NPASS Compound

Natural Product: NPC283417

Natural Product ID	NPC283417
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Gordonoside N
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	gordonoside N
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1782847
PubChem CID	54584203
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 178187 0 0 0 0 0 0 0 0999 V2000 8.1524 -3.3252 1.9607 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5825 -2.3759 2.9900 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4623 -3.1607 4.2966 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5419 -1.2222 3.1542 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7461 0.0516 3.3111 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0529 0.4143 2.0174 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4199 -0.8348 1.4693 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2154 -1.8941 2.5417 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1528 -0.5382 0.7484 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0195 -0.9680 -0.4891 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8213 -0.7506 -1.3349 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6972 -0.3989 -0.3888 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3582 -0.3512 -1.0648 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3657 0.2883 -2.4266 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9700 -1.8115 -1.2896 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4315 -2.0112 -1.6804 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4470 -1.3004 -0.8104 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0747 0.1004 -0.4864 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8246 0.4752 0.7982 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5314 1.0931 -1.5318 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3807 0.2308 -0.1244 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7541 1.6239 0.2015 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9967 1.5340 1.1016 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0752 0.7557 0.4576 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8112 1.7523 -0.4526 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0931 0.2412 1.4868 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3402 -0.6872 2.4123 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6877 1.3070 2.3335 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1246 1.5805 2.1837 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5720 2.2544 3.3512 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6789 -1.3127 -1.4596 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6187 -2.0727 -0.8172 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8886 -1.3771 -0.5276 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8541 -1.3446 -1.6598 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3327 -2.1821 -2.8450 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8802 -3.4779 -2.2094 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5991 -4.5004 -3.2705 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5573 -4.8512 -4.0161 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3681 -5.0710 -3.4747 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7243 -3.2596 -1.5414 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3849 -2.4844 -3.7060 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2275 -0.0894 -2.1188 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6043 0.0341 -2.1268 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0444 1.3294 -1.5613 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.5422 1.5552 -1.8039 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0847 0.2975 -2.4257 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3226 -0.0339 -3.6629 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9402 0.0033 -3.5146 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4129 0.5528 -2.8173 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7827 2.6128 -2.6699 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7020 1.5331 -0.2565 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9218 2.6677 -0.0522 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8168 3.6720 0.6913 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0079 4.8321 1.2351 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0422 4.2681 2.2480 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8666 2.7854 1.9948 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7707 2.4581 0.6567 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8382 4.9254 2.3164 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9119 5.6308 1.9396 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8165 4.1036 -0.1628 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4811 -1.9915 0.6107 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6243 -1.1473 1.6758 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0162 -1.1089 2.2376 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4647 -2.5052 2.5426 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3036 -3.4444 2.6287 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0927 -2.8104 3.2189 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9156 -3.7650 2.9894 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2041 -5.0226 3.5211 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7564 -1.5940 2.6839 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6943 -4.4740 3.5179 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4256 -2.9753 1.6435 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0075 -0.3500 3.4038 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1099 0.8648 1.0603 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3142 0.9295 1.3998 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8214 1.2323 -0.2449 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8083 1.6522 -1.1389 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9830 0.7044 -2.3103 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3456 0.9989 -2.9068 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4176 2.4561 -3.2210 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8858 3.3338 -2.1342 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7837 4.7513 -2.6778 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0110 5.1671 -3.1570 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6372 2.9170 -1.6489 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7795 2.7735 -3.3757 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5872 0.2629 -4.0484 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8858 -0.6312 -1.9041 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3597 -4.3427 2.3774 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3964 -3.4781 1.1661 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0514 -2.9150 1.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5884 -2.4325 5.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4106 -3.5519 4.3209 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1624 -3.9938 4.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1586 -1.4051 4.0754 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2698 -1.1624 2.3356 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4454 0.8783 3.5383 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0186 -0.1203 4.1344 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1768 -1.2995 0.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7494 -2.7810 2.0639 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7095 -1.5311 3.4406 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8380 -1.5327 -0.9642 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0737 0.0601 -2.0370 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5758 -1.6327 -1.9211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6650 -1.2996 0.3025 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5487 -0.1634 -3.0641 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2907 0.0902 -2.9973 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1936 1.3616 -2.4473 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1181 -2.3024 -0.2836 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6231 -2.2856 -2.0321 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6570 -3.1113 -1.5669 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6774 -1.7816 -2.7326 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5682 -1.9202 0.1157 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2822 1.4747 0.6736 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1395 0.5672 1.6682 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6467 -0.2370 0.9867 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9141 2.0006 -1.5111 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6409 0.6387 -2.5290 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5733 1.4496 -1.2735 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4823 -0.3628 0.8370 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0342 2.2670 -0.6314 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0052 2.1745 0.7988 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2939 2.6061 1.2273 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6309 1.2120 2.0701 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2912 1.9191 -1.3930 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8406 1.4771 -0.6400 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8294 2.7462 0.0762 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6309 -1.7508 2.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2614 -0.6604 2.3580 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5768 -0.4750 3.5001 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4702 1.1808 3.4381 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1388 2.2613 2.0831 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2761 2.3584 1.3863 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0372 3.0967 3.4456 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1586 -2.4175 0.1590 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6866 -0.3343 -0.2320 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7749 -1.8854 -1.3656 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4825 -1.7009 -3.3257 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6596 -3.9176 -1.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2621 -5.9566 -3.9634 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1582 -2.1856 -4.5995 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0426 -0.8777 -1.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5566 2.1596 -2.1479 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0760 1.7637 -0.8626 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1260 -0.5493 -1.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6104 0.5942 -4.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5425 -1.1012 -3.9678 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9122 -0.3127 -2.8516 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1869 2.2819 -3.5000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7564 3.1407 -1.0489 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2792 3.1601 1.5537 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5566 5.4621 0.4680 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4925 4.3254 3.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9301 2.4713 2.4929 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6936 2.2082 2.5053 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8881 5.7268 2.9318 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7454 5.7803 1.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3766 4.6978 -0.8430 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2691 -0.0985 1.4683 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7127 -0.5807 1.5433 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9935 -2.4829 3.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0995 -3.9761 1.6741 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2362 -2.7613 4.3196 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7253 -3.9386 1.9112 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0199 -3.3489 3.4774 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3858 -5.4855 3.8260 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4417 -4.9476 3.0318 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9784 -2.2172 1.3351 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4585 -0.7427 4.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7957 1.6247 -0.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2101 0.9604 -3.0624 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1236 0.8021 -2.1207 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9286 2.7314 -4.1691 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6425 3.3462 -1.3139 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3788 5.4401 -1.8993 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0486 4.7969 -3.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1623 4.9502 -4.1078 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3578 2.0840 -2.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8647 -0.3848 -4.2488 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7234 -1.0962 -2.1881 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 36 40 1 0 35 41 1 0 34 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 54 59 1 0 53 60 1 0 33 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 65 70 1 0 64 71 1 0 63 72 1 0 6 73 1 6 73 74 2 0 73 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 80 83 1 0 79 84 1 0 78 85 1 0 77 86 1 0 8 2 1 0 26 9 1 0 40 32 1 0 48 43 1 0 57 52 1 0 69 62 1 0 83 76 1 0 29 6 1 0 24 12 1 0 21 13 1 0 1 87 1 0 1 88 1 0 1 89 1 0 3 90 1 0 3 91 1 0 3 92 1 0 4 93 1 0 4 94 1 0 5 95 1 0 5 96 1 0 7 97 1 6 8 98 1 0 8 99 1 0 10100 1 0 11101 1 0 11102 1 0 12103 1 1 14104 1 0 14105 1 0 14106 1 0 15107 1 0 15108 1 0 16109 1 0 16110 1 0 17111 1 1 19112 1 0 19113 1 0 19114 1 0 20115 1 0 20116 1 0 20117 1 0 21118 1 1 22119 1 0 22120 1 0 23121 1 0 23122 1 0 25123 1 0 25124 1 0 25125 1 0 27126 1 0 27127 1 0 27128 1 0 28129 1 0 28130 1 0 29131 1 6 30132 1 0 32133 1 1 33134 1 1 34135 1 1 35136 1 6 36137 1 1 39138 1 0 41139 1 0 43140 1 1 44141 1 6 45142 1 1 46143 1 1 47144 1 0 47145 1 0 49146 1 0 50147 1 0 52148 1 6 53149 1 1 54150 1 6 55151 1 1 56152 1 0 56153 1 0 58154 1 0 59155 1 0 60156 1 0 62157 1 6 63158 1 6 64159 1 1 65160 1 6 66161 1 1 67162 1 0 67163 1 0 68164 1 0 70165 1 0 71166 1 0 72167 1 0 76168 1 1 77169 1 6 78170 1 1 79171 1 6 80172 1 1 81173 1 0 81174 1 0 82175 1 0 84176 1 0 85177 1 0 86178 1 0 M END

Standard InCHIKey	GNQHWAAORKJVMT-FYPKULKMSA-N
Standard InCHI	InChI=1S/C58H92O28/c1-53(2)14-15-58(52(76)86-49-40(72)37(69)35(67)27(19-60)80-49)23(16-53)22-8-9-29-55(5)12-11-31(54(3,4)28(55)10-13-56(29,6)57(22,7)17-30(58)63)81-51-45(85-48-39(71)36(68)34(66)26(18-59)79-48)42(41(73)43(83-51)46(74)75)82-50-44(33(65)25(62)21-78-50)84-47-38(70)32(64)24(61)20-77-47/h8,23-45,47-51,59-73H,9-21H2,1-7H3,(H,74,75)/t23-,24+,25-,26+,27+,28-,29+,30+,31-,32-,33-,34+,35+,36-,37-,38+,39+,40+,41-,42-,43-,44+,45+,47-,48-,49-,50-,51+,55-,56+,57+,58+/m0/s1
SMILES	CC1(C)CC[C@]2([C@@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1236.58	Volume:	1164.376 ? Van der Waals volume.
Dense:	1.062	LogP:	-0.121 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.123 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.829 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	58.0
TPSA:	450.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	16.0	Rings:	10.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.048	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.304	Fsp³:	0.931
MCE-18:	221.482 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.687	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.307	Promiscuous compounds:	0.137

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.627	MDCK Permeability:	-4.951
Pgp-inhibitor:	0.0	Pgp-substrate:	0.444
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.966
20% Bioavailability (F20%):	0.493	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.117
Plasma Protein Binding (PPB):	55.185%	Volume Distribution (VD):	-0.404
Fu:	27.636% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.008
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.737

Half-life (T1/2):

4.528

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.835	Drug-induced Liver Injury (DILI):	0.994
AMES Toxicity:	0.972	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.013	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.764	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.456	RPMI-8226 Immunitoxicity:	0.204
A549 Cytotoxicity:	0.678	Hek293 Cytotoxicity:	0.083
BCF:	0.503 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.292 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.842 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.673 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO31118	Gordonia chrysandra	Species	Theaceae	Eukaryota	Roots	Yunnan Province, China	2005-MAY	PMID[20560647]
NPO31118	Gordonia chrysandra	Species	Theaceae	Eukaryota	n.a.	stem	n.a.	PMID[21473609]
NPO31118	Gordonia chrysandra	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Inhibition	=	8.9	%	PMID[21473609]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC283417 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22468
0.1-0.2	23015
0.2-0.3	3077
0.3-0.4	621
0.4-0.5	335
0.5-0.6	102
0.6-0.7	66
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC200049
0.8559	High Similarity	NPC4749
0.8435	Intermediate Similarity	NPC302543
0.8208	Intermediate Similarity	NPC64715
0.8158	Intermediate Similarity	NPC21691
0.7931	Intermediate Similarity	NPC265841
0.7909	Intermediate Similarity	NPC187290
0.7838	Intermediate Similarity	NPC11242
0.7627	Intermediate Similarity	NPC488308
0.7589	Intermediate Similarity	NPC104137
0.7589	Intermediate Similarity	NPC26626
0.7563	Intermediate Similarity	NPC271610
0.7563	Intermediate Similarity	NPC312650
0.7431	Intermediate Similarity	NPC164389
0.7404	Intermediate Similarity	NPC1046
0.7387	Intermediate Similarity	NPC302887
0.7364	Intermediate Similarity	NPC475591
0.7364	Intermediate Similarity	NPC236870
0.7345	Intermediate Similarity	NPC160452
0.7273	Intermediate Similarity	NPC44716
0.7265	Intermediate Similarity	NPC284449
0.7258	Intermediate Similarity	NPC488309
0.7257	Intermediate Similarity	NPC301449
0.7257	Intermediate Similarity	NPC601290
0.7213	Intermediate Similarity	NPC476779
0.7049	Intermediate Similarity	NPC286457
0.7049	Intermediate Similarity	NPC476774
0.7049	Intermediate Similarity	NPC476780
0.7025	Intermediate Similarity	NPC85154
0.7025	Intermediate Similarity	NPC71391
0.7	Intermediate Similarity	NPC602995
0.6953	Remote Similarity	NPC489209
0.6891	Remote Similarity	NPC123522
0.688	Remote Similarity	NPC110700
0.688	Remote Similarity	NPC476777
0.685	Remote Similarity	NPC220160
0.6814	Remote Similarity	NPC251768
0.6814	Remote Similarity	NPC488526
0.6772	Remote Similarity	NPC476775
0.6767	Remote Similarity	NPC489208
0.6748	Remote Similarity	NPC192765
0.6744	Remote Similarity	NPC476776
0.6726	Remote Similarity	NPC117714
0.6694	Remote Similarity	NPC178264
0.6667	Remote Similarity	NPC484059
0.6667	Remote Similarity	NPC484060
0.6667	Remote Similarity	NPC279915
0.6667	Remote Similarity	NPC476778
0.6637	Remote Similarity	NPC112352
0.6609	Remote Similarity	NPC63159
0.6587	Remote Similarity	NPC470876
0.6579	Remote Similarity	NPC30289
0.6579	Remote Similarity	NPC605226
0.6555	Remote Similarity	NPC481078
0.6549	Remote Similarity	NPC469946
0.6525	Remote Similarity	NPC23275
0.6508	Remote Similarity	NPC473452
0.65	Remote Similarity	NPC815
0.6491	Remote Similarity	NPC192791
0.6479	Remote Similarity	NPC485563
0.6462	Remote Similarity	NPC484063
0.6462	Remote Similarity	NPC484064
0.6446	Remote Similarity	NPC25998
0.6429	Remote Similarity	NPC484061
0.6429	Remote Similarity	NPC484062
0.6404	Remote Similarity	NPC263756
0.6393	Remote Similarity	NPC609119
0.6343	Remote Similarity	NPC485562
0.6343	Remote Similarity	NPC33012
0.6281	Remote Similarity	NPC207738
0.6271	Remote Similarity	NPC297263
0.6269	Remote Similarity	NPC8524
0.6261	Remote Similarity	NPC80843
0.6261	Remote Similarity	NPC213674
0.625	Remote Similarity	NPC13998
0.624	Remote Similarity	NPC123199
0.6179	Remote Similarity	NPC470475
0.6148	Remote Similarity	NPC469947
0.6148	Remote Similarity	NPC31838
0.6148	Remote Similarity	NPC480948
0.6121	Remote Similarity	NPC22956
0.6111	Remote Similarity	NPC135904
0.6102	Remote Similarity	NPC159309
0.6102	Remote Similarity	NPC305267
0.6102	Remote Similarity	NPC232237
0.6102	Remote Similarity	NPC86222
0.6098	Remote Similarity	NPC480939
0.6094	Remote Similarity	NPC329828
0.609	Remote Similarity	NPC482010
0.6087	Remote Similarity	NPC127056
0.608	Remote Similarity	NPC79643
0.6077	Remote Similarity	NPC258617
0.6063	Remote Similarity	NPC470218
0.6048	Remote Similarity	NPC288205
0.6048	Remote Similarity	NPC51465
0.6034	Remote Similarity	NPC157868
0.6016	Remote Similarity	NPC25663
0.5969	Remote Similarity	NPC181066
0.5966	Remote Similarity	NPC46665
0.5966	Remote Similarity	NPC480475
0.5948	Remote Similarity	NPC480420
0.5935	Remote Similarity	NPC187618
0.5935	Remote Similarity	NPC480473
0.5935	Remote Similarity	NPC480474
0.5931	Remote Similarity	NPC475584
0.5931	Remote Similarity	NPC475152
0.5923	Remote Similarity	NPC57484
0.592	Remote Similarity	NPC475119
0.5902	Remote Similarity	NPC114484
0.5891	Remote Similarity	NPC47995
0.5891	Remote Similarity	NPC277212
0.5891	Remote Similarity	NPC30279
0.5882	Remote Similarity	NPC102505
0.5882	Remote Similarity	NPC488514
0.5873	Remote Similarity	NPC60557
0.5873	Remote Similarity	NPC67857
0.5865	Remote Similarity	NPC481081
0.5859	Remote Similarity	NPC470476
0.5857	Remote Similarity	NPC475368
0.5854	Remote Similarity	NPC481079
0.5833	Remote Similarity	NPC40775
0.5833	Remote Similarity	NPC41061
0.5833	Remote Similarity	NPC227551
0.5826	Remote Similarity	NPC475208
0.582	Remote Similarity	NPC79718
0.5814	Remote Similarity	NPC475140
0.5806	Remote Similarity	NPC69811
0.5794	Remote Similarity	NPC185466
0.5785	Remote Similarity	NPC105800
0.5772	Remote Similarity	NPC281148
0.5763	Remote Similarity	NPC603026
0.576	Remote Similarity	NPC475486
0.575	Remote Similarity	NPC160415
0.5748	Remote Similarity	NPC475287
0.5748	Remote Similarity	NPC473824
0.5748	Remote Similarity	NPC610204
0.5746	Remote Similarity	NPC236638
0.5746	Remote Similarity	NPC294453
0.5746	Remote Similarity	NPC305981
0.5738	Remote Similarity	NPC222580
0.5736	Remote Similarity	NPC475209
0.5736	Remote Similarity	NPC257211
0.5733	Remote Similarity	NPC23020
0.5726	Remote Similarity	NPC218954
0.5714	Remote Similarity	NPC210729
0.5714	Remote Similarity	NPC225791
0.5714	Remote Similarity	NPC475514
0.5714	Remote Similarity	NPC82931
0.5704	Remote Similarity	NPC261506
0.5704	Remote Similarity	NPC309223
0.5704	Remote Similarity	NPC4328
0.5704	Remote Similarity	NPC476991
0.5702	Remote Similarity	NPC10607
0.5702	Remote Similarity	NPC2370
0.5692	Remote Similarity	NPC480423
0.5691	Remote Similarity	NPC488515
0.569	Remote Similarity	NPC48499
0.5685	Remote Similarity	NPC475394
0.5685	Remote Similarity	NPC485564
0.5682	Remote Similarity	NPC470518
0.568	Remote Similarity	NPC80986
0.5652	Remote Similarity	NPC90856
0.5649	Remote Similarity	NPC46823
0.5635	Remote Similarity	NPC329976
0.563	Remote Similarity	NPC472949
0.563	Remote Similarity	NPC488561
0.5625	Remote Similarity	NPC313110
0.562	Remote Similarity	NPC142151
0.562	Remote Similarity	NPC267694
0.5616	Remote Similarity	NPC124828
0.5615	Remote Similarity	NPC603137
0.56	Remote Similarity	NPC324875
0.56	Remote Similarity	NPC292677
0.56	Remote Similarity	NPC291903
0.5593	Remote Similarity	NPC59804
0.5591	Remote Similarity	NPC605294
0.5588	Remote Similarity	NPC144644
0.5588	Remote Similarity	NPC37860
0.5588	Remote Similarity	NPC170407
0.558	Remote Similarity	NPC250247
0.553	Remote Similarity	NPC473918
0.5528	Remote Similarity	NPC476113
0.5517	Remote Similarity	NPC214484
0.5517	Remote Similarity	NPC238935
0.55	Remote Similarity	NPC295371
0.55	Remote Similarity	NPC473884
0.55	Remote Similarity	NPC39211
0.55	Remote Similarity	NPC51099
0.5484	Remote Similarity	NPC475504
0.5476	Remote Similarity	NPC606145
0.5462	Remote Similarity	NPC235405
0.5462	Remote Similarity	NPC56713
0.5462	Remote Similarity	NPC475516
0.5447	Remote Similarity	NPC104400
0.5447	Remote Similarity	NPC10320
0.5435	Remote Similarity	NPC70809
0.5433	Remote Similarity	NPC295823
0.5433	Remote Similarity	NPC174720
0.5433	Remote Similarity	NPC475467

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC283417 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6797
0.1-0.2	2299
0.2-0.3	47
0.3-0.4	5
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data