NPASS Compound

Structure

NPC484830 OpenBabel06302216152D 119130 0 0 1 0 0 0 0 0999 V2000 -9.2759 1.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4230 0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5701 1.2212 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0625 2.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7172 0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8643 1.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0114 0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1584 1.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1584 2.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3055 2.6985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3055 0.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4526 1.2212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3055 -0.2561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1584 -0.7485 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1584 -1.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0114 -2.2258 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8643 -1.7334 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8643 -0.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0114 -0.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5189 0.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5038 0.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7172 -2.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5701 -1.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4230 -2.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4230 -3.2106 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.2759 -3.7031 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2759 -2.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1288 -3.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9817 -3.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9817 -4.6879 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1288 -5.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6212 -6.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6363 -6.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2759 -4.6879 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4230 -5.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5701 -4.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5701 -3.7031 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8643 -4.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7172 -3.2106 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7172 -4.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8643 -3.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0114 -3.2106 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1584 -3.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8346 -5.1803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8346 -6.1652 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9817 -6.6576 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9817 -7.6424 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8346 -8.1349 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.6875 -7.6424 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5404 -8.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5404 -9.1197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3933 -9.6121 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.3933 -10.5970 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.2462 -11.0894 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.0991 -10.5970 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.0991 -9.6121 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.9520 -9.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.2462 -9.1197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.9520 -11.0894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.2462 -12.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5404 -11.0894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5404 -12.0743 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.6875 -12.5667 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.6875 -13.5515 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.5404 -14.0440 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.3933 -13.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.3933 -12.5667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5404 -15.0288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8346 -14.0440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8346 -12.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6875 -6.6576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8346 -9.1197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1288 -8.1349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1288 -6.1652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6186 -3.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8735 -4.5699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6673 -3.3637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9709 -4.0601 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0196 -3.8052 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3232 -4.5016 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5781 -5.4528 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5294 -5.7077 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7843 -6.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7356 -6.9139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2258 -5.0114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1183 -6.1492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6281 -4.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7647 -2.8539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1866 -2.5990 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4415 -1.6477 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3928 -1.3928 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0892 -2.0892 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8343 -3.0405 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5307 -3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8830 -3.2954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0405 -1.8343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7369 -2.5307 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7096 -2.3766 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1567 -3.2541 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4603 -3.9505 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6144 -4.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8490 -5.5430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5828 -3.5034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1294 -3.4082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1567 -1.4991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6477 -0.4415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9513 0.2549 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2062 1.2062 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5098 1.9026 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4415 1.6477 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6964 0.6964 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6477 0.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9026 -0.5098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1379 2.3441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7647 2.8539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1575 1.4611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2549 -0.9513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0776 2.0741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 3 4 1 1 0 0 0 3 5 1 0 0 0 0 3119 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 8 9 1 0 0 0 0 8 11 1 0 0 0 0 9 10 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 14 13 1 1 0 0 0 14 15 1 0 0 0 0 14 19 1 0 0 0 0 15 16 1 0 0 0 0 16 42 1 0 0 0 0 16 17 1 0 0 0 0 16 75 1 1 0 0 0 17 18 1 6 0 0 0 17 22 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 19 21 1 0 0 0 0 22 39 1 0 0 0 0 22 23 2 0 0 0 0 23 24 1 0 0 0 0 25 24 1 1 0 0 0 25 26 1 0 0 0 0 25 37 1 0 0 0 0 26 34 1 0 0 0 0 26 27 1 1 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 44 1 1 0 0 0 31 32 1 0 0 0 0 31 33 1 0 0 0 0 31 34 1 0 0 0 0 34 35 1 1 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 1 0 0 0 37 39 1 0 0 0 0 39 40 1 6 0 0 0 39 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 6 0 0 0 45 44 1 1 0 0 0 45 46 1 0 0 0 0 45 71 1 0 0 0 0 46 47 1 0 0 0 0 46 74 1 6 0 0 0 47 48 1 0 0 0 0 47 73 1 1 0 0 0 48 49 1 0 0 0 0 48 72 1 6 0 0 0 49 50 1 1 0 0 0 49 71 1 0 0 0 0 50 51 1 0 0 0 0 52 51 1 1 0 0 0 52 53 1 0 0 0 0 52 58 1 0 0 0 0 53 54 1 0 0 0 0 53 61 1 6 0 0 0 54 55 1 0 0 0 0 54 60 1 1 0 0 0 55 56 1 0 0 0 0 55 59 1 1 0 0 0 56 57 1 1 0 0 0 56 58 1 0 0 0 0 62 61 1 1 0 0 0 62 63 1 0 0 0 0 62 67 1 0 0 0 0 63 64 1 0 0 0 0 63 70 1 6 0 0 0 64 65 1 0 0 0 0 64 69 1 1 0 0 0 65 66 1 0 0 0 0 65 68 1 6 0 0 0 66 67 1 0 0 0 0 75 76 2 0 0 0 0 75 77 1 0 0 0 0 78 77 1 1 0 0 0 78 79 1 0 0 0 0 78 85 1 0 0 0 0 79 80 1 0 0 0 0 79 88 1 6 0 0 0 80 81 1 0 0 0 0 80 87 1 1 0 0 0 81 82 1 0 0 0 0 81 86 1 6 0 0 0 82 83 1 1 0 0 0 82 85 1 0 0 0 0 83 84 1 0 0 0 0 89 88 1 1 0 0 0 89 90 1 0 0 0 0 89 95 1 0 0 0 0 90 91 1 0 0 0 0 90118 1 6 0 0 0 91 92 1 0 0 0 0 91106 1 6 0 0 0 92 93 1 0 0 0 0 92 96 1 1 0 0 0 93 94 1 6 0 0 0 93 95 1 0 0 0 0 97 96 1 1 0 0 0 97 98 1 0 0 0 0 97103 1 0 0 0 0 98 99 1 0 0 0 0 98105 1 6 0 0 0 99100 1 0 0 0 0 99104 1 1 0 0 0 100101 1 6 0 0 0 100103 1 0 0 0 0 101102 1 0 0 0 0 107106 1 6 0 0 0 107108 1 0 0 0 0 107114 1 0 0 0 0 108109 1 0 0 0 0 108117 1 1 0 0 0 109110 1 0 0 0 0 109116 1 6 0 0 0 110111 1 0 0 0 0 110115 1 1 0 0 0 111112 1 6 0 0 0 111114 1 0 0 0 0 112113 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	334.21
Volume:	356.058
LogP:	2.716
LogD:	2.774
LogS:	-3.427
# Rotatable Bonds:	0
TPSA:	77.76
# H-Bond Aceptor:	4
# H-Bond Donor:	3
# Rings:	3
# Heavy Atoms:	4

MedChem Properties

QED Drug-Likeness Score:	0.594
Synthetic Accessibility Score:	5.606
Fsp3:	0.75
Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Accepted
GSK Rule:	Accepted
BMS Rule:	0
Golden Triangle Rule:	Accepted
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-4.803
MDCK Permeability:	9.970377504942007e-06
Pgp-inhibitor:	0.014
Pgp-substrate:	0.295
Human Intestinal Absorption (HIA):	0.019
20% Bioavailability (F20%):	0.903
30% Bioavailability (F30%):	0.013

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.18
Plasma Protein Binding (PPB):	84.49854278564453%
Volume Distribution (VD):	1.46
Pgp-substrate:	11.206294059753418%

ADMET: Metabolism

CYP1A2-inhibitor:	0.027
CYP1A2-substrate:	0.272
CYP2C19-inhibitor:	0.022
CYP2C19-substrate:	0.736
CYP2C9-inhibitor:	0.016
CYP2C9-substrate:	0.373
CYP2D6-inhibitor:	0.006
CYP2D6-substrate:	0.216
CYP3A4-inhibitor:	0.144
CYP3A4-substrate:	0.289

ADMET: Excretion

Clearance (CL):	4.82
Half-life (T1/2):	0.416

ADMET: Toxicity

hERG Blockers:	0.013
Human Hepatotoxicity (H-HT):	0.506
Drug-inuced Liver Injury (DILI):	0.762
AMES Toxicity:	0.041
Rat Oral Acute Toxicity:	0.897
Maximum Recommended Daily Dose:	0.921
Skin Sensitization:	0.055
Carcinogencity:	0.621
Eye Corrosion:	0.005
Eye Irritation:	0.033
Respiratory Toxicity:	0.959

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC484830

Natural Product ID:	NPC484830
*Common Name:**	XWOLPEBCTZRWEQ-REPSLIDKSA-N
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	XWOLPEBCTZRWEQ-REPSLIDKSA-N
Standard InCHI:	InChI=1S/C80H128O39/c1-12-76(8,104)19-13-14-33(25-81)65(102)113-45-24-80(73(103)119-72-64(55(96)49(90)38(27-83)111-72)118-70-60(101)62(116-69-59(100)52(93)48(89)37(26-82)109-69)61(32(3)108-70)115-68-57(98)50(91)39(28-84)110-68)35(22-74(45,4)5)34-15-16-42-77(9)20-18-44(75(6,7)41(77)17-21-78(42,10)79(34,11)23-43(80)86)114-67-58(99)53(94)51(92)40(112-67)30-106-71-63(54(95)46(87)31(2)107-71)117-66-56(97)47(88)36(85)29-105-66/h12,14-15,31-32,35-64,66-72,81-101,104H,1,13,16-30H2,2-11H3/b33-14+/t31-,32+,35+,36-,37-,38-,39+,40-,41+,42-,43-,44+,45+,46+,47+,48-,49-,50+,51-,52+,53+,54+,55+,56-,57-,58-,59-,60-,61+,62+,63-,64-,66+,67+,68+,69+,70+,71-,72+,76+,77+,78-,79-,80-/m1/s1
SMILES:	C=C[C@@](C)(CC/C=C(CO)/C(=O)O[C@H]1C[C@]2([C@@H](CC1(C)C)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H]([C@@H](C)O2)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O1)O)O)O)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O[C@H]1[C@@H]([C@H]([C@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	n.a.
PubChem CID:	44448256
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40910	Pithecellobium lucidum	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[18095653]

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell Line	5

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT180	Cell Line	HCT-8	Homo sapiens	IC50	>	10000.0	nM	PMID[18095653]
NPT181	Cell Line	Bel-7402	Homo sapiens	IC50	=	2540.0	nM	PMID[18095653]
NPT547	Cell Line	BGC-823	Homo sapiens	IC50	>	10000.0	nM	PMID[18095653]
NPT81	Cell Line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[18095653]
NPT179	Cell Line	A2780	Homo sapiens	IC50	=	1230.0	nM	PMID[18095653]

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC484830 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	284
0.1-0.2	1580
0.2-0.3	4462
0.3-0.4	8075
0.4-0.5	11829
0.5-0.6	7879
0.6-0.7	5005
0.7-0.8	2329
0.8-0.85	625
0.85-0.9	537
0.9-0.95	59
0.95-1	33

Similarity Score	Similarity Level	Natural Product ID

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC484830 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	251
0.1-0.2	1724
0.2-0.3	3829
0.3-0.4	2177
0.4-0.5	653
0.5-0.6	314
0.6-0.7	155
0.7-0.8	26
0.8-0.85	17
0.85-0.9	4
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data