NPASS Compound

Natural Product: NPC112352

Natural Product ID	NPC112352
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ABYPRQZHTBVDLB-PPCHTBMASA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 139146 0 0 0 0 0 0 0 0999 V2000 8.6524 0.2340 3.5510 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9782 0.1992 2.7969 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4806 -1.2277 2.8486 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3630 -1.4324 1.6181 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4617 -1.3095 0.4031 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2865 -0.3718 0.7344 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7974 0.6491 1.4931 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7650 0.0212 -0.4710 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4780 -0.4577 -0.7445 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4936 -1.3654 -1.9548 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7484 -0.6984 -3.0747 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9637 0.7691 -3.1365 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9268 1.4288 -1.9559 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4876 0.6425 -0.8905 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1922 0.3472 -1.1358 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2390 0.9337 -0.2998 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5605 2.0960 -0.9790 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0825 2.1697 -0.8226 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4025 0.8024 -1.0021 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6375 0.3069 -2.3661 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9115 -0.0324 0.1198 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2361 -1.3608 0.1093 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2496 -1.1691 0.3280 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8892 -0.1389 -0.5367 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2351 -0.7853 -1.8497 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0631 1.0895 -0.6703 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6983 2.0986 -1.5571 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1627 1.9539 -1.6105 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9132 1.1598 -0.8442 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3784 1.0906 -0.9798 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0518 2.3427 -1.3839 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7777 3.1263 -0.3466 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8128 3.9816 -1.0472 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8966 4.0622 0.4360 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5312 2.2503 0.6350 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4655 1.3603 1.2593 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0738 0.4039 0.1242 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3978 -0.7790 0.7296 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9390 -0.8640 0.6611 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2077 0.3205 0.1429 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8420 1.1868 1.3560 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4131 -0.0665 -0.4048 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8060 0.1023 -1.5673 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2312 -0.7243 0.4874 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5025 -1.1806 0.0204 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5414 -2.6771 0.2350 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9300 -3.1324 0.6081 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0102 -2.2507 0.0401 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7548 -0.8247 0.4027 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.6924 -0.4271 1.5217 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.0309 -0.6009 1.1289 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4559 -0.6183 0.8616 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1500 -2.4247 -1.3454 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1068 -3.2040 1.9836 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2201 -3.2552 -0.9994 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3947 -0.0791 0.3192 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7078 -0.1041 1.8360 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8413 -1.4790 -0.1253 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4112 -1.0969 -3.1787 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9530 -2.6077 -1.6251 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9499 -2.5966 0.1510 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9282 -2.7070 1.6709 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2017 -1.4736 4.0084 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6489 -0.4340 4.4191 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5116 1.2742 3.9554 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7893 0.0811 2.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7354 0.8066 3.3418 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6643 -1.9717 2.8109 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1300 -0.6385 1.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0426 -0.9474 -0.4435 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6250 -0.9956 1.3529 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2141 -1.0718 0.1329 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5628 -1.4927 -2.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2036 -1.1727 -4.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9474 0.9897 -3.6852 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1865 1.1862 -3.8615 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6318 1.3139 0.0004 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8956 1.4359 0.4781 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9535 3.0772 -0.5968 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7851 2.1442 -2.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6450 2.9032 -1.4976 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8062 2.4764 0.2295 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5014 0.8254 -2.8680 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8063 -0.7959 -2.4708 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8018 0.4927 -3.1028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5105 0.4828 1.0545 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3796 -1.9379 -0.8220 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5561 -2.0096 0.9792 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4924 -1.0967 1.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6930 -2.1729 0.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 -1.4248 -1.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4288 -1.5307 -2.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4593 -0.1148 -2.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0198 1.5674 0.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4900 3.1401 -1.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2665 2.1170 -2.5986 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6451 2.5575 -2.3672 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5149 0.3833 -1.8865 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8499 2.0745 -2.1458 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4387 3.0748 -1.9563 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3185 4.7996 -1.6396 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3647 3.3770 -1.7721 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5330 4.4311 -0.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8826 5.0403 -0.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8828 3.6509 0.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3462 4.1908 1.4417 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3570 1.6916 0.1924 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9087 2.9108 1.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6604 2.0141 1.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8330 0.7855 2.1232 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8449 -1.7132 0.2592 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7744 -0.8833 1.7984 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5612 -1.0327 1.7241 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6601 -1.8217 0.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9305 0.8165 1.8744 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8670 2.2568 1.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6483 1.0026 2.1287 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6682 -0.9189 -1.0453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8474 -3.0218 1.0270 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0820 -4.1442 0.1681 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9743 -2.6377 0.4762 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9340 -0.1229 -0.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5379 -1.1158 2.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5247 0.6008 1.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2095 0.0710 0.4050 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9797 -1.5527 -1.8087 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3887 -2.7498 2.4843 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3542 -4.2417 -0.8572 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7868 -0.2441 1.9767 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0993 -0.8489 2.3555 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4712 0.9023 2.2705 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3903 -1.8100 -1.0530 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9343 -1.5546 -0.1164 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5024 -2.1981 0.6706 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3107 -2.0517 -3.3078 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3695 -3.2563 -2.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1474 -3.2141 0.8947 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0270 -2.9873 2.6017 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6036 -0.6225 4.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 32 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 1 37 42 1 6 42 43 2 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 48 53 1 0 47 54 1 0 46 55 1 0 21 56 1 0 56 57 1 0 56 58 1 0 11 59 1 0 10 60 1 0 5 61 1 0 4 62 1 0 3 63 1 0 7 2 1 0 14 9 1 0 56 16 1 0 26 19 1 0 40 29 1 0 52 45 1 0 40 24 1 0 37 30 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 6 4 69 1 6 5 70 1 6 6 71 1 1 9 72 1 1 10 73 1 6 11 74 1 6 12 75 1 0 12 76 1 0 14 77 1 1 16 78 1 1 17 79 1 0 17 80 1 0 18 81 1 0 18 82 1 0 20 83 1 0 20 84 1 0 20 85 1 0 21 86 1 1 22 87 1 0 22 88 1 0 23 89 1 0 23 90 1 0 25 91 1 0 25 92 1 0 25 93 1 0 26 94 1 1 27 95 1 0 27 96 1 0 28 97 1 0 30 98 1 6 31 99 1 0 31100 1 0 33101 1 0 33102 1 0 33103 1 0 34104 1 0 34105 1 0 34106 1 0 35107 1 0 35108 1 0 36109 1 0 36110 1 0 38111 1 0 38112 1 0 39113 1 0 39114 1 0 41115 1 0 41116 1 0 41117 1 0 45118 1 6 46119 1 1 47120 1 6 48121 1 1 49122 1 6 50123 1 0 50124 1 0 51125 1 0 53126 1 0 54127 1 0 55128 1 0 57129 1 0 57130 1 0 57131 1 0 58132 1 0 58133 1 0 58134 1 0 59135 1 0 60136 1 0 61137 1 0 62138 1 0 63139 1 0 M END

Standard InCHIKey	ABYPRQZHTBVDLB-PPCHTBMASA-N
Standard InCHI	InChI=1S/C47H76O16/c1-22-30(50)33(53)35(55)38(59-22)62-37-31(51)25(49)21-58-40(37)61-29-12-13-44(6)27(43(29,4)5)11-14-46(8)28(44)10-9-23-24-19-42(2,3)15-17-47(24,18-16-45(23,46)7)41(57)63-39-36(56)34(54)32(52)26(20-48)60-39/h9,22,24-40,48-56H,10-21H2,1-8H3/t22-,24-,25-,26+,27-,28+,29-,30-,31-,32+,33+,34-,35+,36+,37+,38-,39-,40-,44-,45+,46+,47-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(CC[C@@]32C)C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C1(C)C)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	896.51	Volume:	888.387 ? Van der Waals volume.
Dense:	1.009	LogP:	2.458 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.952 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.21 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	45.0
TPSA:	254.52 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.1	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.184	Fsp³:	0.936
MCE-18:	171.692 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.947	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.185	Promiscuous compounds:	0.067

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.053	MDCK Permeability:	-5.114
Pgp-inhibitor:	0.0	Pgp-substrate:	0.011
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.803
20% Bioavailability (F20%):	0.744	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.801	MRP1:	0.004
Plasma Protein Binding (PPB):	71.089%	Volume Distribution (VD):	-0.369
Fu:	18.965% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.038
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.013
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.34 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.143

Half-life (T1/2):

4.146

ADMET: Toxicity

hERG Blockers:	0.017	hERG Blockers (10um):	0.058
Human Hepatotoxicity (H-HT):	0.748	Drug-induced Liver Injury (DILI):	0.95
AMES Toxicity:	0.889	Rat Oral Acute Toxicity:	0.009
Maximum Recommended Daily Dose:	0.011	Skin Sensitization:	1.0
Carcinogencity:	0.086	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.997
Hematotoxicity:	0.563	Drug-induced Nephrotoxicity:	0.986
Genotoxicity:	0.53	RPMI-8226 Immunitoxicity:	0.278
A549 Cytotoxicity:	0.828	Hek293 Cytotoxicity:	0.595
BCF:	2.409 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.397 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.635 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.088 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[31301930]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	>	50000.0	nM	PMID[31301930]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC112352 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22497
0.1-0.2	22793
0.2-0.3	3050
0.3-0.4	795
0.4-0.5	378
0.5-0.6	56
0.6-0.7	83
0.7-0.8	0
0.8-0.85	8
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8817	High Similarity	NPC63159
0.8515	High Similarity	NPC135904
0.8469	Intermediate Similarity	NPC481078
0.8317	Intermediate Similarity	NPC79643
0.8316	Intermediate Similarity	NPC46665
0.8218	Intermediate Similarity	NPC60557
0.8218	Intermediate Similarity	NPC67857
0.8211	Intermediate Similarity	NPC160415
0.8191	Intermediate Similarity	NPC469946
0.8125	Intermediate Similarity	NPC480475
0.7981	Intermediate Similarity	NPC123199
0.79	Intermediate Similarity	NPC481079
0.789	Intermediate Similarity	NPC305981
0.7818	Intermediate Similarity	NPC261506
0.7818	Intermediate Similarity	NPC4328
0.7778	Intermediate Similarity	NPC297263
0.7706	Intermediate Similarity	NPC41061
0.7706	Intermediate Similarity	NPC227551
0.7692	Intermediate Similarity	NPC475287
0.7685	Intermediate Similarity	NPC57484
0.766	Intermediate Similarity	NPC48499
0.76	Intermediate Similarity	NPC222580
0.76	Intermediate Similarity	NPC475504
0.7576	Intermediate Similarity	NPC251768
0.7576	Intermediate Similarity	NPC164389
0.7551	Intermediate Similarity	NPC192791
0.7549	Intermediate Similarity	NPC301449
0.7549	Intermediate Similarity	NPC601290
0.7524	Intermediate Similarity	NPC76972
0.7524	Intermediate Similarity	NPC469782
0.7524	Intermediate Similarity	NPC204414
0.7447	Intermediate Similarity	NPC214484
0.7411	Intermediate Similarity	NPC236638
0.7411	Intermediate Similarity	NPC294453
0.7404	Intermediate Similarity	NPC31838
0.7327	Intermediate Similarity	NPC475591
0.7327	Intermediate Similarity	NPC236870
0.7321	Intermediate Similarity	NPC293330
0.732	Intermediate Similarity	NPC475516
0.7308	Intermediate Similarity	NPC480473
0.7308	Intermediate Similarity	NPC480474
0.7238	Intermediate Similarity	NPC187290
0.7228	Intermediate Similarity	NPC10607
0.7193	Intermediate Similarity	NPC298034
0.7193	Intermediate Similarity	NPC71065
0.7172	Intermediate Similarity	NPC39211
0.7168	Intermediate Similarity	NPC43550
0.7155	Intermediate Similarity	NPC250247
0.7143	Intermediate Similarity	NPC295823
0.7143	Intermediate Similarity	NPC174720
0.7143	Intermediate Similarity	NPC235405
0.7143	Intermediate Similarity	NPC475467
0.7115	Intermediate Similarity	NPC114484
0.7083	Intermediate Similarity	NPC90856
0.708	Intermediate Similarity	NPC258617
0.7071	Intermediate Similarity	NPC249848
0.7071	Intermediate Similarity	NPC107966
0.7064	Intermediate Similarity	NPC165204
0.703	Intermediate Similarity	NPC223301
0.703	Intermediate Similarity	NPC171544
0.6981	Remote Similarity	NPC80986
0.6961	Remote Similarity	NPC30735
0.6957	Remote Similarity	NPC481081
0.6937	Remote Similarity	NPC471550
0.6931	Remote Similarity	NPC161674
0.6903	Remote Similarity	NPC21691
0.6832	Remote Similarity	NPC295371
0.6832	Remote Similarity	NPC157868
0.6827	Remote Similarity	NPC68175
0.6827	Remote Similarity	NPC235438
0.681	Remote Similarity	NPC202828
0.681	Remote Similarity	NPC119592
0.6792	Remote Similarity	NPC104372
0.6786	Remote Similarity	NPC475160
0.6786	Remote Similarity	NPC100639
0.6786	Remote Similarity	NPC470218
0.6786	Remote Similarity	NPC473714
0.6739	Remote Similarity	NPC167383
0.6731	Remote Similarity	NPC40775
0.6731	Remote Similarity	NPC159309
0.6731	Remote Similarity	NPC86222
0.6667	Remote Similarity	NPC481080
0.6639	Remote Similarity	NPC220160
0.6637	Remote Similarity	NPC283417
0.6637	Remote Similarity	NPC200049
0.6635	Remote Similarity	NPC309714
0.6609	Remote Similarity	NPC476068
0.6606	Remote Similarity	NPC36831
0.6602	Remote Similarity	NPC263756
0.6596	Remote Similarity	NPC237503
0.6581	Remote Similarity	NPC65105
0.6579	Remote Similarity	NPC488560
0.6569	Remote Similarity	NPC127056
0.6514	Remote Similarity	NPC241909
0.65	Remote Similarity	NPC1046
0.6481	Remote Similarity	NPC281148
0.6471	Remote Similarity	NPC56713
0.6455	Remote Similarity	NPC104137
0.6455	Remote Similarity	NPC26626
0.6442	Remote Similarity	NPC213674
0.6429	Remote Similarity	NPC128925
0.6429	Remote Similarity	NPC268184
0.6417	Remote Similarity	NPC70809
0.641	Remote Similarity	NPC110633
0.641	Remote Similarity	NPC286457
0.6404	Remote Similarity	NPC155410
0.64	Remote Similarity	NPC204458
0.6379	Remote Similarity	NPC4749
0.6364	Remote Similarity	NPC187618
0.6364	Remote Similarity	NPC224381
0.6364	Remote Similarity	NPC209894
0.6337	Remote Similarity	NPC29069
0.629	Remote Similarity	NPC480422
0.6286	Remote Similarity	NPC80843
0.6273	Remote Similarity	NPC324875
0.6273	Remote Similarity	NPC292677
0.625	Remote Similarity	NPC150400
0.6239	Remote Similarity	NPC64715
0.6228	Remote Similarity	NPC123522
0.6204	Remote Similarity	NPC148417
0.619	Remote Similarity	NPC473884
0.6176	Remote Similarity	NPC78046
0.6174	Remote Similarity	NPC475899
0.6168	Remote Similarity	NPC104071
0.6116	Remote Similarity	NPC136768
0.6111	Remote Similarity	NPC102439
0.6111	Remote Similarity	NPC173859
0.6111	Remote Similarity	NPC148603
0.6095	Remote Similarity	NPC473373
0.6091	Remote Similarity	NPC486563
0.6083	Remote Similarity	NPC470876
0.6075	Remote Similarity	NPC242840
0.6071	Remote Similarity	NPC469778
0.6066	Remote Similarity	NPC302543
0.6019	Remote Similarity	NPC117714
0.6018	Remote Similarity	NPC475486
0.6014	Remote Similarity	NPC469776
0.6	Remote Similarity	NPC174679
0.6	Remote Similarity	NPC313110
0.6	Remote Similarity	NPC32723
0.6	Remote Similarity	NPC279554
0.6	Remote Similarity	NPC257468
0.6	Remote Similarity	NPC59804
0.5966	Remote Similarity	NPC85154
0.5965	Remote Similarity	NPC470915
0.5963	Remote Similarity	NPC488526
0.5957	Remote Similarity	NPC481323
0.5948	Remote Similarity	NPC192600
0.5943	Remote Similarity	NPC58448
0.5932	Remote Similarity	NPC191827
0.5929	Remote Similarity	NPC96641
0.5929	Remote Similarity	NPC163183
0.589	Remote Similarity	NPC295941
0.5877	Remote Similarity	NPC207738
0.5874	Remote Similarity	NPC135334
0.5872	Remote Similarity	NPC30289
0.5868	Remote Similarity	NPC473452
0.5856	Remote Similarity	NPC123796
0.5849	Remote Similarity	NPC25605
0.5849	Remote Similarity	NPC139894
0.5847	Remote Similarity	NPC219180
0.5847	Remote Similarity	NPC251263
0.5841	Remote Similarity	NPC486564
0.5841	Remote Similarity	NPC218954
0.5833	Remote Similarity	NPC76497
0.5833	Remote Similarity	NPC481324
0.5818	Remote Similarity	NPC473459
0.581	Remote Similarity	NPC475208
0.5785	Remote Similarity	NPC484061
0.5785	Remote Similarity	NPC484062
0.5784	Remote Similarity	NPC256798
0.5769	Remote Similarity	NPC189884
0.5769	Remote Similarity	NPC138334
0.5755	Remote Similarity	NPC18233
0.5752	Remote Similarity	NPC276093
0.5741	Remote Similarity	NPC470512
0.5725	Remote Similarity	NPC475368
0.5714	Remote Similarity	NPC480419
0.5703	Remote Similarity	NPC489209
0.57	Remote Similarity	NPC306746
0.57	Remote Similarity	NPC199457
0.569	Remote Similarity	NPC75287
0.5688	Remote Similarity	NPC473343
0.5664	Remote Similarity	NPC302887
0.5652	Remote Similarity	NPC160452
0.5644	Remote Similarity	NPC68419
0.5636	Remote Similarity	NPC75417
0.563	Remote Similarity	NPC470911
0.5625	Remote Similarity	NPC162574
0.561	Remote Similarity	NPC265841
0.561	Remote Similarity	NPC480418
0.56	Remote Similarity	NPC477463
0.5593	Remote Similarity	NPC610204
0.5583	Remote Similarity	NPC475209
0.5578	Remote Similarity	NPC469777
0.5566	Remote Similarity	NPC164194
0.5565	Remote Similarity	NPC475514
0.5563	Remote Similarity	NPC469775
0.5556	Remote Similarity	NPC11242

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC112352 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7355
0.1-0.2	1735
0.2-0.3	52
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data