NPASS Compound

Natural Product: NPC475119

Natural Product ID	NPC475119
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Acacic Acid Lactone 3-O-Beta-D-Xylopyranosyl(1->2)-Alpha-L-Arabinopyranosyl(1->6)-[Beta-D-Glucopyranosyl(1->2)]-Beta-D-Glucopyranoside
IUPAC Name	(3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-6-[[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL498819
PubChem CID	44566295
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 159167 0 0 0 0 0 0 0 0999 V2000 -10.6884 3.0488 -0.1620 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7872 2.8164 -1.3144 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3055 2.8076 -0.9782 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0226 1.7531 0.0624 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5503 1.6296 0.2552 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7217 2.3866 -0.3993 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2358 2.3297 -0.2897 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7891 1.8049 1.0059 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3657 1.2165 0.9632 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5685 2.0533 -0.0041 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1349 1.5861 -0.0778 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0506 0.1064 0.0705 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1659 -0.7209 -0.1234 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4395 -0.1691 0.4086 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1099 -1.0262 1.4510 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0657 -0.3236 2.3190 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7272 0.9253 1.7774 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0472 0.6051 1.1964 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2313 -0.6827 0.4325 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4672 -0.7011 -0.4204 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4786 0.3611 -0.3346 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9559 0.5519 -1.8167 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0999 1.4784 -1.9480 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2876 1.7093 -3.3177 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7058 -0.0876 0.3427 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5460 -0.7746 -0.3372 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0671 0.1513 1.6435 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1533 -1.9240 -0.1179 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0204 0.4855 2.3731 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0486 1.7650 3.0480 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2845 -0.9683 -1.6360 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8571 -2.0989 0.4752 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9977 -0.2503 -0.8952 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1698 -0.7690 -0.3643 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5452 -2.0316 -1.0824 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6415 -1.7655 -2.0753 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8402 -1.0168 -1.5037 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3870 -0.3840 -0.2254 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1354 0.2616 -0.5457 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2420 0.6802 0.3609 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4286 0.3174 0.8450 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4264 -0.1442 0.0824 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6472 0.8004 0.2361 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8093 1.0166 1.7451 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5493 -0.3020 2.4455 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7657 -1.4434 1.4765 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7865 -1.4282 0.5287 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3937 -0.4734 3.5419 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9208 1.9833 2.1593 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3024 1.9787 -0.3666 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0889 2.3391 -1.4376 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3723 2.6104 -2.7128 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0952 3.7705 -3.4188 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9217 5.0471 -2.6196 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9757 4.6444 -1.1513 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7634 3.5157 -1.0575 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7242 5.6771 -2.8794 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4322 3.5060 -3.5879 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0709 3.0868 -2.5090 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1281 -0.0412 -2.4882 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0402 -2.9893 -2.6296 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9662 -2.9677 -0.1742 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2864 -4.1712 -0.1719 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0336 -5.3812 -0.5303 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5929 -6.5818 0.2622 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6149 -6.3042 1.7555 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1910 -4.8641 2.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5097 -4.3460 0.9498 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3419 -3.9990 2.3993 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0057 -4.5618 3.5036 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8601 -7.2265 2.4627 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3798 -7.7041 0.0116 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8498 -5.7406 -1.8948 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6865 1.2649 2.3128 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9512 3.9391 -2.3464 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2195 3.2013 0.8147 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3752 3.9159 -0.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4214 2.1997 -0.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7902 2.6315 -1.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0725 3.7870 -0.5185 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5888 2.0292 0.9463 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1815 3.1395 -1.0799 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8351 1.7540 -1.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8741 3.3718 -0.4691 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5623 2.7610 1.6139 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9668 1.8983 -1.0255 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5957 3.1181 0.3095 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4630 2.1036 0.6845 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2647 1.9597 -1.0686 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5367 -0.1522 1.0572 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1736 -0.1029 -0.4473 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5556 -1.9081 0.9439 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2870 -1.4574 2.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9082 -1.0528 2.5354 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6331 -0.1431 3.3194 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3891 -0.9341 -0.2153 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3117 -1.5078 1.1685 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1842 -0.8923 -1.5065 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3325 -0.4709 -2.1369 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1024 0.7404 -2.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0244 1.0501 -1.5439 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3370 0.8298 -3.7977 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6792 -0.4857 2.1170 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4330 -2.6154 -0.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5987 -0.4965 2.3013 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6987 1.3028 2.5090 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4756 0.3220 3.3466 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3673 2.6770 3.0895 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8449 1.2395 3.9695 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0397 2.1999 3.0369 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6309 -1.8211 -1.8956 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0307 -0.0379 -2.1851 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3415 -1.2681 -1.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7379 -2.7267 0.5962 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2293 -1.9957 1.3855 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2117 -2.6036 -0.2709 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1279 -0.8674 0.7521 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6828 -2.3873 -1.7020 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2183 -1.1938 -2.9430 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6323 -1.7700 -1.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1667 -1.1759 0.5056 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6689 1.1836 1.2090 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3651 1.5397 -0.3771 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2195 -0.1471 -0.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4950 0.2643 -0.1789 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8280 1.3291 1.9727 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5078 -0.3539 2.8005 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7591 -1.3805 0.9824 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6844 -2.4319 2.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0759 0.0921 4.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8087 2.0474 3.1213 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8734 1.5729 -1.6163 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4060 1.7678 -3.4350 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6266 3.9080 -4.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8166 5.6725 -2.8097 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9639 4.3898 -0.7925 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3409 5.4744 -0.5435 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7953 6.6318 -2.7110 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9884 4.2585 -3.2507 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4900 2.3287 -2.3327 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0851 -0.5344 -3.3534 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0155 -3.1092 -2.4997 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5163 -4.0238 -1.0134 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1476 -5.2995 -0.3319 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5429 -6.8794 0.0299 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6591 -6.3942 2.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5017 -4.9053 2.9006 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0961 -3.9089 1.5993 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0223 -2.9918 2.6757 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7848 -5.0907 3.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9625 -6.8546 2.6631 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2214 -7.9711 -0.9200 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1809 -6.4477 -1.9873 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3759 0.2545 2.6628 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2464 1.7457 3.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7157 1.8513 2.2589 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2904 4.7623 -2.0125 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5730 3.5796 -3.3180 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0171 4.2578 -2.3961 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 21 25 1 0 25 26 2 0 25 27 1 0 20 28 1 0 18 29 1 0 17 30 1 0 13 31 1 0 13 32 1 0 12 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 52 59 1 0 37 60 1 0 36 61 1 0 35 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 66 71 1 0 65 72 1 0 64 73 1 0 9 74 1 0 2 75 1 0 23 2 1 0 21 4 1 0 18 5 1 0 17 8 1 0 14 9 1 0 39 34 1 0 47 42 1 0 56 51 1 0 68 63 1 0 1 76 1 0 1 77 1 0 1 78 1 0 3 79 1 0 3 80 1 0 4 81 1 0 6 82 1 0 7 83 1 0 7 84 1 0 8 85 1 0 10 86 1 0 10 87 1 0 11 88 1 0 11 89 1 0 12 90 1 0 14 91 1 0 15 92 1 0 15 93 1 0 16 94 1 0 16 95 1 0 19 96 1 0 19 97 1 0 20 98 1 0 22 99 1 0 22100 1 0 23101 1 0 24102 1 0 27103 1 0 28104 1 0 29105 1 0 29106 1 0 29107 1 0 30108 1 0 30109 1 0 30110 1 0 31111 1 0 31112 1 0 31113 1 0 32114 1 0 32115 1 0 32116 1 0 34117 1 0 35118 1 0 36119 1 0 37120 1 0 38121 1 0 40122 1 0 40123 1 0 42124 1 0 43125 1 0 44126 1 0 45127 1 0 46128 1 0 46129 1 0 48130 1 0 49131 1 0 51132 1 0 52133 1 0 53134 1 0 54135 1 0 55136 1 0 55137 1 0 57138 1 0 58139 1 0 59140 1 0 60141 1 0 61142 1 0 63143 1 0 64144 1 0 65145 1 0 66146 1 0 67147 1 0 69148 1 0 69149 1 0 70150 1 0 71151 1 0 72152 1 0 73153 1 0 74154 1 0 74155 1 0 74156 1 0 75157 1 0 75158 1 0 75159 1 0 M END

Standard InCHIKey	CFILEMBUCDXWDF-DPYXFEIXSA-N
Standard InCHI	InChI=1S/C52H84O23/c1-47(2)14-22-21-8-9-28-49(5)12-11-31(48(3,4)27(49)10-13-50(28,6)51(21,7)15-30(57)52(22,46(66)67)16-29(47)56)73-45-41(75-43-39(65)36(62)34(60)25(17-53)71-43)37(63)35(61)26(72-45)20-70-44-40(33(59)24(55)19-69-44)74-42-38(64)32(58)23(54)18-68-42/h8,22-45,53-65H,9-20H2,1-7H3,(H,66,67)/t22-,23+,24-,25+,26+,27-,28+,29-,30+,31-,32-,33-,34+,35+,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,49-,50+,51+,52+/m0/s1
SMILES	CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(CC1O)C(=O)O)O)C)C)(C)C)OC6C(C(C(C(O6)COC7C(C(C(CO7)O)O)OC8C(C(C(CO8)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1076.54	Volume:	1027.842 ? Van der Waals volume.
Dense:	1.047	LogP:	-0.347 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.767 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.196 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	51.0
TPSA:	374.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.077	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.88	Fsp³:	0.942
MCE-18:	198.238 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.004	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.394 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.421	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.687	MDCK Permeability:	-4.9
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.571	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	29.583%	Volume Distribution (VD):	-0.428
Fu:	33.596% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.118	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.056	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.67	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.013	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.276

Half-life (T1/2):

3.907

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.074
Human Hepatotoxicity (H-HT):	0.183	Drug-induced Liver Injury (DILI):	0.118
AMES Toxicity:	0.214	Rat Oral Acute Toxicity:	0.064
Maximum Recommended Daily Dose:	0.279	Skin Sensitization:	0.001
Carcinogencity:	0.004	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.095	Ototoxicity:	1.0
Hematotoxicity:	0.002	Drug-induced Nephrotoxicity:	0.011
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.032
A549 Cytotoxicity:	0.006	Hek293 Cytotoxicity:	0.657
BCF:	0.117 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.895 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.099 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.972 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	fruits	myanmar	n.a.	PMID[11141109]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell line	HT-1080	Homo sapiens	ED50	>	100.0	ug ml-1	PMID[17970593]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475119 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24105
0.1-0.2	21394
0.2-0.3	2990
0.3-0.4	752
0.4-0.5	438
0.5-0.6	139
0.6-0.7	22
0.7-0.8	0
0.8-0.85	2
0.85-0.9	2
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9192	High Similarity	NPC291903
0.9118	High Similarity	NPC473824
0.8835	High Similarity	NPC288205
0.8835	High Similarity	NPC51465
0.8224	Intermediate Similarity	NPC200788
0.8	Intermediate Similarity	NPC37134
0.7736	Intermediate Similarity	NPC488515
0.7589	Intermediate Similarity	NPC243680
0.75	Intermediate Similarity	NPC80843
0.7339	Intermediate Similarity	NPC145899
0.6864	Remote Similarity	NPC475140
0.6842	Remote Similarity	NPC475486
0.6786	Remote Similarity	NPC484832
0.6759	Remote Similarity	NPC488516
0.6667	Remote Similarity	NPC104400
0.6667	Remote Similarity	NPC10320
0.6522	Remote Similarity	NPC75318
0.6514	Remote Similarity	NPC127056
0.6455	Remote Similarity	NPC488561
0.6442	Remote Similarity	NPC242611
0.641	Remote Similarity	NPC207738
0.6356	Remote Similarity	NPC280941
0.6356	Remote Similarity	NPC235772
0.6346	Remote Similarity	NPC31839
0.6303	Remote Similarity	NPC185466
0.626	Remote Similarity	NPC120667
0.626	Remote Similarity	NPC278272
0.6216	Remote Similarity	NPC480424
0.6098	Remote Similarity	NPC166422
0.6098	Remote Similarity	NPC219180
0.6016	Remote Similarity	NPC471384
0.6	Remote Similarity	NPC164194
0.5982	Remote Similarity	NPC59804
0.5966	Remote Similarity	NPC324875
0.5966	Remote Similarity	NPC292677
0.5948	Remote Similarity	NPC488526
0.5948	Remote Similarity	NPC232237
0.5935	Remote Similarity	NPC151543
0.5932	Remote Similarity	NPC79718
0.592	Remote Similarity	NPC283417
0.592	Remote Similarity	NPC200049
0.5859	Remote Similarity	NPC488308
0.5854	Remote Similarity	NPC610204
0.5847	Remote Similarity	NPC257468
0.5841	Remote Similarity	NPC56713
0.584	Remote Similarity	NPC603137
0.5833	Remote Similarity	NPC606145
0.582	Remote Similarity	NPC210729
0.582	Remote Similarity	NPC82931
0.5814	Remote Similarity	NPC312650
0.5798	Remote Similarity	NPC119794
0.5776	Remote Similarity	NPC469945
0.5736	Remote Similarity	NPC265841
0.5714	Remote Similarity	NPC481082
0.5714	Remote Similarity	NPC164419
0.5714	Remote Similarity	NPC488309
0.5702	Remote Similarity	NPC25605
0.5702	Remote Similarity	NPC481079
0.5692	Remote Similarity	NPC271610
0.5656	Remote Similarity	NPC488564
0.5635	Remote Similarity	NPC284449
0.5635	Remote Similarity	NPC323341
0.563	Remote Similarity	NPC63159
0.561	Remote Similarity	NPC104137
0.561	Remote Similarity	NPC26626
0.5603	Remote Similarity	NPC470512
0.5603	Remote Similarity	NPC472949
0.56	Remote Similarity	NPC607904
0.56	Remote Similarity	NPC610461
0.5593	Remote Similarity	NPC114304
0.5593	Remote Similarity	NPC117714
0.5591	Remote Similarity	NPC251263
0.5583	Remote Similarity	NPC470514
0.5583	Remote Similarity	NPC73829
0.5583	Remote Similarity	NPC123796
0.5581	Remote Similarity	NPC4749
0.5574	Remote Similarity	NPC23275
0.5556	Remote Similarity	NPC469946
0.5546	Remote Similarity	NPC164389
0.5537	Remote Similarity	NPC302887
0.5528	Remote Similarity	NPC160452
0.5507	Remote Similarity	NPC33012
0.55	Remote Similarity	NPC105800
0.5492	Remote Similarity	NPC276093
0.5484	Remote Similarity	NPC609281
0.5462	Remote Similarity	NPC30289
0.5447	Remote Similarity	NPC301449
0.5447	Remote Similarity	NPC601290
0.544	Remote Similarity	NPC480939
0.544	Remote Similarity	NPC470915
0.544	Remote Similarity	NPC606553
0.5435	Remote Similarity	NPC8524
0.5431	Remote Similarity	NPC174679
0.5431	Remote Similarity	NPC279554
0.5417	Remote Similarity	NPC173859
0.5417	Remote Similarity	NPC480475
0.5414	Remote Similarity	NPC161717
0.5413	Remote Similarity	NPC283849
0.5413	Remote Similarity	NPC606107
0.541	Remote Similarity	NPC64715
0.5397	Remote Similarity	NPC172365
0.5372	Remote Similarity	NPC139044
0.5349	Remote Similarity	NPC123199
0.5349	Remote Similarity	NPC609305
0.5345	Remote Similarity	NPC136877
0.5328	Remote Similarity	NPC470513
0.5328	Remote Similarity	NPC297263
0.5328	Remote Similarity	NPC488517
0.5308	Remote Similarity	NPC602995
0.5304	Remote Similarity	NPC76999
0.5304	Remote Similarity	NPC1046
0.5303	Remote Similarity	NPC21691
0.5299	Remote Similarity	NPC471385
0.5294	Remote Similarity	NPC263756
0.5294	Remote Similarity	NPC22956
0.5285	Remote Similarity	NPC471435
0.5285	Remote Similarity	NPC471434
0.5267	Remote Similarity	NPC54636
0.5263	Remote Similarity	NPC476774
0.5263	Remote Similarity	NPC476780
0.5259	Remote Similarity	NPC110700
0.5254	Remote Similarity	NPC109079
0.525	Remote Similarity	NPC112352
0.5238	Remote Similarity	NPC31838
0.5238	Remote Similarity	NPC481078
0.5238	Remote Similarity	NPC187290
0.5227	Remote Similarity	NPC85154
0.5227	Remote Similarity	NPC71391
0.5227	Remote Similarity	NPC192765
0.5221	Remote Similarity	NPC128925
0.5214	Remote Similarity	NPC12288
0.5207	Remote Similarity	NPC605226
0.52	Remote Similarity	NPC323359
0.5194	Remote Similarity	NPC79643
0.5188	Remote Similarity	NPC178264
0.5185	Remote Similarity	NPC476779
0.5182	Remote Similarity	NPC70809
0.518	Remote Similarity	NPC102505
0.518	Remote Similarity	NPC488514
0.5167	Remote Similarity	NPC213674
0.5164	Remote Similarity	NPC44716
0.5164	Remote Similarity	NPC148603
0.5159	Remote Similarity	NPC488209
0.5154	Remote Similarity	NPC133818
0.5149	Remote Similarity	NPC286457
0.5147	Remote Similarity	NPC476777
0.5145	Remote Similarity	NPC220160
0.5139	Remote Similarity	NPC489208
0.512	Remote Similarity	NPC470914
0.5115	Remote Similarity	NPC135904
0.5111	Remote Similarity	NPC470876
0.5109	Remote Similarity	NPC302543
0.5108	Remote Similarity	NPC279915
0.5098	Remote Similarity	NPC23020
0.5082	Remote Similarity	NPC160415
0.5078	Remote Similarity	NPC473688
0.5078	Remote Similarity	NPC11242
0.5078	Remote Similarity	NPC62725
0.5077	Remote Similarity	NPC123522
0.5075	Remote Similarity	NPC57484
0.5072	Remote Similarity	NPC476775
0.5041	Remote Similarity	NPC251768
0.5041	Remote Similarity	NPC473383
0.5039	Remote Similarity	NPC187618
0.5039	Remote Similarity	NPC480473
0.5039	Remote Similarity	NPC480474
0.5037	Remote Similarity	NPC110633
0.5035	Remote Similarity	NPC489209
0.5034	Remote Similarity	NPC475177
0.5034	Remote Similarity	NPC40085
0.5032	Remote Similarity	NPC322904

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475119 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7046
0.1-0.2	2054
0.2-0.3	46
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data