NPASS Compound

Natural Product: NPC486564

Natural Product ID	NPC486564
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LFQCBDCJZYWDID-DAXGGDPVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44576014
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 151158 0 0 0 0 0 0 0 0999 V2000 10.1870 4.8850 1.5668 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5309 3.8844 0.6311 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5218 3.0717 -0.1490 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0479 1.8628 0.5309 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2937 1.5953 1.8137 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8401 1.8534 1.5217 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5370 3.1563 1.2517 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5240 1.0941 0.3960 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6179 0.0673 0.6577 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2473 -1.2744 0.3178 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0341 -1.5654 -1.1361 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8045 -0.3530 -1.9756 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8487 0.5074 -1.5081 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4019 0.2353 -0.2131 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7044 -0.9418 -0.2580 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3335 -0.8016 0.0533 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1000 -1.7046 1.2337 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3470 -2.9393 0.8245 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8074 -3.4628 -0.5145 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9435 -4.6138 -0.8709 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3001 -4.6490 -1.9590 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7876 -5.7170 -0.0409 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9415 -6.8101 -0.4249 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7585 -2.5374 -1.5088 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4772 -1.2225 -1.0883 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1469 -1.1973 -0.7796 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3695 -0.4917 -1.6819 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5312 -1.3963 -2.5599 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9422 -1.0230 -2.5826 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4032 -0.9040 -1.1866 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1657 -2.1910 -0.4636 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7302 0.3030 -0.5609 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9025 0.1046 0.9050 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3580 0.0855 1.3085 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3310 -0.5083 0.3788 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8697 -1.8681 0.8558 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8932 -0.5738 -1.0604 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8019 -1.3886 -1.8755 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1874 -1.2681 -1.3818 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5834 -0.4758 -0.3839 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0449 -0.5251 -0.0628 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9072 -0.2342 -1.2421 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4968 1.1204 -1.3441 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8844 1.7842 -2.5876 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2466 2.0374 -0.2002 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1533 1.4151 1.1393 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4349 0.0960 1.2189 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4947 -0.8531 1.8525 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3228 0.1106 2.2037 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0034 0.5924 1.7822 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5971 0.3748 0.3601 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3237 1.6767 -0.3345 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4846 1.3547 1.6636 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8903 2.0583 2.7829 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0396 2.7830 3.3587 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2934 1.9709 3.3048 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9733 1.0933 -1.5732 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4656 1.5984 -2.6091 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8308 0.5121 -0.6490 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2192 0.4476 -0.7876 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6189 0.6300 -1.0886 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4680 1.6770 -2.2220 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4706 1.3483 -0.0724 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8309 2.4584 0.4967 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6714 -3.9353 1.7729 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3248 -1.0230 2.1681 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2041 -2.1799 -1.6458 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7131 -2.2202 1.1662 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7986 2.2846 2.8868 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4353 1.8759 0.7209 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0109 2.7451 -1.4113 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0020 5.9390 1.2717 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2968 4.7754 1.5898 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7456 4.8077 2.6001 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9920 4.5154 -0.1399 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3934 3.7486 -0.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8579 0.9670 -0.1287 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3954 0.5114 2.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2666 1.4447 2.3762 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3049 0.0426 1.7154 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3441 -1.2614 0.5214 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2363 -2.3423 -1.3177 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4473 -0.7250 -2.9811 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7731 0.1456 -2.1871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7507 1.0910 0.0850 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1144 0.2720 0.2786 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0597 -1.9683 1.7498 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2599 -2.8565 0.8396 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8505 -3.8934 -0.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2766 -6.5138 -1.2731 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6195 -7.6047 -0.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3771 -7.2178 0.4177 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6878 -0.5672 -1.9923 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1403 -0.0710 -2.4124 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6954 -2.4621 -2.3086 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8361 -1.3331 -3.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4381 -1.9157 -3.0809 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1372 -0.1887 -3.2512 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1355 -2.5747 -0.4792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4876 -2.2454 0.5681 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7313 -2.9695 -1.0607 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3499 1.2172 -0.8032 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4333 0.9467 1.4434 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3345 -0.7918 1.3010 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6506 1.1056 1.6614 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3679 -0.5395 2.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9873 -1.8400 1.0204 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4786 -2.1406 1.8567 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7687 -2.6553 0.0878 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9548 0.4855 -1.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5277 -2.4560 -1.9796 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8023 -0.9902 -2.9323 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9113 -1.9146 -1.9152 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1929 -1.6573 0.1033 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3357 -0.5297 -2.1685 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7769 -0.9587 -1.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9864 2.3550 -2.2860 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6153 2.5497 -2.9540 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6998 1.0640 -3.3889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3082 2.6066 -0.4036 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0744 2.7884 -0.1798 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6017 2.1227 1.8241 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4599 -0.7679 1.3495 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6303 -0.6121 2.9230 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1553 -1.9016 1.7528 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3005 -0.8911 2.7270 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6771 0.7884 3.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2487 0.1693 2.5116 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9313 1.7041 1.9835 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3385 2.1070 -0.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5744 1.6880 -1.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0439 2.4360 0.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7716 1.0197 2.9294 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2690 1.8819 4.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9351 2.7860 2.9201 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6702 0.7584 0.1940 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4841 -0.6413 -0.8962 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6330 1.0607 -1.5937 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1184 2.5418 -2.0708 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7758 1.2163 -3.1780 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6057 1.9529 -2.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8266 0.6596 0.7254 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3747 1.7378 -0.5809 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9552 3.2828 -0.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1079 -3.9117 2.5611 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5412 -1.2768 3.0835 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6131 -2.7016 -0.8946 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9603 -3.1378 0.9711 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1321 2.4624 3.5946 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9152 1.3923 -0.0181 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5157 2.0004 -1.8255 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 19 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 1 35 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 6 43 45 1 0 45 46 1 0 46 47 1 0 47 48 1 1 47 49 1 0 49 50 1 0 50 51 1 0 51 52 1 6 46 53 1 0 53 54 1 0 54 55 2 0 54 56 1 0 43 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 32 61 1 0 61 62 1 6 61 63 1 0 63 64 1 0 18 65 1 0 17 66 1 0 11 67 1 0 10 68 1 0 5 69 1 0 4 70 1 0 3 71 1 0 7 2 1 0 14 9 1 0 25 16 1 0 61 27 1 0 37 30 1 0 51 40 1 0 51 35 1 0 47 41 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 6 3 76 1 6 4 77 1 6 5 78 1 1 6 79 1 1 9 80 1 1 10 81 1 6 11 82 1 1 12 83 1 0 12 84 1 0 14 85 1 1 16 86 1 1 17 87 1 1 18 88 1 6 19 89 1 1 23 90 1 0 23 91 1 0 23 92 1 0 25 93 1 6 27 94 1 6 28 95 1 0 28 96 1 0 29 97 1 0 29 98 1 0 31 99 1 0 31100 1 0 31101 1 0 32102 1 6 33103 1 0 33104 1 0 34105 1 0 34106 1 0 36107 1 0 36108 1 0 36109 1 0 37110 1 6 38111 1 0 38112 1 0 39113 1 0 41114 1 1 42115 1 0 42116 1 0 44117 1 0 44118 1 0 44119 1 0 45120 1 0 45121 1 0 46122 1 1 48123 1 0 48124 1 0 48125 1 0 49126 1 0 49127 1 0 50128 1 0 50129 1 0 52130 1 0 52131 1 0 52132 1 0 56133 1 0 56134 1 0 56135 1 0 60136 1 0 60137 1 0 60138 1 0 62139 1 0 62140 1 0 62141 1 0 63142 1 0 63143 1 0 64144 1 0 65145 1 0 66146 1 0 67147 1 0 68148 1 0 69149 1 0 70150 1 0 71151 1 0 M END

Standard InCHIKey	LFQCBDCJZYWDID-DAXGGDPVSA-N
Standard InCHI	InChI=1S/C51H80O20/c1-23-32(55)34(57)37(60)42(66-23)70-39-33(56)27(54)21-65-43(39)71-40-36(59)35(58)38(41(61)63-9)69-44(40)68-30-14-15-48(5)28(49(30,6)22-52)13-16-51(8)29(48)12-11-25-26-19-46(3,45(62)64-10)20-31(67-24(2)53)47(26,4)17-18-50(25,51)7/h11,23,26-40,42-44,52,54-60H,12-22H2,1-10H3/t23-,26-,27+,28+,29+,30-,31+,32-,33-,34+,35-,36-,37+,38-,39+,40+,42-,43-,44+,46+,47+,48-,49+,50+,51+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@@H](CO[C@H]1O[C@@H]1[C@H]([C@@H]([C@@H](C(=O)OC)O[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4C[C@](C)(C[C@H]([C@]4(C)CC[C@@]32C)OC(=O)C)C(=O)OC)[C@@]1(C)CO)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1012.52	Volume:	987.459 ? Van der Waals volume.
Dense:	1.025	LogP:	0.775 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.525 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.391 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	47.0
TPSA:	296.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.066	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.635	Fsp³:	0.902
MCE-18:	176.907 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.889	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.209	Promiscuous compounds:	0.183

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.857	MDCK Permeability:	-5.231
Pgp-inhibitor:	0.0	Pgp-substrate:	0.908
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.163	30% Bioavailability (F30%):	0.333
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.969
Plasma Protein Binding (PPB):	69.505%	Volume Distribution (VD):	-0.482
Fu:	22.691% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.966	BCRP inhibitor:	0.006
BSEP inhibitor:	0.982

ADMET: Metabolism

CYP1A2-inhibitor:	0.01	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.068	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	0.264
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.983
HLM stability:	0.018 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.264

Half-life (T1/2):

2.574

ADMET: Toxicity

hERG Blockers:	0.018	hERG Blockers (10um):	0.06
Human Hepatotoxicity (H-HT):	0.385	Drug-induced Liver Injury (DILI):	0.746
AMES Toxicity:	0.351	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.033	Skin Sensitization:	0.997
Carcinogencity:	0.059	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.985
Hematotoxicity:	0.173	Drug-induced Nephrotoxicity:	0.988
Genotoxicity:	0.641	RPMI-8226 Immunitoxicity:	0.235
A549 Cytotoxicity:	0.212	Hek293 Cytotoxicity:	0.25
BCF:	0.373 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.582 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.641 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.532 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40955	Wistaria brachybotrys	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[1294698]
NPO40955	Wistaria brachybotrys	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[1955883]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	7

Activity Type	# Activity
Cell line	4
Others	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	0.0	%	PMID[1955883]
NPT80	Cell line	Raji	Homo sapiens	Activity	=	10.0	%	PMID[1955883]
NPT80	Cell line	Raji	Homo sapiens	Activity	>	80.0	%	PMID[1955883]
NPT2	Others	Unspecified	n.a.	Activity	=	15.4	%	PMID[1955883]
NPT2	Others	Unspecified	n.a.	Activity	=	62.6	%	PMID[1955883]
NPT2	Others	Unspecified	n.a.	Activity	=	79.7	%	PMID[1955883]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486564 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21111
0.1-0.2	24138
0.2-0.3	3432
0.3-0.4	762
0.4-0.5	358
0.5-0.6	46
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7524	Intermediate Similarity	NPC486563
0.6609	Remote Similarity	NPC313110
0.6545	Remote Similarity	NPC162574
0.6525	Remote Similarity	NPC471550
0.6404	Remote Similarity	NPC187618
0.6339	Remote Similarity	NPC475504
0.5913	Remote Similarity	NPC131469
0.5909	Remote Similarity	NPC174679
0.5909	Remote Similarity	NPC279554
0.5897	Remote Similarity	NPC218954
0.5862	Remote Similarity	NPC95437
0.5841	Remote Similarity	NPC112352
0.5812	Remote Similarity	NPC114692
0.5789	Remote Similarity	NPC309714
0.5785	Remote Similarity	NPC76972
0.5785	Remote Similarity	NPC469782
0.5785	Remote Similarity	NPC204414
0.5641	Remote Similarity	NPC297263
0.5603	Remote Similarity	NPC480475
0.5583	Remote Similarity	NPC470477
0.5462	Remote Similarity	NPC293330
0.542	Remote Similarity	NPC202828
0.542	Remote Similarity	NPC119592
0.5403	Remote Similarity	NPC475287
0.5385	Remote Similarity	NPC160415
0.5379	Remote Similarity	NPC298034
0.5379	Remote Similarity	NPC71065
0.5351	Remote Similarity	NPC56713
0.5351	Remote Similarity	NPC59804
0.5339	Remote Similarity	NPC164389
0.5304	Remote Similarity	NPC473373
0.5289	Remote Similarity	NPC276093
0.528	Remote Similarity	NPC60557
0.528	Remote Similarity	NPC67857
0.5273	Remote Similarity	NPC476884
0.5203	Remote Similarity	NPC120116
0.5191	Remote Similarity	NPC473452
0.5169	Remote Similarity	NPC469945
0.5167	Remote Similarity	NPC63159
0.5164	Remote Similarity	NPC236657
0.5161	Remote Similarity	NPC481078
0.5156	Remote Similarity	NPC155410
0.5156	Remote Similarity	NPC135904
0.513	Remote Similarity	NPC12288
0.5124	Remote Similarity	NPC222580
0.5118	Remote Similarity	NPC79643
0.5115	Remote Similarity	NPC484061
0.5115	Remote Similarity	NPC484062
0.5078	Remote Similarity	NPC165204
0.5045	Remote Similarity	NPC476883
0.504	Remote Similarity	NPC207738
0.504	Remote Similarity	NPC31838

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486564 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7179
0.1-0.2	1924
0.2-0.3	43
0.3-0.4	3
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data