NPASS Compound

Natural Product: NPC473679

Natural Product ID	NPC473679
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Kinmoonoside B
IUPAC Name	[(2S,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6S)-5-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-3-[(2E,6S)-6-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-5-[(2E)-6-hydroxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoyl]oxy-6-methyloxan-2-yl]oxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoyl]oxy-10-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	kinmoonoside B
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL449004
PubChem CID	44566291
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 295307 0 0 0 0 0 0 0 0999 V2000 3.0905 -6.9678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 -6.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3886 -5.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 -4.0753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6486 -0.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4200 3.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8296 3.8023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2709 4.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5314 5.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3824 6.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7667 7.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9158 8.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8800 7.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3572 7.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8441 9.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8083 10.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5093 11.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2855 10.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7986 8.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8344 7.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1334 6.7242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0976 9.3732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2855 11.5328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5846 12.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 11.5328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5846 13.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 14.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 16.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 17.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 19.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3836 19.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1336 17.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3836 19.0328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 20.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2855 14.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9865 15.2828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9516 9.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5256 9.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0648 9.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5481 3.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 -3.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 -7.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3405 -9.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0105 -10.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -9.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9200 -11.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3296 -10.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4786 -11.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2286 -10.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9786 -8.9366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2286 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6382 -7.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8986 -5.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7496 -4.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3400 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0796 -6.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6700 -6.1603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0796 -3.7189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8986 -3.7189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2181 -13.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -13.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -12.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9095 -13.8598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -15.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -15.6718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -17.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5800 -16.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1704 -16.1230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1386 -18.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5481 -17.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -16.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2181 -16.6360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8086 -19.0774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -19.0774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5586 -14.8239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7181 -13.0119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 1.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9095 -2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0586 -3.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7981 -4.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0586 -6.0037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4681 -3.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0586 -1.1209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4681 -1.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7286 -0.1567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1382 0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3882 1.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2872 -0.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0268 -2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6172 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3672 -3.8971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5268 -2.0850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2768 -3.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4258 -2.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.8354 -2.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0958 -1.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3563 0.0215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.0958 -4.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9468 -5.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5372 -4.8613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2768 -6.3385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.0958 -6.3385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.5054 -3.8971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0372 0.6912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5372 0.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0044 0.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7544 1.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7507 2.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3804 2.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9132 1.8711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0007 4.0921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.7581 2.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7618 3.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3509 -8.4450 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2753 -4.8546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2037 -7.1527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 -6.3385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2395 -1.1209 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2538 -0.2595 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 2.7762 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9410 6.2437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4794 7.7178 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7147 5.6719 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7309 6.5100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4469 8.5406 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3572 6.2346 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3214 11.7028 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2593 12.3423 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0959 9.6013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2103 11.7932 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7200 10.4714 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7628 7.4742 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3214 6.0646 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1334 5.2242 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2805 10.8620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1827 13.7828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3724 15.8499 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3948 16.2156 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3836 17.5328 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3390 17.1698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2864 20.2307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6336 17.7337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5476 16.3529 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4809 20.2307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3724 20.7156 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3948 20.7156 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8836 22.0328 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5355 13.2337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8716 15.9135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9865 16.7828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2890 11.2338 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4898 10.6609 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2066 8.1753 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2479 10.8454 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4557 9.0256 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9465 10.8010 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3744 2.3309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8196 5.0769 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1583 1.8571 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7580 -0.8169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7580 0.8169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2388 -1.4819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0982 -4.5546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8991 -2.9329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -4.4101 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0363 -5.3695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9183 -2.1098 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1409 -3.4055 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4991 -2.6503 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7947 -1.3259 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4134 -1.1562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7044 -6.5205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7044 -3.8718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2730 -7.5922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6683 -6.0070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2137 -9.2666 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0905 -8.3073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0972 -8.9922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5456 -5.1708 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3895 -7.7238 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8497 -7.0329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6595 -5.9822 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3547 -4.9989 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1491 -8.7584 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8816 -6.5807 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9895 -10.5705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6778 -11.0679 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3563 -8.4743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9309 -10.1193 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5068 -10.6752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5760 -11.0091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2709 -12.0477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4646 -11.4465 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8882 -12.0477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8478 -9.6496 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5277 -10.9856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9706 -8.4545 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6486 -4.3483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3082 -6.1603 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9996 -3.3841 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8512 -5.0133 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3296 -7.9724 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2314 -4.7259 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6700 -3.2059 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6382 -2.2417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4786 -14.4891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9270 -14.7385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -12.0477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0078 -14.5013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2395 -18.4481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0930 -15.2265 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0670 -18.0455 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0214 -17.0872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8886 -19.4123 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0481 -17.6002 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8507 -15.0440 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3672 -15.6718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2181 -19.5904 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -20.5546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1452 -16.2659 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4681 -14.3109 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1858 3.3118 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8406 0.4756 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5691 2.3251 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9877 2.5158 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9875 2.8547 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5942 4.2726 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1595 -0.7860 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1007 -1.9703 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2981 -4.5264 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4681 -6.5167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8164 -2.9048 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0548 -3.0758 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0198 1.5699 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5861 2.5581 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0891 0.9054 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6382 2.9544 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6237 -1.2889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2872 -3.5623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7356 -3.8116 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8226 -4.2601 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0332 -4.2229 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.3354 -2.9329 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6186 -1.1952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5730 -1.7162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.8179 0.3589 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8458 -5.7092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3607 -6.7551 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0372 -4.8613 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2997 -7.4356 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8354 -7.8157 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.6544 -4.8613 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5634 -0.8086 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.0664 0.9512 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8478 3.8161 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9169 3.6096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0529 3.0999 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7507 5.3912 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.8729 1.7894 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7741 3.9252 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2291 3.5959 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 9 7 1 1 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 26 29 1 0 25 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 2 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 37 40 1 0 37 41 1 0 33 42 1 0 42 43 1 0 19 44 1 0 44 45 2 0 19 46 1 0 15 47 1 0 47 48 1 0 11 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 57 61 1 6 56 62 1 1 56 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 1 66 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 71 73 1 0 70 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 84 87 1 0 83 88 1 0 77 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 92 93 1 0 93 94 1 0 94 95 1 0 95 96 1 0 96 97 1 0 95 98 1 0 98 99 1 0 99100 1 0 100101 1 0 99102 1 0 98103 1 0 90104 1 0 89105 1 0 49106 1 0 49107 1 0 5108 1 0 108109 1 0 109110 1 0 110111 1 0 109112 1 0 108113 1 0 113114 1 0 114115 1 0 115116 1 0 116117 1 0 116118 1 0 118119 1 0 119120 1 0 120121 1 0 119122 1 0 122123 1 0 123124 1 0 124125 1 0 125126 1 0 126127 1 0 125128 1 0 128129 1 0 129130 1 0 130131 1 0 129132 1 0 128133 1 0 118134 1 0 134135 1 0 135136 1 0 136137 1 0 137138 1 0 138139 1 0 139140 1 0 138141 1 0 137142 1 0 142143 1 0 110 3 1 0 120114 1 0 130123 1 0 139135 1 0 59 9 1 0 71 65 1 0 91 75 1 0 100 93 1 0 51 9 1 0 57 52 1 0 85 80 1 0 27 21 1 0 66 55 1 0 1144 1 0 2145 1 0 2146 1 0 3147 1 6 5148 1 6 10149 1 0 10150 1 0 11151 1 6 16152 1 0 17153 1 0 17154 1 0 18155 1 0 18156 1 0 21157 1 6 23158 1 6 24159 1 0 24160 1 0 24161 1 0 25162 1 1 26163 1 6 27164 1 1 28165 1 0 29166 1 0 34167 1 0 35168 1 0 35169 1 0 36170 1 0 36171 1 0 38172 1 0 39173 1 0 39174 1 0 40175 1 0 41176 1 0 41177 1 0 41178 1 0 42179 1 0 42180 1 0 43181 1 0 44182 1 0 45183 1 0 45184 1 0 46185 1 0 46186 1 0 46187 1 0 47188 1 0 47189 1 0 48190 1 0 50191 1 0 50192 1 0 51193 1 1 53194 1 0 54195 1 0 54196 1 0 55197 1 6 58198 1 0 58199 1 0 59200 1 1 60201 1 0 61202 1 0 61203 1 0 61204 1 0 62205 1 0 62206 1 0 62207 1 0 63208 1 0 63209 1 0 64210 1 0 64211 1 0 65212 1 6 67213 1 0 67214 1 0 67215 1 0 68216 1 0 68217 1 0 69218 1 0 69219 1 0 70220 1 6 72221 1 0 72222 1 0 72223 1 0 73224 1 0 73225 1 0 73226 1 0 75227 1 6 77228 1 6 78229 1 0 78230 1 0 80231 1 1 82232 1 0 82233 1 0 83234 1 1 84235 1 1 85236 1 6 86237 1 0 87238 1 0 88239 1 0 89240 1 1 90241 1 6 91242 1 1 93243 1 1 95244 1 1 96245 1 0 96246 1 0 97247 1 0 98248 1 6 99249 1 1 100250 1 6 101251 1 0 102252 1 0 103253 1 0 104254 1 0 105255 1 0 106256 1 0 106257 1 0 106258 1 0 107259 1 0 107260 1 0 107261 1 0 108262 1 1 109263 1 6 110264 1 1 111265 1 0 112266 1 0 114267 1 1 116268 1 6 117269 1 0 117270 1 0 117271 1 0 118272 1 1 119273 1 6 120274 1 6 121275 1 0 123276 1 1 125277 1 1 126278 1 0 126279 1 0 127280 1 0 128281 1 6 129282 1 1 130283 1 6 131284 1 0 132285 1 0 133286 1 0 135287 1 1 137288 1 1 138289 1 6 139290 1 1 140291 1 0 141292 1 0 142293 1 0 142294 1 0 143295 1 0 M END

Standard InCHIKey	ZWQIYSCVPSEGHA-SNMLLMHDSA-N
Standard InCHI	InChI=1S/C96H152O47/c1-14-91(9,125)24-16-18-42(32-98)79(123)137-73-39(3)129-85(71(120)66(73)115)143-92(10,15-2)25-17-19-41(31-97)78(122)135-55-30-96(88(124)142-87-77(64(113)59(108)48(35-101)133-87)141-84-72(121)75(139-82-69(118)62(111)57(106)46(33-99)130-82)74(40(4)128-84)138-81-68(117)60(109)49(36-102)132-81)44(28-89(55,5)6)43-20-21-52-93(11)26-23-54(90(7,8)51(93)22-27-94(52,12)95(43,13)29-53(96)104)136-86-76(140-83-70(119)63(112)58(107)47(34-100)131-83)65(114)61(110)50(134-86)38-127-80-67(116)56(105)45(103)37-126-80/h14-15,18-20,39-40,44-77,80-87,97-121,125H,1-2,16-17,21-38H2,3-13H3/b41-19+,42-18+/t39-,40+,44+,45+,46-,47-,48-,49+,50-,51+,52-,53-,54+,55+,56+,57-,58-,59-,60+,61-,62+,63+,64+,65+,66-,67-,68-,69-,70-,71-,72-,73-,74+,75+,76-,77-,80+,81-,82+,83+,84+,85+,86+,87+,91?,92-,93+,94-,95-,96-/m1/s1
SMILES	OC[C@H]1O[C@@H](OC(=O)[C@@]23C[C@H](OC(=O)/C(=C/CC[C@](O[C@@H]4O[C@H](C)[C@H]([C@@H]([C@H]4O)O)OC(=O)/C(=C/CCC(C=C)(O)C)/CO)(C=C)C)/CO)C(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(C[C@H]2O)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H](C2(C)C)O[C@@H]2O[C@H](CO[C@@H]3OC[C@@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@H]1O[C@H]([C@@H]([C@H]1O)O)CO

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	fruits	myanmar	n.a.	PMID[11141109]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell line	HT-1080	Homo sapiens	ED50	=	0.7	uM	PMID[20022253]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473679 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25234
0.1-0.2	21567
0.2-0.3	2119
0.3-0.4	608
0.4-0.5	260
0.5-0.6	33
0.6-0.7	8
0.7-0.8	0
0.8-0.85	10
0.85-0.9	3
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC475444
0.903	High Similarity	NPC475177
0.8733	High Similarity	NPC174336
0.8521	High Similarity	NPC196874
0.8506	High Similarity	NPC187497
0.8446	Intermediate Similarity	NPC322904
0.8333	Intermediate Similarity	NPC319719
0.8288	Intermediate Similarity	NPC222951
0.8252	Intermediate Similarity	NPC329878
0.817	Intermediate Similarity	NPC488201
0.8069	Intermediate Similarity	NPC233223
0.8069	Intermediate Similarity	NPC183816
0.8042	Intermediate Similarity	NPC484830
0.8014	Intermediate Similarity	NPC300655
0.8	Intermediate Similarity	NPC484829
0.7986	Intermediate Similarity	NPC329893
0.7908	Intermediate Similarity	NPC324933
0.7895	Intermediate Similarity	NPC100612
0.7881	Intermediate Similarity	NPC113620
0.7852	Intermediate Similarity	NPC311178
0.7756	Intermediate Similarity	NPC488204
0.7692	Intermediate Similarity	NPC265699
0.7584	Intermediate Similarity	NPC43589
0.75	Intermediate Similarity	NPC478559
0.75	Intermediate Similarity	NPC478560
0.7312	Intermediate Similarity	NPC488202
0.7312	Intermediate Similarity	NPC488200
0.72	Intermediate Similarity	NPC484831
0.7124	Intermediate Similarity	NPC220838
0.6933	Remote Similarity	NPC488203
0.6752	Remote Similarity	NPC13989
0.6731	Remote Similarity	NPC45606
0.625	Remote Similarity	NPC488620
0.6242	Remote Similarity	NPC23020
0.6127	Remote Similarity	NPC207738
0.6036	Remote Similarity	NPC472270
0.6036	Remote Similarity	NPC112492
0.5966	Remote Similarity	NPC488513
0.5858	Remote Similarity	NPC488619
0.5855	Remote Similarity	NPC470876
0.5799	Remote Similarity	NPC488618
0.5793	Remote Similarity	NPC472268
0.5743	Remote Similarity	NPC123522
0.5686	Remote Similarity	NPC286457
0.566	Remote Similarity	NPC489209
0.5644	Remote Similarity	NPC489208
0.5641	Remote Similarity	NPC309223
0.564	Remote Similarity	NPC482013
0.5578	Remote Similarity	NPC104137
0.5578	Remote Similarity	NPC26626
0.5494	Remote Similarity	NPC33012
0.5455	Remote Similarity	NPC85154
0.5432	Remote Similarity	NPC8524
0.5404	Remote Similarity	NPC102505
0.5404	Remote Similarity	NPC488514
0.5385	Remote Similarity	NPC13998
0.5379	Remote Similarity	NPC105800
0.5375	Remote Similarity	NPC482010
0.5371	Remote Similarity	NPC472269
0.5357	Remote Similarity	NPC297950
0.531	Remote Similarity	NPC232237
0.5287	Remote Similarity	NPC473452
0.526	Remote Similarity	NPC603137
0.5197	Remote Similarity	NPC172365
0.5197	Remote Similarity	NPC185466
0.5185	Remote Similarity	NPC220160
0.5132	Remote Similarity	NPC210729
0.5132	Remote Similarity	NPC82931
0.5123	Remote Similarity	NPC70809
0.5033	Remote Similarity	NPC481079

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473679 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7963
0.1-0.2	1157
0.2-0.3	28
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data