NPASS Compound

Natural Product: NPC602995

Natural Product ID	NPC602995
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JNZRVUUXJGGFKC-KNMQGJONSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1094687
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 160167 0 0 0 0 0 0 0 0999 V2000 12.9666 2.8076 -0.0767 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8819 1.5561 0.6972 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7612 0.9118 0.9182 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7348 -0.3463 1.7043 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4905 1.4273 0.3576 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5481 2.4963 -0.3506 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3309 0.9191 0.5062 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0033 0.8817 0.3131 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5254 -0.2356 -0.5908 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0433 0.0814 -1.8773 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9922 -0.6759 -2.5232 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5115 -0.3092 -3.8762 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4685 -1.7158 -2.0007 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0674 -0.4226 -0.6738 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8916 -1.9504 -0.9646 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4789 -2.3066 -2.1468 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3700 0.2842 -1.7592 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1148 1.3649 -2.2764 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9933 0.7332 -1.5757 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1999 0.2413 -0.4041 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7987 1.4765 0.4477 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9938 -0.6074 0.4974 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5165 -1.6515 1.1466 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1082 -2.1231 1.0632 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3271 -1.0070 0.4960 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1566 -1.2074 0.4303 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5292 -2.0832 -0.7123 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6158 -1.8988 1.6971 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0893 -2.0015 1.7846 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8922 -0.8710 1.1930 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8197 -1.3628 0.2540 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0609 -1.6158 0.7721 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3394 -2.9388 0.6071 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8491 -3.3537 -0.5633 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9720 -3.3239 -1.7529 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7909 -2.9342 -1.7925 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4801 -3.7776 -2.9934 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1931 -2.6856 -0.9041 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0572 -3.0084 0.1465 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9679 -1.2105 -0.8552 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4363 -0.6470 -1.9911 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2886 0.1782 -2.6726 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5497 -0.2744 -3.9730 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9950 0.5242 -4.9456 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6484 1.8946 -4.9861 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0558 2.6837 -5.9451 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5753 2.4762 -3.6160 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9391 3.7060 -3.6671 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7210 1.5684 -2.7395 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7073 2.1501 -1.4454 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2002 -0.7587 0.3383 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1385 -0.6598 1.4098 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2441 0.6165 1.9103 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6653 0.7271 3.1831 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3919 0.1462 4.1826 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4478 -1.3612 4.1462 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2084 -1.7463 5.2718 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7262 0.7892 4.3724 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5069 1.9930 5.0551 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4391 1.0456 3.1058 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.5106 0.1374 2.9026 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6144 1.2056 1.8854 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4872 2.5743 1.5490 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1639 0.2989 0.6921 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9931 0.9505 -0.4259 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2453 1.3857 1.8146 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7301 0.1918 0.3658 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3274 0.7710 -0.9272 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0171 0.5130 -1.4648 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9179 -0.4802 -0.7876 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2769 -1.5859 -1.7554 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4369 -0.2955 0.7038 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7386 0.9933 1.3576 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2265 1.0733 1.5809 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4855 2.5358 1.9995 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6088 0.2366 2.7372 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0472 3.1514 -0.0248 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3997 3.6474 0.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7676 2.6849 -1.1549 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7866 1.0976 1.1388 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2163 -0.2526 2.6736 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7622 -0.7720 1.8160 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1614 -1.1399 1.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7629 1.8109 -0.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0113 -1.1979 -0.3097 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6108 -0.3011 -3.9262 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0733 0.6534 -4.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1589 -1.0912 -4.5832 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4259 -2.4208 -0.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8439 -2.2095 -0.8699 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1973 -3.2438 -2.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3673 -0.4377 -2.6522 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7098 1.7310 -3.0960 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4387 0.6240 -2.5419 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0299 1.8706 -1.4672 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3522 2.3695 0.0292 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7458 1.7366 0.3283 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0062 1.3103 1.5160 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1768 -2.2371 1.8076 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0570 -3.0898 0.5777 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8387 -2.3287 2.1526 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4700 -0.1483 1.2349 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2477 -2.8616 -0.8403 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7612 -1.5578 -1.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4526 -2.6873 -0.5060 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2933 -1.2831 2.5802 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1320 -2.8840 1.8199 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4064 -2.1622 2.8338 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3932 -2.9422 1.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5817 -0.5961 2.0635 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9661 -1.4035 1.8911 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0532 -4.4788 -0.4238 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9715 -3.5109 -3.8277 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5128 -3.0704 -1.8776 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7603 -3.8091 0.6189 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0132 -0.7664 -0.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2867 0.2803 -2.1961 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9079 0.5662 -4.8371 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2379 0.0418 -5.9296 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7211 1.7212 -5.2848 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7231 3.3691 -6.2404 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5777 2.6458 -3.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4115 4.3408 -4.2280 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6943 1.6065 -3.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5744 2.6299 -1.2924 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8166 0.2702 0.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5835 1.2675 1.2698 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8135 0.3708 5.1392 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4271 -1.7359 4.3637 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9272 -1.7957 3.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9961 -2.6643 5.5649 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3393 0.1384 5.0446 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0038 1.8463 5.9122 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9883 2.0355 3.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2102 0.3912 3.5748 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1991 0.7672 1.0285 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6191 2.7461 1.1192 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8480 1.4633 0.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4645 0.2402 -1.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4640 1.7877 -0.9110 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0843 2.3841 1.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2556 1.3582 2.2777 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4624 1.0945 2.5352 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1496 0.7504 1.1680 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1543 0.5029 -1.6666 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4696 1.8940 -0.8205 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5348 1.4816 -1.6602 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8539 0.1258 -2.5252 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4587 -1.7116 -2.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1703 -1.3476 -2.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5434 -2.5437 -1.2799 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9430 -1.1135 1.2978 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4890 1.8961 0.7563 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2451 1.0580 2.3394 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4554 3.1348 1.0704 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6770 2.9108 2.6592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4946 2.6226 2.4598 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1341 -0.7433 2.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2601 0.8048 3.6537 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7270 0.1933 2.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 2 0 9 14 1 0 14 15 1 6 15 16 1 0 14 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 2 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 34 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 40 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 30 64 1 0 64 65 1 0 64 66 1 0 64 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 6 22 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 74 76 1 0 74 8 1 0 72 14 1 0 70 20 1 0 70 25 1 0 67 26 1 0 51 32 1 0 62 53 1 0 49 42 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 0 4 81 1 0 4 82 1 0 4 83 1 0 8 84 1 6 9 85 1 1 12 86 1 0 12 87 1 0 12 88 1 0 15 89 1 0 15 90 1 0 16 91 1 0 17 92 1 6 18 93 1 0 19 94 1 0 19 95 1 0 21 96 1 0 21 97 1 0 21 98 1 0 23 99 1 0 24100 1 0 24101 1 0 25102 1 1 27103 1 0 27104 1 0 27105 1 0 28106 1 0 28107 1 0 29108 1 0 29109 1 0 30110 1 1 32111 1 1 34112 1 1 37113 1 0 38114 1 6 39115 1 0 40116 1 1 42117 1 1 44118 1 0 44119 1 0 45120 1 6 46121 1 0 47122 1 1 48123 1 0 49124 1 6 50125 1 0 51126 1 6 53127 1 6 55128 1 1 56129 1 0 56130 1 0 57131 1 0 58132 1 1 59133 1 0 60134 1 1 61135 1 0 62136 1 6 63137 1 0 65138 1 0 65139 1 0 65140 1 0 66141 1 0 66142 1 0 66143 1 0 67144 1 1 68145 1 0 68146 1 0 69147 1 0 69148 1 0 71149 1 0 71150 1 0 71151 1 0 72152 1 1 73153 1 0 73154 1 0 75155 1 0 75156 1 0 75157 1 0 76158 1 0 76159 1 0 76160 1 0 M END

Standard InCHIKey	JNZRVUUXJGGFKC-KNMQGJONSA-N
Standard InCHI	InChI=1S/C54H84O22/c1-11-23(2)45(68)76-42-43(70-24(3)57)54(22-56)26(18-49(42,4)5)25-12-13-30-51(8)16-15-32(50(6,7)29(51)14-17-52(30,9)53(25,10)19-31(54)59)72-48-41(75-47-37(64)35(62)34(61)28(20-55)71-47)39(38(65)40(74-48)44(66)67)73-46-36(63)33(60)27(58)21-69-46/h11-12,26-43,46-48,55-56,58-65H,13-22H2,1-10H3,(H,66,67)/b23-11-/t26-,27-,28+,29-,30+,31+,32-,33-,34+,35-,36+,37+,38-,39-,40-,41+,42-,43-,46-,47-,48+,51-,52+,53+,54-/m0/s1
SMILES	C/C=C(/C)C(=O)O[C@H]1[C@H](OC(C)=O)[C@]2(CO)[C@H](O)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O[C@@H]7OC[C@H](O)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2CC1(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1084.55	Volume:	1054.291 ? Van der Waals volume.
Dense:	1.029	LogP:	1.566 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.189 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.822 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	48.0
TPSA:	347.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.848	Fsp³:	0.87
MCE-18:	183.129 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.83	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.195	Promiscuous compounds:	0.267

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.115	MDCK Permeability:	-5.172
Pgp-inhibitor:	0.0	Pgp-substrate:	0.136
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.297
20% Bioavailability (F20%):	0.838	30% Bioavailability (F30%):	0.994
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.863
Plasma Protein Binding (PPB):	67.532%	Volume Distribution (VD):	-0.56
Fu:	21.778% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.908	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.023	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.019
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.011

Half-life (T1/2):

2.746

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.664	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.966	Rat Oral Acute Toxicity:	0.016
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.334	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.013
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.996
Hematotoxicity:	0.887	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.972	RPMI-8226 Immunitoxicity:	0.163
A549 Cytotoxicity:	0.977	Hek293 Cytotoxicity:	0.53
BCF:	0.289 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.446 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.449 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.252 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25186	Eryngium yuccifolium	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25186	Eryngium yuccifolium	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2
GI50	5

Activity Type	# Activity
Individual protein	2
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT143	Individual protein	DNA topoisomerase I	Homo sapiens	IC50	>	250000.0	nM	PMID[20371180]
NPT1044	Individual protein	DNA topoisomerase II alpha	Homo sapiens	IC50	>	250000.0	nM	PMID[20371180]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT171	Cell line	MRC5	Homo sapiens	GI50	=	8710.0	nM	PMID[20371180]
NPT461	Cell line	PANC-1	Homo sapiens	GI50	=	13000.0	nM	PMID[20371180]
NPT306	Cell line	PC-3	Homo sapiens	GI50	=	11320.0	nM	PMID[20371180]
NPT116	Cell line	HL-60	Homo sapiens	GI50	=	8410.0	nM	PMID[20371180]
NPT81	Cell line	A549	Homo sapiens	GI50	=	8350.0	nM	PMID[20371180]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC602995 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21900
0.1-0.2	23318
0.2-0.3	3435
0.3-0.4	661
0.4-0.5	366
0.5-0.6	98
0.6-0.7	39
0.7-0.8	0
0.8-0.85	4
0.85-0.9	3
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9352	High Similarity	NPC271610
0.9135	High Similarity	NPC25998
0.8739	High Similarity	NPC476780
0.8559	High Similarity	NPC329828
0.8509	High Similarity	NPC476777
0.8496	Intermediate Similarity	NPC312650
0.8407	Intermediate Similarity	NPC488308
0.8087	Intermediate Similarity	NPC265841
0.8	Intermediate Similarity	NPC178264
0.7983	Intermediate Similarity	NPC488309
0.7913	Intermediate Similarity	NPC192765
0.7748	Intermediate Similarity	NPC329976
0.7731	Intermediate Similarity	NPC110700
0.7699	Intermediate Similarity	NPC609119
0.7658	Intermediate Similarity	NPC477193
0.7632	Intermediate Similarity	NPC478155
0.7632	Intermediate Similarity	NPC478154
0.7395	Intermediate Similarity	NPC470518
0.7355	Intermediate Similarity	NPC476779
0.7333	Intermediate Similarity	NPC476774
0.7177	Intermediate Similarity	NPC476775
0.7167	Intermediate Similarity	NPC71391
0.7105	Intermediate Similarity	NPC477191
0.7083	Intermediate Similarity	NPC46823
0.7073	Intermediate Similarity	NPC484059
0.7073	Intermediate Similarity	NPC484060
0.7009	Intermediate Similarity	NPC107536
0.7009	Intermediate Similarity	NPC280029
0.7009	Intermediate Similarity	NPC9470
0.7	Intermediate Similarity	NPC283417
0.7	Intermediate Similarity	NPC200049
0.6935	Remote Similarity	NPC484833
0.6929	Remote Similarity	NPC476778
0.6923	Remote Similarity	NPC477195
0.6885	Remote Similarity	NPC82380
0.6885	Remote Similarity	NPC244296
0.6875	Remote Similarity	NPC476776
0.6875	Remote Similarity	NPC605226
0.6864	Remote Similarity	NPC477196
0.6838	Remote Similarity	NPC187290
0.6814	Remote Similarity	NPC44716
0.678	Remote Similarity	NPC605294
0.6693	Remote Similarity	NPC302543
0.6557	Remote Similarity	NPC284449
0.6532	Remote Similarity	NPC47995
0.6532	Remote Similarity	NPC473918
0.6496	Remote Similarity	NPC302887
0.6446	Remote Similarity	NPC478152
0.6446	Remote Similarity	NPC478151
0.6429	Remote Similarity	NPC484061
0.6429	Remote Similarity	NPC484062
0.6417	Remote Similarity	NPC477194
0.64	Remote Similarity	NPC277212
0.64	Remote Similarity	NPC30279
0.6333	Remote Similarity	NPC160452
0.6333	Remote Similarity	NPC477077
0.6325	Remote Similarity	NPC475591
0.6325	Remote Similarity	NPC236870
0.6288	Remote Similarity	NPC279915
0.624	Remote Similarity	NPC478150
0.622	Remote Similarity	NPC478597
0.6212	Remote Similarity	NPC484063
0.6212	Remote Similarity	NPC484064
0.6179	Remote Similarity	NPC470475
0.6154	Remote Similarity	NPC117714
0.6154	Remote Similarity	NPC30289
0.6124	Remote Similarity	NPC478596
0.6121	Remote Similarity	NPC22956
0.6098	Remote Similarity	NPC11242
0.6034	Remote Similarity	NPC603026
0.5969	Remote Similarity	NPC4749
0.595	Remote Similarity	NPC64715
0.5935	Remote Similarity	NPC477192
0.5902	Remote Similarity	NPC470914
0.5847	Remote Similarity	NPC263756
0.5847	Remote Similarity	NPC213674
0.584	Remote Similarity	NPC477197
0.584	Remote Similarity	NPC606553
0.5821	Remote Similarity	NPC11577
0.5821	Remote Similarity	NPC141600
0.582	Remote Similarity	NPC79718
0.5794	Remote Similarity	NPC472267
0.5794	Remote Similarity	NPC115656
0.5769	Remote Similarity	NPC252289
0.5769	Remote Similarity	NPC305793
0.5739	Remote Similarity	NPC1046
0.5738	Remote Similarity	NPC470913
0.5736	Remote Similarity	NPC470476
0.5726	Remote Similarity	NPC301449
0.5726	Remote Similarity	NPC23275
0.5726	Remote Similarity	NPC601290
0.5682	Remote Similarity	NPC21691
0.568	Remote Similarity	NPC477078
0.5635	Remote Similarity	NPC104137
0.5635	Remote Similarity	NPC207738
0.5635	Remote Similarity	NPC26626
0.5625	Remote Similarity	NPC610204
0.5606	Remote Similarity	NPC329923
0.5606	Remote Similarity	NPC475281
0.5597	Remote Similarity	NPC225791
0.5597	Remote Similarity	NPC262796
0.5597	Remote Similarity	NPC45346
0.5573	Remote Similarity	NPC269484
0.5573	Remote Similarity	NPC97918
0.5515	Remote Similarity	NPC475377
0.5515	Remote Similarity	NPC476074
0.5514	Remote Similarity	NPC473160
0.5512	Remote Similarity	NPC469947
0.5512	Remote Similarity	NPC480948
0.5504	Remote Similarity	NPC252657
0.5504	Remote Similarity	NPC88311
0.5496	Remote Similarity	NPC603137
0.5489	Remote Similarity	NPC181066
0.5476	Remote Similarity	NPC477076
0.5469	Remote Similarity	NPC480939
0.5462	Remote Similarity	NPC478600
0.5462	Remote Similarity	NPC478599
0.5455	Remote Similarity	NPC475140
0.544	Remote Similarity	NPC603832
0.5401	Remote Similarity	NPC329657
0.536	Remote Similarity	NPC611191
0.5344	Remote Similarity	NPC123522
0.5344	Remote Similarity	NPC1314
0.5344	Remote Similarity	NPC273878
0.5328	Remote Similarity	NPC478153
0.5323	Remote Similarity	NPC251768
0.5323	Remote Similarity	NPC164389
0.5323	Remote Similarity	NPC232237
0.5323	Remote Similarity	NPC2370
0.531	Remote Similarity	NPC475368
0.5308	Remote Similarity	NPC475119
0.5294	Remote Similarity	NPC286457
0.5286	Remote Similarity	NPC329960
0.5282	Remote Similarity	NPC489209
0.5267	Remote Similarity	NPC610461
0.5259	Remote Similarity	NPC85154
0.5254	Remote Similarity	NPC90856
0.5234	Remote Similarity	NPC291903
0.5234	Remote Similarity	NPC477079
0.5221	Remote Similarity	NPC478598
0.5208	Remote Similarity	NPC150893
0.5203	Remote Similarity	NPC80843
0.5191	Remote Similarity	NPC185466
0.5191	Remote Similarity	NPC288205
0.5191	Remote Similarity	NPC51465
0.517	Remote Similarity	NPC489208
0.5164	Remote Similarity	NPC127056
0.5164	Remote Similarity	NPC109079
0.5161	Remote Similarity	NPC192791
0.5159	Remote Similarity	NPC105800
0.5156	Remote Similarity	NPC281148
0.5154	Remote Similarity	NPC609281
0.5152	Remote Similarity	NPC473824
0.5145	Remote Similarity	NPC470876
0.5122	Remote Similarity	NPC472949
0.5122	Remote Similarity	NPC488561
0.5115	Remote Similarity	NPC210729
0.5115	Remote Similarity	NPC62725
0.5115	Remote Similarity	NPC82931
0.5111	Remote Similarity	NPC264566
0.5081	Remote Similarity	NPC76497
0.5081	Remote Similarity	NPC469946
0.5079	Remote Similarity	NPC159309
0.5079	Remote Similarity	NPC86222
0.5077	Remote Similarity	NPC187618
0.5036	Remote Similarity	NPC475167
0.5036	Remote Similarity	NPC329993
0.5033	Remote Similarity	NPC329893

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC602995 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6801
0.1-0.2	2285
0.2-0.3	59
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data