NPASS Compound

Structure

NPC311178 OpenBabel07101718312D 150163 0 0 1 0 0 0 0 0999 V2000 -16.2629 3.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8030 8.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1022 3.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3352 6.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.4907 7.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2045 -5.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3894 8.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4282 -5.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2098 3.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1917 3.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9105 -2.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8925 -2.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.7900 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4617 8.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5511 0.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8504 -1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.7719 3.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8030 7.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1022 5.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3171 4.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2519 5.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3352 4.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8504 1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7007 0.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7007 -1.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2519 -0.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1022 6.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.8080 3.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4015 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8504 -1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8504 2.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8504 -0.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5511 1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2626 -4.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8003 -0.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0402 -8.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7556 -1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5037 -1.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2519 4.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8442 5.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.4907 6.9087 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2045 -4.9096 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.8984 7.3645 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4797 -5.6574 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 0.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8504 1.4729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 12.7556 -0.4910 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0085 -5.3351 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1060 -1.4233 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9296 -8.7158 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6534 -1.4729 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5511 -1.4729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7007 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7007 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2519 -1.4729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5511 2.4548 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -17.3411 6.4178 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0549 -4.4187 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9052 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7028 -6.0294 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3601 -2.3718 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6239 -9.4101 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6534 -0.4910 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -17.3411 5.4359 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4487 -6.9779 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8030 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0549 -3.4367 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6658 -3.0661 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8984 5.6637 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0549 -0.4910 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4988 -8.9643 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9526 -0.4910 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5002 -7.2321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.4907 4.9449 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9165 5.6637 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5828 -5.1491 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3894 6.5141 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7854 -6.3517 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8369 -6.0975 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2045 -2.9458 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7173 -2.8119 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4015 3.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8623 5.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0549 -1.4729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9526 -1.4729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3452 -7.9945 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1941 -6.5377 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2771 -4.4547 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.6403 5.4359 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4255 6.5141 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3541 -3.4367 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4632 -1.8635 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0064 0.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7007 2.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4015 -1.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.7900 3.9630 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9526 7.3645 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5511 -0.4910 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8504 -0.4910 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7007 0.9819 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2111 -4.1325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7488 -0.9831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3921 -9.7861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6060 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5511 -0.4910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -18.1915 6.9087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9052 -4.9096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9052 0.9819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6513 -5.7753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3086 -2.6259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4703 -10.3799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5037 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -18.1915 4.9449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1430 -7.6722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8030 0.9819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9052 -2.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9199 -4.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3894 4.8133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2045 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3737 -9.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1022 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2460 -8.1805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.4907 3.9630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4255 4.8133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6343 -4.8949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5511 4.4187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3713 4.8133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8905 0.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9052 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5037 -2.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.6403 6.4178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3541 -4.4187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2256 -4.7089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9165 7.3645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0600 -5.5893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3754 -7.8409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1575 -1.1692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8030 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4015 2.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1022 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3713 6.5141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0396 -7.3002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1426 -6.7919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2045 -1.9639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0230 -3.5063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5147 -1.6093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.7900 4.9449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4436 6.5141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 18 2 0 0 0 0 2 19 2 0 0 0 0 3 40 1 0 0 0 0 4 41 1 0 0 0 0 9 95 1 0 0 0 0 10 95 1 0 0 0 0 11 96 1 0 0 0 0 12 96 1 0 0 0 0 16100 1 0 0 0 0 18 97 1 0 0 0 0 19 98 1 0 0 0 0 20 22 1 0 0 0 0 20 28 1 0 0 0 0 21 23 1 0 0 0 0 21 29 1 0 0 0 0 22 40 2 0 0 0 0 23 41 2 0 0 0 0 24 25 1 0 0 0 0 24 46 2 0 0 0 0 25 54 1 0 0 0 0 26 31 1 0 0 0 0 26 53 1 0 0 0 0 27 30 1 0 0 0 0 27 56 1 0 0 0 0 28 98 1 0 0 0 0 29 97 1 0 0 0 0 30 99 1 0 0 0 0 31100 1 0 0 0 0 32 47 1 0 0 0 0 32 95 1 0 0 0 0 33 55 1 0 0 0 0 33101 1 0 0 0 0 34 57 1 0 0 0 0 34102 1 0 0 0 0 35103 1 0 0 0 0 36104 1 0 0 0 0 37105 1 0 0 0 0 38 48 1 0 0 0 0 38131 1 0 0 0 0 39132 1 0 0 0 0 40 83 1 0 0 0 0 41 84 1 0 0 0 0 42 5 1 1 0 0 0 42 58 1 0 0 0 0 42133 1 0 0 0 0 43 6 1 1 0 0 0 43 59 1 0 0 0 0 43134 1 0 0 0 0 44 7 1 1 0 0 0 44 78 1 0 0 0 0 44136 1 0 0 0 0 45 8 1 6 0 0 0 45 79 1 0 0 0 0 45135 1 0 0 0 0 46 47 1 0 0 0 0 46101 1 0 0 0 0 47102 1 1 0 0 0 48 60 1 0 0 0 0 48106 1 6 0 0 0 49 35 1 6 0 0 0 49 61 1 0 0 0 0 49137 1 0 0 0 0 50 36 1 1 0 0 0 50 62 1 0 0 0 0 50139 1 0 0 0 0 51 37 1 1 0 0 0 51 63 1 0 0 0 0 51138 1 0 0 0 0 52 39 1 1 0 0 0 52 64 1 0 0 0 0 52140 1 0 0 0 0 53 96 1 0 0 0 0 53 99 1 6 0 0 0 54 99 1 6 0 0 0 54100 1 0 0 0 0 55102 1 1 0 0 0 55107 1 0 0 0 0 56 96 1 0 0 0 0 56142 1 6 0 0 0 57 95 1 0 0 0 0 57141 1 6 0 0 0 58 65 1 0 0 0 0 58108 1 6 0 0 0 59 68 1 0 0 0 0 59109 1 1 0 0 0 60 71 1 0 0 0 0 60110 1 1 0 0 0 61 66 1 0 0 0 0 61111 1 1 0 0 0 62 69 1 0 0 0 0 62112 1 6 0 0 0 63 72 1 0 0 0 0 63113 1 6 0 0 0 64 67 1 0 0 0 0 64114 1 6 0 0 0 65 75 1 0 0 0 0 65115 1 1 0 0 0 66 74 1 0 0 0 0 66116 1 6 0 0 0 67 73 1 0 0 0 0 67117 1 1 0 0 0 68 81 1 0 0 0 0 68118 1 1 0 0 0 69 82 1 0 0 0 0 69119 1 1 0 0 0 70 76 1 0 0 0 0 70 78 1 0 0 0 0 70120 1 1 0 0 0 71 85 1 0 0 0 0 71121 1 6 0 0 0 72 87 1 0 0 0 0 72122 1 1 0 0 0 73 86 1 0 0 0 0 73123 1 6 0 0 0 74 88 1 0 0 0 0 74124 1 1 0 0 0 75 90 1 0 0 0 0 75125 1 6 0 0 0 76 91 1 0 0 0 0 76126 1 6 0 0 0 77 80 1 0 0 0 0 77 89 1 0 0 0 0 77127 1 6 0 0 0 78143 1 6 0 0 0 79 80 1 0 0 0 0 79144 1 1 0 0 0 80145 1 6 0 0 0 81 92 1 0 0 0 0 81146 1 6 0 0 0 82 93 1 0 0 0 0 82147 1 6 0 0 0 83128 2 0 0 0 0 83141 1 0 0 0 0 84129 2 0 0 0 0 84143 1 0 0 0 0 85131 1 0 0 0 0 85146 1 1 0 0 0 86140 1 0 0 0 0 86142 1 1 0 0 0 87138 1 0 0 0 0 87144 1 6 0 0 0 88137 1 0 0 0 0 88145 1 6 0 0 0 89135 1 0 0 0 0 89147 1 1 0 0 0 90133 1 0 0 0 0 90149 1 1 0 0 0 91136 1 0 0 0 0 91150 1 1 0 0 0 92132 1 1 0 0 0 92134 1 0 0 0 0 93139 1 0 0 0 0 93148 1 1 0 0 0 94130 2 0 0 0 0 94148 1 0 0 0 0 97 13 1 6 0 0 0 97149 1 0 0 0 0 98 14 1 1 0 0 0 98150 1 0 0 0 0 99 15 1 6 0 0 0 100101 1 1 0 0 0 101 17 1 1 0 0 0 102 94 1 6 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	2155.02
Volume:	2053.796
LogP:	2.482
LogD:	1.165
LogS:	-2.519
# Rotatable Bonds:	37
TPSA:	741.56
# H-Bond Aceptor:	48
# H-Bond Donor:	25
# Rings:	14
# Heavy Atoms:	48

MedChem Properties

QED Drug-Likeness Score:	0.012
Synthetic Accessibility Score:	8.834
Fsp3:	0.873
Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted
GSK Rule:	Rejected
BMS Rule:	1
Golden Triangle Rule:	Rejected
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-6.573
MDCK Permeability:	0.007239074446260929
Pgp-inhibitor:	0.023
Pgp-substrate:	1.0
Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.0
30% Bioavailability (F30%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.351
Plasma Protein Binding (PPB):	46.34135818481445%
Volume Distribution (VD):	-0.83
Pgp-substrate:	20.70615005493164%

ADMET: Metabolism

CYP1A2-inhibitor:	0.0
CYP1A2-substrate:	0.063
CYP2C19-inhibitor:	0.0
CYP2C19-substrate:	0.051
CYP2C9-inhibitor:	0.0
CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0
CYP2D6-substrate:	0.006
CYP3A4-inhibitor:	0.104
CYP3A4-substrate:	0.0

ADMET: Excretion

Clearance (CL):	-2.505
Half-life (T1/2):	0.718

ADMET: Toxicity

hERG Blockers:	0.118
Human Hepatotoxicity (H-HT):	0.083
Drug-inuced Liver Injury (DILI):	0.013
AMES Toxicity:	0.023
Rat Oral Acute Toxicity:	0.021
Maximum Recommended Daily Dose:	0.527
Skin Sensitization:	0.042
Carcinogencity:	0.005
Eye Corrosion:	0.003
Eye Irritation:	0.003
Respiratory Toxicity:	0.134

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC311178

Natural Product ID:	NPC311178
*Common Name:**	Julibroside Ii
IUPAC Name:	[(2S,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6S)-5-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-[(2E,6S)-6-[(2S,3R,4R,5S,6R)-5-[(2E,6S)-2,6-dimethyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyocta-2,7-dienoyl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-2,6-dimethylocta-2,7-dienoyl]oxy-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms:	Julibroside II
Standard InCHIKey:	LKBSJWFTPPMQGM-PCIKECTOSA-N
Standard InCHI:	InChI=1S/C102H162O48/c1-18-97(13,149-90-75(125)65(115)58(108)42(5)133-90)29-21-23-41(4)84(129)143-78-44(7)136-91(76(126)70(78)120)150-98(14,19-2)28-20-22-40(3)83(128)141-57-34-102(94(130)148-93-82(69(119)62(112)50(36-104)139-93)147-89-77(127)80(145-88-74(124)66(116)61(111)49(35-103)137-88)79(45(8)135-89)144-87-72(122)63(113)51(37-105)138-87)47(32-95(57,9)10)46-24-25-54-99(15)30-27-56(96(11,12)53(99)26-31-100(54,16)101(46,17)33-55(102)107)142-86-73(123)67(117)64(114)52(140-86)39-132-92-81(68(118)59(109)43(6)134-92)146-85-71(121)60(110)48(106)38-131-85/h18-19,22-24,42-45,47-82,85-93,103-127H,1-2,20-21,25-39H2,3-17H3/b40-22+,41-23+/t42-,43-,44-,45+,47+,48-,49-,50-,51+,52-,53+,54-,55-,56+,57+,58-,59+,60+,61-,62-,63+,64-,65+,66+,67+,68+,69+,70-,71-,72-,73-,74-,75-,76-,77-,78-,79+,80+,81-,82-,85+,86+,87+,88+,89+,90+,91+,92-,93+,97-,98-,99+,100-,101-,102-/m1/s1
SMILES:	OC[C@H]1O[C@@H](OC(=O)[C@@]23C[C@H](OC(=O)/C(=C/CC[C@](O[C@@H]4O[C@H](C)[C@H]([C@@H]([C@H]4O)O)OC(=O)/C(=C/CC[C@](O[C@@H]4O[C@H](C)[C@H]([C@@H]([C@H]4O)O)O)(C=C)C)/C)(C=C)C)/C)C(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(C[C@H]2O)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H](C2(C)C)O[C@@H]2O[C@H](CO[C@@H]3O[C@H](C)[C@@H]([C@@H]([C@H]3O[C@@H]3OC[C@H]([C@@H]([C@H]3O)O)O)O)O)[C@H]([C@@H]([C@H]2O)O)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H]([C@@H]([C@H]1O)O)CO
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	CHEMBL504272
PubChem CID:	21638099
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9051910]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	stem	n.a.	PMID[15577257]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	bark	n.a.	PMID[15283458]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Showing 1 to 7 of 7 entries

Previous1Next

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Show entries

Search:

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference
No data available in table

Showing 0 to 0 of 0 entries

PreviousNext

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell Line	1

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell Line	KB	Homo sapiens	IC50	>	10.0	ug.mL-1	PMID[528385]

Showing 1 to 1 of 1 entries

Previous1Next

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC311178 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	285
0.1-0.2	1592
0.2-0.3	4535
0.3-0.4	8296
0.4-0.5	11731
0.5-0.6	7606
0.6-0.7	5010
0.7-0.8	2347
0.8-0.85	561
0.85-0.9	628
0.9-0.95	73
0.95-1	33

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC300655
1.0	High Similarity	NPC222951
1.0	High Similarity	NPC43589
0.9917	High Similarity	NPC196874
0.9917	High Similarity	NPC183816

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC311178 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	250
0.1-0.2	1748
0.2-0.3	3825
0.3-0.4	2179
0.4-0.5	634
0.5-0.6	311
0.6-0.7	152
0.7-0.8	29
0.8-0.85	13
0.85-0.9	9
0.9-0.95	0
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.856	High Similarity	NPD8328	Phase 3
0.84	Intermediate Similarity	NPD8516	Approved
0.84	Intermediate Similarity	NPD8517	Approved
0.84	Intermediate Similarity	NPD8515	Approved
0.8279	Intermediate Similarity	NPD8133	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data