remote Similarity	NPC609763
0.5285	Remote Similarity	NPC209894
0.5252	Remote Similarity	NPC475899
0.5214	Remote Similarity	NPC257211
0.5172	Remote Similarity	NPC65105
0.5102	Remote Similarity	NPC144644
0.5102	Remote Similarity	NPC37860
0.5102	Remote Similarity	NPC170407
0.5074	Remote Similarity	NPC481079
0.5069	Remote Similarity	NPC57484
0.5068	Remote Similarity	NPC43550
0.5067	Remote Similarity	NPC68767
0.5067	Remote Similarity	NPC293031
0.5034	Remote Similarity	NPC480418
0.5034	Remote Similarity	NPC51564

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478824 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7156
0.1-0.2	1953
0.2-0.3	41
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data