NPASS Compound

Natural Product: NPC469821

Natural Product ID	NPC469821
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Acankoreoside N
IUPAC Name	[(2R,3S,4R,5R,6S)-6-[[(2S,3S,4S,5R,6S)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aS,11bR,12R,13aR,13bS)-12-hydroxy-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,8,11a-pentamethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
Synonyms	acankoreoside N
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1209875
PubChem CID	49862813
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 166174 0 0 0 0 0 0 0 0999 V2000 9.5033 1.6052 -1.5894 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8553 0.7430 -0.5634 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1411 -0.6330 -1.1249 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0672 -1.1656 -1.7479 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1811 -1.9145 -1.0382 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3453 -1.1976 -0.1793 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0180 -1.3024 -0.5944 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0701 -0.5391 0.3136 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7751 -0.6253 -0.1003 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1684 0.5463 -0.4625 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0486 0.2247 -1.3068 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7841 0.7745 -1.0569 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7459 1.5416 -0.0678 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2958 0.3955 -1.9553 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1704 0.6525 -3.3757 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1515 2.1662 -3.4119 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7875 2.6094 -2.3066 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4869 1.3417 -1.9902 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2852 1.2028 -0.7784 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8067 -0.2091 -0.6843 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5283 -1.0388 -0.4257 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7127 -1.0165 -1.7023 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3798 -0.8053 -1.9149 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7942 -0.3852 0.4685 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0345 -0.3370 1.7909 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3464 -1.7866 0.3727 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5114 -1.8695 1.3793 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5575 -0.9490 0.8189 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1311 0.4585 1.0494 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8292 0.6752 0.3527 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1781 1.9854 0.6649 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2646 2.2888 -0.5277 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0844 3.0408 0.7920 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1352 0.8640 2.4927 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1571 1.3606 0.3463 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3328 0.5817 -0.1443 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9518 -0.2712 0.9656 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9133 -1.3294 1.2750 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0259 -1.6709 2.7372 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2579 -2.6244 0.5169 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0882 -0.8280 0.4248 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2577 -0.4120 1.0571 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9774 -1.5128 1.4301 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.2584 -1.2773 1.8509 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.9602 -2.6396 1.9468 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.2698 -2.4922 2.3626 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.0958 -0.4695 0.8751 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.2537 -0.3761 -0.4002 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.0113 0.3977 -0.0108 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.4565 1.6136 0.5511 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8686 -1.6662 -0.7291 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.2469 0.8090 1.4557 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6901 3.6808 -2.8637 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7791 4.8477 -2.2553 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5090 3.4302 -4.0684 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2883 4.5824 -4.3472 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1153 1.2852 -1.4231 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4551 1.5655 -0.8293 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6240 0.8403 0.4647 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9903 1.5769 1.4677 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4717 1.1899 -1.7250 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4665 2.4570 -1.8294 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8436 -3.0683 -0.3808 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2795 -2.8773 -0.0319 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7477 -1.4539 -0.0175 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1365 -1.3930 -0.1851 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8037 -0.7815 0.8455 C 0 0 1 0 0 0 0 0 0 0 0 0 13.7819 -1.5906 1.4486 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2492 -0.8593 2.5385 C 0 0 1 0 0 0 0 0 0 0 0 0 14.7962 -1.7614 3.6244 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2912 0.1099 2.0352 C 0 0 1 0 0 0 0 0 0 0 0 0 15.0565 0.3170 0.5545 C 0 0 2 0 0 0 0 0 0 0 0 0 13.5751 0.4030 0.2558 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4582 0.4370 -1.1379 O 0 0 0 0 0 0 0 0 0 0 0 0 15.6865 -0.6643 -0.2124 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2159 1.3271 2.7264 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4929 -3.4152 1.2461 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7422 -4.1883 -1.2398 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1543 1.0678 -2.3550 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7798 1.1578 -0.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0271 0.6628 0.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9166 -0.4401 -1.9360 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4771 -2.3596 -1.8177 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8861 -1.0560 -1.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7136 -2.3904 -0.5034 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1069 -1.0027 1.3451 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8624 1.2097 0.3595 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2015 0.2539 -3.4975 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5456 0.2038 -4.0706 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1880 2.4391 -4.4243 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1717 2.5896 -3.2246 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2318 3.0529 -1.4532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0810 1.1617 -2.9502 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5497 1.2871 0.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7504 -2.0740 -0.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9310 -0.5881 0.3826 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1642 -1.5458 -2.5335 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2326 -1.5905 -1.4642 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2658 -1.9372 -1.8381 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9183 -0.5794 -2.8684 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4696 -0.6654 -2.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6557 -1.3673 2.0537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1584 0.3118 1.7653 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6665 -0.0315 2.6256 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8311 -2.0177 -0.5975 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6216 -2.5252 0.7091 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0991 -1.5745 2.3463 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8335 -2.9268 1.4408 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5494 -1.1018 -0.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0999 0.7372 -0.7452 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5935 1.9512 1.5954 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8946 2.5476 -1.3876 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6763 3.1800 -0.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0288 3.6392 0.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0406 0.0178 3.1977 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1049 1.3591 2.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3657 1.6654 2.6912 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5375 2.1557 1.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7221 1.8844 -0.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1226 1.3091 -0.4271 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1338 -0.0538 -1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1926 0.3861 1.8127 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3287 -0.8148 3.3600 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8595 -2.4251 2.8495 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1222 -2.1917 3.0732 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8249 -2.5277 -0.5222 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8230 -3.5051 0.9908 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3258 -2.7571 0.3832 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0195 0.2892 1.9027 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2823 -0.8490 2.8656 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4544 -3.2907 2.6902 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8931 -3.1705 0.9724 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.7537 -3.3386 2.1054 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0705 -0.9089 0.6635 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8181 0.1256 -1.1930 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4110 0.5879 -0.9020 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6672 2.1844 -0.2330 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9976 -1.8728 -1.6936 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7851 0.6483 2.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2485 5.1299 -1.3568 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4316 5.6042 -2.6700 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8519 3.3381 -4.9564 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1803 2.5487 -3.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1346 4.5298 -3.8359 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2543 0.6665 -2.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5508 2.6694 -0.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6985 0.8356 0.7181 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3513 2.4923 1.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2199 1.4299 -2.6568 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3826 3.0181 -0.9884 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2293 -3.3784 0.5191 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9337 -3.5171 -0.6994 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5372 -0.9795 0.9602 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1571 -0.4240 1.6744 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4237 -0.2335 2.9702 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2721 -1.0898 4.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9187 -2.2050 4.1420 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4625 -2.5290 3.2331 H 0 0 0 0 0 0 0 0 0 0 0 0 16.3069 -0.3039 2.2302 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4861 1.3053 0.2915 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2107 1.3615 0.6744 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6810 1.3706 -1.4317 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0254 -0.2116 -1.0488 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0541 1.1194 3.6728 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8400 -2.7234 1.8612 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2763 -4.9417 -0.8895 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 1 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 6 20 24 1 0 24 25 1 1 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 29 34 1 1 29 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 37 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 44 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 47 52 1 0 17 53 1 0 53 54 2 0 53 55 1 0 55 56 1 0 10 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 5 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 72 75 1 0 71 76 1 0 64 77 1 0 63 78 1 0 65 3 1 0 73 67 1 0 59 8 1 0 22 14 1 0 30 24 1 0 49 42 1 0 18 14 1 0 32 19 1 0 38 28 1 0 1 79 1 0 2 80 1 0 2 81 1 0 3 82 1 6 5 83 1 6 7 84 1 0 7 85 1 0 8 86 1 1 10 87 1 1 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 17 92 1 1 18 93 1 6 19 94 1 1 21 95 1 0 21 96 1 0 22 97 1 0 22 98 1 0 23 99 1 0 23100 1 0 23101 1 0 25102 1 0 25103 1 0 25104 1 0 26105 1 0 26106 1 0 27107 1 0 27108 1 0 28109 1 6 30110 1 6 31111 1 1 32112 1 0 32113 1 0 33114 1 0 34115 1 0 34116 1 0 34117 1 0 35118 1 0 35119 1 0 36120 1 0 36121 1 0 37122 1 1 39123 1 0 39124 1 0 39125 1 0 40126 1 0 40127 1 0 40128 1 0 42129 1 1 44130 1 1 45131 1 0 45132 1 0 46133 1 0 47134 1 6 48135 1 6 49136 1 6 50137 1 0 51138 1 0 52139 1 0 54140 1 0 54141 1 0 55142 1 0 55143 1 0 56144 1 0 57145 1 6 58146 1 1 59147 1 1 60148 1 0 61149 1 0 62150 1 0 63151 1 1 64152 1 6 65153 1 1 67154 1 1 69155 1 1 70156 1 0 70157 1 0 70158 1 0 71159 1 6 72160 1 6 73161 1 1 74162 1 0 75163 1 0 76164 1 0 77165 1 0 78166 1 0 M END

Standard InCHIKey	FKPSIWHVNUWRQS-LQGGZQDSSA-N
Standard InCHI	InChI=1S/C54H88O24/c1-21(17-55)23-8-13-54(49(70)78-48-41(68)37(64)34(61)28(75-48)20-71-45-42(69)38(65)43(27(19-57)74-45)77-46-39(66)35(62)32(59)22(2)72-46)15-14-52(6)24(31(23)54)16-25(58)44-51(5)11-10-30(50(3,4)29(51)9-12-53(44,52)7)76-47-40(67)36(63)33(60)26(18-56)73-47/h22-48,55-69H,1,8-20H2,2-7H3/t22-,23-,24+,25+,26+,27-,28-,29-,30+,31+,32-,33+,34-,35+,36-,37+,38-,39+,40+,41-,42-,43-,44+,45-,46+,47-,48+,51-,52+,53+,54-/m0/s1
SMILES	OC[C@@H]1O[C@H](OC[C@@H]2O[C@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3[C@@H](C4)O)(C)CC[C@H](C5(C)C)O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C(=C)CO)[C@H]([C@@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O[C@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1120.57	Volume:	1071.224 ? Van der Waals volume.
Dense:	1.046	LogP:	0.164 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.921 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.814 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	51.0
TPSA:	394.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	15.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.049	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.987	Fsp³:	0.944
MCE-18:	197.448 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.767	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.242	Promiscuous compounds:	0.025

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.914	MDCK Permeability:	-4.959
Pgp-inhibitor:	0.0	Pgp-substrate:	0.983
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.927
20% Bioavailability (F20%):	0.309	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.001
Plasma Protein Binding (PPB):	65.498%	Volume Distribution (VD):	-0.259
Fu:	17.559% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.003	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.739
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.858

Half-life (T1/2):

4.385

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.463	Drug-induced Liver Injury (DILI):	0.785
AMES Toxicity:	0.757	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.008	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.263	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.013	RPMI-8226 Immunitoxicity:	0.232
A549 Cytotoxicity:	0.075	Hek293 Cytotoxicity:	0.051
BCF:	1.069 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.469 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.992 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.042 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[20621475]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	steamed leaves	n.a.	n.a.	PMID[20932756]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[HerDing]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	6

Activity Type	# Activity
Others	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	Activity	=	1.5	pg/ml	PMID[11052720]
NPT2	Others	Unspecified	n.a.	Activity	=	1.55	pg/ml	PMID[20888765]
NPT2	Others	Unspecified	n.a.	Activity	=	1.92	pg/ml	DrugMatrix in vivo data: Hematology
NPT2	Others	Unspecified	n.a.	Activity	=	17.11	pg/ml	PMID[19654408]
NPT2	Others	Unspecified	n.a.	Activity	=	13.66	pg/ml	PMID[19833521]
NPT2	Others	Unspecified	n.a.	Activity	=	19.06	pg/ml	PMID[19663388]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC469821 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22567
0.1-0.2	23052
0.2-0.3	3068
0.3-0.4	972
0.4-0.5	141
0.5-0.6	45
0.6-0.7	5
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.81	Intermediate Similarity	NPC469822
0.7857	Intermediate Similarity	NPC1876
0.7624	Intermediate Similarity	NPC137414
0.729	Intermediate Similarity	NPC469820
0.6514	Remote Similarity	NPC148417
0.6429	Remote Similarity	NPC469823
0.6182	Remote Similarity	NPC287269
0.6122	Remote Similarity	NPC473844
0.6018	Remote Similarity	NPC146563
0.5893	Remote Similarity	NPC54395
0.582	Remote Similarity	NPC475160
0.582	Remote Similarity	NPC473714
0.5812	Remote Similarity	NPC295823
0.5812	Remote Similarity	NPC174720
0.5812	Remote Similarity	NPC475467
0.5738	Remote Similarity	NPC135904
0.563	Remote Similarity	NPC473826
0.5603	Remote Similarity	NPC470478
0.5556	Remote Similarity	NPC476068
0.5528	Remote Similarity	NPC165204
0.5492	Remote Similarity	NPC60557
0.5492	Remote Similarity	NPC67857
0.5476	Remote Similarity	NPC481080
0.5469	Remote Similarity	NPC258617
0.5426	Remote Similarity	NPC43550
0.5397	Remote Similarity	NPC488560
0.5385	Remote Similarity	NPC136768
0.5385	Remote Similarity	NPC469825
0.5385	Remote Similarity	NPC305981
0.5344	Remote Similarity	NPC261506
0.5344	Remote Similarity	NPC4328
0.5299	Remote Similarity	NPC101744
0.5294	Remote Similarity	NPC469826
0.5289	Remote Similarity	NPC241909
0.5271	Remote Similarity	NPC110633
0.5268	Remote Similarity	NPC48499
0.5231	Remote Similarity	NPC41061
0.5231	Remote Similarity	NPC227551
0.5224	Remote Similarity	NPC250247
0.5221	Remote Similarity	NPC11035
0.5207	Remote Similarity	NPC469827
0.5197	Remote Similarity	NPC100639
0.5167	Remote Similarity	NPC134835
0.5115	Remote Similarity	NPC475514
0.5093	Remote Similarity	NPC272242
0.5089	Remote Similarity	NPC470543
0.5085	Remote Similarity	NPC469824
0.5085	Remote Similarity	NPC104071
0.5079	Remote Similarity	NPC192600
0.5042	Remote Similarity	NPC156651
0.5042	Remote Similarity	NPC102439
0.5041	Remote Similarity	NPC601659
0.5038	Remote Similarity	NPC236638
0.5038	Remote Similarity	NPC294453

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469821 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7433
0.1-0.2	1644
0.2-0.3	67
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data