NPASS Compound

Natural Product: NPC110633

Natural Product ID	NPC110633
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Beta-D-Xylopyranosyl-(1->3)-Alpha-L-Rhamnopyranosyl-(1->2)-Alpha-L-Arabinopyranosylsiaresinolic Acid 28-O-Alpha-L-Rhamnopyranosyl-(1->4)-Beta-Dglucopyranosyl-(1->6)-Beta-D-Glucopyranosyl Ester
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,4aR,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-1-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2430033
PubChem CID	72189233
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 198208 0 0 0 0 0 0 0 0999 V2000 9.7287 0.1316 -1.2001 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9315 -0.4206 -0.7806 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6944 0.5170 0.1336 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0015 0.8404 1.2679 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9300 -0.1474 2.2348 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7471 -0.8451 2.0612 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8288 -0.6597 3.0498 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5937 -1.4619 2.7675 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9864 -1.1106 1.5544 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6867 -1.6681 1.6297 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8840 -1.1627 0.5986 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7970 -0.3716 0.9267 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5975 -0.1391 2.1432 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8853 0.1961 -0.1367 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1082 -0.9778 -0.6530 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7704 -1.1585 0.0625 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0478 0.0863 -0.3153 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6609 1.1967 0.3961 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0339 2.1017 1.1312 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4416 2.1340 1.3495 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0332 1.3364 0.2247 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4792 -0.0231 0.2338 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2340 -0.5663 1.6558 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2501 -1.0905 -0.4615 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7161 -0.8146 -0.6592 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9055 0.6201 -1.0676 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5133 1.4955 0.0680 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2001 1.3017 1.3511 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8484 2.9047 -0.4014 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3217 3.0955 -0.5317 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0888 1.9028 -1.0430 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2266 0.9139 -1.7143 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9507 -0.3957 -1.9767 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0241 1.4867 -3.1440 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8797 1.3158 -0.0745 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2232 1.4438 -0.2808 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7981 2.3059 0.7122 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3493 1.9586 1.9635 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8162 0.6031 2.3946 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5156 -0.3979 1.3313 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8978 0.1205 -0.0666 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.2929 0.2423 -0.1455 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8180 -0.6722 -1.0177 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4586 -0.0893 -2.1077 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3552 0.8879 -1.7490 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.3943 1.0066 -2.8692 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9672 0.7437 -0.4132 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.9213 -0.6330 0.1993 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8632 -1.5300 -0.3388 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.4771 -2.3773 -1.2754 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.1561 -1.2758 0.1111 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.7249 -1.4679 1.3660 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.0191 -2.8024 1.6416 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.4730 -3.4016 0.4941 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.3630 -2.5566 -0.3539 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.9731 -1.3828 0.3641 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.0564 -0.7235 1.3401 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.5740 -0.7282 2.6457 O 0 0 0 0 0 0 0 0 0 0 0 0 -17.3398 -0.4619 -0.6444 O 0 0 0 0 0 0 0 0 0 0 0 0 -17.4269 -3.3638 -0.7891 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4926 1.7373 0.4744 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2075 -0.8091 1.3098 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1159 0.2619 3.5486 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1572 1.3565 0.3566 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4474 2.6980 -0.2204 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8531 2.9573 -0.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7151 1.7135 -0.6208 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8485 0.6193 -1.2440 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8538 3.4461 -2.0746 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5389 4.0464 0.1745 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5749 3.0986 -1.2344 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0185 0.2076 -1.8016 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7405 -3.1596 1.5384 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1776 -3.6454 1.5810 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8799 -2.9456 2.7073 C 0 0 2 0 0 0 0 0 0 0 0 0 7.6216 -3.5606 3.9350 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8252 -3.4618 0.3604 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0232 -3.8329 2.5023 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1592 -0.9557 2.3830 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3292 -0.1162 1.8468 C 0 0 2 0 0 0 0 0 0 0 0 0 13.0768 -0.0134 0.3498 C 0 0 2 0 0 0 0 0 0 0 0 0 14.0800 0.8435 -0.1397 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8828 0.2123 -1.0606 C 0 0 2 0 0 0 0 0 0 0 0 0 16.2113 0.2846 -0.5854 O 0 0 0 0 0 0 0 0 0 0 0 0 16.9924 -0.6857 -1.2164 C 0 0 1 0 0 0 0 0 0 0 0 0 16.8173 -1.9596 -0.4179 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5306 -0.9558 -2.6312 C 0 0 1 0 0 0 0 0 0 0 0 0 15.9294 0.2645 -3.2944 C 0 0 2 0 0 0 0 0 0 0 0 0 14.9006 0.9275 -2.3984 C 0 0 1 0 0 0 0 0 0 0 0 0 13.6539 0.9245 -3.0042 O 0 0 0 0 0 0 0 0 0 0 0 0 15.3522 -0.1467 -4.4907 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6380 -1.3669 -3.3698 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5477 -0.7214 2.1333 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4770 -1.1901 3.7341 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0799 -0.6423 -1.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8154 -1.4243 -0.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5364 -0.5800 -1.7063 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8156 1.4768 -0.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7914 0.4135 3.2099 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2284 -1.0755 4.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4967 0.3913 3.1782 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8138 -1.2360 3.5432 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2542 -1.3961 2.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0225 -0.9324 -1.7426 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6549 -1.9481 -0.4597 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3052 -2.0764 -0.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0324 -1.1489 1.1493 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5751 2.9176 1.6481 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5649 1.6832 2.3599 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8179 3.1666 1.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6243 1.8622 -0.7040 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1534 -0.6592 2.2396 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3979 -0.0853 2.1572 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9110 -1.6367 1.4732 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7873 -1.2618 -1.4596 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2022 -2.0825 0.0431 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3604 -1.1490 0.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0298 -1.4378 -1.5338 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1594 0.7708 -1.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7411 0.3501 1.4838 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4655 1.3322 2.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8974 2.1504 1.6325 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2539 3.1896 -1.2735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5175 3.5893 0.4313 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8102 3.4904 0.4082 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4608 3.9472 -1.2513 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8318 2.3000 -1.7997 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9914 -1.0698 -1.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9629 -0.1444 -2.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4296 -0.8582 -2.8677 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2417 0.8632 -3.6315 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9679 1.4894 -3.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6469 2.5171 -3.1072 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4970 1.9566 -1.2197 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2586 2.0190 1.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7815 2.6995 2.6713 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9171 0.6114 2.5478 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1460 -1.3248 1.4512 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5663 -0.6831 -0.7472 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0209 -1.3189 -1.4588 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7905 1.8613 -1.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9334 1.5007 -3.7649 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7850 0.0429 -3.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1686 1.7068 -2.4975 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0674 0.9926 -0.5238 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7085 -0.4607 1.2869 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4184 -2.1918 0.4310 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1007 -3.2828 -1.2567 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0320 -1.0394 2.1187 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5631 -3.7296 -0.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.9531 -4.3721 0.8000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.8534 -2.2288 -1.2967 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.8868 -1.7244 0.9248 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.9309 0.3519 1.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.2021 0.0354 2.7585 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.1218 0.4586 -0.3326 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.9208 -2.8405 -1.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6122 1.4033 1.4198 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1267 -1.7681 1.1881 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5001 0.7434 4.3326 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4154 1.4568 1.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2464 3.4645 0.6011 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6375 1.8489 -1.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9821 1.4045 0.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4817 -0.2631 -1.5085 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3288 0.9431 -2.1447 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9583 2.9725 -2.5733 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7601 4.5295 -2.1686 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7226 3.0310 -2.6346 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3256 4.5144 -0.4751 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0330 3.6512 1.0767 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8138 4.8466 0.3813 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3731 4.0696 -1.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0294 -0.7971 -2.3169 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8392 0.7866 -2.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9163 0.6757 -2.1887 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3466 -3.5063 0.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1530 -4.7276 1.7891 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9797 -3.0531 2.5449 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0591 -4.4376 3.9912 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4942 -4.0558 -0.3357 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0995 -4.8230 2.3240 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1997 -1.9145 1.8762 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2437 0.8990 2.2599 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2288 -1.0019 -0.1626 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6014 -0.8394 -1.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 18.0437 -0.3343 -1.1822 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5704 -2.7261 -0.7126 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7799 -2.3224 -0.5269 H 0 0 0 0 0 0 0 0 0 0 0 0 16.9296 -1.6717 0.6641 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7956 -1.7810 -2.6699 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7694 0.9471 -3.5518 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2132 1.9953 -2.2887 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4722 1.7641 -3.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6347 0.3812 -5.2602 H 0 0 0 0 0 0 0 0 0 0 0 0 18.2227 -1.9855 -2.8615 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0692 -0.0606 2.6899 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1843 -0.4399 4.3124 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 1 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 31 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 47 61 1 0 40 62 1 0 39 63 1 0 18 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 66 70 1 0 65 71 1 0 17 72 1 6 10 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 73 78 1 0 5 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 85 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 88 91 1 0 87 92 1 0 80 93 1 0 79 94 1 0 81 3 1 0 89 83 1 0 75 8 1 0 68 14 1 0 64 14 1 0 22 17 1 0 32 26 1 0 41 36 1 0 49 43 1 0 57 52 1 0 27 21 1 0 1 95 1 0 2 96 1 0 2 97 1 0 3 98 1 6 5 99 1 1 7100 1 0 7101 1 0 8102 1 1 10103 1 1 15104 1 0 15105 1 0 16106 1 0 16107 1 0 19108 1 0 20109 1 0 20110 1 0 21111 1 6 23112 1 0 23113 1 0 23114 1 0 24115 1 0 24116 1 0 25117 1 0 25118 1 0 26119 1 6 28120 1 0 28121 1 0 28122 1 0 29123 1 0 29124 1 0 30125 1 0 30126 1 0 31127 1 6 33128 1 0 33129 1 0 33130 1 0 34131 1 0 34132 1 0 34133 1 0 36134 1 6 38135 1 0 38136 1 0 39137 1 1 40138 1 1 41139 1 6 43140 1 6 45141 1 1 46142 1 0 46143 1 0 46144 1 0 47145 1 6 48146 1 1 49147 1 1 50148 1 0 52149 1 1 54150 1 0 54151 1 0 55152 1 6 56153 1 1 57154 1 6 58155 1 0 59156 1 0 60157 1 0 61158 1 0 62159 1 0 63160 1 0 64161 1 1 65162 1 1 67163 1 0 67164 1 0 68165 1 0 68166 1 0 69167 1 0 69168 1 0 69169 1 0 70170 1 0 70171 1 0 70172 1 0 71173 1 0 72174 1 0 72175 1 0 72176 1 0 73177 1 6 74178 1 1 75179 1 6 76180 1 0 77181 1 0 78182 1 0 79183 1 6 80184 1 1 81185 1 6 83186 1 6 85187 1 6 86188 1 0 86189 1 0 86190 1 0 87191 1 1 88192 1 6 89193 1 1 90194 1 0 91195 1 0 92196 1 0 93197 1 0 94198 1 0 M END

Standard InCHIKey	ANZUJNAJUBXIKU-WFXPECHOSA-N
Standard InCHI	InChI=1S/C64H104O30/c1-24-35(68)40(73)44(77)54(86-24)91-48-29(20-65)88-52(46(79)42(48)75)85-23-30-39(72)41(74)45(78)55(89-30)94-58(82)64-18-16-59(3,4)51(81)34(64)26-10-11-32-61(7)14-13-33(60(5,6)31(61)12-15-63(32,9)62(26,8)17-19-64)90-57-50(38(71)28(67)22-84-57)93-56-47(80)49(36(69)25(2)87-56)92-53-43(76)37(70)27(66)21-83-53/h10,24-25,27-57,65-81H,11-23H2,1-9H3/t24-,25-,27+,28-,29+,30+,31-,32+,33-,34+,35-,36-,37-,38-,39+,40+,41-,42+,43+,44+,45+,46+,47+,48+,49+,50+,51-,52+,53-,54-,55-,56-,57-,61-,62+,63+,64-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H](C5(C)C)O[C@@H]5OC[C@@H]([C@@H]([C@H]5O[C@@H]5O[C@@H](C)[C@@H]([C@H]([C@H]5O)O[C@@H]5OC[C@H]([C@@H]([C@H]5O)O)O)O)O)O)[C@@H]4[C@@H](C(CC3)(C)C)O)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1352.66	Volume:	1279.812 ? Van der Waals volume.
Dense:	1.057	LogP:	0.833 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.549 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.27 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	63.0
TPSA:	471.74 ? Topological Polar Surface Area.	H-Bond Acceptor:	30.0
H-Bond Donor:	17.0	Rings:	11.0
Heavy Atoms:	30.0

MedChem Properties

QED Drug-Likeness Score:	0.045	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.701	Fsp³:	0.953
MCE-18:	240.8 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.708	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.023 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.377	Promiscuous compounds:	0.047

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.054	MDCK Permeability:	-4.864
Pgp-inhibitor:	0.0	Pgp-substrate:	0.98
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.947	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.002
Plasma Protein Binding (PPB):	49.778%	Volume Distribution (VD):	-0.275
Fu:	21.041% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.149
HLM stability:	0.051 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.19

Half-life (T1/2):

4.804

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.528	Drug-induced Liver Injury (DILI):	0.968
AMES Toxicity:	0.968	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.589	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.094	RPMI-8226 Immunitoxicity:	0.609
A549 Cytotoxicity:	0.83	Hek293 Cytotoxicity:	0.235
BCF:	1.048 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.447 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.985 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.91 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32682	anemone taipaiensis	Species	Ranunculaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[23992864]
NPO32682	anemone taipaiensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	4
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	80000.0	nM	PMID[18676884]
NPT81	Cell line	A549	Homo sapiens	IC50	>	80000.0	nM	DrugMatrix in vivo data: Pathology
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	80000.0	nM	PMID[18077363]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	80000.0	nM	DOI[10.6019/CHEMBL1201861]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	34780.0	nM	PMID[23992864]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC110633 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25729
0.1-0.2	20491
0.2-0.3	2380
0.3-0.4	707
0.4-0.5	354
0.5-0.6	114
0.6-0.7	38
0.7-0.8	0
0.8-0.85	8
0.85-0.9	2
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9196	High Similarity	NPC136768
0.8696	High Similarity	NPC236638
0.8696	High Similarity	NPC294453
0.8376	Intermediate Similarity	NPC305981
0.8305	Intermediate Similarity	NPC261506
0.8305	Intermediate Similarity	NPC4328
0.8205	Intermediate Similarity	NPC41061
0.8205	Intermediate Similarity	NPC227551
0.8099	Intermediate Similarity	NPC250247
0.8067	Intermediate Similarity	NPC202828
0.8067	Intermediate Similarity	NPC119592
0.7739	Intermediate Similarity	NPC60557
0.7739	Intermediate Similarity	NPC67857
0.7727	Intermediate Similarity	NPC148417
0.7705	Intermediate Similarity	NPC298034
0.7705	Intermediate Similarity	NPC71065
0.7692	Intermediate Similarity	NPC135904
0.7692	Intermediate Similarity	NPC123199
0.7686	Intermediate Similarity	NPC43550
0.7647	Intermediate Similarity	NPC481080
0.7607	Intermediate Similarity	NPC165204
0.7581	Intermediate Similarity	NPC220160
0.7521	Intermediate Similarity	NPC79643
0.7273	Intermediate Similarity	NPC488560
0.7241	Intermediate Similarity	NPC295823
0.7241	Intermediate Similarity	NPC174720
0.7241	Intermediate Similarity	NPC475467
0.72	Intermediate Similarity	NPC481081
0.7179	Intermediate Similarity	NPC481078
0.7143	Intermediate Similarity	NPC475287
0.7143	Intermediate Similarity	NPC76972
0.7143	Intermediate Similarity	NPC469782
0.7143	Intermediate Similarity	NPC204414
0.712	Intermediate Similarity	NPC65105
0.6984	Remote Similarity	NPC161717
0.6911	Remote Similarity	NPC475160
0.6911	Remote Similarity	NPC473714
0.688	Remote Similarity	NPC476068
0.6853	Remote Similarity	NPC469776
0.6828	Remote Similarity	NPC32723
0.6781	Remote Similarity	NPC481323
0.6781	Remote Similarity	NPC469778
0.6719	Remote Similarity	NPC293330
0.6689	Remote Similarity	NPC135334
0.6667	Remote Similarity	NPC63159
0.6667	Remote Similarity	NPC241909
0.6609	Remote Similarity	NPC161674
0.6606	Remote Similarity	NPC128925
0.6533	Remote Similarity	NPC481324
0.6515	Remote Similarity	NPC224381
0.6512	Remote Similarity	NPC258617
0.6484	Remote Similarity	NPC57484
0.6471	Remote Similarity	NPC295941
0.641	Remote Similarity	NPC112352
0.6395	Remote Similarity	NPC469775
0.6376	Remote Similarity	NPC469774
0.6356	Remote Similarity	NPC160415
0.6316	Remote Similarity	NPC70809
0.6299	Remote Similarity	NPC251263
0.6299	Remote Similarity	NPC155410
0.625	Remote Similarity	NPC100639
0.625	Remote Similarity	NPC100925
0.6179	Remote Similarity	NPC481079
0.6172	Remote Similarity	NPC219180
0.6169	Remote Similarity	NPC469777
0.6136	Remote Similarity	NPC475514
0.6094	Remote Similarity	NPC471384
0.6087	Remote Similarity	NPC480422
0.6051	Remote Similarity	NPC469772
0.6033	Remote Similarity	NPC101744
0.6018	Remote Similarity	NPC256798
0.6016	Remote Similarity	NPC192600
0.5975	Remote Similarity	NPC469773
0.597	Remote Similarity	NPC471385
0.5954	Remote Similarity	NPC54636
0.595	Remote Similarity	NPC104071
0.5935	Remote Similarity	NPC475504
0.5923	Remote Similarity	NPC475209
0.5902	Remote Similarity	NPC102439
0.5846	Remote Similarity	NPC133818
0.5827	Remote Similarity	NPC102505
0.5827	Remote Similarity	NPC473826
0.5827	Remote Similarity	NPC488514
0.5802	Remote Similarity	NPC166422
0.5785	Remote Similarity	NPC469946
0.5772	Remote Similarity	NPC480475
0.5763	Remote Similarity	NPC48499
0.576	Remote Similarity	NPC134835
0.5704	Remote Similarity	NPC13998
0.5704	Remote Similarity	NPC286457
0.568	Remote Similarity	NPC481082
0.568	Remote Similarity	NPC164419
0.5669	Remote Similarity	NPC324875
0.5669	Remote Similarity	NPC292677
0.5652	Remote Similarity	NPC309223
0.5645	Remote Similarity	NPC46665
0.5608	Remote Similarity	NPC472268
0.56	Remote Similarity	NPC68175
0.5591	Remote Similarity	NPC73318
0.5574	Remote Similarity	NPC295371
0.5556	Remote Similarity	NPC297263
0.5546	Remote Similarity	NPC78046
0.5541	Remote Similarity	NPC297950
0.554	Remote Similarity	NPC302543
0.5522	Remote Similarity	NPC470218
0.5522	Remote Similarity	NPC471550
0.552	Remote Similarity	NPC173859
0.552	Remote Similarity	NPC148603
0.5489	Remote Similarity	NPC470911
0.5462	Remote Similarity	NPC204458
0.5462	Remote Similarity	NPC90856
0.5462	Remote Similarity	NPC475486
0.5462	Remote Similarity	NPC31838
0.5462	Remote Similarity	NPC36831
0.5462	Remote Similarity	NPC187290
0.5448	Remote Similarity	NPC309907
0.5441	Remote Similarity	NPC85154
0.5435	Remote Similarity	NPC470876
0.543	Remote Similarity	NPC45606
0.5426	Remote Similarity	NPC301449
0.5426	Remote Similarity	NPC601290
0.5417	Remote Similarity	NPC8524
0.5414	Remote Similarity	NPC123522
0.5391	Remote Similarity	NPC601659
0.5379	Remote Similarity	NPC33012
0.5373	Remote Similarity	NPC323341
0.5355	Remote Similarity	NPC478559
0.5355	Remote Similarity	NPC478560
0.535	Remote Similarity	NPC472269
0.5344	Remote Similarity	NPC104137
0.5344	Remote Similarity	NPC26626
0.5338	Remote Similarity	NPC268184
0.5338	Remote Similarity	NPC489208
0.5294	Remote Similarity	NPC220838
0.5294	Remote Similarity	NPC191827
0.529	Remote Similarity	NPC21691
0.5285	Remote Similarity	NPC475516
0.5276	Remote Similarity	NPC164389
0.5276	Remote Similarity	NPC488526
0.5276	Remote Similarity	NPC232237
0.5271	Remote Similarity	NPC469821
0.5267	Remote Similarity	NPC480473
0.5267	Remote Similarity	NPC480474
0.5252	Remote Similarity	NPC473452
0.5252	Remote Similarity	NPC480418
0.5242	Remote Similarity	NPC58448
0.5238	Remote Similarity	NPC223301
0.5238	Remote Similarity	NPC171544
0.5234	Remote Similarity	NPC105800
0.5231	Remote Similarity	NPC104372
0.5231	Remote Similarity	NPC276093
0.5227	Remote Similarity	NPC207738
0.5221	Remote Similarity	NPC480419
0.5217	Remote Similarity	NPC4749
0.52	Remote Similarity	NPC470512
0.5197	Remote Similarity	NPC309714
0.5188	Remote Similarity	NPC470915
0.5182	Remote Similarity	NPC283417
0.5182	Remote Similarity	NPC200049
0.5172	Remote Similarity	NPC480417
0.5159	Remote Similarity	NPC263756
0.5159	Remote Similarity	NPC213674
0.5156	Remote Similarity	NPC104400
0.5156	Remote Similarity	NPC10320
0.5156	Remote Similarity	NPC473459
0.5154	Remote Similarity	NPC484832
0.5149	Remote Similarity	NPC185466
0.5137	Remote Similarity	NPC489209
0.512	Remote Similarity	NPC473373
0.5115	Remote Similarity	NPC37134
0.5115	Remote Similarity	NPC114484
0.5111	Remote Similarity	NPC473824
0.5088	Remote Similarity	NPC191763
0.5078	Remote Similarity	NPC30735
0.5077	Remote Similarity	NPC222580
0.5068	Remote Similarity	NPC477464
0.5067	Remote Similarity	NPC475368
0.504	Remote Similarity	NPC235405
0.504	Remote Similarity	NPC56713
0.5039	Remote Similarity	NPC10607
0.5039	Remote Similarity	NPC251768
0.5038	Remote Similarity	NPC80986
0.5038	Remote Similarity	NPC488515
0.5037	Remote Similarity	NPC114287
0.5037	Remote Similarity	NPC475119
0.503	Remote Similarity	NPC488203

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC110633 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7887
0.1-0.2	1208
0.2-0.3	50
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data