NPASS Compound

Natural Product: NPC470478

Natural Product ID	NPC470478
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Erucasaponin A
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl]oxy]-3-hydroxy-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxane-2-carboxylic acid
Synonyms	Erucasaponin A
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2047212
PubChem CID	70681950
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 162170 0 0 0 0 0 0 0 0999 V2000 -10.1335 -3.8399 0.2422 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4659 -2.5402 -0.0610 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7690 -1.4578 0.9246 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6081 -1.0878 1.8139 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3171 -0.9128 1.0399 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5091 -1.4877 -0.3360 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0786 -2.7575 -0.1873 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4016 -1.4790 -1.1386 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5770 -0.7617 -2.3187 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3216 -1.7184 -3.4561 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9543 -1.7347 -4.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1231 -0.6988 -3.7301 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2210 -0.2387 -2.3647 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5573 0.3790 -2.2973 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8588 1.1882 -1.2358 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2155 2.4770 -1.6397 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6193 2.8618 -1.3221 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9041 3.0179 0.1341 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6233 3.3337 0.8776 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6364 4.0522 -0.0142 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3366 3.4011 -1.1718 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3671 4.2994 0.7718 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9554 4.1646 1.9447 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8686 4.0260 0.3668 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8178 4.1343 -1.9091 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1209 0.5896 -2.2201 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1030 -0.0294 -1.5127 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9016 -0.2654 -2.4138 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4075 -0.2871 -1.7446 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3900 -0.8751 -0.3205 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7648 -0.5342 0.2278 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8560 -1.1854 -0.5537 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8503 -1.9299 0.2542 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3744 -1.1733 1.4848 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6233 -0.4811 1.1519 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8834 -0.8530 1.8692 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1093 0.1608 2.9756 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6404 1.4162 2.3028 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7033 1.0047 1.1664 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3603 1.6412 1.3006 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6636 1.0186 2.4558 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2997 -0.4532 2.2181 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9008 -0.6401 1.7001 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9743 0.4740 2.2100 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4286 0.1235 1.8501 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7271 -0.2740 0.4664 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5768 0.7302 -0.3250 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8922 1.9923 -0.6707 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7985 1.0973 0.5128 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3415 -1.8948 2.3109 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2319 -0.9749 3.6767 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3461 1.5188 -0.0758 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6917 2.2923 -0.8149 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6172 1.1983 -0.4672 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2506 1.6697 -1.6389 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5745 0.5079 -2.5265 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7700 -0.2233 -1.9656 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9251 0.7467 -1.9875 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4868 2.1724 -1.9744 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3382 2.4173 -1.2461 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6209 2.9851 -1.3456 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8172 2.6114 -0.0183 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8472 0.4633 -0.9664 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0245 -1.4045 -2.6413 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6804 0.8276 -3.8572 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1121 -2.2301 2.2351 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0116 -2.9425 1.5118 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5206 -2.9912 3.3713 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2575 -2.3709 -0.5140 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2910 -3.0034 -3.5493 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1717 -2.9722 -2.9868 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8690 -4.2543 -3.7197 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7197 -3.0307 -3.1043 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2643 -1.5627 1.6955 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4579 -1.9946 2.8630 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8338 -1.8116 1.7774 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2179 -3.6569 0.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6849 -4.3422 1.1223 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0516 -4.4922 -0.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7793 -2.1994 -1.0894 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0569 -0.5153 0.3764 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8698 -0.0959 2.2782 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0261 0.1532 1.0055 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2806 -0.8506 -0.8596 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6146 -0.3279 -2.3729 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0425 -1.4198 -4.2608 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0325 -1.8161 -5.1227 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1721 -1.1898 -1.8156 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6771 0.9615 -3.2798 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1321 2.4872 -2.7606 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3800 2.1988 -1.7926 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3322 2.1017 0.5790 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2260 2.4003 1.3052 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0976 5.0652 -0.2061 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2681 3.5779 1.5942 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3063 5.3355 1.1654 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4927 4.1440 0.0887 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3614 5.0175 1.6468 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6721 3.7838 -0.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5946 4.1476 -2.5198 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4269 -1.0257 -1.1897 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1170 -1.1773 -3.0064 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9138 0.5841 -3.1599 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0220 0.6324 -1.8038 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0304 -1.0276 -2.3413 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8343 0.5729 -0.0226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4140 -0.4787 -1.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4508 -1.9592 -1.2754 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5520 -2.9765 0.4845 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7559 -2.0842 -0.4154 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6709 -2.0281 2.1362 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8712 -0.7679 0.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7796 -0.5903 1.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1844 0.1991 3.2435 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5285 -0.1200 3.8525 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1470 2.1259 2.9940 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5519 1.9378 1.9369 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8770 1.6145 0.3339 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4869 2.7229 1.5551 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8360 1.6032 2.8412 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4314 1.0603 3.2960 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2161 1.4110 1.6697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0341 0.5917 3.2946 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0299 1.0379 2.1084 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7814 -0.6179 2.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5027 -1.1074 0.5544 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8669 2.0892 -1.7918 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5084 2.8951 -0.3751 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0898 2.1869 -0.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3055 0.2418 0.9498 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5643 1.9211 1.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4516 1.6568 -0.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9740 -2.7749 2.2565 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3364 -2.1755 2.0019 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2129 -1.6760 3.4171 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5195 -0.4031 4.2757 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2346 -0.7066 4.1317 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1814 -2.0583 3.7311 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5702 2.3523 -2.2218 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7095 -0.2108 -2.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5514 -0.4667 -0.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4766 0.5598 -2.9388 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4144 2.5411 -3.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5579 2.7459 -1.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4538 4.0748 -1.4560 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7775 3.3871 0.5625 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6186 -0.3773 -0.4958 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9943 -1.6593 -2.6358 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5677 0.5331 -4.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5479 -2.4995 0.6819 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2313 -3.9741 1.7273 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9163 -2.4096 4.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3832 -3.4991 3.8839 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9264 -3.8196 2.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6785 -2.7878 -0.0568 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1802 -2.6665 -1.5824 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0920 -2.9544 -0.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6409 -4.9872 -3.0330 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3352 -3.2778 -2.2214 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5576 -1.9139 2.5685 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3293 -2.4361 3.0559 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6843 -1.6886 1.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 19 23 1 0 18 24 1 0 17 25 1 0 13 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 43 50 1 0 42 51 1 0 39 52 1 0 52 53 2 0 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 36 66 1 0 66 67 2 0 66 68 1 0 30 69 1 0 11 70 1 0 70 71 2 0 70 72 1 0 10 73 1 0 5 74 1 0 4 75 1 0 3 76 1 0 7 2 1 0 14 9 1 0 21 16 1 0 47 27 1 0 46 30 1 0 43 31 1 0 42 34 1 0 39 35 1 0 60 55 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 0 3 81 1 0 4 82 1 0 5 83 1 0 6 84 1 0 9 85 1 0 10 86 1 0 11 87 1 0 13 88 1 0 14 89 1 0 16 90 1 0 17 91 1 0 18 92 1 0 19 93 1 0 20 94 1 0 22 95 1 0 22 96 1 0 22 97 1 0 23 98 1 0 24 99 1 0 25100 1 0 27101 1 0 28102 1 0 28103 1 0 29104 1 0 29105 1 0 31106 1 0 32107 1 0 32108 1 0 33109 1 0 33110 1 0 34111 1 0 35112 1 0 36113 1 0 37114 1 0 37115 1 0 38116 1 0 38117 1 0 40118 1 0 40119 1 0 41120 1 0 41121 1 0 44122 1 0 44123 1 0 45124 1 0 45125 1 0 46126 1 0 48127 1 0 48128 1 0 48129 1 0 49130 1 0 49131 1 0 49132 1 0 50133 1 0 50134 1 0 50135 1 0 51136 1 0 51137 1 0 51138 1 0 55139 1 0 56140 1 0 57141 1 0 58142 1 0 59143 1 0 61144 1 0 61145 1 0 62146 1 0 63147 1 0 64148 1 0 65149 1 0 67150 1 0 67151 1 0 68152 1 0 68153 1 0 68154 1 0 69155 1 0 69156 1 0 69157 1 0 72158 1 0 73159 1 0 74160 1 0 75161 1 0 76162 1 0 M END

Standard InCHIKey	VFZBLNCRTMCDKR-NIBDAWPYSA-N
Standard InCHI	InChI=1S/C54H86O22/c1-21(2)24-12-17-54(49(68)76-47-39(64)36(61)33(58)26(20-55)71-47)19-18-52(8)25(30(24)54)10-11-28-51(7)15-14-29(50(5,6)27(51)13-16-53(28,52)9)72-48-43(75-46-38(63)35(60)32(57)23(4)70-46)41(40(65)42(74-48)44(66)67)73-45-37(62)34(59)31(56)22(3)69-45/h22-43,45-48,55-65H,1,10-20H2,2-9H3,(H,66,67)/t22-,23-,24-,25+,26+,27-,28+,29-,30+,31-,32-,33+,34+,35+,36-,37+,38+,39+,40-,41-,42-,43+,45-,46-,47-,48+,51-,52+,53+,54-/m0/s1
SMILES	CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7C8C(CCC8(CCC7(C6(CCC5C4(C)C)C)C)C(=O)OC9C(C(C(C(O9)CO)O)O)O)C(=C)C)C)C(=O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1086.56	Volume:	1051.007 ? Van der Waals volume.
Dense:	1.034	LogP:	1.318 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.359 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.501 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	52.0
TPSA:	350.74 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.073	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.807	Fsp³:	0.926
MCE-18:	197.981 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.017	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.36 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.35	Promiscuous compounds:	0.051

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.311	MDCK Permeability:	-4.981
Pgp-inhibitor:	0.0	Pgp-substrate:	0.773
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.994
20% Bioavailability (F20%):	0.063	30% Bioavailability (F30%):	0.988
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	50.175%	Volume Distribution (VD):	-0.358
Fu:	24.413% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.045	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.998	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.979	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.017	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.643

Half-life (T1/2):

4.92

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.259
Human Hepatotoxicity (H-HT):	0.379	Drug-induced Liver Injury (DILI):	0.333
AMES Toxicity:	0.062	Rat Oral Acute Toxicity:	0.063
Maximum Recommended Daily Dose:	0.318	Skin Sensitization:	0.001
Carcinogencity:	0.005	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.199	Ototoxicity:	1.0
Hematotoxicity:	0.005	Drug-induced Nephrotoxicity:	0.019
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.052
A549 Cytotoxicity:	0.007	Hek293 Cytotoxicity:	0.482
BCF:	0.647 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.604 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.556 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.403 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32656	Stenocereus alamosensis	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22704889]
NPO32619	isolatocereus dumortieri	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22704889]
NPO32656	Stenocereus alamosensis	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO32619	isolatocereus dumortieri	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT521	Cell line	RBL-2H3	Rattus norvegicus	IC50	>	200000.0	nM	PMID[23395661]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470478 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22226
0.1-0.2	23323
0.2-0.3	3131
0.3-0.4	857
0.4-0.5	256
0.5-0.6	51
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7525	Intermediate Similarity	NPC273962
0.7253	Intermediate Similarity	NPC473844
0.7087	Intermediate Similarity	NPC179429
0.6422	Remote Similarity	NPC475591
0.6422	Remote Similarity	NPC236870
0.6327	Remote Similarity	NPC94919
0.6087	Remote Similarity	NPC187290
0.5946	Remote Similarity	NPC287269
0.5789	Remote Similarity	NPC146563
0.5625	Remote Similarity	NPC302543
0.5603	Remote Similarity	NPC469821
0.5565	Remote Similarity	NPC47995
0.5565	Remote Similarity	NPC473918
0.5545	Remote Similarity	NPC11035
0.5536	Remote Similarity	NPC603026
0.5526	Remote Similarity	NPC204392
0.5508	Remote Similarity	NPC469823
0.5487	Remote Similarity	NPC22956
0.5424	Remote Similarity	NPC114484
0.5417	Remote Similarity	NPC329976
0.5392	Remote Similarity	NPC240125
0.5392	Remote Similarity	NPC91583
0.5391	Remote Similarity	NPC258617
0.5391	Remote Similarity	NPC605226
0.5385	Remote Similarity	NPC275668
0.5351	Remote Similarity	NPC161674
0.5345	Remote Similarity	NPC44716
0.5345	Remote Similarity	NPC46665
0.5328	Remote Similarity	NPC470475
0.5328	Remote Similarity	NPC25998
0.5317	Remote Similarity	NPC46823
0.5299	Remote Similarity	NPC68175
0.5246	Remote Similarity	NPC605294
0.5238	Remote Similarity	NPC283417
0.5238	Remote Similarity	NPC200049
0.5234	Remote Similarity	NPC484061
0.5234	Remote Similarity	NPC484062
0.5214	Remote Similarity	NPC251768
0.52	Remote Similarity	NPC477465
0.5197	Remote Similarity	NPC277212
0.5197	Remote Similarity	NPC30279
0.5172	Remote Similarity	NPC192791
0.5161	Remote Similarity	NPC609119
0.5159	Remote Similarity	NPC470476
0.5143	Remote Similarity	NPC604868
0.5115	Remote Similarity	NPC484059
0.5115	Remote Similarity	NPC484060
0.5085	Remote Similarity	NPC159309
0.5085	Remote Similarity	NPC86222
0.5044	Remote Similarity	NPC235841
0.5044	Remote Similarity	NPC297208
0.5043	Remote Similarity	NPC75417
0.5043	Remote Similarity	NPC240734
0.5043	Remote Similarity	NPC112352
0.5042	Remote Similarity	NPC469825
0.5041	Remote Similarity	NPC281148
0.5039	Remote Similarity	NPC329828
0.5038	Remote Similarity	NPC225791

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470478 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6485
0.1-0.2	2580
0.2-0.3	77
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data