NPASS Compound

Natural Product: NPC475591

Natural Product ID	NPC475591
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-[Beta-D-Glucopyranosyl (1->3)-Beta-D-Galactopyranosyl(1->2)]-Beta-D-Glucuronopyranosyl-Oleanolic Acid-28-O-Beta-D-Glucopyranoside
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,8aS,12aR,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL508826
PubChem CID	44566340
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 164172 0 0 0 0 0 0 0 0999 V2000 7.9239 2.5913 -2.3486 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0719 1.4160 -1.3646 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1500 1.9712 0.0021 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8737 2.0536 0.7678 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1137 0.7710 0.7321 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7406 0.9412 1.3179 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7197 1.6392 0.5163 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7545 1.2945 -0.9582 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5950 0.1039 -1.0876 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1265 -1.0472 -1.5784 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7137 -1.2594 -2.0407 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8838 -0.2731 -1.2839 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3820 1.0856 -1.5633 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4269 2.1722 -1.1129 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3043 1.7785 -0.2560 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1965 0.3791 -0.2787 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3986 -0.4611 -1.3878 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2042 -0.0852 -2.7057 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6670 -0.3732 -2.6492 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4069 0.2352 -1.4912 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7120 0.2602 -0.1903 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1034 -0.9150 0.7037 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1840 1.5165 0.5644 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5895 -0.5407 -1.4002 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7365 0.1703 -1.6347 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6359 0.1268 -0.4558 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3509 -1.2033 -0.4130 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0995 -1.3232 -1.7477 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1266 -1.2221 -2.9001 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3305 -0.1243 -2.8551 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9548 -1.1588 -4.1520 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7529 -2.1079 -4.3574 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8475 -0.1088 -5.0382 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0725 -0.3422 -1.8024 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3142 -1.1553 0.5707 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1934 -2.1954 1.5198 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4130 -3.0550 1.3744 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9339 -3.6430 2.6429 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6837 -2.8226 3.8620 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2237 -2.4076 3.8349 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0411 -1.5961 2.7448 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3764 -3.6447 3.8400 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6970 -4.3517 5.0208 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5382 -1.7243 3.8912 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3281 -3.8153 2.4957 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1240 -4.1453 0.5217 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6083 1.1154 -0.4485 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5935 1.9233 0.6467 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8279 2.0322 1.4509 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8969 2.9088 0.8452 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2811 4.1750 0.3560 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0436 3.9261 -0.4601 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1424 3.1768 0.2407 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3591 3.4230 -1.8309 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2296 3.3733 -2.6214 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1790 5.0048 -0.2928 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6851 2.2517 -0.0759 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4743 2.6551 2.6730 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1493 -1.9322 -1.1654 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5879 1.2925 -3.0744 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0370 0.0972 -0.6011 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0411 0.3756 -1.6242 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2521 2.5431 -1.6545 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8296 -0.1166 1.7357 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1810 -0.5654 2.7052 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1472 -0.4579 1.6458 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7536 -1.2898 2.6171 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9012 -0.6244 3.3069 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1736 -0.9167 2.5897 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0237 -1.2903 1.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9336 -2.3149 0.9279 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1751 -2.4953 2.0875 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4836 -3.6196 0.4114 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4083 -4.4661 0.1214 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2284 -1.8777 0.7356 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9314 0.2781 2.6060 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9547 -1.1592 4.6157 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4837 0.8861 -1.6962 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3425 3.4116 -1.8360 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8964 3.0432 -2.6027 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3473 2.3072 -3.2325 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5434 3.0304 -0.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9672 1.4534 0.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3527 2.9581 0.4916 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1841 2.2221 1.8483 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8897 1.5119 2.2877 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4070 -0.0687 1.6678 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8028 2.7304 0.6982 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7275 1.3613 0.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7958 -1.8953 -1.6578 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5823 -1.3370 -3.1009 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4506 -2.2840 -1.6285 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1101 -0.4954 -0.1898 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0795 2.7861 -1.9995 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0597 2.9225 -0.5624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5823 2.4287 -0.5375 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4943 2.1141 0.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1703 -0.1125 0.6647 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0756 0.9526 -3.0054 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2195 -0.8225 -3.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1173 0.0668 -3.5756 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8912 -1.4755 -2.7509 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7230 1.2847 -1.7569 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8191 -1.6024 0.2092 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2094 -1.4250 1.1310 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6647 -0.5723 1.6233 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0556 1.2367 1.2282 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5704 2.2836 -0.1154 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4238 1.8764 1.2850 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3911 1.2442 -1.7720 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0033 0.1539 0.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6456 -2.0522 -0.2903 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5960 -2.3097 -1.8268 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5835 -2.1906 -2.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3412 -0.2041 -5.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8266 -0.6309 -2.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3076 -2.7853 1.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2408 -2.4936 0.8496 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5423 -4.6830 2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8410 -3.4537 4.7669 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9691 -1.8177 4.7390 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5468 -4.3232 3.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2945 -3.4096 3.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2748 -5.1414 4.8167 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1372 -1.7596 3.0999 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5429 -4.2171 1.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3483 -3.8659 -0.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7612 1.5470 1.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2966 1.0958 1.7276 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5827 3.1917 1.6986 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9441 4.7461 1.2712 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5624 4.9394 -0.5991 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0397 4.1872 -2.3086 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9225 2.4796 -1.8506 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5322 3.2421 -3.5652 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1178 4.7441 -0.0992 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5722 1.2781 0.0680 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9008 3.4221 2.4379 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7676 -2.3389 -0.3454 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9209 -2.1934 -1.1086 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4955 -2.4460 -2.1147 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0663 2.2355 -3.4225 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1663 0.5043 -3.6884 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6353 1.4016 -3.3618 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2262 -1.0009 -0.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6249 -0.5563 -1.9444 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5336 0.6255 -2.5822 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0666 2.4109 -2.3487 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5517 3.3182 -0.9126 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4448 3.0746 -2.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9636 -1.5530 3.3703 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6694 0.4611 3.3701 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7758 -1.6481 3.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8784 -0.4114 0.4870 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2470 -1.9154 0.1554 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9546 -3.3956 -0.5829 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2019 -4.0848 1.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6113 -5.3354 0.5543 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9347 -1.1778 0.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5374 0.8352 1.8640 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8481 -1.5971 4.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6868 1.0064 -2.7980 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5013 -0.1862 -1.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2102 1.4249 -1.0858 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 20 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 2 0 31 33 1 0 28 34 1 0 27 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 26 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 51 56 1 0 50 57 1 0 49 58 1 0 17 59 1 0 13 60 1 0 9 61 1 0 61 62 1 0 8 63 1 0 5 64 1 0 64 65 2 0 64 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 71 73 1 0 73 74 1 0 70 75 1 0 69 76 1 0 68 77 1 0 2 78 1 0 62 2 1 0 61 5 1 0 13 8 1 0 17 12 1 0 21 16 1 0 30 25 1 0 41 36 1 0 53 48 1 0 72 67 1 0 1 79 1 0 1 80 1 0 1 81 1 0 3 82 1 0 3 83 1 0 4 84 1 0 4 85 1 0 6 86 1 0 6 87 1 0 7 88 1 0 7 89 1 0 10 90 1 0 11 91 1 0 11 92 1 0 12 93 1 0 14 94 1 0 14 95 1 0 15 96 1 0 15 97 1 0 16 98 1 0 18 99 1 0 18100 1 0 19101 1 0 19102 1 0 20103 1 0 22104 1 0 22105 1 0 22106 1 0 23107 1 0 23108 1 0 23109 1 0 25110 1 0 26111 1 0 27112 1 0 28113 1 0 29114 1 0 33115 1 0 34116 1 0 36117 1 0 37118 1 0 38119 1 0 39120 1 0 40121 1 0 42122 1 0 42123 1 0 43124 1 0 44125 1 0 45126 1 0 46127 1 0 48128 1 0 49129 1 0 50130 1 0 51131 1 0 52132 1 0 54133 1 0 54134 1 0 55135 1 0 56136 1 0 57137 1 0 58138 1 0 59139 1 0 59140 1 0 59141 1 0 60142 1 0 60143 1 0 60144 1 0 61145 1 0 62146 1 0 62147 1 0 63148 1 0 63149 1 0 63150 1 0 67151 1 0 68152 1 0 69153 1 0 70154 1 0 71155 1 0 73156 1 0 73157 1 0 74158 1 0 75159 1 0 76160 1 0 77161 1 0 78162 1 0 78163 1 0 78164 1 0 M END

Standard InCHIKey	YSCJAYPKBYRXEZ-CUTUMUAQSA-N
Standard InCHI	InChI=1S/C54H86O24/c1-49(2)14-16-54(48(70)78-46-38(66)35(63)32(60)26(21-57)73-46)17-15-52(6)22(23(54)18-49)8-9-28-51(5)12-11-29(50(3,4)27(51)10-13-53(28,52)7)74-47-42(77-45-37(65)34(62)31(59)25(20-56)72-45)40(39(67)41(76-47)43(68)69)75-44-36(64)33(61)30(58)24(19-55)71-44/h8,23-42,44-47,55-67H,9-21H2,1-7H3,(H,68,69)/t23-,24-,25-,26-,27?,28-,29+,30-,31+,32-,33+,34+,35+,36-,37-,38-,39+,40+,41+,42-,44+,45+,46+,47-,51+,52-,53-,54+/m1/s1
SMILES	CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C(=O)O)O)OC7C(C(C(C(O7)CO)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)C2C1)C)C(=O)OC9C(C(C(C(O9)CO)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1118.55	Volume:	1068.588 ? Van der Waals volume.
Dense:	1.047	LogP:	0.179 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.409 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.73 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	52.0
TPSA:	391.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.057	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.813	Fsp³:	0.926
MCE-18:	199.385 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.013	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.377 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.395	Promiscuous compounds:	0.0

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.824	MDCK Permeability:	-4.993
Pgp-inhibitor:	0.0	Pgp-substrate:	0.601
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.624	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	47.752%	Volume Distribution (VD):	-0.324
Fu:	23.902% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.001	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.663	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.48

Half-life (T1/2):

3.755

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.046
Human Hepatotoxicity (H-HT):	0.391	Drug-induced Liver Injury (DILI):	0.22
AMES Toxicity:	0.107	Rat Oral Acute Toxicity:	0.056
Maximum Recommended Daily Dose:	0.099	Skin Sensitization:	0.008
Carcinogencity:	0.004	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.074	Ototoxicity:	1.0
Hematotoxicity:	0.006	Drug-induced Nephrotoxicity:	0.036
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.047
A549 Cytotoxicity:	0.006	Hek293 Cytotoxicity:	0.399
BCF:	0.175 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.222 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.424 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.039 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO10763	Aralia dasyphylla	Species	Araliaceae	Eukaryota	root bark	n.a.	n.a.	PMID[10425135]
NPO10763	Aralia dasyphylla	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	IC50	=	1.2	ug.mL-1	PMID[23268694]
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	0.02	ug.mL-1	PMID[23268694]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475591 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21232
0.1-0.2	24034
0.2-0.3	3212
0.3-0.4	737
0.4-0.5	358
0.5-0.6	80
0.6-0.7	84
0.7-0.8	0
0.8-0.85	5
0.85-0.9	0
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC236870
0.9368	High Similarity	NPC187290
0.8247	Intermediate Similarity	NPC251768
0.8229	Intermediate Similarity	NPC192791
0.8061	Intermediate Similarity	NPC159309
0.8061	Intermediate Similarity	NPC86222
0.8021	Intermediate Similarity	NPC157868
0.7843	Intermediate Similarity	NPC301449
0.7843	Intermediate Similarity	NPC601290
0.7745	Intermediate Similarity	NPC281148
0.7745	Intermediate Similarity	NPC114484
0.77	Intermediate Similarity	NPC40775
0.77	Intermediate Similarity	NPC44716
0.77	Intermediate Similarity	NPC10607
0.77	Intermediate Similarity	NPC46665
0.7449	Intermediate Similarity	NPC235405
0.7374	Intermediate Similarity	NPC249848
0.7374	Intermediate Similarity	NPC107966
0.7364	Intermediate Similarity	NPC283417
0.7364	Intermediate Similarity	NPC200049
0.7327	Intermediate Similarity	NPC112352
0.73	Intermediate Similarity	NPC473884
0.7264	Intermediate Similarity	NPC80986
0.7228	Intermediate Similarity	NPC22956
0.7216	Intermediate Similarity	NPC214484
0.7193	Intermediate Similarity	NPC258617
0.7157	Intermediate Similarity	NPC242840
0.7143	Intermediate Similarity	NPC302887
0.7115	Intermediate Similarity	NPC63159
0.7103	Intermediate Similarity	NPC160452
0.7087	Intermediate Similarity	NPC30735
0.7071	Intermediate Similarity	NPC48499
0.7059	Intermediate Similarity	NPC469946
0.7054	Intermediate Similarity	NPC470218
0.7009	Intermediate Similarity	NPC302543
0.6952	Remote Similarity	NPC235438
0.6931	Remote Similarity	NPC475516
0.6923	Remote Similarity	NPC605226
0.6842	Remote Similarity	NPC47995
0.6837	Remote Similarity	NPC209894
0.6822	Remote Similarity	NPC64715
0.6796	Remote Similarity	NPC39211
0.6729	Remote Similarity	NPC222580
0.6729	Remote Similarity	NPC297263
0.672	Remote Similarity	NPC475368
0.6667	Remote Similarity	NPC75417
0.6667	Remote Similarity	NPC223301
0.6667	Remote Similarity	NPC135904
0.6667	Remote Similarity	NPC171544
0.6636	Remote Similarity	NPC480473
0.6636	Remote Similarity	NPC480474
0.6635	Remote Similarity	NPC603026
0.6607	Remote Similarity	NPC25998
0.6581	Remote Similarity	NPC484061
0.6581	Remote Similarity	NPC484062
0.6577	Remote Similarity	NPC481078
0.6571	Remote Similarity	NPC263756
0.6571	Remote Similarity	NPC213674
0.6549	Remote Similarity	NPC609119
0.6545	Remote Similarity	NPC23275
0.6542	Remote Similarity	NPC480475
0.6535	Remote Similarity	NPC90856
0.6526	Remote Similarity	NPC167383
0.65	Remote Similarity	NPC481081
0.6491	Remote Similarity	NPC79643
0.6429	Remote Similarity	NPC469947
0.6429	Remote Similarity	NPC31838
0.6429	Remote Similarity	NPC480948
0.6422	Remote Similarity	NPC470478
0.6415	Remote Similarity	NPC161674
0.6404	Remote Similarity	NPC60557
0.6404	Remote Similarity	NPC67857
0.6392	Remote Similarity	NPC237503
0.6372	Remote Similarity	NPC480939
0.6372	Remote Similarity	NPC11242
0.6333	Remote Similarity	NPC41061
0.6333	Remote Similarity	NPC227551
0.633	Remote Similarity	NPC68175
0.6325	Remote Similarity	NPC602995
0.6306	Remote Similarity	NPC104372
0.6303	Remote Similarity	NPC21691
0.6283	Remote Similarity	NPC329976
0.6281	Remote Similarity	NPC484059
0.6281	Remote Similarity	NPC484060
0.6261	Remote Similarity	NPC475287
0.625	Remote Similarity	NPC265841
0.625	Remote Similarity	NPC481079
0.6239	Remote Similarity	NPC11551
0.6239	Remote Similarity	NPC123199
0.623	Remote Similarity	NPC305981
0.6228	Remote Similarity	NPC605294
0.6218	Remote Similarity	NPC4749
0.6218	Remote Similarity	NPC329828
0.6195	Remote Similarity	NPC295823
0.6195	Remote Similarity	NPC174720
0.6195	Remote Similarity	NPC475467
0.6186	Remote Similarity	NPC100639
0.6179	Remote Similarity	NPC261506
0.6179	Remote Similarity	NPC4328
0.6174	Remote Similarity	NPC470475
0.6168	Remote Similarity	NPC295371
0.6167	Remote Similarity	NPC57484
0.6134	Remote Similarity	NPC473918
0.6126	Remote Similarity	NPC31193
0.6083	Remote Similarity	NPC181066
0.6083	Remote Similarity	NPC481080
0.608	Remote Similarity	NPC484063
0.608	Remote Similarity	NPC484064
0.6078	Remote Similarity	NPC128925
0.6075	Remote Similarity	NPC109079
0.605	Remote Similarity	NPC475160
0.605	Remote Similarity	NPC473714
0.6016	Remote Similarity	NPC43550
0.6	Remote Similarity	NPC277212
0.6	Remote Similarity	NPC160415
0.6	Remote Similarity	NPC30279
0.6	Remote Similarity	NPC1046
0.6	Remote Similarity	NPC117714
0.6	Remote Similarity	NPC30289
0.5984	Remote Similarity	NPC488308
0.5966	Remote Similarity	NPC470476
0.5963	Remote Similarity	NPC475171
0.595	Remote Similarity	NPC71391
0.5946	Remote Similarity	NPC2370
0.5935	Remote Similarity	NPC271610
0.5935	Remote Similarity	NPC312650
0.5929	Remote Similarity	NPC79718
0.5906	Remote Similarity	NPC250247
0.5905	Remote Similarity	NPC204458
0.5902	Remote Similarity	NPC476068
0.5872	Remote Similarity	NPC472949
0.5849	Remote Similarity	NPC29069
0.5847	Remote Similarity	NPC76972
0.5847	Remote Similarity	NPC469782
0.5847	Remote Similarity	NPC204414
0.5841	Remote Similarity	NPC475504
0.584	Remote Similarity	NPC236638
0.584	Remote Similarity	NPC294453
0.5806	Remote Similarity	NPC225791
0.578	Remote Similarity	NPC150400
0.578	Remote Similarity	NPC127056
0.5776	Remote Similarity	NPC96641
0.5776	Remote Similarity	NPC163183
0.576	Remote Similarity	NPC293330
0.575	Remote Similarity	NPC284449
0.5738	Remote Similarity	NPC488560
0.5738	Remote Similarity	NPC46823
0.5726	Remote Similarity	NPC36831
0.5714	Remote Similarity	NPC309714
0.5703	Remote Similarity	NPC488309
0.5701	Remote Similarity	NPC78046
0.5691	Remote Similarity	NPC192765
0.5686	Remote Similarity	NPC199457
0.5686	Remote Similarity	NPC606107
0.5678	Remote Similarity	NPC62725
0.5669	Remote Similarity	NPC298034
0.5669	Remote Similarity	NPC71065
0.5664	Remote Similarity	NPC164389
0.5645	Remote Similarity	NPC178264
0.5641	Remote Similarity	NPC187618
0.5641	Remote Similarity	NPC241909
0.5636	Remote Similarity	NPC58448
0.5636	Remote Similarity	NPC473373
0.5635	Remote Similarity	NPC476779
0.5631	Remote Similarity	NPC68419
0.5625	Remote Similarity	NPC70809
0.5607	Remote Similarity	NPC473481
0.5593	Remote Similarity	NPC104137
0.5593	Remote Similarity	NPC26626
0.5574	Remote Similarity	NPC155410
0.5566	Remote Similarity	NPC480937
0.5565	Remote Similarity	NPC609763
0.5556	Remote Similarity	NPC164194
0.5536	Remote Similarity	NPC80843
0.5534	Remote Similarity	NPC306746
0.5528	Remote Similarity	NPC191827
0.5512	Remote Similarity	NPC65105
0.5492	Remote Similarity	NPC165204
0.5481	Remote Similarity	NPC604133
0.5478	Remote Similarity	NPC148417
0.5478	Remote Similarity	NPC118440
0.5476	Remote Similarity	NPC476774
0.5476	Remote Similarity	NPC476780
0.5472	Remote Similarity	NPC256798
0.5455	Remote Similarity	NPC268184
0.544	Remote Similarity	NPC487505
0.5439	Remote Similarity	NPC104071
0.5429	Remote Similarity	NPC31839
0.5417	Remote Similarity	NPC75287
0.541	Remote Similarity	NPC478155
0.541	Remote Similarity	NPC478154
0.5405	Remote Similarity	NPC108748
0.5391	Remote Similarity	NPC102439
0.5391	Remote Similarity	NPC473459
0.5366	Remote Similarity	NPC475899
0.5351	Remote Similarity	NPC256133
0.5349	Remote Similarity	NPC110700
0.5349	Remote Similarity	NPC202828
0.5349	Remote Similarity	NPC119592

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475591 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6623
0.1-0.2	2451
0.2-0.3	68
0.3-0.4	6
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data