NPASS Compound

Natural Product: NPC475504

Natural Product ID	NPC475504
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Methyl (4As,6Ar,6As,6Br,8Ar,9R,10S,12Ar,14Bs)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6S)-3,5-Dihydroxy-6-Methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl]Oxyoxan-2-Yl]Oxy-4,5-Dihydroxyoxan-2-Yl]Oxy-9-(Hydroxymethyl)-2,2,6A,6B,9,12A-Hexamethyl-1,3,4,5,6,6A,7,8,8A,10,11,12,13,14B-Tetradecahydropicene-4A-Carboxylate
IUPAC Name	methyl (4aS,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL506919
PubChem CID	10677276
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 8.5341 4.0981 -0.0741 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5473 3.0278 0.4310 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0676 1.7104 -0.1185 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8978 0.7050 -0.2067 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9009 1.2504 0.7935 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2951 2.4594 0.1845 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3359 3.3761 -0.0701 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3002 3.0744 0.9213 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1483 3.3393 0.2068 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1170 4.8624 -0.1291 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8931 5.0523 -1.0436 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7156 4.7026 -0.1565 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1436 4.1632 1.0562 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8729 2.9624 0.7831 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0640 2.0136 0.2487 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6887 0.9631 1.0442 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7663 1.3143 1.4384 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4774 0.1728 2.0528 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6421 -1.0253 1.1149 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5518 -1.0449 0.0979 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7529 -0.3997 0.5032 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4395 -1.2564 1.6044 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7280 -0.6211 -0.6214 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 0.0808 -1.7557 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9440 -0.5376 -1.2340 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3560 -0.5416 -1.6333 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3254 -1.3619 -0.8103 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0287 -0.9730 0.6073 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0401 -1.6366 1.5102 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3288 -0.9679 1.1688 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5993 -0.6475 -0.0542 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7076 -0.8968 -1.1950 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4392 -1.9516 -2.0315 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8497 -1.5982 -2.3168 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6355 -0.9135 -1.2860 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8737 0.0164 -0.3808 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7705 0.2756 0.8074 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8883 1.1561 0.3048 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5330 0.7019 -0.9489 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7296 -0.0789 -1.9134 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9366 1.2280 1.3922 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3297 2.5674 0.1445 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3304 -1.9010 -0.4068 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5827 -1.9519 -0.2760 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6018 -2.8321 0.3243 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2885 -3.7760 1.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7075 0.2994 -2.1480 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1481 -2.8411 -1.0952 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4817 -2.2494 2.0297 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9327 4.1277 -2.0829 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8731 5.6074 0.9994 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9835 0.2896 1.1937 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3951 -0.5268 0.0999 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3229 -1.5180 -0.8081 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6516 -2.1250 -1.2088 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4387 -2.6737 -0.0514 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5416 -3.7322 0.6128 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2247 -3.0554 0.9020 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6013 -2.5888 -0.2565 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3070 -4.0379 1.5578 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8887 -4.5205 2.7191 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3503 -4.7630 -0.3274 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7828 -1.7644 0.9104 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4094 -1.2993 -2.0344 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0111 1.2267 0.7702 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5742 3.7709 0.0406 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2888 4.3937 -1.1072 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3768 5.0350 0.5391 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6594 3.0841 1.5373 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5390 1.9052 -1.0756 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4632 0.8380 -1.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4923 1.4726 1.7186 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8849 2.2908 -0.8406 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2821 2.9101 -0.8124 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9807 5.1571 -0.7354 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8486 6.0473 -1.4781 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0479 4.0366 -0.7296 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1576 5.6282 0.0387 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0541 2.5969 1.8458 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2228 1.1062 2.0309 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7707 2.1161 2.2303 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3166 1.7662 0.5890 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4993 0.5871 2.3216 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0680 -0.0945 3.0406 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2462 -2.1323 -0.0159 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4543 -0.7524 1.6825 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6698 -2.2617 1.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9899 -1.1471 2.5769 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6247 -1.7188 -0.8819 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7969 -0.5497 -0.2664 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4121 0.5149 -2.1027 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3551 -1.1182 -2.0093 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5852 0.5352 -1.3350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4119 -0.8116 -2.7162 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7508 0.5045 -1.5803 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3238 0.1333 0.6344 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7487 -1.4709 2.5749 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2023 -2.7074 1.3235 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9831 -0.7883 2.0248 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9172 -1.9790 -3.0054 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3706 -2.9635 -1.5929 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3811 -2.5860 -2.5140 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9958 -1.0710 -3.3055 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7145 1.0263 -0.8471 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1739 0.8631 1.5320 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1275 -0.6465 1.2933 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8744 1.6412 -1.4801 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5017 0.1712 -0.7183 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3676 -0.7574 -2.5143 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2203 0.5976 -2.6561 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5827 1.7758 2.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8157 1.8293 1.0162 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3282 0.2331 1.6166 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0397 2.7626 -0.9080 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1444 3.2683 0.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4744 2.7203 0.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0320 -3.1651 1.7504 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8951 -4.4788 0.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6332 -4.2462 1.8953 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5512 1.2648 -1.6611 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7790 0.3499 -2.5377 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1355 0.0566 -3.0280 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7744 -3.4947 -0.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0675 -3.0603 -1.0706 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4445 -3.0907 -2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3276 -2.9275 2.0104 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5934 -2.8446 1.7368 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3242 -1.9718 3.0917 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7271 4.5601 -2.9708 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3702 6.4300 0.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4966 0.5699 2.0039 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8203 -1.2751 -1.7694 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3852 -3.0128 -1.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3305 -3.1890 -0.5038 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9866 -4.0720 1.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3871 -2.1651 1.5452 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3232 -3.5855 1.8250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1812 -4.9142 0.8568 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6018 -5.1839 2.5366 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9494 -5.5191 -0.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7665 -1.7221 1.1080 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8840 -0.7008 -2.5882 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9514 1.4103 0.4765 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 20 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 38 42 1 0 35 43 1 0 43 44 2 0 43 45 1 0 45 46 1 0 32 47 1 0 27 48 1 0 19 49 1 0 11 50 1 0 10 51 1 0 5 52 1 0 4 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 57 62 1 0 56 63 1 0 55 64 1 0 3 65 1 0 7 2 1 0 14 9 1 0 21 16 1 0 28 19 1 0 32 27 1 0 36 31 1 0 40 35 1 0 59 54 1 0 1 66 1 0 1 67 1 0 1 68 1 0 2 69 1 0 3 70 1 0 4 71 1 0 5 72 1 0 6 73 1 0 9 74 1 0 10 75 1 0 11 76 1 0 12 77 1 0 12 78 1 0 14 79 1 0 16 80 1 0 17 81 1 0 17 82 1 0 18 83 1 0 18 84 1 0 20 85 1 0 22 86 1 0 22 87 1 0 22 88 1 0 23 89 1 0 23 90 1 0 24 91 1 0 25 92 1 0 25 93 1 0 26 94 1 0 26 95 1 0 28 96 1 0 29 97 1 0 29 98 1 0 30 99 1 0 33100 1 0 33101 1 0 34102 1 0 34103 1 0 36104 1 0 37105 1 0 37106 1 0 39107 1 0 39108 1 0 40109 1 0 40110 1 0 41111 1 0 41112 1 0 41113 1 0 42114 1 0 42115 1 0 42116 1 0 46117 1 0 46118 1 0 46119 1 0 47120 1 0 47121 1 0 47122 1 0 48123 1 0 48124 1 0 48125 1 0 49126 1 0 49127 1 0 49128 1 0 50129 1 0 51130 1 0 52131 1 0 54132 1 0 55133 1 0 56134 1 0 57135 1 0 58136 1 0 60137 1 0 60138 1 0 61139 1 0 62140 1 0 63141 1 0 64142 1 0 65143 1 0 M END

Standard InCHIKey	BUTMKVMHHNGNTO-HAOFKQSVSA-N
Standard InCHI	InChI=1S/C48H78O17/c1-23-31(52)37(64-39-35(56)34(55)33(54)27(20-49)62-39)36(57)40(61-23)65-38-32(53)26(51)21-60-41(38)63-30-12-13-44(4)28(45(30,5)22-50)11-14-47(7)29(44)10-9-24-25-19-43(2,3)15-17-48(25,42(58)59-8)18-16-46(24,47)6/h9,23,25-41,49-57H,10-22H2,1-8H3/t23-,25-,26-,27+,28+,29+,30-,31-,32-,33+,34-,35+,36+,37+,38+,39-,40-,41-,44-,45-,46+,47+,48-/m0/s1
SMILES	CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C(C3(C)CO)CCC5(C4CC=C6C5(CCC7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	926.52	Volume:	914.473 ? Van der Waals volume.
Dense:	1.013	LogP:	1.235 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.351 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.451 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	45.0
TPSA:	263.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.312	Fsp³:	0.938
MCE-18:	170.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.245	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.059 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.13	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.681	MDCK Permeability:	-5.087
Pgp-inhibitor:	0.0	Pgp-substrate:	0.925
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.918
20% Bioavailability (F20%):	0.158	30% Bioavailability (F30%):	0.976
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.054	MRP1:	1.0
Plasma Protein Binding (PPB):	60.851%	Volume Distribution (VD):	-0.45
Fu:	25.882% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.303	BCRP inhibitor:	0.001
BSEP inhibitor:	0.04

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.994	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.211	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.048

Half-life (T1/2):

3.368

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.253
Human Hepatotoxicity (H-HT):	0.386	Drug-induced Liver Injury (DILI):	0.077
AMES Toxicity:	0.198	Rat Oral Acute Toxicity:	0.088
Maximum Recommended Daily Dose:	0.251	Skin Sensitization:	0.05
Carcinogencity:	0.027	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.225	Ototoxicity:	1.0
Hematotoxicity:	0.015	Drug-induced Nephrotoxicity:	0.016
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.05
A549 Cytotoxicity:	0.031	Hek293 Cytotoxicity:	0.621
BCF:	1.353 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.385 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.388 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.986 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	roots	n.a.	n.a.	PMID[10514313]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	root	n.a.	PMID[10514313]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	roots	n.a.	n.a.	PMID[11575962]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO1373	Pulsatilla chinensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	8.0	ug.mL-1	PMID[10560729]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475504 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21692
0.1-0.2	23609
0.2-0.3	3135
0.3-0.4	839
0.4-0.5	310
0.5-0.6	118
0.6-0.7	62
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8431	Intermediate Similarity	NPC475287
0.8137	Intermediate Similarity	NPC481078
0.8	Intermediate Similarity	NPC293330
0.8	Intermediate Similarity	NPC79643
0.7857	Intermediate Similarity	NPC298034
0.7857	Intermediate Similarity	NPC71065
0.7685	Intermediate Similarity	NPC123199
0.76	Intermediate Similarity	NPC112352
0.7456	Intermediate Similarity	NPC202828
0.7456	Intermediate Similarity	NPC119592
0.7434	Intermediate Similarity	NPC41061
0.7434	Intermediate Similarity	NPC227551
0.7333	Intermediate Similarity	NPC276093
0.7304	Intermediate Similarity	NPC305981
0.7241	Intermediate Similarity	NPC261506
0.7241	Intermediate Similarity	NPC4328
0.7217	Intermediate Similarity	NPC65105
0.7143	Intermediate Similarity	NPC471550
0.7048	Intermediate Similarity	NPC63159
0.6937	Remote Similarity	NPC76972
0.6937	Remote Similarity	NPC469782
0.6937	Remote Similarity	NPC204414
0.6864	Remote Similarity	NPC236638
0.6864	Remote Similarity	NPC294453
0.6857	Remote Similarity	NPC309714
0.6814	Remote Similarity	NPC133818
0.6796	Remote Similarity	NPC150400
0.6789	Remote Similarity	NPC324875
0.6789	Remote Similarity	NPC292677
0.6762	Remote Similarity	NPC223301
0.6762	Remote Similarity	NPC171544
0.6723	Remote Similarity	NPC481081
0.6639	Remote Similarity	NPC43550
0.6639	Remote Similarity	NPC250247
0.6609	Remote Similarity	NPC135904
0.6571	Remote Similarity	NPC295371
0.6514	Remote Similarity	NPC297263
0.6509	Remote Similarity	NPC469946
0.6481	Remote Similarity	NPC480475
0.6455	Remote Similarity	NPC486563
0.6441	Remote Similarity	NPC481080
0.6429	Remote Similarity	NPC187618
0.6387	Remote Similarity	NPC57484
0.6381	Remote Similarity	NPC475516
0.6381	Remote Similarity	NPC59804
0.6379	Remote Similarity	NPC323341
0.6372	Remote Similarity	NPC475486
0.6348	Remote Similarity	NPC60557
0.6348	Remote Similarity	NPC67857
0.6339	Remote Similarity	NPC486564
0.6339	Remote Similarity	NPC481079
0.633	Remote Similarity	NPC46665
0.6325	Remote Similarity	NPC219180
0.6325	Remote Similarity	NPC251263
0.629	Remote Similarity	NPC220160
0.6271	Remote Similarity	NPC100639
0.625	Remote Similarity	NPC104372
0.6239	Remote Similarity	NPC160415
0.6187	Remote Similarity	NPC469775
0.6182	Remote Similarity	NPC10607
0.6182	Remote Similarity	NPC164389
0.6181	Remote Similarity	NPC469777
0.617	Remote Similarity	NPC469774
0.6168	Remote Similarity	NPC473373
0.6154	Remote Similarity	NPC214484
0.6134	Remote Similarity	NPC191827
0.6075	Remote Similarity	NPC174679
0.6075	Remote Similarity	NPC279554
0.6071	Remote Similarity	NPC222580
0.6068	Remote Similarity	NPC313110
0.6054	Remote Similarity	NPC469772
0.6053	Remote Similarity	NPC301449
0.6053	Remote Similarity	NPC601290
0.605	Remote Similarity	NPC155410
0.6042	Remote Similarity	NPC100925
0.6038	Remote Similarity	NPC48499
0.6036	Remote Similarity	NPC251768
0.6036	Remote Similarity	NPC473459
0.6	Remote Similarity	NPC192791
0.6	Remote Similarity	NPC241909
0.6	Remote Similarity	NPC480474
0.5982	Remote Similarity	NPC162574
0.5973	Remote Similarity	NPC469773
0.5968	Remote Similarity	NPC471385
0.5965	Remote Similarity	NPC114484
0.5963	Remote Similarity	NPC473884
0.5952	Remote Similarity	NPC70809
0.5948	Remote Similarity	NPC31838
0.5946	Remote Similarity	NPC30735
0.5935	Remote Similarity	NPC473452
0.5935	Remote Similarity	NPC110633
0.5929	Remote Similarity	NPC481082
0.5929	Remote Similarity	NPC164419
0.5917	Remote Similarity	NPC166422
0.5913	Remote Similarity	NPC218954
0.5897	Remote Similarity	NPC75287
0.5893	Remote Similarity	NPC159309
0.5893	Remote Similarity	NPC86222
0.5872	Remote Similarity	NPC249848
0.5872	Remote Similarity	NPC127056
0.5872	Remote Similarity	NPC107966
0.5862	Remote Similarity	NPC480473
0.5854	Remote Similarity	NPC476068
0.5854	Remote Similarity	NPC21691
0.5842	Remote Similarity	NPC237503
0.5841	Remote Similarity	NPC475591
0.5841	Remote Similarity	NPC236870
0.5833	Remote Similarity	NPC475899
0.5812	Remote Similarity	NPC187290
0.58	Remote Similarity	NPC167383
0.5793	Remote Similarity	NPC469778
0.578	Remote Similarity	NPC139894
0.5766	Remote Similarity	NPC263756
0.5766	Remote Similarity	NPC213674
0.575	Remote Similarity	NPC192600
0.5738	Remote Similarity	NPC475160
0.5738	Remote Similarity	NPC473714
0.5734	Remote Similarity	NPC469776
0.5726	Remote Similarity	NPC80986
0.5724	Remote Similarity	NPC32723
0.5702	Remote Similarity	NPC471384
0.5702	Remote Similarity	NPC139044
0.5702	Remote Similarity	NPC91838
0.5701	Remote Similarity	NPC162354
0.5701	Remote Similarity	NPC90856
0.5685	Remote Similarity	NPC481323
0.5676	Remote Similarity	NPC39211
0.5669	Remote Similarity	NPC136768
0.5659	Remote Similarity	NPC224381
0.5652	Remote Similarity	NPC609763
0.5648	Remote Similarity	NPC270667
0.5648	Remote Similarity	NPC29069
0.5645	Remote Similarity	NPC4749
0.5645	Remote Similarity	NPC85154
0.5636	Remote Similarity	NPC235405
0.5629	Remote Similarity	NPC295941
0.5625	Remote Similarity	NPC473343
0.561	Remote Similarity	NPC470218
0.5608	Remote Similarity	NPC135334
0.5606	Remote Similarity	NPC480422
0.5596	Remote Similarity	NPC473127
0.5596	Remote Similarity	NPC110656
0.5591	Remote Similarity	NPC161717
0.557	Remote Similarity	NPC481324
0.5566	Remote Similarity	NPC256798
0.5565	Remote Similarity	NPC54636
0.5565	Remote Similarity	NPC488560
0.5556	Remote Similarity	NPC189884
0.5556	Remote Similarity	NPC138334
0.5546	Remote Similarity	NPC104137
0.5546	Remote Similarity	NPC26626
0.5514	Remote Similarity	NPC209894
0.5512	Remote Similarity	NPC258617
0.5504	Remote Similarity	NPC302543
0.5495	Remote Similarity	NPC56713
0.5487	Remote Similarity	NPC80843
0.5484	Remote Similarity	NPC283417
0.5484	Remote Similarity	NPC200049
0.5478	Remote Similarity	NPC488526
0.5462	Remote Similarity	NPC295823
0.5462	Remote Similarity	NPC174720
0.5462	Remote Similarity	NPC475467
0.5462	Remote Similarity	NPC69811
0.5455	Remote Similarity	NPC68767
0.5448	Remote Similarity	NPC477464
0.5447	Remote Similarity	NPC165204
0.5441	Remote Similarity	NPC475368
0.5433	Remote Similarity	NPC286457
0.5431	Remote Similarity	NPC235438
0.5424	Remote Similarity	NPC114692
0.542	Remote Similarity	NPC142151
0.5414	Remote Similarity	NPC51099
0.5405	Remote Similarity	NPC12288
0.5398	Remote Similarity	NPC157868
0.5391	Remote Similarity	NPC114304
0.5385	Remote Similarity	NPC144644
0.5385	Remote Similarity	NPC131469
0.5385	Remote Similarity	NPC170407
0.5372	Remote Similarity	NPC815
0.5364	Remote Similarity	NPC1046
0.5345	Remote Similarity	NPC40775
0.5345	Remote Similarity	NPC180550
0.5345	Remote Similarity	NPC35405
0.5339	Remote Similarity	NPC95437
0.5338	Remote Similarity	NPC293031
0.5333	Remote Similarity	NPC96641
0.5333	Remote Similarity	NPC120116
0.5333	Remote Similarity	NPC163183
0.5315	Remote Similarity	NPC475208
0.5308	Remote Similarity	NPC135849
0.5304	Remote Similarity	NPC242840
0.5303	Remote Similarity	NPC267694
0.5299	Remote Similarity	NPC153673
0.5299	Remote Similarity	NPC118440
0.5294	Remote Similarity	NPC236657
0.5294	Remote Similarity	NPC281148
0.5294	Remote Similarity	NPC275225
0.5289	Remote Similarity	NPC36831
0.5285	Remote Similarity	NPC610204

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475504 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7279
0.1-0.2	1810
0.2-0.3	55
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data