NPASS Compound

Natural Product: NPC210729

Natural Product ID	NPC210729
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Prosapogenin 4
IUPAC Name	n.a.
Synonyms	Concinnoside D; Prosapogenin 4
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL509569
PubChem CID	16681643
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 141149 0 0 0 0 0 0 0 0999 V2000 2.2819 -4.8518 -2.6876 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6539 -4.7853 -1.2462 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7513 -3.6991 -0.5623 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5073 -2.3846 -1.1182 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1055 -1.3720 -0.0876 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9522 -0.2397 -0.1360 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1930 -0.7468 0.3637 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8288 -1.5182 -0.7907 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7582 -1.8713 -1.8268 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4347 -0.7745 -2.5881 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4712 -2.6754 -0.3628 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0866 0.3439 0.8025 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2430 0.1375 1.3843 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3339 -0.4555 0.9579 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5172 -1.6089 1.8008 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3971 -2.5023 1.2477 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3206 -1.9155 0.2352 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7264 -0.4923 0.5094 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6355 0.3192 1.1921 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6473 1.5598 0.6126 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9812 2.5815 1.4759 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9895 3.5426 1.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6215 4.0558 0.3503 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7354 4.1194 -0.6507 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0278 4.3851 0.0956 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2706 3.2805 1.0937 C 0 0 1 0 0 0 0 0 0 0 0 0 10.8376 3.8953 2.2268 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0646 4.3666 -0.8304 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5748 5.1664 -1.5598 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8564 -0.5314 1.3200 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4947 -2.7045 0.2443 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7942 -1.0570 -0.1913 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0117 -1.2044 0.9173 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3908 0.1233 1.5248 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7516 0.6146 1.2617 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4477 -0.0430 0.0466 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4406 -1.4677 0.4298 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1112 -2.1186 0.6647 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8513 -3.0897 -0.4663 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2363 -3.0533 1.8958 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3308 -2.3496 -0.3759 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7318 -1.7971 -0.2520 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8519 -0.3536 -0.7750 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8725 0.4200 0.0283 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0053 1.8845 -0.2976 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3850 2.2325 0.1539 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4250 1.4642 0.0020 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2554 0.1568 -0.6506 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0596 -0.9563 0.0026 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9956 0.3352 -1.9839 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1209 1.2934 -1.9710 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6558 1.8559 -0.7347 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7322 1.9878 0.4309 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2598 1.5529 1.7459 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7190 1.9139 1.9369 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4688 0.6155 2.2702 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9751 2.8606 3.0711 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3583 2.4590 0.7000 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0781 1.3956 -0.3763 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7684 3.5957 0.1456 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1414 3.2756 -1.0682 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9930 3.8999 -2.1151 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2246 0.6273 -2.6064 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5264 -0.4672 -2.2376 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6968 0.4074 -1.1273 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9031 -6.0384 -0.6546 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2203 -3.8942 -3.1930 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0772 -5.4877 -3.1806 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3593 -5.4873 -2.7755 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7051 -2.4807 -1.8920 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2928 -1.7910 0.9179 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9204 -1.4762 1.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5563 -0.9069 -1.3476 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1518 -2.7031 -2.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1814 -0.6272 -3.2262 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2854 -2.8325 -0.9045 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4577 0.9954 1.5059 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2372 1.0870 -0.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4338 -0.8661 -0.0399 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0305 -2.9255 2.0823 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9025 -3.3912 0.8004 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9308 -2.0409 -0.8186 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9739 -0.0522 -0.5027 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8908 0.3576 2.2788 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1574 2.1277 2.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2788 5.1017 0.5167 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8195 3.4122 -0.0637 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8382 3.2039 -1.2551 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0264 5.3842 0.5741 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0195 2.6037 0.6913 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5949 3.3411 2.5677 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6906 3.6093 -0.7160 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0409 5.9802 -1.2274 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0989 -1.4474 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1976 -3.6415 0.3091 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -1.6443 1.6917 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4010 0.8480 1.1642 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2408 0.1215 2.6368 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4215 0.3723 2.1336 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7317 1.7068 1.1849 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9396 -1.4625 1.4557 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6014 -2.6072 -1.4050 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6366 -3.8691 -0.5593 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0487 -3.6771 -0.1309 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2218 -3.2903 2.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7044 -2.4043 2.6862 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8596 -3.9279 1.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4009 -3.3169 0.2215 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0066 -2.6407 -1.3563 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8832 -1.7295 0.8586 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3410 -2.5206 -0.7713 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2034 0.3264 1.0998 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2341 2.5289 0.1166 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9869 2.0858 -1.4180 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4479 3.2306 0.6435 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1453 -0.7082 0.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0871 -1.7607 -0.7651 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7684 -1.2372 0.9956 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3516 -0.6459 -2.3625 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3193 0.6878 -2.7944 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9550 2.1438 -2.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6279 3.1219 0.6020 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7314 2.1185 2.5837 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0589 0.5078 2.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3899 0.5080 1.6689 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7525 0.5749 3.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8410 -0.2646 1.9935 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0773 2.8030 3.2838 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4720 2.4634 3.9736 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6838 3.8928 2.8298 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4363 2.5497 0.8911 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6841 1.5800 -1.2888 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1508 0.3963 0.0135 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8867 0.3331 -3.4746 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3655 0.4439 -2.7904 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5969 -1.0842 -2.4394 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3286 -1.0493 -2.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3202 1.1430 -1.6814 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3072 -0.3849 -1.8004 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7968 1.0612 -0.8921 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3141 -6.0766 0.2470 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 8 11 1 0 7 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 24 29 1 0 18 30 1 0 17 31 1 0 5 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 37 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 47 48 1 0 48 49 1 1 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 55 57 1 0 55 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 2 0 51 63 1 0 43 64 1 6 36 65 1 6 2 66 1 0 9 4 1 0 19 14 1 0 26 21 1 0 38 33 1 0 48 43 1 0 59 52 1 0 44 36 1 0 53 47 1 0 52 61 1 6 1 67 1 0 1 68 1 0 1 69 1 0 4 70 1 6 5 71 1 1 7 72 1 1 8 73 1 6 9 74 1 6 10 75 1 0 11 76 1 0 12 77 1 0 12 78 1 0 14 79 1 6 16 80 1 0 16 81 1 0 17 82 1 6 18 83 1 6 19 84 1 1 21 85 1 1 23 86 1 0 23 87 1 0 24 88 1 6 25 89 1 1 26 90 1 6 27 91 1 0 28 92 1 0 29 93 1 0 30 94 1 0 31 95 1 0 33 96 1 1 34 97 1 0 34 98 1 0 35 99 1 0 35100 1 0 37101 1 1 39102 1 0 39103 1 0 39104 1 0 40105 1 0 40106 1 0 40107 1 0 41108 1 0 41109 1 0 42110 1 0 42111 1 0 44112 1 1 45113 1 0 45114 1 0 46115 1 0 49116 1 0 49117 1 0 49118 1 0 50119 1 0 50120 1 0 51121 1 6 53122 1 1 54123 1 0 54124 1 0 56125 1 0 56126 1 0 56127 1 0 57128 1 0 57129 1 0 57130 1 0 58131 1 1 59132 1 0 59133 1 0 63134 1 0 64135 1 0 64136 1 0 64137 1 0 65138 1 0 65139 1 0 65140 1 0 66141 1 0 M END

Standard InCHIKey	HCPJVMUCDGEUPL-PYRSKJNPSA-N
Standard InCHI	InChI=1S/C48H75NO17/c1-21(50)49-32-36(57)35(56)26(20-62-41-38(34(55)25(52)19-61-41)66-40-37(58)33(54)24(51)18-60-40)63-39(32)64-30-12-13-45(6)27(44(30,4)5)11-14-46(7)28(45)10-9-22-23-15-43(2,3)31-17-48(23,42(59)65-31)29(53)16-47(22,46)8/h9,23-41,51-58H,10-20H2,1-8H3,(H,49,50)/t23-,24+,25-,26+,27-,28+,29+,30-,31-,32+,33-,34-,35+,36+,37+,38+,39-,40-,41-,45-,46+,47+,48+/m0/s1
SMILES	CC(=N[C@H]1[C@@H](O[C@@H]([C@H]([C@@H]1O)O)CO[C@@H]1OC[C@@H]([C@@H]([C@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@H]([C@]13[C@H]2CC(C)(C)[C@H](C1)OC3=O)O)C)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	937.5	Volume:	914.277 ? Van der Waals volume.
Dense:	1.025	LogP:	0.941 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.768 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.994 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	49.0
TPSA:	276.11 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.055	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.804	Fsp³:	0.917
MCE-18:	251.978 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.948	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.031	Promiscuous compounds:	0.048

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.12	MDCK Permeability:	-5.171
Pgp-inhibitor:	0.0	Pgp-substrate:	0.292
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.142
20% Bioavailability (F20%):	0.459	30% Bioavailability (F30%):	0.976
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.044	MRP1:	0.032
Plasma Protein Binding (PPB):	72.145%	Volume Distribution (VD):	-0.41
Fu:	19.717% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.005
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.786
HLM stability:	0.136 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.188

Half-life (T1/2):

2.749

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.022
Human Hepatotoxicity (H-HT):	0.991	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.987	Rat Oral Acute Toxicity:	0.022
Maximum Recommended Daily Dose:	0.021	Skin Sensitization:	1.0
Carcinogencity:	0.35	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.008
Drug-induced Neurotoxicity:	0.005	Ototoxicity:	0.991
Hematotoxicity:	0.748	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.998	RPMI-8226 Immunitoxicity:	0.162
A549 Cytotoxicity:	0.64	Hek293 Cytotoxicity:	0.531
BCF:	1.328 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.921 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.701 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.829 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	bark	n.a.	PMID[15283458]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	stem	n.a.	PMID[15577257]
NPO17211	Albizia inundata	Species	Fabaceae	Eukaryota	n.a.	aerial part	n.a.	PMID[21314099]
NPO17211	Albizia inundata	Species	Fabaceae	Eukaryota	aerial parts	Primavera, Department Patino, Province of Formosa, Argentina (lat. 27S, long. 58W)	1999-AUG	PMID[21314099]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9051910]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO17211	Albizia inundata	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	3
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	IC50	>	10.0	ug.mL-1	PMID[9051910]
NPT169	Cell line	B16-F10	Mus musculus	IC50	>	20000.0	nM	PMID[21314099]
NPT170	Cell line	SK-MEL-28	Homo sapiens	IC50	>	20000.0	nM	PMID[21314099]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	20000.0	nM	PMID[21314099]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC210729 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21878
0.1-0.2	24098
0.2-0.3	2897
0.3-0.4	592
0.4-0.5	275
0.5-0.6	88
0.6-0.7	18
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC82931
0.9109	High Similarity	NPC172365
0.8218	Intermediate Similarity	NPC232237
0.7523	Intermediate Similarity	NPC207738
0.7453	Intermediate Similarity	NPC105800
0.7168	Intermediate Similarity	NPC200788
0.7064	Intermediate Similarity	NPC488517
0.6842	Remote Similarity	NPC280941
0.6842	Remote Similarity	NPC235772
0.6727	Remote Similarity	NPC488526
0.661	Remote Similarity	NPC243680
0.6562	Remote Similarity	NPC120667
0.6562	Remote Similarity	NPC278272
0.6475	Remote Similarity	NPC488618
0.6429	Remote Similarity	NPC488619
0.6348	Remote Similarity	NPC145899
0.6338	Remote Similarity	NPC113620
0.625	Remote Similarity	NPC100612
0.6207	Remote Similarity	NPC488620
0.6194	Remote Similarity	NPC489208
0.6154	Remote Similarity	NPC75318
0.6107	Remote Similarity	NPC489209
0.6081	Remote Similarity	NPC265699
0.6042	Remote Similarity	NPC482013
0.6034	Remote Similarity	NPC73829
0.5887	Remote Similarity	NPC603137
0.5882	Remote Similarity	NPC174336
0.5878	Remote Similarity	NPC482010
0.582	Remote Similarity	NPC475119
0.582	Remote Similarity	NPC185466
0.5789	Remote Similarity	NPC102505
0.5789	Remote Similarity	NPC488514
0.5785	Remote Similarity	NPC104137
0.5785	Remote Similarity	NPC26626
0.5732	Remote Similarity	NPC187497
0.5726	Remote Similarity	NPC164389
0.5714	Remote Similarity	NPC283417
0.5714	Remote Similarity	NPC200049
0.5691	Remote Similarity	NPC288205
0.5691	Remote Similarity	NPC51465
0.5659	Remote Similarity	NPC13998
0.5612	Remote Similarity	NPC475177
0.5583	Remote Similarity	NPC488515
0.5563	Remote Similarity	NPC322904
0.5563	Remote Similarity	NPC329893
0.552	Remote Similarity	NPC610204
0.5517	Remote Similarity	NPC300655
0.5517	Remote Similarity	NPC13989
0.5517	Remote Similarity	NPC196874
0.5504	Remote Similarity	NPC4749
0.5496	Remote Similarity	NPC271610
0.5496	Remote Similarity	NPC312650
0.5487	Remote Similarity	NPC1046
0.5474	Remote Similarity	NPC8524
0.5469	Remote Similarity	NPC475140
0.5462	Remote Similarity	NPC104400
0.5462	Remote Similarity	NPC10320
0.5455	Remote Similarity	NPC119794
0.5435	Remote Similarity	NPC33012
0.542	Remote Similarity	NPC488308
0.5405	Remote Similarity	NPC478559
0.5405	Remote Similarity	NPC478560
0.5397	Remote Similarity	NPC473824
0.5385	Remote Similarity	NPC85154
0.5385	Remote Similarity	NPC484831
0.5385	Remote Similarity	NPC488201
0.5385	Remote Similarity	NPC484830
0.5373	Remote Similarity	NPC309223
0.5373	Remote Similarity	NPC482012
0.5369	Remote Similarity	NPC222951
0.5306	Remote Similarity	NPC475584
0.5306	Remote Similarity	NPC475152
0.5303	Remote Similarity	NPC265841
0.5303	Remote Similarity	NPC286457
0.5299	Remote Similarity	NPC480420
0.5294	Remote Similarity	NPC220160
0.5289	Remote Similarity	NPC63159
0.5285	Remote Similarity	NPC37134
0.5274	Remote Similarity	NPC484829
0.5248	Remote Similarity	NPC164349
0.5242	Remote Similarity	NPC481079
0.5242	Remote Similarity	NPC291903
0.5238	Remote Similarity	NPC233223
0.5238	Remote Similarity	NPC183816
0.5238	Remote Similarity	NPC43589
0.5234	Remote Similarity	NPC123522
0.5203	Remote Similarity	NPC64715
0.5203	Remote Similarity	NPC484832
0.5182	Remote Similarity	NPC488309
0.5156	Remote Similarity	NPC610461
0.5154	Remote Similarity	NPC123199
0.5154	Remote Similarity	NPC609305
0.5132	Remote Similarity	NPC475444
0.5132	Remote Similarity	NPC473679
0.5127	Remote Similarity	NPC488204
0.5124	Remote Similarity	NPC117714
0.5118	Remote Similarity	NPC606553
0.5115	Remote Similarity	NPC480423
0.5115	Remote Similarity	NPC602995
0.5113	Remote Similarity	NPC21691
0.5099	Remote Similarity	NPC311178
0.5096	Remote Similarity	NPC319719
0.5083	Remote Similarity	NPC469946
0.5075	Remote Similarity	NPC476774
0.5075	Remote Similarity	NPC476780
0.5072	Remote Similarity	NPC224381
0.5072	Remote Similarity	NPC482011
0.5068	Remote Similarity	NPC329878
0.5062	Remote Similarity	NPC476113
0.5039	Remote Similarity	NPC481078
0.5039	Remote Similarity	NPC609281
0.5037	Remote Similarity	NPC470876
0.5033	Remote Similarity	NPC23020

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC210729 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6601
0.1-0.2	2509
0.2-0.3	37
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data