NPASS Compound

Natural Product: NPC159309

Natural Product ID	NPC159309
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Spinasaponin A 28-O-Glucoside
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1288832
PubChem CID	52949435
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 11.8283 -0.6458 1.1839 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5333 0.6640 0.8434 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7115 0.9180 -0.6503 C 0 0 1 0 0 0 0 0 0 0 0 0 10.8937 0.0947 -1.3460 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5486 0.3747 -1.3806 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9754 -0.0365 -0.1916 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0345 -1.0537 -0.3298 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7642 -0.5280 0.3368 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3754 0.6782 -0.1869 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6814 -1.5663 0.4302 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2144 -2.5567 1.3161 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2476 -3.1738 0.6131 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4436 -2.2868 0.4567 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3988 -2.9836 -0.2685 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6629 -4.3892 1.3647 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5919 -5.1184 0.9195 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0451 -4.7431 2.5567 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5729 -0.9786 1.0100 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3766 -1.2172 0.3128 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5858 -2.1157 1.2164 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1108 -2.0348 1.1098 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6070 -0.5819 1.1222 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2442 0.0546 -0.0767 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7609 0.0803 -0.0406 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3280 1.2144 0.7321 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1391 0.3255 -1.5174 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6308 1.3244 -0.5169 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6270 1.7363 0.1582 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5334 0.6718 0.6276 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8649 -0.6638 0.8205 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6830 -1.4409 1.7848 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0433 -1.5698 1.1893 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5059 -0.7328 0.2458 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7181 0.4075 -0.3058 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2996 0.2313 -1.7257 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6833 1.5976 -0.2694 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7752 1.2706 -1.2639 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5744 0.0767 -0.9054 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8948 -1.0280 -0.2164 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8491 -2.3377 -0.9594 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2151 -2.7895 -1.4179 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8466 -3.6986 -0.3872 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0315 -3.5994 -2.6844 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1002 -1.6135 -1.7517 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1616 -0.4877 -2.2105 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7784 0.5689 -0.1425 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9011 0.1428 1.0522 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7169 1.4207 -0.6461 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8187 1.8573 0.0872 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0458 1.4112 -0.4179 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9511 1.5719 0.6540 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.1671 0.7244 0.4149 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7111 -0.6114 0.3339 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2592 3.0361 0.7615 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0093 3.8018 1.0713 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8063 3.3437 0.2801 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6671 3.6802 1.0109 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2322 5.1437 0.7693 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1716 3.2567 1.8086 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1995 1.1708 1.9171 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9493 -0.0046 2.4313 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3324 1.8172 -1.7043 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0948 2.7511 -0.8249 C 0 0 2 0 0 0 0 0 0 0 0 0 11.5434 2.3933 -0.8798 C 0 0 2 0 0 0 0 0 0 0 0 0 12.0492 2.7937 -2.1190 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5819 2.8827 0.4560 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8104 2.0209 -3.0200 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6697 -0.7502 1.6864 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5223 0.9014 1.2114 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2682 1.2929 1.4260 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8001 0.6488 -0.8468 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0704 -0.2630 -2.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8776 -1.3816 -1.3645 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0844 -0.3444 1.4085 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4132 0.7137 -1.1775 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4955 -2.0943 -0.5023 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9103 -3.4734 -0.3872 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9008 -2.0015 1.4333 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0853 -3.3347 0.3290 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9896 -5.6948 2.8724 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6997 -1.8291 -0.5821 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9039 -1.9961 2.2947 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8811 -3.1694 0.9898 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7173 -2.5842 0.2309 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7060 -2.5807 2.0129 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0339 -0.6953 -0.9081 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0390 0.8694 1.5241 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6027 1.8736 1.2247 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9470 1.9167 0.0971 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0592 0.9364 -1.5952 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2946 -0.6403 -2.0475 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3540 0.8994 -2.0482 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3928 2.1411 -0.3906 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4240 1.3469 -1.6303 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2084 2.4186 -0.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3509 2.4356 1.0038 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9324 -1.2215 -0.1622 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3138 -2.4590 1.9850 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7218 -0.9344 2.7788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6507 -2.3926 1.5681 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3367 -0.2528 -1.8947 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0467 -0.3292 -2.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2350 1.2672 -2.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2316 2.5329 -0.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1800 1.7042 0.7135 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3561 1.2250 -2.2928 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4282 2.1956 -1.2867 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4907 -1.2568 0.7205 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1424 -2.3889 -1.7830 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5056 -3.1140 -0.2135 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9071 -3.8516 -0.6254 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6496 -3.3709 0.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3571 -4.7113 -0.4891 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3164 -3.0076 -3.3237 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9716 -3.6738 -3.2800 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5768 -4.5775 -2.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5660 -1.2969 -0.7742 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8790 -1.8298 -2.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6981 0.2734 -2.7808 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3481 -0.8883 -2.8214 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7541 1.3880 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4237 1.2809 1.5850 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8975 0.8066 1.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5877 0.9543 -0.5816 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2043 -1.1259 -0.3439 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6905 3.4008 -0.1914 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8403 3.7469 2.1685 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7320 3.9023 -0.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6252 3.0803 1.8195 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9324 5.1851 0.0707 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0813 3.0737 1.4635 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1472 0.6897 2.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5629 1.0967 2.7887 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3730 2.2741 1.7471 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8132 1.0615 2.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9699 -0.2533 2.7508 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2786 -0.5026 3.1938 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2803 2.1219 -1.7213 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0054 3.7692 -1.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0597 2.9878 -0.0862 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6844 2.0849 -2.3996 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9189 3.6234 0.4761 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2742 1.2295 -3.3702 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 2 0 15 17 1 0 10 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 23 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 1 6 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 41 44 1 0 44 45 1 0 38 46 1 1 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 54 59 1 0 29 60 1 1 22 61 1 1 5 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 62 67 1 0 64 3 1 0 13 7 1 0 24 19 1 0 34 29 1 0 45 38 1 0 56 49 1 0 30 22 1 0 39 33 1 0 1 68 1 0 2 69 1 0 2 70 1 0 3 71 1 6 5 72 1 6 7 73 1 6 8 74 1 1 9 75 1 0 10 76 1 6 12 77 1 6 13 78 1 1 14 79 1 0 17 80 1 0 19 81 1 6 20 82 1 0 20 83 1 0 21 84 1 0 21 85 1 0 23 86 1 6 25 87 1 0 25 88 1 0 25 89 1 0 26 90 1 0 26 91 1 0 26 92 1 0 27 93 1 0 27 94 1 0 28 95 1 0 28 96 1 0 30 97 1 6 31 98 1 0 31 99 1 0 32100 1 0 35101 1 0 35102 1 0 35103 1 0 36104 1 0 36105 1 0 37106 1 0 37107 1 0 39108 1 1 40109 1 0 40110 1 0 42111 1 0 42112 1 0 42113 1 0 43114 1 0 43115 1 0 43116 1 0 44117 1 0 44118 1 0 45119 1 0 45120 1 0 49121 1 1 51122 1 1 52123 1 0 52124 1 0 53125 1 0 54126 1 6 55127 1 1 56128 1 6 57129 1 0 58130 1 0 59131 1 0 60132 1 0 60133 1 0 60134 1 0 61135 1 0 61136 1 0 61137 1 0 62138 1 6 63139 1 6 64140 1 1 65141 1 0 66142 1 0 67143 1 0 M END

Standard InCHIKey	QZMAEZWZCGBZFK-GGFCLXHWSA-N
Standard InCHI	InChI=1S/C48H76O19/c1-43(2)14-16-48(42(61)67-40-33(56)31(54)29(52)24(20-50)63-40)17-15-46(6)21(22(48)18-43)8-9-26-45(5)12-11-27(44(3,4)25(45)10-13-47(26,46)7)64-41-35(58)36(34(57)37(66-41)38(59)60)65-39-32(55)30(53)28(51)23(19-49)62-39/h8,22-37,39-41,49-58H,9-20H2,1-7H3,(H,59,60)/t22-,23+,24+,25-,26+,27-,28+,29+,30-,31-,32+,33+,34-,35+,36-,37-,39-,40-,41+,45-,46+,47+,48-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O[C@@H]([C@H]2O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	956.5	Volume:	929.417 ? Van der Waals volume.
Dense:	1.029	LogP:	1.085 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.182 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.705 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	312.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.084	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.306	Fsp³:	0.917
MCE-18:	176.696 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.877	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.203	Promiscuous compounds:	0.152

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.34	MDCK Permeability:	-5.049
Pgp-inhibitor:	0.0	Pgp-substrate:	0.005
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.135
20% Bioavailability (F20%):	0.039	30% Bioavailability (F30%):	0.955
50% Bioavailability (F50%):	0.984

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.31
Plasma Protein Binding (PPB):	68.291%	Volume Distribution (VD):	-0.511
Fu:	22.94% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.005	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.042
HLM stability:	0.184 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.291

Half-life (T1/2):

4.331

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.757	Drug-induced Liver Injury (DILI):	0.971
AMES Toxicity:	0.921	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.06	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.586	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.71	RPMI-8226 Immunitoxicity:	0.082
A549 Cytotoxicity:	0.286	Hek293 Cytotoxicity:	0.101
BCF:	0.642 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.426 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.956 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.067 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1994	Panax stipuleanatus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20951582]
NPO1994	Panax stipuleanatus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	72990.0	nM	PubChem BioAssay data set
NPT393	Cell line	HCT-116	Homo sapiens	IC50	>	100000.0	nM	PMID[25927586]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC159309 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20551
0.1-0.2	24771
0.2-0.3	3233
0.3-0.4	713
0.4-0.5	350
0.5-0.6	117
0.6-0.7	54
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC86222
0.9565	High Similarity	NPC114484
0.8495	Intermediate Similarity	NPC157868
0.8061	Intermediate Similarity	NPC475591
0.8061	Intermediate Similarity	NPC236870
0.8	Intermediate Similarity	NPC281148
0.7959	Intermediate Similarity	NPC40775
0.7959	Intermediate Similarity	NPC251768
0.7938	Intermediate Similarity	NPC192791
0.7895	Intermediate Similarity	NPC475516
0.7732	Intermediate Similarity	NPC473884
0.7692	Intermediate Similarity	NPC11242
0.7596	Intermediate Similarity	NPC187290
0.7576	Intermediate Similarity	NPC223301
0.7576	Intermediate Similarity	NPC242840
0.7576	Intermediate Similarity	NPC171544
0.7474	Intermediate Similarity	NPC214484
0.7404	Intermediate Similarity	NPC301449
0.7404	Intermediate Similarity	NPC601290
0.7347	Intermediate Similarity	NPC235405
0.732	Intermediate Similarity	NPC48499
0.7273	Intermediate Similarity	NPC249848
0.7273	Intermediate Similarity	NPC107966
0.7157	Intermediate Similarity	NPC30735
0.7143	Intermediate Similarity	NPC104372
0.708	Intermediate Similarity	NPC21691
0.7059	Intermediate Similarity	NPC75417
0.703	Intermediate Similarity	NPC39211
0.6991	Remote Similarity	NPC4749
0.6907	Remote Similarity	NPC209894
0.6857	Remote Similarity	NPC235438
0.6814	Remote Similarity	NPC470218
0.6731	Remote Similarity	NPC112352
0.6667	Remote Similarity	NPC258617
0.6636	Remote Similarity	NPC481078
0.6635	Remote Similarity	NPC469946
0.6604	Remote Similarity	NPC10607
0.6604	Remote Similarity	NPC11551
0.6604	Remote Similarity	NPC46665
0.66	Remote Similarity	NPC90856
0.6596	Remote Similarity	NPC167383
0.6574	Remote Similarity	NPC64715
0.6549	Remote Similarity	NPC79643
0.6542	Remote Similarity	NPC63159
0.6522	Remote Similarity	NPC475160
0.6522	Remote Similarity	NPC473714
0.6481	Remote Similarity	NPC31193
0.6481	Remote Similarity	NPC222580
0.6458	Remote Similarity	NPC237503
0.6442	Remote Similarity	NPC114441
0.6442	Remote Similarity	NPC58448
0.6442	Remote Similarity	NPC150400
0.641	Remote Similarity	NPC481080
0.6356	Remote Similarity	NPC476068
0.633	Remote Similarity	NPC297263
0.6321	Remote Similarity	NPC475171
0.6293	Remote Similarity	NPC123199
0.6283	Remote Similarity	NPC480936
0.625	Remote Similarity	NPC80986
0.623	Remote Similarity	NPC302543
0.6226	Remote Similarity	NPC295371
0.6182	Remote Similarity	NPC609763
0.6161	Remote Similarity	NPC481079
0.6147	Remote Similarity	NPC44716
0.6116	Remote Similarity	NPC41061
0.6116	Remote Similarity	NPC227551
0.6106	Remote Similarity	NPC480473
0.6106	Remote Similarity	NPC480474
0.6102	Remote Similarity	NPC283417
0.6102	Remote Similarity	NPC200049
0.6075	Remote Similarity	NPC6377
0.6075	Remote Similarity	NPC208381
0.6066	Remote Similarity	NPC43550
0.6058	Remote Similarity	NPC1046
0.6053	Remote Similarity	NPC31838
0.605	Remote Similarity	NPC488560
0.6034	Remote Similarity	NPC475287
0.6016	Remote Similarity	NPC305981
0.6016	Remote Similarity	NPC481081
0.6	Remote Similarity	NPC473459
0.6	Remote Similarity	NPC475368
0.6	Remote Similarity	NPC480475
0.5981	Remote Similarity	NPC173583
0.598	Remote Similarity	NPC128925
0.5968	Remote Similarity	NPC261506
0.5968	Remote Similarity	NPC4328
0.5965	Remote Similarity	NPC295823
0.5965	Remote Similarity	NPC174720
0.5965	Remote Similarity	NPC475467
0.5962	Remote Similarity	NPC204458
0.5922	Remote Similarity	NPC480937
0.5905	Remote Similarity	NPC29069
0.59	Remote Similarity	NPC606107
0.5893	Remote Similarity	NPC475504
0.5882	Remote Similarity	NPC135904
0.5862	Remote Similarity	NPC75287
0.5856	Remote Similarity	NPC180550
0.5856	Remote Similarity	NPC35405
0.5841	Remote Similarity	NPC302887
0.5833	Remote Similarity	NPC473373
0.5833	Remote Similarity	NPC191827
0.5827	Remote Similarity	NPC250247
0.5826	Remote Similarity	NPC160452
0.581	Remote Similarity	NPC473481
0.5804	Remote Similarity	NPC258885
0.5794	Remote Similarity	NPC603870
0.5776	Remote Similarity	NPC477194
0.5755	Remote Similarity	NPC78046
0.5727	Remote Similarity	NPC22956
0.569	Remote Similarity	NPC477193
0.5669	Remote Similarity	NPC70809
0.5636	Remote Similarity	NPC472949
0.5635	Remote Similarity	NPC236638
0.5635	Remote Similarity	NPC294453
0.5631	Remote Similarity	NPC31839
0.563	Remote Similarity	NPC60557
0.563	Remote Similarity	NPC67857
0.5596	Remote Similarity	NPC108748
0.5588	Remote Similarity	NPC306746
0.5588	Remote Similarity	NPC199457
0.5565	Remote Similarity	NPC603832
0.5556	Remote Similarity	NPC293330
0.5556	Remote Similarity	NPC65105
0.5534	Remote Similarity	NPC68419
0.5528	Remote Similarity	NPC47995
0.5487	Remote Similarity	NPC160415
0.5487	Remote Similarity	NPC309714
0.5487	Remote Similarity	NPC605226
0.5469	Remote Similarity	NPC298034
0.5469	Remote Similarity	NPC71065
0.5463	Remote Similarity	NPC270667
0.5446	Remote Similarity	NPC263756
0.5446	Remote Similarity	NPC161674
0.5446	Remote Similarity	NPC213674
0.544	Remote Similarity	NPC484061
0.544	Remote Similarity	NPC484062
0.544	Remote Similarity	NPC57484
0.5439	Remote Similarity	NPC164389
0.5424	Remote Similarity	NPC241909
0.5391	Remote Similarity	NPC148417
0.5391	Remote Similarity	NPC135849
0.5391	Remote Similarity	NPC68175
0.5391	Remote Similarity	NPC118440
0.5385	Remote Similarity	NPC604133
0.5377	Remote Similarity	NPC256798
0.537	Remote Similarity	NPC189884
0.537	Remote Similarity	NPC138334
0.5354	Remote Similarity	NPC475514
0.5351	Remote Similarity	NPC124296
0.5351	Remote Similarity	NPC114304
0.534	Remote Similarity	NPC204407
0.5339	Remote Similarity	NPC324875
0.5339	Remote Similarity	NPC292677
0.5339	Remote Similarity	NPC23275
0.5333	Remote Similarity	NPC286347
0.5333	Remote Similarity	NPC224121
0.5328	Remote Similarity	NPC192600
0.5323	Remote Similarity	NPC100639
0.5323	Remote Similarity	NPC471550
0.5321	Remote Similarity	NPC164194
0.5294	Remote Similarity	NPC477192
0.5289	Remote Similarity	NPC25998
0.5278	Remote Similarity	NPC47063
0.5268	Remote Similarity	NPC127056
0.5254	Remote Similarity	NPC114692
0.5254	Remote Similarity	NPC247315
0.5254	Remote Similarity	NPC482728
0.525	Remote Similarity	NPC469947
0.525	Remote Similarity	NPC480948
0.5248	Remote Similarity	NPC191763
0.5246	Remote Similarity	NPC609119
0.5243	Remote Similarity	NPC46388
0.5238	Remote Similarity	NPC85154
0.5229	Remote Similarity	NPC30397
0.5224	Remote Similarity	NPC480422
0.5221	Remote Similarity	NPC603026
0.5217	Remote Similarity	NPC104071
0.521	Remote Similarity	NPC477191
0.5207	Remote Similarity	NPC480939
0.5194	Remote Similarity	NPC484059
0.5194	Remote Similarity	NPC484060
0.5179	Remote Similarity	NPC139894
0.5175	Remote Similarity	NPC473343
0.5175	Remote Similarity	NPC76497
0.5172	Remote Similarity	NPC102439
0.5169	Remote Similarity	NPC95437
0.5167	Remote Similarity	NPC187618
0.5167	Remote Similarity	NPC481030
0.5164	Remote Similarity	NPC477196
0.5156	Remote Similarity	NPC265841
0.5154	Remote Similarity	NPC202828
0.5154	Remote Similarity	NPC119592
0.5152	Remote Similarity	NPC224381
0.5143	Remote Similarity	NPC37739
0.5138	Remote Similarity	NPC480943
0.5135	Remote Similarity	NPC235841
0.5135	Remote Similarity	NPC297208
0.5133	Remote Similarity	NPC109079
0.5128	Remote Similarity	NPC470515

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC159309 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6535
0.1-0.2	2541
0.2-0.3	67
0.3-0.4	5
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5044	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data