NPASS Compound

Natural Product: NPC478152

Natural Product ID	NPC478152
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	xanifolia-Y3
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,4aS,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bS)-7,8-dihydroxy-8a-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-9,10-bis[[(Z)-2-methylbut-2-enoyl]oxy]-2,3,4,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	xanifolia-Y3
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44560534
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 165172 0 0 0 0 0 0 0 0999 V2000 8.5615 -3.2988 -1.5703 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7141 -3.8371 -0.8084 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9289 -3.4328 0.4142 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1068 -4.0209 1.1138 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1105 -2.4737 1.0993 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4168 -2.1497 2.3056 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9915 -1.8295 0.6058 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2484 -0.9005 1.3552 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2285 0.4771 0.7696 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8320 1.4533 1.8488 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8070 0.8403 2.7413 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9652 -0.2512 2.1483 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8040 -1.3398 1.5686 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3072 -1.9471 0.3211 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8080 -1.9333 0.2441 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2050 -0.5746 0.2066 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7922 0.1793 1.3739 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1533 1.2964 1.7009 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9592 1.8433 1.0067 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1833 0.8161 0.2719 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6987 -0.5830 0.3410 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0619 -1.3516 -0.7911 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4752 -1.2914 -0.6646 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9380 0.1145 -0.6126 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3068 0.9590 0.4532 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6161 2.3913 -0.0368 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0577 2.6681 -0.1412 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9590 1.5974 -0.6583 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4420 0.2243 -0.6576 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8368 -0.5119 -1.9512 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1957 1.6669 -0.0138 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2027 2.0982 -0.8642 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3951 1.2180 -0.7730 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5725 1.7695 -1.5562 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1731 3.1116 -2.1500 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5160 3.9812 -1.1353 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5064 3.4087 -0.4085 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5418 4.5778 -0.2564 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3982 4.5060 0.9834 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6447 5.2066 -0.8053 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4745 2.9738 -3.3297 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6028 2.0418 -0.6635 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7751 1.3952 -0.9858 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.2254 0.5233 0.1243 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.3057 1.3390 0.7935 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.6482 2.3586 -0.2299 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7437 2.3502 -1.2478 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0775 2.2387 -0.7254 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.9288 2.2528 0.3530 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8136 1.9443 1.9541 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8566 -0.6374 -0.3585 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0737 -0.0671 -1.1913 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2493 -1.0175 -0.1870 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3824 -1.9265 -0.6904 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8474 -3.2342 -1.2183 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0272 -3.9485 -0.1827 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5259 -2.9109 0.8017 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1509 -1.7713 0.1010 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3518 -3.4494 1.6039 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9638 -2.4466 2.4880 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9413 -4.5218 -0.8188 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2073 -3.0455 -2.4190 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2537 -2.1370 0.3862 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8427 0.8611 1.8155 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3540 -1.3535 1.5790 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6585 0.0882 -1.0736 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5218 -2.7023 -0.9062 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9778 -1.5080 -0.7961 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9262 -2.4971 2.5907 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6851 -3.5327 2.1177 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0492 1.9418 2.6481 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3478 2.7107 1.1519 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4171 0.8224 0.0942 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4891 1.1689 -1.2212 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3879 1.1749 -1.8592 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7415 1.5058 -1.8402 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8663 1.4841 -1.1542 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9380 1.1204 0.2765 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7828 1.8846 -3.2674 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 -2.1962 -1.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5290 -3.7825 -2.5605 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6506 -3.7069 -1.0371 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3731 -4.5767 -1.2997 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0464 -3.5805 0.7196 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0928 -3.8691 2.1978 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1707 -5.1247 0.9378 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7557 -0.8783 2.3790 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4251 0.5368 0.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2365 1.5077 3.3748 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4452 0.2756 3.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4871 -0.7269 3.0773 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5544 -3.0740 0.3338 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5176 -2.5121 1.1743 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5193 1.8537 2.5277 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3488 2.6479 0.3353 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3634 2.3962 1.7672 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2607 1.1141 -0.8253 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2356 -2.4646 -0.6750 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2974 -0.9791 -1.7829 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8374 -1.9398 0.1501 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8405 -1.7577 -1.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5997 0.5657 -1.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1162 2.4876 -1.0327 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1507 3.1333 0.6179 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1628 3.6169 -0.7404 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4457 2.9742 0.8715 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1834 1.8950 -1.7281 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8041 -0.4136 0.1710 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0044 -0.5009 -2.6873 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1867 -1.5245 -1.7844 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6474 0.0749 -2.4288 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8294 2.2162 -1.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6984 1.1647 0.3149 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8473 1.0732 -2.3586 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1404 3.6332 -2.4203 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0512 4.8563 -1.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2572 5.7192 -0.1715 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1177 2.7081 -4.0377 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6258 0.7775 -1.9014 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4275 0.2895 0.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1782 0.6987 1.0753 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5942 3.3783 0.2494 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2647 3.1428 -1.3423 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2332 1.3378 -1.3307 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8676 2.4949 0.0782 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5033 2.5942 2.2543 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1106 -1.2351 0.3791 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5898 -0.4943 0.7372 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9703 -1.4475 -1.4942 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7501 -3.8621 -1.4272 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6505 -4.6790 0.3610 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3069 -2.6646 1.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7366 -4.3035 2.1882 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5569 -3.7181 0.9081 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6957 -2.1153 3.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3143 -3.8045 -1.0669 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3406 -2.5880 -2.3404 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0110 -2.6510 0.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6266 0.0697 1.9266 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0641 0.8005 2.6342 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4074 1.7897 2.1513 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2434 -1.3899 1.7830 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5233 -2.4448 1.3164 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8562 -1.0469 2.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1251 -0.6591 -1.7901 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8334 0.4859 -1.7058 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3057 0.9750 -0.9111 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0624 -3.5318 -0.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9297 -2.1494 -1.5514 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8731 -2.8814 2.7261 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2362 -2.1164 3.5740 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1052 -4.0042 2.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6119 2.3728 3.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6989 1.1183 2.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5367 2.7604 2.1311 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1573 3.4822 1.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2012 3.0349 0.4903 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4990 2.4888 0.5058 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8257 1.7467 -1.6435 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3641 1.7914 0.9267 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0068 1.2267 0.6152 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5801 0.0849 0.4629 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7466 2.9860 -3.4154 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9020 1.4294 -3.7642 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6803 1.4366 -3.7576 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 2 0 38 40 1 0 35 41 1 0 34 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 45 50 1 0 44 51 1 0 33 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 56 61 1 0 55 62 1 0 54 63 1 0 25 64 1 1 21 65 1 1 16 66 1 6 15 67 1 0 14 68 1 0 13 69 1 1 69 70 1 0 10 71 1 0 10 72 1 0 9 73 1 0 73 74 1 0 74 75 2 0 74 76 1 0 76 77 2 0 77 78 1 0 76 79 1 0 13 8 1 0 17 12 1 0 21 16 1 0 25 20 1 0 29 24 1 0 37 32 1 0 47 43 1 0 58 53 1 0 1 80 1 0 1 81 1 0 1 82 1 0 2 83 1 0 4 84 1 0 4 85 1 0 4 86 1 0 8 87 1 1 9 88 1 6 11 89 1 0 11 90 1 0 12 91 1 1 14 92 1 1 15 93 1 1 18 94 1 0 19 95 1 0 19 96 1 0 20 97 1 6 22 98 1 0 22 99 1 0 23100 1 0 23101 1 0 24102 1 6 26103 1 0 26104 1 0 27105 1 0 27106 1 0 28107 1 6 29108 1 1 30109 1 0 30110 1 0 30111 1 0 32112 1 6 33113 1 1 34114 1 6 35115 1 6 36116 1 6 40117 1 0 41118 1 0 43119 1 6 44120 1 1 45121 1 1 46122 1 1 48123 1 0 48124 1 0 49125 1 0 50126 1 0 51127 1 0 53128 1 1 54129 1 6 55130 1 6 56131 1 1 57132 1 1 59133 1 0 59134 1 0 60135 1 0 61136 1 0 62137 1 0 63138 1 0 64139 1 0 64140 1 0 64141 1 0 65142 1 0 65143 1 0 65144 1 0 66145 1 0 66146 1 0 66147 1 0 67148 1 0 68149 1 0 69150 1 0 69151 1 0 70152 1 0 71153 1 0 71154 1 0 71155 1 0 72156 1 0 72157 1 0 72158 1 0 77159 1 0 78160 1 0 78161 1 0 78162 1 0 79163 1 0 79164 1 0 79165 1 0 M END

Standard InCHIKey	RIHFRRZHVHNGFQ-PTEMOXQYSA-N
Standard InCHI	InChI=1S/C56H86O23/c1-11-23(3)47(70)78-44-45(79-48(71)24(4)12-2)56(22-59)28(19-52(44,6)7)27-13-14-32-53(8)17-16-29(25(5)26(53)15-18-54(32,9)55(27,10)42(66)43(56)67)72-51-41(77-50-37(64)35(62)33(60)30(20-57)73-50)39(38(65)40(76-51)46(68)69)75-49-36(63)34(61)31(21-58)74-49/h11-13,25-26,28-45,49-51,57-67H,14-22H2,1-10H3,(H,68,69)/b23-11-,24-12-/t25-,26-,28-,29-,30+,31-,32+,33-,34-,35-,36+,37+,38-,39-,40-,41+,42-,43+,44-,45-,49-,50-,51+,53-,54+,55-,56-/m0/s1
SMILES	C/C=C(/C)\C(=O)O[C@H]1[C@@H](C(C[C@@H]2[C@]1([C@@H]([C@@H]([C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@H]5C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)C)C)C)O)O)CO)(C)C)OC(=O)/C(=C\C)/C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1126.56	Volume:	1095.036 ? Van der Waals volume.
Dense:	1.029	LogP:	1.023 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.122 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.235 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	367.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.047	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.087	Fsp³:	0.839
MCE-18:	180.893 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.727	Fluc inhibitor:	0.009 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.0 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.254	Promiscuous compounds:	0.271

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.339	MDCK Permeability:	-5.173
Pgp-inhibitor:	0.0	Pgp-substrate:	0.048
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.26
20% Bioavailability (F20%):	0.984	30% Bioavailability (F30%):	0.993
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	0.952
Plasma Protein Binding (PPB):	76.954%	Volume Distribution (VD):	-0.487
Fu:	14.033% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.044	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.171	CYP3A4-substrate:	0.372
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.054
HLM stability:	0.017 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.058

Half-life (T1/2):

2.529

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.531	Drug-induced Liver Injury (DILI):	0.98
AMES Toxicity:	0.982	Rat Oral Acute Toxicity:	0.019
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.252	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.012
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.997
Hematotoxicity:	0.971	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.951	RPMI-8226 Immunitoxicity:	0.252
A549 Cytotoxicity:	0.993	Hek293 Cytotoxicity:	0.663
BCF:	0.329 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.404 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.448 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.164 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT377	Cell line	OVCAR-3	Homo sapiens	IC50	=	4000	nM	PMID[18549275]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478152 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21958
0.1-0.2	23571
0.2-0.3	3536
0.3-0.4	625
0.4-0.5	91
0.5-0.6	47
0.6-0.7	17
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9604	High Similarity	NPC478150
0.8491	Intermediate Similarity	NPC478155
0.8286	Intermediate Similarity	NPC329976
0.8131	Intermediate Similarity	NPC478151
0.7521	Intermediate Similarity	NPC478153
0.7241	Intermediate Similarity	NPC46823
0.7179	Intermediate Similarity	NPC192765
0.7119	Intermediate Similarity	NPC178264
0.7018	Intermediate Similarity	NPC25998
0.693	Remote Similarity	NPC605294
0.6897	Remote Similarity	NPC478154
0.6612	Remote Similarity	NPC329828
0.6532	Remote Similarity	NPC484833
0.6529	Remote Similarity	NPC473918
0.6446	Remote Similarity	NPC602995
0.626	Remote Similarity	NPC277212
0.626	Remote Similarity	NPC30279
0.624	Remote Similarity	NPC476780
0.621	Remote Similarity	NPC71391
0.6186	Remote Similarity	NPC477077
0.6161	Remote Similarity	NPC603026
0.6116	Remote Similarity	NPC609119
0.6066	Remote Similarity	NPC478600
0.6066	Remote Similarity	NPC478599
0.6063	Remote Similarity	NPC271610
0.6017	Remote Similarity	NPC470914
0.5969	Remote Similarity	NPC476777
0.5847	Remote Similarity	NPC470913
0.582	Remote Similarity	NPC477197
0.5814	Remote Similarity	NPC262796
0.5814	Remote Similarity	NPC45346
0.5781	Remote Similarity	NPC478598
0.5725	Remote Similarity	NPC475377
0.5725	Remote Similarity	NPC476074
0.5581	Remote Similarity	NPC329923
0.5581	Remote Similarity	NPC475281
0.5528	Remote Similarity	NPC477078
0.552	Remote Similarity	NPC107536
0.552	Remote Similarity	NPC280029
0.552	Remote Similarity	NPC9470
0.5504	Remote Similarity	NPC47995
0.5496	Remote Similarity	NPC488308
0.5496	Remote Similarity	NPC476774
0.5481	Remote Similarity	NPC329960
0.5455	Remote Similarity	NPC225791
0.5455	Remote Similarity	NPC312650
0.5414	Remote Similarity	NPC484059
0.5414	Remote Similarity	NPC484060
0.5396	Remote Similarity	NPC150893
0.5379	Remote Similarity	NPC265841
0.5373	Remote Similarity	NPC110700
0.5373	Remote Similarity	NPC329657
0.5344	Remote Similarity	NPC82380
0.5344	Remote Similarity	NPC244296
0.5333	Remote Similarity	NPC605226
0.5323	Remote Similarity	NPC477076
0.5303	Remote Similarity	NPC484061
0.5303	Remote Similarity	NPC484062
0.5299	Remote Similarity	NPC476779
0.5294	Remote Similarity	NPC476775
0.5255	Remote Similarity	NPC488309
0.5191	Remote Similarity	NPC264566
0.5188	Remote Similarity	NPC470518
0.5143	Remote Similarity	NPC475263
0.5122	Remote Similarity	NPC475591
0.5122	Remote Similarity	NPC236870
0.5113	Remote Similarity	NPC475167
0.5079	Remote Similarity	NPC477191
0.5078	Remote Similarity	NPC606553
0.5075	Remote Similarity	NPC134914
0.5075	Remote Similarity	NPC473755
0.5041	Remote Similarity	NPC44716
0.5041	Remote Similarity	NPC22956

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478152 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6982
0.1-0.2	2103
0.2-0.3	63
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data