NPASS Compound

Natural Product: NPC302887

Natural Product ID	NPC302887
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Camellioside D
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aS,12aS,14aR,14bR)-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	Camellioside D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2087222
PubChem CID	21633819
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 166174 0 0 0 0 0 0 0 0999 V2000 -1.0520 4.1904 0.9738 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3225 4.4567 1.4536 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2194 3.2971 1.1528 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8824 2.0985 1.7310 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7554 1.1318 1.0960 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3041 -0.1260 1.2954 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7450 -0.8474 0.2783 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4651 -1.5210 0.7120 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6661 -2.8728 0.9522 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0823 -3.6930 -0.0043 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8409 -2.9040 -1.0490 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7475 -1.9207 -0.1870 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6722 -1.5312 -1.0807 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9341 -2.0352 -0.7431 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0149 -3.2706 -1.5102 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3038 -3.6917 -1.5220 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3158 -5.1413 -1.9793 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6600 -5.5501 -1.9736 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1225 -2.8855 -2.5371 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4241 -1.5070 -2.5968 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1086 -1.2426 -1.0958 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2480 -1.4872 -0.3564 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8878 -0.4266 0.2213 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8860 -0.6269 1.6182 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5396 0.3337 2.3299 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.5108 -0.2406 3.3460 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9023 -1.0488 4.2790 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2899 1.3238 1.5104 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0435 0.7224 0.3726 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3523 -0.5031 -0.1750 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5336 -0.5873 -1.5587 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3776 0.4857 0.6751 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4967 2.4134 1.0890 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2861 -1.5630 -3.3552 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0251 -3.5150 -3.7537 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6245 -3.6549 -1.8436 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1609 -4.5668 -0.7167 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6108 -5.3208 -1.6670 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1912 -4.7016 -0.4983 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3522 -1.4052 -0.0520 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7539 -0.8448 0.6415 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7266 -1.8871 1.0777 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1423 -1.4587 1.1651 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5585 -0.7584 -0.1382 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7491 0.5059 -0.1421 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2522 0.3055 -0.1110 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7505 1.6113 0.5769 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6521 0.4306 -1.5080 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1824 1.4507 -1.2223 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6277 1.6291 -1.3979 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5756 0.5752 -0.9305 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9777 -0.3299 0.1143 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8792 -1.5227 0.3985 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2916 -1.1954 0.2243 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7833 0.0043 -0.1145 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8569 1.1300 -0.3466 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4992 1.7147 1.0404 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5315 2.1910 -1.0879 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7453 1.8494 -1.8908 C 0 0 2 0 0 0 0 0 0 0 0 0 9.8221 1.0990 -1.1283 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2898 0.1042 -0.1789 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7331 0.2219 1.2571 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0850 0.8062 1.4732 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2292 -0.0078 0.9640 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2726 0.9887 2.9787 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0401 2.1755 0.8257 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9077 1.9943 -0.6316 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5450 0.3204 -2.2651 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6304 -0.5009 -2.8600 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3132 3.0892 -2.2581 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9499 -0.3275 -2.0852 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3102 -1.6811 -1.2405 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0473 1.3027 1.8570 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5481 2.7168 1.9358 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6453 3.7165 1.2865 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7578 4.9162 2.0355 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7723 3.0992 3.2719 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0519 0.4917 1.4009 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9219 4.7772 0.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2266 4.5071 2.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6957 5.4131 1.0689 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0692 3.1156 0.0292 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7689 1.4787 0.0713 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6208 -0.1470 -0.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2745 -1.0878 1.7557 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8594 -4.3876 0.4691 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1982 -2.2096 -1.6181 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0564 -2.4929 0.6916 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9776 -2.4623 0.2798 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7358 -3.6621 -0.5165 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8984 -5.1898 -2.9958 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7255 -5.7802 -1.2827 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0405 -5.3399 -1.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1257 -2.7888 -2.1413 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1803 -0.7854 -2.8928 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8950 -0.1575 -1.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4430 0.5598 0.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7745 0.9018 2.9280 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9707 0.6192 3.8775 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3560 -0.7614 2.8187 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3803 -0.9843 5.1257 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0467 1.8054 2.1977 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9981 1.4717 -0.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7532 -1.4217 0.2861 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0501 0.2029 -1.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9383 1.0047 0.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8805 2.8817 0.3324 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2757 -2.3571 -3.9245 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8783 -3.9885 -4.0160 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3774 -3.5220 -2.7954 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8124 -5.1662 -1.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2766 -0.5044 1.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7320 -2.8298 0.5058 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4571 -2.2478 2.1185 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7743 -2.3319 1.3744 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2338 -0.6579 1.9474 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0046 1.0024 0.8193 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3054 1.5153 0.8692 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9151 2.4712 -0.0957 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3489 1.8066 1.5030 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4285 0.2095 -1.5040 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7408 1.4870 -1.8879 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1124 -0.1903 -2.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7677 1.0102 -2.1781 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6647 2.4295 -1.1443 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8912 2.6526 -0.9893 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8432 1.7808 -2.5029 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9139 0.2089 1.1107 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7607 -1.8207 1.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5615 -2.4374 -0.1386 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0058 -2.0187 0.3918 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2035 2.5591 1.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5026 2.1954 1.0022 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6373 0.9846 1.8411 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8818 2.7782 -1.7929 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8846 2.9777 -0.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5037 1.4037 -2.8829 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6555 -0.9285 -0.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0289 0.8168 1.8713 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7253 -0.7901 1.7142 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9238 0.6499 0.4004 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8179 -0.4497 1.8149 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9561 -0.8658 0.3358 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1533 0.0105 3.4555 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6557 1.8018 3.3657 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3571 1.2824 3.1062 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0177 2.6767 1.0180 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1804 2.7642 1.2017 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7697 3.0109 -1.1060 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9391 1.7057 -1.0139 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4102 -0.2247 -1.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9009 1.0449 -3.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0032 -1.3432 -3.2105 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6743 3.5802 -2.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4238 -0.0114 -3.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7297 -1.4215 -1.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0040 -0.3306 -2.3295 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2127 -1.9490 -1.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4209 -1.2918 -2.2648 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8133 -2.6480 -1.0683 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8582 0.9564 2.9234 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5633 2.8140 1.4509 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0820 3.9990 0.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2344 4.8476 2.8916 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4457 3.8299 3.2885 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1585 -0.3602 1.9233 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 28 33 1 0 20 34 1 0 19 35 1 0 11 36 1 0 10 37 1 0 37 38 2 0 37 39 1 0 8 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 45 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 2 0 55 56 1 0 56 57 1 1 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 63 66 1 0 66 67 1 0 60 68 1 6 68 69 1 0 59 70 1 0 51 71 1 6 44 72 1 6 5 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 73 78 1 0 75 3 1 0 12 7 1 0 21 14 1 0 30 23 1 0 46 41 1 0 56 51 1 0 67 60 1 0 52 44 1 0 61 55 1 0 1 79 1 0 2 80 1 0 2 81 1 0 3 82 1 6 5 83 1 6 7 84 1 6 8 85 1 1 10 86 1 1 11 87 1 6 12 88 1 1 14 89 1 1 16 90 1 1 17 91 1 0 17 92 1 0 18 93 1 0 19 94 1 1 20 95 1 6 21 96 1 6 23 97 1 1 25 98 1 1 26 99 1 0 26100 1 0 27101 1 0 28102 1 1 29103 1 6 30104 1 1 31105 1 0 32106 1 0 33107 1 0 34108 1 0 35109 1 0 36110 1 0 39111 1 0 41112 1 1 42113 1 0 42114 1 0 43115 1 0 43116 1 0 45117 1 1 47118 1 0 47119 1 0 47120 1 0 48121 1 0 48122 1 0 48123 1 0 49124 1 0 49125 1 0 50126 1 0 50127 1 0 52128 1 1 53129 1 0 53130 1 0 54131 1 0 57132 1 0 57133 1 0 57134 1 0 58135 1 0 58136 1 0 59137 1 6 61138 1 6 62139 1 0 62140 1 0 64141 1 0 64142 1 0 64143 1 0 65144 1 0 65145 1 0 65146 1 0 66147 1 0 66148 1 0 67149 1 0 67150 1 0 68151 1 0 68152 1 0 69153 1 0 70154 1 0 71155 1 0 71156 1 0 71157 1 0 72158 1 0 72159 1 0 72160 1 0 73161 1 1 74162 1 6 75163 1 6 76164 1 0 77165 1 0 78166 1 0 M END

Standard InCHIKey	LCUYLFDTSIUOCT-VTKJNYOFSA-N
Standard InCHI	InChI=1S/C54H88O24/c1-49(2)14-15-54(21-58)23(16-49)22-8-9-28-51(5)12-11-30(50(3,4)27(51)10-13-52(28,6)53(22,7)17-29(54)59)74-48-43(78-46-38(67)35(64)32(61)25(19-56)72-46)40(39(68)41(76-48)44(69)70)75-47-42(36(65)33(62)26(20-57)73-47)77-45-37(66)34(63)31(60)24(18-55)71-45/h8,23-43,45-48,55-68H,9-21H2,1-7H3,(H,69,70)/t23-,24+,25+,26+,27-,28+,29+,30-,31+,32-,33-,34-,35-,36-,37+,38+,39-,40-,41-,42+,43+,45-,46-,47-,48+,51-,52+,53+,54+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2O[C@H](CO)[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)CC2)CO)O)C)C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1120.57	Volume:	1071.224 ? Van der Waals volume.
Dense:	1.046	LogP:	-0.045 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.367 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.207 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	51.0
TPSA:	394.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	15.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.067	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.925	Fsp³:	0.944
MCE-18:	198.857 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.743	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.333	Promiscuous compounds:	0.139

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.7	MDCK Permeability:	-5.022
Pgp-inhibitor:	0.0	Pgp-substrate:	0.379
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.98
20% Bioavailability (F20%):	0.999	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.009	MRP1:	0.817
Plasma Protein Binding (PPB):	59.4%	Volume Distribution (VD):	-0.462
Fu:	26.775% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.997
OATP1B3 inhibitor:	0.033	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.07
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.328

Half-life (T1/2):

3.017

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.854	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.996	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.368	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.985	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.894	RPMI-8226 Immunitoxicity:	0.272
A549 Cytotoxicity:	0.998	Hek293 Cytotoxicity:	0.716
BCF:	0.645 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.253 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.654 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.552 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[16926516]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[22834923]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	Roots	n.a.	n.a.	PMID[30395460]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32569471]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39065796]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	12

Activity Type	# Activity
Others	3
Non-molecular	9

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	16.1	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	16.3	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	29.5	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	107.6	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	98.6	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	108.6	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	110.7	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	113.1	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	94.7	%	PMID[22834923]
NPT2	Others	Unspecified	n.a.	Activity	=	0.3	%	PMID[24571273]
NPT2	Others	Unspecified	n.a.	Activity	=	-6.2	%	PMID[17958396]
NPT2	Others	Unspecified	n.a.	Activity	=	8.3	%	PMID[24571273]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC302887 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24693
0.1-0.2	21082
0.2-0.3	2759
0.3-0.4	668
0.4-0.5	432
0.5-0.6	131
0.6-0.7	51
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8878	High Similarity	NPC160452
0.8081	Intermediate Similarity	NPC44716
0.7692	Intermediate Similarity	NPC23275
0.7456	Intermediate Similarity	NPC484059
0.7456	Intermediate Similarity	NPC484060
0.7451	Intermediate Similarity	NPC605226
0.7387	Intermediate Similarity	NPC283417
0.7387	Intermediate Similarity	NPC200049
0.7222	Intermediate Similarity	NPC469947
0.7222	Intermediate Similarity	NPC480948
0.7203	Intermediate Similarity	NPC484063
0.7203	Intermediate Similarity	NPC484064
0.7193	Intermediate Similarity	NPC484061
0.7193	Intermediate Similarity	NPC484062
0.7156	Intermediate Similarity	NPC480939
0.7143	Intermediate Similarity	NPC475591
0.7143	Intermediate Similarity	NPC236870
0.6983	Remote Similarity	NPC265841
0.6923	Remote Similarity	NPC22956
0.6852	Remote Similarity	NPC64715
0.6786	Remote Similarity	NPC25998
0.6757	Remote Similarity	NPC187290
0.6726	Remote Similarity	NPC609119
0.6724	Remote Similarity	NPC277212
0.6724	Remote Similarity	NPC30279
0.6695	Remote Similarity	NPC488308
0.6667	Remote Similarity	NPC181066
0.6639	Remote Similarity	NPC271610
0.6639	Remote Similarity	NPC312650
0.6612	Remote Similarity	NPC302543
0.6609	Remote Similarity	NPC284449
0.6514	Remote Similarity	NPC118440
0.6509	Remote Similarity	NPC603026
0.6505	Remote Similarity	NPC164194
0.65	Remote Similarity	NPC225791
0.6496	Remote Similarity	NPC602995
0.6455	Remote Similarity	NPC123796
0.6446	Remote Similarity	NPC476779
0.6441	Remote Similarity	NPC46823
0.6422	Remote Similarity	NPC251768
0.6387	Remote Similarity	NPC329828
0.6379	Remote Similarity	NPC151543
0.6371	Remote Similarity	NPC488309
0.6333	Remote Similarity	NPC21691
0.633	Remote Similarity	NPC30289
0.625	Remote Similarity	NPC4749
0.6239	Remote Similarity	NPC192791
0.6204	Remote Similarity	NPC472949
0.6195	Remote Similarity	NPC236657
0.6182	Remote Similarity	NPC117714
0.6168	Remote Similarity	NPC25605
0.6167	Remote Similarity	NPC47995
0.6148	Remote Similarity	NPC476774
0.6148	Remote Similarity	NPC476780
0.6147	Remote Similarity	NPC76497
0.614	Remote Similarity	NPC301449
0.614	Remote Similarity	NPC601290
0.6129	Remote Similarity	NPC110700
0.6129	Remote Similarity	NPC476777
0.6126	Remote Similarity	NPC2370
0.6116	Remote Similarity	NPC71391
0.6083	Remote Similarity	NPC475140
0.6053	Remote Similarity	NPC114692
0.6036	Remote Similarity	NPC114304
0.6018	Remote Similarity	NPC131469
0.6	Remote Similarity	NPC80843
0.6	Remote Similarity	NPC213674
0.6	Remote Similarity	NPC469946
0.5983	Remote Similarity	NPC11242
0.5983	Remote Similarity	NPC480936
0.5982	Remote Similarity	NPC164389
0.5965	Remote Similarity	NPC95437
0.5963	Remote Similarity	NPC127056
0.5963	Remote Similarity	NPC109079
0.5909	Remote Similarity	NPC488561
0.5906	Remote Similarity	NPC476775
0.5897	Remote Similarity	NPC329976
0.5893	Remote Similarity	NPC480947
0.5882	Remote Similarity	NPC313110
0.5856	Remote Similarity	NPC263756
0.5854	Remote Similarity	NPC192765
0.5847	Remote Similarity	NPC605294
0.5841	Remote Similarity	NPC159309
0.5841	Remote Similarity	NPC86222
0.5833	Remote Similarity	NPC123522
0.5814	Remote Similarity	NPC279915
0.5814	Remote Similarity	NPC476778
0.5812	Remote Similarity	NPC120116
0.5806	Remote Similarity	NPC470518
0.5806	Remote Similarity	NPC178264
0.5772	Remote Similarity	NPC473918
0.5766	Remote Similarity	NPC157868
0.5763	Remote Similarity	NPC104137
0.5763	Remote Similarity	NPC26626
0.5741	Remote Similarity	NPC1046
0.5714	Remote Similarity	NPC470876
0.5702	Remote Similarity	NPC480475
0.569	Remote Similarity	NPC79718
0.5678	Remote Similarity	NPC187618
0.5667	Remote Similarity	NPC288205
0.5667	Remote Similarity	NPC51465
0.5664	Remote Similarity	NPC112352
0.5649	Remote Similarity	NPC476776
0.5641	Remote Similarity	NPC114484
0.5636	Remote Similarity	NPC12288
0.562	Remote Similarity	NPC610204
0.5619	Remote Similarity	NPC31839
0.5603	Remote Similarity	NPC222580
0.5593	Remote Similarity	NPC291903
0.5593	Remote Similarity	NPC606145
0.5591	Remote Similarity	NPC258617
0.5577	Remote Similarity	NPC606107
0.5574	Remote Similarity	NPC478155
0.5574	Remote Similarity	NPC478154
0.5565	Remote Similarity	NPC40775
0.5565	Remote Similarity	NPC470218
0.5537	Remote Similarity	NPC470475
0.5537	Remote Similarity	NPC475119
0.5528	Remote Similarity	NPC477465
0.5517	Remote Similarity	NPC63159
0.5508	Remote Similarity	NPC281148
0.55	Remote Similarity	NPC475486
0.5476	Remote Similarity	NPC85154
0.547	Remote Similarity	NPC297263
0.5463	Remote Similarity	NPC480937
0.5462	Remote Similarity	NPC324875
0.5462	Remote Similarity	NPC218954
0.5462	Remote Similarity	NPC292677
0.5446	Remote Similarity	NPC59804
0.5431	Remote Similarity	NPC10607
0.5431	Remote Similarity	NPC46665
0.5417	Remote Similarity	NPC480473
0.5417	Remote Similarity	NPC480474
0.5407	Remote Similarity	NPC33012
0.5391	Remote Similarity	NPC286457
0.5372	Remote Similarity	NPC207738
0.5372	Remote Similarity	NPC31838
0.5366	Remote Similarity	NPC252657
0.5366	Remote Similarity	NPC88311
0.5366	Remote Similarity	NPC473824
0.536	Remote Similarity	NPC470476
0.536	Remote Similarity	NPC603137
0.5354	Remote Similarity	NPC82380
0.5354	Remote Similarity	NPC244296
0.5351	Remote Similarity	NPC473884
0.5339	Remote Similarity	NPC257468
0.5333	Remote Similarity	NPC8524
0.5328	Remote Similarity	NPC62725
0.531	Remote Similarity	NPC281939
0.531	Remote Similarity	NPC56713
0.5299	Remote Similarity	NPC488526
0.529	Remote Similarity	NPC475368
0.5289	Remote Similarity	NPC488564
0.5289	Remote Similarity	NPC80986
0.5285	Remote Similarity	NPC472267
0.5285	Remote Similarity	NPC107536
0.5285	Remote Similarity	NPC115656
0.5285	Remote Similarity	NPC280029
0.5285	Remote Similarity	NPC9470
0.5285	Remote Similarity	NPC185466
0.5274	Remote Similarity	NPC485563
0.5259	Remote Similarity	NPC242840
0.5259	Remote Similarity	NPC489209
0.5252	Remote Similarity	NPC489208
0.5248	Remote Similarity	NPC86368
0.5246	Remote Similarity	NPC609281
0.5242	Remote Similarity	NPC475287
0.5242	Remote Similarity	NPC607904
0.5242	Remote Similarity	NPC610461
0.5238	Remote Similarity	NPC251263
0.5221	Remote Similarity	NPC203354
0.5221	Remote Similarity	NPC603870
0.5207	Remote Similarity	NPC481079
0.5207	Remote Similarity	NPC477075
0.5175	Remote Similarity	NPC235405
0.5175	Remote Similarity	NPC309780
0.5169	Remote Similarity	NPC305267
0.5169	Remote Similarity	NPC148603
0.5167	Remote Similarity	NPC471435
0.5167	Remote Similarity	NPC471434
0.5149	Remote Similarity	NPC220160
0.5149	Remote Similarity	NPC482010
0.5133	Remote Similarity	NPC48499
0.513	Remote Similarity	NPC249848
0.513	Remote Similarity	NPC107966
0.5122	Remote Similarity	NPC481078
0.5122	Remote Similarity	NPC36831
0.512	Remote Similarity	NPC268184
0.5118	Remote Similarity	NPC219180
0.5118	Remote Similarity	NPC135904
0.5113	Remote Similarity	NPC11577
0.5113	Remote Similarity	NPC141600
0.5089	Remote Similarity	NPC214484
0.5086	Remote Similarity	NPC470512
0.5085	Remote Similarity	NPC30735
0.5083	Remote Similarity	NPC470514
0.5083	Remote Similarity	NPC475504
0.5079	Remote Similarity	NPC79643
0.5078	Remote Similarity	NPC269484

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC302887 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7206
0.1-0.2	1878
0.2-0.3	60
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data