NPASS Compound

Natural Product: NPC471435

Natural Product ID	NPC471435
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JVURSZYCQGOREA-HNSZYCTNSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2442992
PubChem CID	72544564
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 153161 0 0 0 0 0 0 0 0999 V2000 12.3306 2.3431 2.7058 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4872 1.3014 2.0147 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0954 1.0215 0.6627 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2553 -0.0281 -0.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9450 0.4056 -0.2116 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2342 -0.5729 -0.8410 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7378 -0.1960 -2.0828 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0371 0.9568 -2.0541 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7172 0.9062 -1.2477 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1561 1.2135 0.1619 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5071 -0.0886 0.9015 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0592 -1.1178 -0.0585 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5037 -2.3082 0.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0119 -1.5727 -1.0768 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0878 -0.4503 -1.3543 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7773 -0.4654 -0.7182 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2961 -1.4335 0.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9685 -1.4440 0.7065 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0263 -0.5466 -0.0053 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5372 -0.0227 -1.3054 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8526 0.7001 -0.9850 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3930 1.5448 -2.0714 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8380 1.9334 -1.8785 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9252 3.1995 -1.2972 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6616 1.5892 0.2200 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8015 -1.0988 -2.3175 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5924 0.9510 -1.9622 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1905 0.3932 -2.0629 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2322 0.0547 -0.6540 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5896 -1.0280 -0.0431 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3955 -2.4037 -0.5294 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1727 -1.0744 1.4405 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2901 -1.3576 1.5814 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1352 -0.2793 0.9014 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7078 -0.0212 -0.4948 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4173 -0.8973 -1.5055 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1949 1.4099 -0.8219 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4530 -0.7025 0.9317 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2401 0.0235 1.8146 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4717 -0.9060 2.8820 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9816 -2.0223 2.2095 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4456 -1.7861 1.8569 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7230 -0.2944 1.7967 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5341 0.4786 1.2246 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7132 1.8127 1.5841 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9063 2.6857 0.5133 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8677 3.5519 0.3119 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9190 4.6780 1.0561 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5987 4.5481 2.5131 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4170 3.7325 3.2425 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2010 5.4666 0.9268 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2264 4.7122 0.1039 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2752 3.2576 0.4758 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0521 2.5630 -0.4525 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4753 5.3183 0.3448 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9275 6.6600 0.2700 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8623 -0.1176 1.0267 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8846 -2.4807 0.7627 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8307 -3.4294 0.9940 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3977 -4.6620 0.5509 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3366 -4.8617 -0.7918 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4503 -3.8269 -1.4505 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1661 -3.8711 -0.9560 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7055 -4.8112 -1.4092 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6834 -4.1825 -0.4913 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1179 -3.0204 0.2970 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0823 -2.6449 1.2241 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7285 -3.6355 -1.2769 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1678 -6.0891 -1.7462 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5525 3.1386 1.9421 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2499 1.8983 3.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6859 2.8325 3.4833 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4614 1.6720 1.8990 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4395 0.3458 2.5791 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1541 1.9219 0.0197 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1249 0.6251 0.7677 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7614 -0.2527 -1.0052 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2999 -0.9529 0.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8958 -1.4512 -1.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7001 1.7534 -1.6165 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8245 1.3080 -3.0925 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1343 1.7910 0.1656 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4373 1.7342 0.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6650 -0.5094 1.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3049 0.0872 1.6539 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0216 -2.0303 1.6695 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2417 -2.8779 0.1040 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6578 -3.0113 0.9402 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5863 -2.5424 -0.8531 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6112 -1.7733 -2.0291 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8595 -0.5267 -2.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0143 -2.2642 0.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1194 -1.0517 1.7600 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5790 -2.4828 0.8430 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9493 0.3802 0.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8096 2.4967 -2.0893 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2619 1.1140 -3.0925 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2008 2.1478 -2.9394 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6240 3.7627 -1.6821 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3424 2.5016 0.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8784 1.1301 1.1819 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6528 2.1127 0.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9096 -1.2515 -2.9809 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0854 -2.0713 -1.9382 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5845 -0.8093 -3.0542 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5315 1.9285 -1.4955 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9620 1.1133 -3.0062 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4459 1.2653 -2.3755 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0765 -0.4398 -2.7597 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0628 0.9869 -0.0672 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8549 -2.7267 -1.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7621 -3.1120 0.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6834 -2.6456 -0.5983 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3614 -0.0686 1.8392 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7377 -1.8228 1.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5238 -1.2993 2.6621 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5977 -2.3673 1.2490 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0014 0.6117 1.5495 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7896 -1.1658 -2.3764 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8676 -1.7741 -0.9849 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3240 -0.3912 -1.9554 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4139 1.4727 -1.9308 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4529 2.1620 -0.5453 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1815 1.5206 -0.3210 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7364 0.8496 2.3078 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9413 -2.8719 2.9129 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4443 -2.2881 1.3054 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0176 -2.1680 2.7293 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9231 0.1384 2.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5436 0.4024 0.1312 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8499 1.9766 -0.3898 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0945 5.3593 0.6437 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5602 4.1082 2.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4760 5.5702 2.9767 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1643 4.3091 3.5937 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6412 5.7341 1.9089 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0159 4.8370 -0.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8121 3.1923 1.4477 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5291 2.1394 -1.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6615 5.9532 -0.3809 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0936 6.6477 -0.6861 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6414 -0.2362 1.6553 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1009 -3.5414 2.0714 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9153 -5.8838 -1.0417 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3685 -4.1776 -2.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9202 -2.8522 -1.5119 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5517 -3.3675 -1.5672 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6546 -4.2396 -2.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1438 -4.9241 0.1696 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9071 -2.2035 -0.3906 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0354 -3.1499 2.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2267 -2.9555 -0.7541 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1420 -6.1623 -1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 9 8 1 6 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 12 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 21 25 1 1 20 26 1 6 20 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 34 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 43 57 1 0 42 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 12 6 1 0 21 16 1 0 35 29 1 0 44 39 1 0 53 46 1 0 66 59 1 0 15 9 1 0 30 19 1 0 23 9 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 0 2 74 1 0 3 75 1 0 3 76 1 0 4 77 1 0 4 78 1 0 6 79 1 6 8 80 1 0 8 81 1 0 10 82 1 0 10 83 1 0 11 84 1 0 11 85 1 0 13 86 1 0 13 87 1 0 13 88 1 0 14 89 1 0 14 90 1 0 15 91 1 6 17 92 1 0 18 93 1 0 18 94 1 0 19 95 1 1 22 96 1 0 22 97 1 0 23 98 1 6 24 99 1 0 25100 1 0 25101 1 0 25102 1 0 26103 1 0 26104 1 0 26105 1 0 27106 1 0 27107 1 0 28108 1 0 28109 1 0 29110 1 1 31111 1 0 31112 1 0 31113 1 0 32114 1 0 32115 1 0 33116 1 0 33117 1 0 34118 1 1 36119 1 0 36120 1 0 36121 1 0 37122 1 0 37123 1 0 37124 1 0 39125 1 1 41126 1 0 41127 1 0 42128 1 1 43129 1 1 44130 1 6 46131 1 6 48132 1 6 49133 1 0 49134 1 0 50135 1 0 51136 1 1 52137 1 6 53138 1 1 54139 1 0 55140 1 0 56141 1 0 57142 1 0 59143 1 1 61144 1 1 62145 1 0 62146 1 0 63147 1 0 64148 1 6 65149 1 1 66150 1 6 67151 1 0 68152 1 0 69153 1 0 M END

Standard InCHIKey	JVURSZYCQGOREA-HNSZYCTNSA-N
Standard InCHI	InChI=1S/C51H84O18/c1-8-9-18-62-45-47(4)16-17-51(24-64-45)26(19-47)25-10-11-31-48(5)14-13-33(46(2,3)30(48)12-15-49(31,6)50(25,7)20-32(51)54)68-44-41(69-43-40(61)38(59)35(56)28(22-53)66-43)36(57)29(23-63-44)67-42-39(60)37(58)34(55)27(21-52)65-42/h10,26-45,52-61H,8-9,11-24H2,1-7H3/t26-,27+,28+,29-,30-,31+,32+,33-,34+,35+,36-,37-,38-,39+,40+,41+,42-,43-,44-,45+,47-,48-,49+,50+,51+/m0/s1
SMILES	CCCCO[C@@H]1OC[C@]23CC[C@@]1(C)C[C@H]2C1=CC[C@H]2[C@@]([C@@]1(C[C@H]3O)C)(C)CC[C@@H]1[C@]2(C)CC[C@@H](C1(C)C)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	984.57	Volume:	969.231 ? Van der Waals volume.
Dense:	1.016	LogP:	1.877 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.847 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.134 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	10.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.075	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.751	Fsp³:	0.961
MCE-18:	246.84 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.877	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.012 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.241	Promiscuous compounds:	0.026

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.28	MDCK Permeability:	-5.216
Pgp-inhibitor:	0.001	Pgp-substrate:	0.681
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.301
20% Bioavailability (F20%):	0.17	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.019	MRP1:	0.153
Plasma Protein Binding (PPB):	76.766%	Volume Distribution (VD):	-0.432
Fu:	17.512% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.02
BSEP inhibitor:	0.008

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.113	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.03	CYP3A4-substrate:	0.315
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.531
HLM stability:	0.015 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.151

Half-life (T1/2):

2.584

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.006
Human Hepatotoxicity (H-HT):	0.748	Drug-induced Liver Injury (DILI):	0.968
AMES Toxicity:	0.978	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.005	Skin Sensitization:	1.0
Carcinogencity:	0.353	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.61	Drug-induced Nephrotoxicity:	0.979
Genotoxicity:	0.1	RPMI-8226 Immunitoxicity:	0.191
A549 Cytotoxicity:	0.986	Hek293 Cytotoxicity:	0.807
BCF:	1.456 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.559 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.933 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.162 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24095094]
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT180	Cell line	HCT-8	Homo sapiens	IC50	>	100000.0	nM	PMID[25863432]
NPT181	Cell line	Bel-7402	Homo sapiens	IC50	=	7340.0	nM	Casarett and Doull's Toxicology The Basic Science of Poisons, 7th edition
NPT81	Cell line	A549	Homo sapiens	IC50	=	10550.0	nM	PMID[8411013]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC471435 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23539
0.1-0.2	22087
0.2-0.3	3076
0.3-0.4	608
0.4-0.5	428
0.5-0.6	100
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC471434
0.7091	Intermediate Similarity	NPC185466
0.6606	Remote Similarity	NPC123796
0.641	Remote Similarity	NPC603137
0.6204	Remote Similarity	NPC470512
0.6154	Remote Similarity	NPC610204
0.6102	Remote Similarity	NPC151543
0.6083	Remote Similarity	NPC475140
0.6042	Remote Similarity	NPC471433
0.6042	Remote Similarity	NPC471432
0.6034	Remote Similarity	NPC207738
0.5982	Remote Similarity	NPC173859
0.5982	Remote Similarity	NPC148603
0.5917	Remote Similarity	NPC470911
0.5877	Remote Similarity	NPC257468
0.5862	Remote Similarity	NPC606145
0.5812	Remote Similarity	NPC488564
0.5789	Remote Similarity	NPC470515
0.5752	Remote Similarity	NPC309714
0.575	Remote Similarity	NPC607904
0.575	Remote Similarity	NPC610461
0.5714	Remote Similarity	NPC470915
0.5702	Remote Similarity	NPC164389
0.5656	Remote Similarity	NPC471384
0.5652	Remote Similarity	NPC105800
0.5652	Remote Similarity	NPC63159
0.563	Remote Similarity	NPC609281
0.5625	Remote Similarity	NPC224003
0.561	Remote Similarity	NPC166422
0.561	Remote Similarity	NPC609305
0.5603	Remote Similarity	NPC222580
0.5596	Remote Similarity	NPC1046
0.5583	Remote Similarity	NPC606553
0.5565	Remote Similarity	NPC470517
0.5565	Remote Similarity	NPC232237
0.5546	Remote Similarity	NPC69811
0.5536	Remote Similarity	NPC18724
0.5508	Remote Similarity	NPC78034
0.55	Remote Similarity	NPC104137
0.55	Remote Similarity	NPC26626
0.5496	Remote Similarity	NPC220160
0.5478	Remote Similarity	NPC30289
0.547	Remote Similarity	NPC470514
0.547	Remote Similarity	NPC470513
0.5447	Remote Similarity	NPC79643
0.5439	Remote Similarity	NPC158051
0.5439	Remote Similarity	NPC76497
0.5439	Remote Similarity	NPC80843
0.5431	Remote Similarity	NPC488526
0.5431	Remote Similarity	NPC305267
0.5426	Remote Similarity	NPC43550
0.5424	Remote Similarity	NPC64715
0.5397	Remote Similarity	NPC54636
0.5391	Remote Similarity	NPC112352
0.5385	Remote Similarity	NPC139044
0.5372	Remote Similarity	NPC31838
0.5366	Remote Similarity	NPC473824
0.5349	Remote Similarity	NPC470876
0.5345	Remote Similarity	NPC117714
0.5338	Remote Similarity	NPC250247
0.5333	Remote Similarity	NPC291903
0.5317	Remote Similarity	NPC283417
0.5317	Remote Similarity	NPC200049
0.5299	Remote Similarity	NPC480475
0.5294	Remote Similarity	NPC33012
0.5285	Remote Similarity	NPC475119
0.5268	Remote Similarity	NPC48499
0.5263	Remote Similarity	NPC127056
0.525	Remote Similarity	NPC104372
0.5246	Remote Similarity	NPC475486
0.5238	Remote Similarity	NPC123199
0.5234	Remote Similarity	NPC85154
0.5221	Remote Similarity	NPC8524
0.5217	Remote Similarity	NPC39211
0.5207	Remote Similarity	NPC323359
0.5194	Remote Similarity	NPC21691
0.5172	Remote Similarity	NPC469946
0.5169	Remote Similarity	NPC2370
0.5167	Remote Similarity	NPC302887
0.5164	Remote Similarity	NPC470516
0.5164	Remote Similarity	NPC80986
0.5161	Remote Similarity	NPC288205
0.5161	Remote Similarity	NPC51465
0.5159	Remote Similarity	NPC323341
0.5154	Remote Similarity	NPC265841
0.5154	Remote Similarity	NPC488308
0.5152	Remote Similarity	NPC136768
0.5124	Remote Similarity	NPC267238
0.5124	Remote Similarity	NPC77717
0.5122	Remote Similarity	NPC481078
0.512	Remote Similarity	NPC475287
0.5118	Remote Similarity	NPC219180
0.5118	Remote Similarity	NPC135904
0.5116	Remote Similarity	NPC4749
0.5115	Remote Similarity	NPC271610
0.5115	Remote Similarity	NPC312650
0.5115	Remote Similarity	NPC41061
0.5115	Remote Similarity	NPC227551
0.5082	Remote Similarity	NPC481079
0.5082	Remote Similarity	NPC324875
0.5082	Remote Similarity	NPC292677
0.5079	Remote Similarity	NPC123522
0.5078	Remote Similarity	NPC470218
0.5043	Remote Similarity	NPC213674
0.5041	Remote Similarity	NPC253611
0.5041	Remote Similarity	NPC160452
0.5041	Remote Similarity	NPC488782
0.504	Remote Similarity	NPC172365
0.5038	Remote Similarity	NPC305981
0.5038	Remote Similarity	NPC286457
0.5035	Remote Similarity	NPC489208

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC471435 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7474
0.1-0.2	1623
0.2-0.3	49
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data