NPASS Compound

Natural Product: NPC9470

Natural Product ID	NPC9470
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2S,3S,4S,5R,6R)-6-[[(4S,6Bs,8R,9R)-9-Acetyloxy-8-Hydroxy-4,8A-Bis(Hydroxymethyl)-4,6A,6B,11,11,14B-Hexamethyl-10-[(E)-2-Methylbut-2-Enoyl]Oxy-1,2,3,4A,5,6,7,8,9,10,12,12A,14,14A-Tetradecahydropicen-3-Yl]Oxy]-4-Hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl]Oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl]Oxyoxane-2-Carboxylic Acid
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(4S,6bS,8R,9R)-9-acetyloxy-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(E)-2-methylbut-2-enoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1875956
PubChem CID	16211024
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 165172 0 0 0 0 0 0 0 0999 V2000 -6.8557 -3.7142 0.3924 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9938 -3.7104 -0.3965 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9764 -2.6558 -1.4630 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8578 -1.3723 -0.9245 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5423 -0.9703 -0.9732 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3171 0.1989 -0.2568 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2608 0.0473 0.6449 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1916 1.0473 0.2959 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4001 2.1911 1.0522 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7379 2.6021 1.0508 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5576 1.6627 1.9188 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8002 0.3340 2.0225 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8758 0.3039 3.0289 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7394 1.3781 1.2567 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8806 1.6576 2.0103 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4539 0.4127 2.2975 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6325 0.6919 3.0122 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1157 -0.5493 3.7356 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2691 -0.2858 4.4308 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6845 1.0226 1.9790 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1906 2.0942 1.0788 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8048 2.5895 1.3147 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9164 3.7899 2.0591 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2795 1.7086 -0.2830 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8713 1.4723 2.6035 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8048 3.9502 1.6310 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7718 4.5475 2.0474 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9900 4.6586 1.7626 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9786 0.4917 0.5742 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0879 0.3742 -0.4977 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8183 -1.0073 -0.9181 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4757 -1.5856 -0.9944 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5762 -0.4951 -1.3182 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3823 0.5411 -0.2542 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8804 1.2812 -0.2809 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0497 1.7563 1.1974 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9791 2.5393 -1.0512 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1145 3.3092 -0.6855 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6439 1.3033 -0.1153 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6439 0.3925 0.6156 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7956 -0.9140 -0.0845 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9431 -1.0767 -1.3013 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6166 -0.7609 -2.5934 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0210 -0.3989 -2.5871 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8019 -0.5686 -1.5693 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2749 -1.1545 -0.3349 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4053 -2.6816 -0.5511 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0965 -0.8480 0.8772 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0675 0.2346 0.8110 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5694 0.6924 -0.5265 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2391 -0.2006 -1.6639 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1428 -1.3747 -1.8321 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5167 -0.7630 -2.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5262 -1.8156 -2.4922 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4179 0.1834 -3.3485 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9993 0.0588 -0.9911 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0167 1.0671 -0.5208 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4365 1.4811 0.7877 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9099 2.7412 1.0827 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9887 3.5848 0.1551 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3332 3.1638 2.4335 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5363 -0.7808 0.0154 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8755 -0.7876 0.3786 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6468 0.0051 -0.2200 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4226 -1.6587 1.4049 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7094 -1.6192 1.7073 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3017 -2.4926 2.7473 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5868 -2.6270 2.1633 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8012 1.9956 -0.8544 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9849 2.9642 0.0900 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2525 -0.1633 1.5163 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4340 -1.9992 0.9538 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1195 -0.0035 -2.6753 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1888 -0.6590 -2.4376 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7454 -1.7336 -3.3401 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9338 -2.9809 -2.4872 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3464 -4.0069 -3.3424 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8635 -1.9201 -4.3870 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7721 0.5574 -2.8154 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3575 -4.5486 0.4005 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8591 -3.5804 0.2942 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0185 -4.7017 -0.8997 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9593 -2.6906 -2.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8500 -1.7724 -0.6642 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8518 -0.9948 0.5896 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3288 1.2887 -0.7866 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1817 2.6264 0.0427 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8219 2.0741 2.9042 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5538 -0.4714 2.2511 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1098 0.8901 2.9620 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6146 2.0796 3.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4807 1.5541 3.6788 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3506 -1.3058 2.9537 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3329 -0.9573 4.4103 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1512 0.0757 5.3294 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9137 0.1314 1.3524 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9053 2.9736 1.1351 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3254 2.9310 0.3473 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5218 4.4312 1.6091 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3147 2.5390 -0.8497 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6925 2.3487 3.0439 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0864 5.6340 1.4979 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6810 0.8429 -1.3175 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3476 -1.2565 -1.9009 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4407 -1.6669 -0.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4073 -2.3010 -1.8332 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1557 -2.1572 -0.0998 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3620 -0.1249 0.7073 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6342 2.6835 1.2233 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5255 0.9324 1.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0706 1.9266 1.6497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2158 2.2932 -2.1302 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1374 3.2051 -1.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8316 4.2215 -0.3611 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0871 1.3936 -1.1507 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5478 2.2517 0.4122 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5519 0.9401 0.7706 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1606 0.2697 1.6356 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7805 -2.2093 -1.3625 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5120 -1.6024 -3.3561 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1020 0.0811 -3.1547 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4610 0.0465 -3.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1671 -2.9145 -1.3343 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7915 -3.1876 0.3565 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4781 -3.1625 -0.8385 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3703 -0.6216 1.7172 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5923 -1.7816 1.2835 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7886 1.1354 1.4018 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3566 0.4388 -2.5994 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3048 -1.9388 -0.8988 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8525 -1.9665 -2.6980 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5204 -1.9959 -3.6029 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5324 -1.4320 -2.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3996 -2.7701 -1.9342 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4701 0.2610 -3.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1746 1.2192 -3.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7976 -0.2206 -4.1566 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8912 0.6306 -1.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1463 1.9677 -1.1546 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4187 3.2329 3.0615 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0755 2.4668 2.8182 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7725 4.1788 2.4413 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3616 -0.9347 1.1882 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1159 -3.1356 2.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7616 -1.8223 3.5172 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5577 -3.0954 3.2779 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6010 -2.6669 1.6166 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4899 -2.2731 3.1955 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0015 -3.6520 2.0895 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7496 1.7372 -0.9608 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1168 2.3387 -1.8824 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2490 2.9831 0.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2322 -1.1435 1.6155 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9994 -2.8834 0.4560 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7611 -1.6486 1.7287 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3331 -2.3773 1.4890 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0114 0.0009 -2.7325 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4611 0.9679 -2.9821 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3686 -0.7596 -3.4772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1000 -0.5102 -2.5523 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7248 -1.3711 -3.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9437 -3.2392 -2.0719 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3772 -4.8692 -2.8416 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6801 -2.8546 -4.6087 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7896 0.6014 -3.8099 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 20 25 1 0 10 26 1 0 26 27 2 0 26 28 1 0 8 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 1 35 37 1 0 37 38 1 0 34 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 2 0 45 46 1 0 46 47 1 6 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 53 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 56 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 65 66 2 0 66 67 1 0 65 68 1 0 50 69 1 0 69 70 1 0 49 71 1 0 41 72 1 0 33 73 1 0 5 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 75 78 1 0 74 79 1 0 76 3 1 0 12 7 1 0 22 15 1 0 35 30 1 0 46 41 1 0 57 50 1 0 42 33 1 0 51 45 1 0 1 80 1 0 2 81 1 0 2 82 1 0 3 83 1 6 5 84 1 1 7 85 1 1 8 86 1 6 10 87 1 6 11 88 1 1 12 89 1 1 13 90 1 0 15 91 1 1 17 92 1 1 18 93 1 0 18 94 1 0 19 95 1 0 20 96 1 6 21 97 1 6 22 98 1 6 23 99 1 0 24100 1 0 25101 1 0 28102 1 0 30103 1 0 31104 1 0 31105 1 0 32106 1 0 32107 1 0 34108 1 0 36109 1 0 36110 1 0 36111 1 0 37112 1 0 37113 1 0 38114 1 0 39115 1 0 39116 1 0 40117 1 0 40118 1 0 42119 1 0 43120 1 0 43121 1 0 44122 1 0 47123 1 0 47124 1 0 47125 1 0 48126 1 0 48127 1 0 49128 1 1 51129 1 0 52130 1 0 52131 1 0 54132 1 0 54133 1 0 54134 1 0 55135 1 0 55136 1 0 55137 1 0 56138 1 0 57139 1 6 61140 1 0 61141 1 0 61142 1 0 66143 1 0 67144 1 0 67145 1 0 67146 1 0 68147 1 0 68148 1 0 68149 1 0 69150 1 0 69151 1 0 70152 1 0 71153 1 0 72154 1 0 72155 1 0 72156 1 0 73157 1 0 73158 1 0 73159 1 0 74160 1 1 75161 1 6 76162 1 1 77163 1 0 78164 1 0 79165 1 0 M END

Standard InCHIKey	AXNVHPCVMSNXNP-YSYFQUGBSA-N
Standard InCHI	InChI=1S/C55H86O24/c1-10-23(2)46(71)79-43-44(72-24(3)60)55(22-59)26(17-50(43,4)5)25-11-12-30-51(6)15-14-32(52(7,21-58)29(51)13-16-53(30,8)54(25,9)18-31(55)61)75-49-41(77-48-38(67)36(65)34(63)28(20-57)74-48)39(68)40(42(78-49)45(69)70)76-47-37(66)35(64)33(62)27(19-56)73-47/h10-11,26-44,47-49,56-59,61-68H,12-22H2,1-9H3,(H,69,70)/b23-10+/t26?,27-,28-,29?,30?,31-,32?,33-,34-,35+,36+,37-,38-,39+,40+,41-,42+,43?,44+,47+,48-,49-,51?,52-,53?,54-,55?/m1/s1
SMILES	OC[C@H]1O[C@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C(=O)O)OC2CCC3(C([C@@]2(C)CO)CCC2(C3CC=C3[C@@]2(C)C[C@H](C2(C3CC(C)(C)C([C@@H]2OC(=O)C)OC(=O)/C(=C/C)/C)CO)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1130.55	Volume:	1089.167 ? Van der Waals volume.
Dense:	1.038	LogP:	0.718 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.671 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.154 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	388.04 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.988	Fsp³:	0.873
MCE-18:	184.893 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.597	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.065 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.196	Promiscuous compounds:	0.078

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.487	MDCK Permeability:	-5.143
Pgp-inhibitor:	0.0	Pgp-substrate:	0.442
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.946
20% Bioavailability (F20%):	0.698	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.949
Plasma Protein Binding (PPB):	61.632%	Volume Distribution (VD):	-0.509
Fu:	24.133% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.409
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.336

Half-life (T1/2):

4.466

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.586	Drug-induced Liver Injury (DILI):	0.659
AMES Toxicity:	0.618	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.044	Skin Sensitization:	1.0
Carcinogencity:	0.049	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.088	Drug-induced Nephrotoxicity:	0.862
Genotoxicity:	0.223	RPMI-8226 Immunitoxicity:	0.133
A549 Cytotoxicity:	0.235	Hek293 Cytotoxicity:	0.268
BCF:	0.164 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.635 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.788 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.147 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	seeds	n.a.	n.a.	PMID[10579862]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	seeds	n.a.	n.a.	PMID[15104496]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	seeds	n.a.	n.a.	PMID[25442304]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO29234	Aesculus chinensis	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Individual protein	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1109	Individual protein	Apelin receptor	Homo sapiens	IC50	=	9070.0	nM	PubChem BioAssay data set
NPT1110	Individual protein	C-C chemokine receptor type 6	Homo sapiens	IC50	=	7820.0	nM	PubChem BioAssay data set
NPT1111	Individual protein	C-X-C chemokine receptor type 5	Homo sapiens	IC50	=	9456.0	nM	PubChem BioAssay data set

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC9470 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20734
0.1-0.2	24365
0.2-0.3	3677
0.3-0.4	724
0.4-0.5	248
0.5-0.6	69
0.6-0.7	19
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC107536
1.0	High Similarity	NPC280029
0.8302	Intermediate Similarity	NPC472267
0.8302	Intermediate Similarity	NPC115656
0.8018	Intermediate Similarity	NPC252289
0.8018	Intermediate Similarity	NPC305793
0.7768	Intermediate Similarity	NPC269484
0.7768	Intermediate Similarity	NPC97918
0.7632	Intermediate Similarity	NPC82380
0.7632	Intermediate Similarity	NPC244296
0.7568	Intermediate Similarity	NPC252657
0.7568	Intermediate Similarity	NPC88311
0.75	Intermediate Similarity	NPC476780
0.7168	Intermediate Similarity	NPC25998
0.7119	Intermediate Similarity	NPC470518
0.7009	Intermediate Similarity	NPC602995
0.7	Intermediate Similarity	NPC271610
0.6885	Remote Similarity	NPC476777
0.675	Remote Similarity	NPC329828
0.661	Remote Similarity	NPC478155
0.661	Remote Similarity	NPC478154
0.6522	Remote Similarity	NPC477191
0.6341	Remote Similarity	NPC478597
0.632	Remote Similarity	NPC312650
0.6299	Remote Similarity	NPC11577
0.6299	Remote Similarity	NPC141600
0.624	Remote Similarity	NPC478596
0.624	Remote Similarity	NPC488308
0.624	Remote Similarity	NPC476774
0.622	Remote Similarity	NPC110700
0.6124	Remote Similarity	NPC476775
0.6066	Remote Similarity	NPC1314
0.6066	Remote Similarity	NPC273878
0.605	Remote Similarity	NPC477077
0.605	Remote Similarity	NPC477193
0.6	Remote Similarity	NPC329976
0.5984	Remote Similarity	NPC265841
0.5984	Remote Similarity	NPC609119
0.5954	Remote Similarity	NPC488309
0.595	Remote Similarity	NPC477195
0.5906	Remote Similarity	NPC178264
0.5902	Remote Similarity	NPC477196
0.5891	Remote Similarity	NPC484059
0.5891	Remote Similarity	NPC484060
0.5891	Remote Similarity	NPC476779
0.5873	Remote Similarity	NPC46823
0.5827	Remote Similarity	NPC192765
0.5798	Remote Similarity	NPC603832
0.5784	Remote Similarity	NPC473160
0.5714	Remote Similarity	NPC611191
0.5669	Remote Similarity	NPC470218
0.5667	Remote Similarity	NPC64715
0.5649	Remote Similarity	NPC484833
0.563	Remote Similarity	NPC118440
0.5583	Remote Similarity	NPC470913
0.5556	Remote Similarity	NPC476778
0.552	Remote Similarity	NPC478152
0.552	Remote Similarity	NPC478151
0.5515	Remote Similarity	NPC476776
0.5492	Remote Similarity	NPC470914
0.5433	Remote Similarity	NPC478600
0.5433	Remote Similarity	NPC478599
0.5403	Remote Similarity	NPC477078
0.5403	Remote Similarity	NPC477192
0.5366	Remote Similarity	NPC236657
0.5349	Remote Similarity	NPC478150
0.5344	Remote Similarity	NPC329923
0.5344	Remote Similarity	NPC475281
0.5303	Remote Similarity	NPC484061
0.5303	Remote Similarity	NPC484062
0.5285	Remote Similarity	NPC302887
0.528	Remote Similarity	NPC187618
0.5267	Remote Similarity	NPC277212
0.5267	Remote Similarity	NPC30279
0.525	Remote Similarity	NPC192791
0.5242	Remote Similarity	NPC114692
0.5227	Remote Similarity	NPC71391
0.5224	Remote Similarity	NPC262796
0.5224	Remote Similarity	NPC45346
0.5207	Remote Similarity	NPC605226
0.5203	Remote Similarity	NPC131469
0.52	Remote Similarity	NPC477076
0.5197	Remote Similarity	NPC605294
0.5188	Remote Similarity	NPC478598
0.5164	Remote Similarity	NPC44716
0.5164	Remote Similarity	NPC251768
0.5161	Remote Similarity	NPC95437
0.5159	Remote Similarity	NPC120116
0.5159	Remote Similarity	NPC160452
0.5154	Remote Similarity	NPC284449
0.5147	Remote Similarity	NPC475377
0.5147	Remote Similarity	NPC329657
0.5147	Remote Similarity	NPC476074
0.5145	Remote Similarity	NPC484063
0.5145	Remote Similarity	NPC484064
0.5083	Remote Similarity	NPC473884
0.5079	Remote Similarity	NPC218954
0.5079	Remote Similarity	NPC477079
0.5078	Remote Similarity	NPC606553
0.5076	Remote Similarity	NPC283417
0.5076	Remote Similarity	NPC200049
0.5042	Remote Similarity	NPC59804
0.5041	Remote Similarity	NPC40775
0.5038	Remote Similarity	NPC47995
0.5038	Remote Similarity	NPC473918

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC9470 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6720
0.1-0.2	2366
0.2-0.3	60
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data