NPASS Compound

Structure

NPC57484 OpenBabel07101719212D 93103 0 0 1 0 0 0 0 0999 V2000 -7.7193 5.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4347 -2.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0683 -4.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0779 -4.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0683 2.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0779 2.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7154 -0.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8577 1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8577 0.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8577 -1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8577 1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4308 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5731 -0.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 0.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4308 -2.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7154 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4308 -1.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5731 -0.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7154 -2.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1501 -1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5731 4.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7154 5.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0039 0.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7193 4.4567 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5770 -2.9712 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8577 -1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7154 -1.9808 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7154 6.9327 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8616 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1501 -2.4760 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4308 3.9615 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7154 0.9904 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8577 -0.4952 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4308 0.9904 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5770 3.9615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5731 7.4279 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8616 -0.9904 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 12.0078 -2.9712 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5770 2.9712 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.0078 -3.9615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7193 -4.4567 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4308 6.9327 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7193 2.4760 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 11.1501 -4.4567 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8616 -3.9615 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1462 3.9615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5770 -3.9615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2885 4.4567 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0039 -1.4856 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1462 2.9712 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4308 5.9423 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8616 2.9712 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8616 -2.9712 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2924 -3.9615 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1462 -0.9904 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2885 2.4760 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4308 -0.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5731 -3.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5731 1.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7154 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8577 -0.4952 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5731 -1.4856 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.0078 -0.9904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7154 3.9615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8577 7.4279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7193 0.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4347 4.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5731 8.4183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7193 -1.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8655 -2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4347 2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8655 -4.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7193 -5.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2885 7.4279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7193 1.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1501 -5.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0039 -4.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0039 4.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4308 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5731 5.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1462 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8616 3.9615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7193 -2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2924 -2.9712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4308 2.9712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2885 1.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4347 -4.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2885 5.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0039 -2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0039 2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2885 -1.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 59 1 0 0 0 0 4 59 1 0 0 0 0 5 60 1 0 0 0 0 6 60 1 0 0 0 0 8 62 1 0 0 0 0 10 11 1 0 0 0 0 10 27 2 0 0 0 0 11 34 1 0 0 0 0 12 15 1 0 0 0 0 12 33 1 0 0 0 0 13 14 1 0 0 0 0 13 35 1 0 0 0 0 14 61 1 0 0 0 0 15 63 1 0 0 0 0 16 18 1 0 0 0 0 16 59 1 0 0 0 0 17 19 1 0 0 0 0 17 62 1 0 0 0 0 18 64 1 0 0 0 0 19 64 1 0 0 0 0 20 28 1 0 0 0 0 20 59 1 0 0 0 0 21 65 1 0 0 0 0 22 66 1 0 0 0 0 23 29 1 0 0 0 0 23 82 1 0 0 0 0 24 30 1 0 0 0 0 24 83 1 0 0 0 0 25 1 1 6 0 0 0 25 36 1 0 0 0 0 25 84 1 0 0 0 0 26 2 1 1 0 0 0 26 48 1 0 0 0 0 26 85 1 0 0 0 0 27 28 1 0 0 0 0 27 62 1 0 0 0 0 28 64 1 1 0 0 0 29 37 1 0 0 0 0 29 67 1 6 0 0 0 30 38 1 0 0 0 0 30 68 1 6 0 0 0 31 21 1 6 0 0 0 31 39 1 0 0 0 0 31 86 1 0 0 0 0 32 22 1 1 0 0 0 32 49 1 0 0 0 0 32 87 1 0 0 0 0 33 60 1 0 0 0 0 33 61 1 6 0 0 0 34 61 1 6 0 0 0 34 63 1 0 0 0 0 35 60 1 0 0 0 0 35 88 1 6 0 0 0 36 40 1 0 0 0 0 36 69 1 1 0 0 0 37 43 1 0 0 0 0 37 70 1 1 0 0 0 38 50 1 0 0 0 0 38 71 1 6 0 0 0 39 41 1 0 0 0 0 39 72 1 1 0 0 0 40 44 1 0 0 0 0 40 73 1 6 0 0 0 41 45 1 0 0 0 0 41 74 1 6 0 0 0 42 46 1 0 0 0 0 42 48 1 0 0 0 0 42 75 1 1 0 0 0 43 52 1 0 0 0 0 43 76 1 6 0 0 0 44 53 1 0 0 0 0 44 77 1 6 0 0 0 45 55 1 0 0 0 0 45 78 1 1 0 0 0 46 54 1 0 0 0 0 46 79 1 1 0 0 0 47 49 1 0 0 0 0 47 51 1 0 0 0 0 47 80 1 1 0 0 0 48 89 1 6 0 0 0 49 90 1 6 0 0 0 50 56 1 0 0 0 0 50 91 1 1 0 0 0 51 57 1 0 0 0 0 51 92 1 6 0 0 0 52 82 1 0 0 0 0 52 90 1 1 0 0 0 53 84 1 0 0 0 0 53 92 1 1 0 0 0 54 85 1 0 0 0 0 54 91 1 6 0 0 0 55 86 1 0 0 0 0 55 89 1 6 0 0 0 56 83 1 0 0 0 0 56 93 1 6 0 0 0 57 87 1 0 0 0 0 57 88 1 1 0 0 0 58 81 2 0 0 0 0 58 93 1 0 0 0 0 61 7 1 6 0 0 0 62 63 1 6 0 0 0 63 9 1 6 0 0 0 64 58 1 6 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	1336.67
Volume:	1271.022
LogP:	2.196
LogD:	1.926
LogS:	-3.06
# Rotatable Bonds:	15
TPSA:	451.51
# H-Bond Aceptor:	29
# H-Bond Donor:	16
# Rings:	11
# Heavy Atoms:	29

MedChem Properties

QED Drug-Likeness Score:	0.047
Synthetic Accessibility Score:	7.602
Fsp3:	0.953
Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted
GSK Rule:	Rejected
BMS Rule:	1
Golden Triangle Rule:	Rejected
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-6.196
MDCK Permeability:	0.0003376199456397444
Pgp-inhibitor:	0.217
Pgp-substrate:	0.994
Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.003
30% Bioavailability (F30%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.109
Plasma Protein Binding (PPB):	58.141143798828125%
Volume Distribution (VD):	-0.263
Pgp-substrate:	17.922597885131836%

ADMET: Metabolism

CYP1A2-inhibitor:	0.0
CYP1A2-substrate:	0.104
CYP2C19-inhibitor:	0.0
CYP2C19-substrate:	0.061
CYP2C9-inhibitor:	0.0
CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.002
CYP2D6-substrate:	0.032
CYP3A4-inhibitor:	0.028
CYP3A4-substrate:	0.001

ADMET: Excretion

Clearance (CL):	-0.593
Half-life (T1/2):	0.669

ADMET: Toxicity

hERG Blockers:	0.188
Human Hepatotoxicity (H-HT):	0.124
Drug-inuced Liver Injury (DILI):	0.01
AMES Toxicity:	0.069
Rat Oral Acute Toxicity:	0.114
Maximum Recommended Daily Dose:	0.026
Skin Sensitization:	0.048
Carcinogencity:	0.015
Eye Corrosion:	0.003
Eye Irritation:	0.006
Respiratory Toxicity:	0.309

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC57484

Natural Product ID:	NPC57484
*Common Name:**	Helianthoside 1
IUPAC Name:	[(2S,3R,4S,5S)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-4-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms:	Helianthoside 1
Standard InCHIKey:	HRLBXTNYZCUPNV-LHHWLQITSA-N
Standard InCHI:	InChI=1S/C64H104O29/c1-25-36(69)40(73)44(77)53(84-25)92-51-47(80)49(90-52-43(76)37(70)29(67)23-82-52)32(22-66)87-57(51)88-35-13-14-61(7)33(60(35,5)6)12-15-63(9)34(61)11-10-27-28-20-59(3,4)16-18-64(28,19-17-62(27,63)8)58(81)93-56-50(38(71)30(68)24-83-56)91-54-46(79)42(75)48(26(2)85-54)89-55-45(78)41(74)39(72)31(21-65)86-55/h10,25-26,28-57,65-80H,11-24H2,1-9H3/t25-,26-,28-,29+,30-,31+,32+,33-,34+,35-,36-,37-,38-,39+,40+,41-,42-,43+,44+,45+,46+,47-,48-,49+,50+,51+,52-,53-,54-,55-,56-,57-,61-,62+,63+,64-/m0/s1
SMILES:	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	CHEMBL427433
PubChem CID:	44423115
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	Flowers	n.a.	n.a.	PMID[6361218]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22537213]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	flower petals	n.a.	n.a.	PMID[17480100]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16660462]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11746-997-0093-1]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	small food enterprises (Zvijezda d.d., Zagreb, Croatia)	n.a.	DOI[10.1002/EJLT.200900231]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO454	Helianthus annuus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]

Showing 1 to 10 of 21 entries

Previous1 2 3Next

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Show entries

Search:

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference
No data available in table

Showing 0 to 0 of 0 entries

PreviousNext

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Others	2

Activity Type	# Activity
Organism	2

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	ID50	=	144.0	nmol	PMID[558196]
NPT32	Organism	Mus musculus	Mus musculus	Ratio	=	71.0	%	PMID[558196]

Showing 1 to 2 of 2 entries

Previous1Next

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC57484 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	261
0.1-0.2	1737
0.2-0.3	5108
0.3-0.4	11934
0.4-0.5	10269
0.5-0.6	6164
0.6-0.7	3984
0.7-0.8	1930
0.8-0.85	607
0.85-0.9	291
0.9-0.95	169
0.95-1	243

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC71065
1.0	High Similarity	NPC475160
1.0	High Similarity	NPC4328
1.0	High Similarity	NPC305981
1.0	High Similarity	NPC119592

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC57484 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	241
0.1-0.2	2042
0.2-0.3	3876
0.3-0.4	1952
0.4-0.5	598
0.5-0.6	266
0.6-0.7	142
0.7-0.8	21
0.8-0.85	8
0.85-0.9	3
0.9-0.95	1
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8793	High Similarity	NPD8328	Phase 3
0.8636	High Similarity	NPD8132	Clinical (unspecified phase)
0.8596	High Similarity	NPD8295	Clinical (unspecified phase)
0.8496	Intermediate Similarity	NPD8133	Approved
0.7965	Intermediate Similarity	NPD6412	Phase 2

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data