NPASS Compound

Natural Product: NPC191827

Natural Product ID	NPC191827
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Dianversicoside G
IUPAC Name	(3S,4S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-[(2S,3R,4S,5R,6R)-6-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid
Synonyms	Dianversicoside G
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL558386
PubChem CID	42640292
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 182191 0 0 0 0 0 0 0 0999 V2000 -7.3293 -8.3147 0.3832 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2332 -8.5225 1.1944 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9517 -7.9741 0.5544 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0339 -6.6314 0.3337 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8937 -5.8958 0.5268 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2132 -4.5350 0.4743 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6144 -3.8428 -0.5454 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9203 -2.6286 0.0091 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5379 -2.9386 -0.0852 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1579 -1.4625 -0.9116 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4728 -1.0853 -0.8917 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3408 -2.1212 -0.9595 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7425 -3.3959 -1.4842 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3532 -3.3350 -2.8033 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2138 -2.3476 0.2473 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1152 -1.4158 0.5706 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8002 -0.1169 0.7745 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0173 0.1575 2.1310 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3127 0.2930 2.5144 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4547 -0.5375 3.8098 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1356 -1.8705 3.4988 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3671 -0.2171 1.5956 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1731 0.2808 0.2012 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7282 0.8239 0.0199 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7363 2.0476 0.6646 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6023 3.1430 -0.1547 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3625 3.7523 0.1520 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1100 4.6597 -0.8752 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7068 5.2227 -0.6169 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7241 5.8471 0.6430 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0995 5.7973 -0.9329 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4960 5.2324 -1.0517 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6359 4.2024 0.0750 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9300 3.7645 0.1497 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4745 6.1982 -0.8880 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8387 6.5363 -2.0815 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3976 -0.7432 -0.7171 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6446 0.1740 2.0361 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2838 -0.3770 -0.6153 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3022 0.0796 -1.4433 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1461 -0.4643 -2.5344 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3825 1.2288 -1.0829 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1950 2.5144 -0.9606 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3544 3.7269 -1.3072 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1020 3.6567 -2.7530 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2764 2.2507 -3.2051 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6991 1.2772 -2.1005 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0806 1.4583 -1.6600 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9853 1.8487 -2.5712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3952 2.0387 -2.1377 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8050 1.2794 -0.9298 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8002 0.3459 -0.3884 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5076 1.1809 -0.2540 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4425 0.2724 0.3346 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1238 0.9643 0.3333 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7304 2.4377 0.4979 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4540 -0.8579 -1.1710 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2552 -0.1479 0.9874 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5834 -0.8563 0.7340 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5466 0.2241 0.3613 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2271 0.7263 -0.9931 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4995 -0.1471 -2.1414 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1008 1.9807 -1.1688 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5463 1.6757 -1.0188 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9293 0.8944 0.2094 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9756 -0.1496 0.6326 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3637 -1.4942 0.1183 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0428 -0.2305 2.1425 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2863 -1.3078 2.7434 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8371 0.8873 2.9366 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1533 0.2656 -0.1247 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2248 0.7688 0.5943 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1525 1.3522 -0.3148 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9897 2.2011 0.4181 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3543 1.5551 1.7467 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3518 0.0329 1.5598 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9406 -0.3762 1.2555 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2616 -0.7431 2.4392 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2441 -0.3458 0.5712 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6204 1.9473 2.0864 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3212 4.5225 -2.9286 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0651 4.2356 -3.5688 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1749 -6.1526 1.8123 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1103 -7.5714 2.2404 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7248 -8.4748 1.2316 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7866 -8.9392 0.3095 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6965 -7.6958 3.5050 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8503 -5.6905 1.6101 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1475 -8.3369 -0.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4087 -7.9016 2.1209 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1640 -9.5917 1.4267 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9557 -8.4503 -0.4756 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1867 -6.1619 -0.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9469 -4.5197 -1.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2249 -2.4894 1.0404 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1482 -3.1539 0.7903 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8587 -1.7984 -1.9252 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0818 -1.8197 -1.8023 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5154 -4.1905 -1.4232 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6109 -3.9668 -2.9494 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5532 -2.6742 1.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8065 -3.3080 0.0380 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7372 0.0750 0.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5356 1.3576 2.7439 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7362 -0.1871 4.5675 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4936 -0.4756 4.1108 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2216 -2.4231 4.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3743 -1.3422 1.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9036 1.0646 -0.0150 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5505 0.9040 -1.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5265 2.8838 -1.2304 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0812 4.0806 -1.8208 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4107 5.9075 -1.4109 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0470 4.3368 -0.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8008 6.8214 0.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0350 6.3646 -0.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6436 4.6819 -2.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3573 4.7435 1.0192 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3008 3.5342 -0.7257 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3453 5.7819 -1.1125 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2819 7.4344 -1.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2433 -0.6572 -1.2071 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9429 -0.5062 2.6741 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0886 2.4240 -1.6078 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5614 2.6721 0.0765 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4624 3.8418 -0.5982 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0049 4.6165 -1.2081 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7093 1.8116 -3.5666 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9197 2.2017 -4.0784 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6158 0.2632 -2.6607 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7754 2.0317 -3.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5104 3.1642 -2.0356 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0976 1.8372 -3.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9289 2.0736 -0.1208 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6769 -0.0811 1.3332 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3349 -0.5565 -0.4278 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0599 1.8593 0.9825 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5977 0.2418 0.8198 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8404 2.8060 1.0474 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5251 2.4021 1.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0079 3.2912 -0.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0308 -1.6275 -0.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6743 -0.7415 -1.9428 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2803 -1.4090 -1.6469 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5440 -0.9063 1.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4452 0.6388 1.7061 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4986 -1.6678 0.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8804 -1.3009 1.7090 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3344 1.0824 1.0715 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6445 -1.2214 -1.9218 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4565 0.1340 -2.6759 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7408 -0.0842 -2.9709 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9504 2.4382 -2.1570 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8047 2.7012 -0.3765 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0699 2.6648 -0.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9966 1.2025 -1.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1902 1.6142 1.0155 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8452 -1.4798 -0.8886 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1701 -1.9049 0.7948 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5423 -2.2441 0.1805 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3566 0.9982 3.8108 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8797 1.5573 1.2879 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3929 3.1112 0.6659 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8910 2.4235 -0.1545 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6438 1.8375 2.5290 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6131 -0.4294 2.5469 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8955 -1.2596 0.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7744 -0.4167 3.2158 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1146 -0.5430 1.0125 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1554 2.1322 1.2788 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8622 4.2057 -3.8410 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0007 5.5731 -3.1464 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9913 4.4904 -2.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0119 3.8448 -3.1510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9616 5.3366 -3.4596 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9571 3.8626 -4.5863 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5496 -5.4716 2.6338 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0293 -7.8551 2.4112 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0445 -9.4033 1.7998 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1172 -8.2278 0.1887 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4369 -7.0123 3.5566 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4449 -5.5700 2.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 23 37 1 0 22 38 1 0 10 39 1 0 39 40 1 0 40 41 2 0 42 40 1 6 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 1 52 57 1 6 52 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 6 61 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 6 66 68 1 0 68 69 2 0 68 70 1 0 65 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 75 80 1 0 45 81 1 0 45 82 1 0 5 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 84 87 1 0 83 88 1 0 85 3 1 0 13 7 1 0 24 17 1 0 33 26 1 0 55 42 1 0 66 60 1 0 77 72 1 0 47 42 1 0 53 48 1 0 61 51 1 0 1 89 1 0 2 90 1 0 2 91 1 0 3 92 1 6 5 93 1 6 7 94 1 6 8 95 1 1 9 96 1 0 10 97 1 6 12 98 1 6 13 99 1 6 14100 1 0 15101 1 0 15102 1 0 17103 1 6 19104 1 1 20105 1 0 20106 1 0 21107 1 0 22108 1 6 23109 1 6 24110 1 6 26111 1 6 28112 1 6 29113 1 0 29114 1 0 30115 1 0 31116 1 1 32117 1 6 33118 1 1 34119 1 0 35120 1 0 36121 1 0 37122 1 0 38123 1 0 43124 1 0 43125 1 0 44126 1 0 44127 1 0 46128 1 0 46129 1 0 47130 1 6 49131 1 0 50132 1 0 50133 1 0 51134 1 1 54135 1 0 54136 1 0 55137 1 0 55138 1 0 56139 1 0 56140 1 0 56141 1 0 57142 1 0 57143 1 0 57144 1 0 58145 1 0 58146 1 0 59147 1 0 59148 1 0 60149 1 1 62150 1 0 62151 1 0 62152 1 0 63153 1 0 63154 1 0 64155 1 0 64156 1 0 65157 1 1 67158 1 0 67159 1 0 67160 1 0 70161 1 0 72162 1 1 74163 1 0 74164 1 0 75165 1 1 76166 1 1 77167 1 6 78168 1 0 79169 1 0 80170 1 0 81171 1 0 81172 1 0 81173 1 0 82174 1 0 82175 1 0 82176 1 0 83177 1 1 84178 1 1 85179 1 1 86180 1 0 87181 1 0 88182 1 0 M END

Standard InCHIKey	NKURNVCWJJFIBK-VIYGISPWSA-N
Standard InCHI	InChI=1S/C59H94O29/c1-54(2)13-15-59(16-14-56(4)23(24(59)17-54)7-8-30-55(3)11-10-32(85-47-41(72)33(64)25(63)21-79-47)58(6,52(76)77)31(55)9-12-57(30,56)5)53(78)88-50-44(75)45(86-48-42(73)38(69)34(65)26(18-60)81-48)37(68)29(84-50)22-80-51-46(40(71)36(67)28(20-62)83-51)87-49-43(74)39(70)35(66)27(19-61)82-49/h7,24-51,60-75H,8-22H2,1-6H3,(H,76,77)/t24-,25-,26+,27+,28+,29+,30+,31+,32-,33-,34+,35+,36+,37+,38-,39-,40-,41+,42+,43+,44+,45-,46+,47-,48-,49-,50-,51+,55+,56+,57+,58-,59-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O[C@@H]([C@H]2O)CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)OC(=O)[C@@]23CCC(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H]([C@@]2(C)C(=O)O)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1266.59	Volume:	1190.462 ? Van der Waals volume.
Dense:	1.064	LogP:	-1.067 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.754 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.821 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	58.0
TPSA:	470.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	17.0	Rings:	10.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.341	Fsp³:	0.932
MCE-18:	220.368 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.689	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.294	Promiscuous compounds:	0.15

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.059	MDCK Permeability:	-4.867
Pgp-inhibitor:	0.0	Pgp-substrate:	0.142
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.978
20% Bioavailability (F20%):	0.076	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.007
Plasma Protein Binding (PPB):	62.201%	Volume Distribution (VD):	-0.389
Fu:	23.266% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.047

Half-life (T1/2):

4.557

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.781	Drug-induced Liver Injury (DILI):	0.986
AMES Toxicity:	0.993	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.019	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.886	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.545	RPMI-8226 Immunitoxicity:	0.234
A549 Cytotoxicity:	0.948	Hek293 Cytotoxicity:	0.212
BCF:	0.48 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.327 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.874 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.698 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	aerial parts	Changqing, Shangdong Province, China	2004-JUN	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	3
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1855	Cell line	HFL1	Homo sapiens	IC50	=	3300.0	nM	PMID[19290648]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	6800.0	nM	PMID[19290648]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC191827 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23102
0.1-0.2	22581
0.2-0.3	2917
0.3-0.4	752
0.4-0.5	318
0.5-0.6	136
0.6-0.7	39
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8165	Intermediate Similarity	NPC75287
0.7455	Intermediate Similarity	NPC609763
0.7282	Intermediate Similarity	NPC209894
0.7016	Intermediate Similarity	NPC135849
0.6777	Remote Similarity	NPC123199
0.6696	Remote Similarity	NPC469946
0.6695	Remote Similarity	NPC481078
0.6612	Remote Similarity	NPC79643
0.6538	Remote Similarity	NPC250247
0.6393	Remote Similarity	NPC300419
0.6387	Remote Similarity	NPC301449
0.6387	Remote Similarity	NPC601290
0.6379	Remote Similarity	NPC473459
0.6325	Remote Similarity	NPC63159
0.6316	Remote Similarity	NPC295371
0.6311	Remote Similarity	NPC476992
0.626	Remote Similarity	NPC70809
0.625	Remote Similarity	NPC481079
0.622	Remote Similarity	NPC481080
0.6212	Remote Similarity	NPC51564
0.6202	Remote Similarity	NPC41061
0.6202	Remote Similarity	NPC227551
0.6198	Remote Similarity	NPC69811
0.616	Remote Similarity	NPC323341
0.6154	Remote Similarity	NPC293330
0.6154	Remote Similarity	NPC65105
0.6154	Remote Similarity	NPC43550
0.6134	Remote Similarity	NPC475504
0.6134	Remote Similarity	NPC297263
0.6111	Remote Similarity	NPC166422
0.6107	Remote Similarity	NPC202828
0.6107	Remote Similarity	NPC119592
0.6107	Remote Similarity	NPC236638
0.6107	Remote Similarity	NPC294453
0.6107	Remote Similarity	NPC305981
0.6107	Remote Similarity	NPC481081
0.6087	Remote Similarity	NPC150400
0.6061	Remote Similarity	NPC261506
0.6061	Remote Similarity	NPC298034
0.6061	Remote Similarity	NPC71065
0.6061	Remote Similarity	NPC4328
0.6016	Remote Similarity	NPC187290
0.6	Remote Similarity	NPC473645
0.597	Remote Similarity	NPC478823
0.5966	Remote Similarity	NPC251768
0.5965	Remote Similarity	NPC48499
0.5938	Remote Similarity	NPC470218
0.5932	Remote Similarity	NPC112352
0.5906	Remote Similarity	NPC471384
0.5887	Remote Similarity	NPC31838
0.5882	Remote Similarity	NPC309714
0.5862	Remote Similarity	NPC475516
0.5852	Remote Similarity	NPC478824
0.5833	Remote Similarity	NPC159309
0.5833	Remote Similarity	NPC86222
0.5798	Remote Similarity	NPC192791
0.5798	Remote Similarity	NPC223301
0.5798	Remote Similarity	NPC171544
0.5789	Remote Similarity	NPC471385
0.5748	Remote Similarity	NPC475287
0.5736	Remote Similarity	NPC135904
0.5704	Remote Similarity	NPC476991
0.5702	Remote Similarity	NPC480475
0.5674	Remote Similarity	NPC478822
0.5649	Remote Similarity	NPC488560
0.5645	Remote Similarity	NPC104372
0.5645	Remote Similarity	NPC114484
0.563	Remote Similarity	NPC136768
0.5603	Remote Similarity	NPC29069
0.5597	Remote Similarity	NPC258617
0.5573	Remote Similarity	NPC475160
0.5573	Remote Similarity	NPC471550
0.5573	Remote Similarity	NPC473714
0.5564	Remote Similarity	NPC476068
0.5556	Remote Similarity	NPC295823
0.5556	Remote Similarity	NPC174720
0.5556	Remote Similarity	NPC241909
0.5556	Remote Similarity	NPC475467
0.554	Remote Similarity	NPC478825
0.5528	Remote Similarity	NPC475591
0.5528	Remote Similarity	NPC236870
0.5524	Remote Similarity	NPC475368
0.5517	Remote Similarity	NPC90856
0.5507	Remote Similarity	NPC224381
0.5504	Remote Similarity	NPC60557
0.5504	Remote Similarity	NPC76972
0.5504	Remote Similarity	NPC469782
0.5504	Remote Similarity	NPC67857
0.5504	Remote Similarity	NPC204414
0.5504	Remote Similarity	NPC610204
0.5496	Remote Similarity	NPC219180
0.5489	Remote Similarity	NPC4749
0.5484	Remote Similarity	NPC222580
0.5462	Remote Similarity	NPC139894
0.5448	Remote Similarity	NPC57484
0.5447	Remote Similarity	NPC305267
0.5433	Remote Similarity	NPC480473
0.5433	Remote Similarity	NPC480474
0.5423	Remote Similarity	NPC33012
0.5397	Remote Similarity	NPC276093
0.5391	Remote Similarity	NPC609281
0.5373	Remote Similarity	NPC487505
0.5372	Remote Similarity	NPC473884
0.5372	Remote Similarity	NPC488561
0.5372	Remote Similarity	NPC157868
0.5362	Remote Similarity	NPC302543
0.5354	Remote Similarity	NPC324875
0.5354	Remote Similarity	NPC292677
0.5352	Remote Similarity	NPC8524
0.5349	Remote Similarity	NPC11242
0.5338	Remote Similarity	NPC283417
0.5338	Remote Similarity	NPC200049
0.5338	Remote Similarity	NPC475140
0.5323	Remote Similarity	NPC40775
0.5315	Remote Similarity	NPC167383
0.5303	Remote Similarity	NPC475899
0.5299	Remote Similarity	NPC54636
0.5294	Remote Similarity	NPC110633
0.5289	Remote Similarity	NPC473373
0.5286	Remote Similarity	NPC220160
0.5285	Remote Similarity	NPC242840
0.528	Remote Similarity	NPC139044
0.5276	Remote Similarity	NPC281148
0.5267	Remote Similarity	NPC473824
0.5267	Remote Similarity	NPC610461
0.5255	Remote Similarity	NPC484942
0.5254	Remote Similarity	NPC214484
0.5252	Remote Similarity	NPC33068
0.5242	Remote Similarity	NPC114304
0.5238	Remote Similarity	NPC257468
0.5234	Remote Similarity	NPC323359
0.5234	Remote Similarity	NPC606145
0.5221	Remote Similarity	NPC21691
0.5221	Remote Similarity	NPC237503
0.5208	Remote Similarity	NPC477464
0.5203	Remote Similarity	NPC473343
0.5203	Remote Similarity	NPC213674
0.5191	Remote Similarity	NPC185466
0.5191	Remote Similarity	NPC288205
0.5191	Remote Similarity	NPC51465
0.5182	Remote Similarity	NPC480418
0.5157	Remote Similarity	NPC469778
0.5154	Remote Similarity	NPC475486
0.5152	Remote Similarity	NPC607904
0.5149	Remote Similarity	NPC257211
0.5139	Remote Similarity	NPC480422
0.5133	Remote Similarity	NPC472268
0.5122	Remote Similarity	NPC39211
0.5122	Remote Similarity	NPC469772
0.5122	Remote Similarity	NPC295941
0.512	Remote Similarity	NPC30735
0.5118	Remote Similarity	NPC481082
0.5118	Remote Similarity	NPC164419
0.5115	Remote Similarity	NPC606553
0.5113	Remote Similarity	NPC123522
0.5111	Remote Similarity	NPC100639
0.5083	Remote Similarity	NPC1046
0.5082	Remote Similarity	NPC235405
0.5082	Remote Similarity	NPC59804
0.5079	Remote Similarity	NPC10607
0.5079	Remote Similarity	NPC104400
0.5079	Remote Similarity	NPC10320
0.5079	Remote Similarity	NPC46665
0.5078	Remote Similarity	NPC64715
0.5078	Remote Similarity	NPC484832
0.5077	Remote Similarity	NPC488564
0.5075	Remote Similarity	NPC133818
0.5074	Remote Similarity	NPC25663
0.5067	Remote Similarity	NPC297950
0.5066	Remote Similarity	NPC45606
0.5041	Remote Similarity	NPC249848
0.5041	Remote Similarity	NPC127056
0.5041	Remote Similarity	NPC107966
0.5039	Remote Similarity	NPC37134
0.5038	Remote Similarity	NPC207738
0.5037	Remote Similarity	NPC251263
0.5037	Remote Similarity	NPC480419
0.5037	Remote Similarity	NPC603137
0.5036	Remote Similarity	NPC85154

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC191827 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6939
0.1-0.2	2161
0.2-0.3	46
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data