NPASS Compound

Natural Product: NPC219180

Natural Product ID	NPC219180
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Oleanolate 3Beta-O-Beta-D-Glucopyranosyl-(1->4)-Beta-D-Xylopyranosyl-(1->3)-Alpha-L-Rhamnopyranosyl-(1->2)-Alpha-L-Arabinopyranoside
IUPAC Name	(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6S)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL502517
PubChem CID	21577273
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 156164 0 0 0 0 0 0 0 0999 V2000 15.6774 -1.9671 -0.0727 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7156 -0.6902 -0.6238 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3772 -0.3054 -1.2304 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3687 -0.3283 -0.2942 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2630 0.3395 -0.7780 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1349 -0.1333 -0.1022 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0901 -0.4450 -0.9359 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9131 0.4170 -0.5111 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3886 0.0395 0.7275 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8354 -1.2502 0.6599 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0136 -2.1687 0.4210 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6241 -1.8632 -0.9166 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5817 -1.9334 -1.8731 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9950 -1.8605 1.3980 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8925 -1.2284 -0.3173 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6114 -1.6458 0.0408 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6359 -0.4884 0.0664 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7968 0.1949 -1.1542 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2311 -1.0123 0.2143 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6248 -0.3916 1.3095 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6050 0.4733 1.0805 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2537 -0.1453 1.5588 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7055 -0.8016 2.7303 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2891 0.0892 3.5780 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3633 1.5279 3.2643 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7379 1.7710 1.8253 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9476 2.7232 1.2209 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2502 2.2643 3.6804 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6936 0.6358 1.9375 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9917 0.7120 1.5456 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9176 0.3497 2.6926 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2974 0.1086 2.2313 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8353 1.3459 1.4305 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8993 1.5789 0.3134 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4692 1.8599 0.7619 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2529 3.2258 1.2753 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6876 1.7931 -0.5794 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4206 2.4564 -0.7391 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6519 1.8226 -1.3754 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6850 1.4920 -0.3377 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1581 0.9118 0.9120 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2552 1.0597 1.9662 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4743 0.4474 1.4015 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6780 0.1678 0.1087 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6501 0.4608 -0.9247 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9058 -0.8790 -1.0984 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1583 0.8214 -2.2653 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4823 0.2263 -2.6355 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4667 0.1612 -1.5101 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9633 -0.4419 -0.2552 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9705 -1.9423 -0.1852 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3940 -2.3925 -0.4270 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3720 -3.9036 -0.4629 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3039 -1.9998 0.7266 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8995 -1.9135 -1.7587 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7731 -0.4445 -1.9807 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8346 1.5896 -1.1722 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3884 2.5725 -1.7829 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7177 1.7898 -0.1235 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5286 2.7385 -0.0917 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9402 2.4260 2.4709 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1698 -2.3656 0.3918 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8246 -3.2195 -0.4240 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0676 -2.6165 -0.9814 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0123 -3.5720 -1.3513 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9354 -3.8767 -1.4676 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4953 1.8207 -0.4274 C 0 0 1 0 0 0 0 0 0 0 0 0 13.8529 2.1560 -1.0140 C 0 0 2 0 0 0 0 0 0 0 0 0 14.4350 1.0590 -1.8624 C 0 0 2 0 0 0 0 0 0 0 0 0 13.9485 1.0139 -3.1564 O 0 0 0 0 0 0 0 0 0 0 0 0 14.7742 2.4006 0.0197 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5418 2.5215 -1.1909 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7622 -1.9578 0.9193 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0689 0.0046 0.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4674 -0.7330 -1.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1577 -1.0807 -1.9987 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1705 0.3255 -1.8573 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4024 -0.2078 -1.9890 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0944 1.4932 -0.5864 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1008 0.1769 -1.2620 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4050 -1.5398 1.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7900 -3.2328 0.5374 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4090 -2.5918 -1.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7491 -2.6071 -2.5591 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7569 -0.9984 1.8431 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6117 -2.0236 1.0802 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8881 0.2559 0.8567 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9966 0.1758 -1.7028 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6407 -0.6611 -0.6722 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4595 0.6364 0.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0744 -0.9485 0.8233 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3629 -0.2520 3.7843 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7525 -0.0057 4.5922 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2075 2.0076 3.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7796 2.1525 1.8265 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2281 3.6493 1.4881 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4198 3.1925 3.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0738 -0.1635 0.8272 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5524 -0.6721 3.0744 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8553 1.0801 3.5236 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0033 -0.1389 3.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2231 -0.6948 1.4265 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7725 0.5568 -0.1852 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8603 3.3001 2.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1745 3.8626 1.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5272 3.8431 0.6522 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7036 2.7959 -1.0419 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2210 1.1142 -1.3030 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7076 1.3407 -0.4378 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6035 3.5122 -0.4906 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6683 2.4805 -1.5834 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3708 0.9651 -2.0096 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0689 2.5933 -2.0503 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0908 -0.2081 0.7557 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9496 0.4639 2.8814 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4173 2.0831 2.2990 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2939 0.1903 2.0890 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1430 -1.5992 -0.3094 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8264 -0.7760 -1.1565 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2233 -1.3825 -2.0571 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4163 0.5433 -3.0779 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2414 1.9155 -2.3550 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9356 0.7536 -3.4958 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2873 -0.8133 -2.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7547 -0.1502 0.5308 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7107 -2.2360 0.8408 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3226 -2.4663 -0.8714 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4318 -4.2512 -0.2865 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1604 -4.2128 -1.5121 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6699 -4.3547 0.2652 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7309 -0.9840 0.5955 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1059 -2.7708 0.7996 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6886 -2.1104 1.6502 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9868 -2.1517 -1.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4504 -2.5209 -2.5722 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9260 -0.2675 -3.0699 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6028 0.0346 -1.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1251 2.6866 0.1211 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0288 3.4812 0.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6458 3.3120 -1.0683 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5283 2.5695 0.2737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0010 2.5727 3.0150 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6320 1.9821 3.2608 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3141 3.3844 2.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2037 -4.0697 0.2559 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8786 -2.0178 -1.9211 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5071 -3.9536 -0.5764 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5520 -4.7307 -1.8795 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6673 -3.2386 -2.3024 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1035 -4.3366 -0.9051 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4320 2.0097 0.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7810 3.0503 -1.6974 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5270 1.3104 -1.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2296 0.1443 -3.5329 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5745 2.7974 -0.3636 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9518 3.1388 -1.8477 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 10 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 22 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 34 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 1 6 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 52 55 1 0 55 56 1 0 49 57 1 1 57 58 2 0 57 59 1 0 40 60 1 1 33 61 1 1 19 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 5 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 69 3 1 0 12 7 1 0 64 16 1 0 26 21 1 0 35 30 1 0 45 40 1 0 56 49 1 0 41 33 1 0 50 44 1 0 1 73 1 0 2 74 1 0 2 75 1 0 3 76 1 6 5 77 1 6 7 78 1 6 8 79 1 0 8 80 1 0 10 81 1 1 11 82 1 6 12 83 1 6 13 84 1 0 14 85 1 0 16 86 1 1 17 87 1 1 18 88 1 0 19 89 1 6 21 90 1 6 22 91 1 6 24 92 1 0 24 93 1 0 25 94 1 1 26 95 1 1 27 96 1 0 28 97 1 0 30 98 1 6 31 99 1 0 31100 1 0 32101 1 0 32102 1 0 34103 1 6 36104 1 0 36105 1 0 36106 1 0 37107 1 0 37108 1 0 37109 1 0 38110 1 0 38111 1 0 39112 1 0 39113 1 0 41114 1 6 42115 1 0 42116 1 0 43117 1 0 46118 1 0 46119 1 0 46120 1 0 47121 1 0 47122 1 0 48123 1 0 48124 1 0 50125 1 1 51126 1 0 51127 1 0 53128 1 0 53129 1 0 53130 1 0 54131 1 0 54132 1 0 54133 1 0 55134 1 0 55135 1 0 56136 1 0 56137 1 0 59138 1 0 60139 1 0 60140 1 0 60141 1 0 61142 1 0 61143 1 0 61144 1 0 63145 1 1 64146 1 6 65147 1 0 66148 1 0 66149 1 0 66150 1 0 67151 1 1 68152 1 6 69153 1 6 70154 1 0 71155 1 0 72156 1 0 M END

Standard InCHIKey	SQMQSLVVHZAFKJ-RQZRKUQTSA-N
Standard InCHI	InChI=1S/C52H84O20/c1-23-32(55)40(71-42-37(60)35(58)28(22-66-42)69-43-38(61)36(59)34(57)27(20-53)68-43)39(62)44(67-23)72-41-33(56)26(54)21-65-45(41)70-31-12-13-49(6)29(48(31,4)5)11-14-51(8)30(49)10-9-24-25-19-47(2,3)15-17-52(25,46(63)64)18-16-50(24,51)7/h9,23,25-45,53-62H,10-22H2,1-8H3,(H,63,64)/t23-,25-,26-,27+,28+,29-,30+,31-,32-,33-,34+,35-,36-,37+,38+,39+,40+,41+,42-,43-,44-,45-,49-,50+,51+,52-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@@H]2CO[C@H]([C@@H]([C@H]2O)O)O[C@H]2[C@@H](O)[C@H](O[C@H]3[C@@H](OC[C@@H]([C@@H]3O)O)O[C@H]3CC[C@]4([C@H](C3(C)C)CC[C@@]3([C@@H]4CC=C4[C@@]3(C)CC[C@@]3([C@H]4CC(C)(C)CC3)C(=O)O)C)C)O[C@H]([C@@H]2O)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1028.56	Volume:	1001.471 ? Van der Waals volume.
Dense:	1.027	LogP:	1.33 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.108 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.424 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	51.0
TPSA:	313.44 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	11.0	Rings:	9.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.107	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.642	Fsp³:	0.942
MCE-18:	192.653 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.891	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.234	Promiscuous compounds:	0.144

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.317	MDCK Permeability:	-5.148
Pgp-inhibitor:	0.0	Pgp-substrate:	0.016
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.778
20% Bioavailability (F20%):	0.131	30% Bioavailability (F30%):	0.991
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.017	MRP1:	0.009
Plasma Protein Binding (PPB):	71.453%	Volume Distribution (VD):	-0.441
Fu:	20.076% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.966	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.013
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.3

Half-life (T1/2):

3.761

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.86	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.931	Rat Oral Acute Toxicity:	0.008
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.103	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.009
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.74	Drug-induced Nephrotoxicity:	0.988
Genotoxicity:	0.342	RPMI-8226 Immunitoxicity:	0.169
A549 Cytotoxicity:	0.857	Hek293 Cytotoxicity:	0.475
BCF:	1.452 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.879 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.486 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.617 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15104490]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1083	Cell line	A-375	Homo sapiens	IC50	=	22100.0	nM	PMID[9514009]
NPT81	Cell line	A549	Homo sapiens	IC50	>	20000.0	nM	PMID[3668556]
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	4200.0	nM	DOI[10.6019/CHEMBL1201861]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC219180 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24312
0.1-0.2	21347
0.2-0.3	2743
0.3-0.4	807
0.4-0.5	425
0.5-0.6	115
0.6-0.7	50
0.7-0.8	0
0.8-0.85	6
0.85-0.9	4
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9208	High Similarity	NPC324875
0.9208	High Similarity	NPC292677
0.8829	High Similarity	NPC161717
0.8704	High Similarity	NPC166422
0.8704	High Similarity	NPC251263
0.8558	High Similarity	NPC276093
0.8365	Intermediate Similarity	NPC481082
0.8365	Intermediate Similarity	NPC164419
0.8218	Intermediate Similarity	NPC127056
0.8214	Intermediate Similarity	NPC54636
0.8108	Intermediate Similarity	NPC323341
0.8108	Intermediate Similarity	NPC133818
0.7982	Intermediate Similarity	NPC475486
0.785	Intermediate Similarity	NPC257468
0.7767	Intermediate Similarity	NPC56713
0.7712	Intermediate Similarity	NPC471385
0.7596	Intermediate Similarity	NPC59804
0.757	Intermediate Similarity	NPC114304
0.75	Intermediate Similarity	NPC104400
0.75	Intermediate Similarity	NPC10320
0.7478	Intermediate Similarity	NPC471384
0.7411	Intermediate Similarity	NPC488564
0.7333	Intermediate Similarity	NPC136877
0.7273	Intermediate Similarity	NPC139044
0.7264	Intermediate Similarity	NPC174679
0.7264	Intermediate Similarity	NPC279554
0.7143	Intermediate Similarity	NPC164194
0.713	Intermediate Similarity	NPC488561
0.7103	Intermediate Similarity	NPC25605
0.7094	Intermediate Similarity	NPC79643
0.7064	Intermediate Similarity	NPC80843
0.7027	Intermediate Similarity	NPC180550
0.7027	Intermediate Similarity	NPC35405
0.7018	Intermediate Similarity	NPC323359
0.6991	Remote Similarity	NPC79718
0.6991	Remote Similarity	NPC119794
0.6972	Remote Similarity	NPC472949
0.6863	Remote Similarity	NPC606107
0.6833	Remote Similarity	NPC123199
0.6822	Remote Similarity	NPC270667
0.678	Remote Similarity	NPC288205
0.678	Remote Similarity	NPC51465
0.6774	Remote Similarity	NPC41061
0.6774	Remote Similarity	NPC227551
0.6746	Remote Similarity	NPC261506
0.6746	Remote Similarity	NPC4328
0.6727	Remote Similarity	NPC109079
0.6695	Remote Similarity	NPC280941
0.6695	Remote Similarity	NPC235772
0.6667	Remote Similarity	NPC305981
0.6667	Remote Similarity	NPC471383
0.6639	Remote Similarity	NPC476992
0.6607	Remote Similarity	NPC22956
0.6552	Remote Similarity	NPC488515
0.6545	Remote Similarity	NPC12288
0.6471	Remote Similarity	NPC481078
0.6446	Remote Similarity	NPC475287
0.6417	Remote Similarity	NPC62725
0.6404	Remote Similarity	NPC469945
0.6385	Remote Similarity	NPC220160
0.6381	Remote Similarity	NPC283849
0.6357	Remote Similarity	NPC298034
0.6357	Remote Similarity	NPC71065
0.6325	Remote Similarity	NPC275668
0.6325	Remote Similarity	NPC73829
0.6325	Remote Similarity	NPC475504
0.6286	Remote Similarity	NPC204407
0.6283	Remote Similarity	NPC114441
0.6279	Remote Similarity	NPC236638
0.6279	Remote Similarity	NPC294453
0.6279	Remote Similarity	NPC481081
0.6239	Remote Similarity	NPC63159
0.6228	Remote Similarity	NPC6377
0.6228	Remote Similarity	NPC208381
0.6172	Remote Similarity	NPC110633
0.6098	Remote Similarity	NPC475119
0.6091	Remote Similarity	NPC284807
0.609	Remote Similarity	NPC250247
0.6087	Remote Similarity	NPC488516
0.6077	Remote Similarity	NPC293330
0.6077	Remote Similarity	NPC43550
0.6032	Remote Similarity	NPC135904
0.6017	Remote Similarity	NPC473383
0.6016	Remote Similarity	NPC481080
0.5984	Remote Similarity	NPC488209
0.5926	Remote Similarity	NPC28198
0.5926	Remote Similarity	NPC476123
0.592	Remote Similarity	NPC473824
0.5909	Remote Similarity	NPC136768
0.5909	Remote Similarity	NPC202828
0.5909	Remote Similarity	NPC119592
0.5902	Remote Similarity	NPC291903
0.5896	Remote Similarity	NPC488212
0.5859	Remote Similarity	NPC475140
0.5847	Remote Similarity	NPC112352
0.5833	Remote Similarity	NPC258885
0.5833	Remote Similarity	NPC91838
0.5818	Remote Similarity	NPC31839
0.5794	Remote Similarity	NPC60557
0.5794	Remote Similarity	NPC67857
0.5789	Remote Similarity	NPC111466
0.5769	Remote Similarity	NPC488211
0.5752	Remote Similarity	NPC191410
0.5714	Remote Similarity	NPC65105
0.5641	Remote Similarity	NPC475296
0.5635	Remote Similarity	NPC480939
0.5625	Remote Similarity	NPC151543
0.5625	Remote Similarity	NPC100383
0.5625	Remote Similarity	NPC40085
0.562	Remote Similarity	NPC173859
0.562	Remote Similarity	NPC148603
0.5615	Remote Similarity	NPC470218
0.561	Remote Similarity	NPC484832
0.5606	Remote Similarity	NPC21691
0.56	Remote Similarity	NPC187618
0.5593	Remote Similarity	NPC480424
0.5581	Remote Similarity	NPC470911
0.5565	Remote Similarity	NPC37134
0.5546	Remote Similarity	NPC470512
0.5536	Remote Similarity	NPC286347
0.553	Remote Similarity	NPC4749
0.5522	Remote Similarity	NPC258617
0.552	Remote Similarity	NPC481079
0.552	Remote Similarity	NPC75318
0.5496	Remote Similarity	NPC191827
0.5487	Remote Similarity	NPC242611
0.5442	Remote Similarity	NPC264270
0.5431	Remote Similarity	NPC475472
0.5426	Remote Similarity	NPC76972
0.5426	Remote Similarity	NPC469782
0.5426	Remote Similarity	NPC204414
0.541	Remote Similarity	NPC160415
0.5401	Remote Similarity	NPC302543
0.5391	Remote Similarity	NPC470915
0.5385	Remote Similarity	NPC211798
0.5385	Remote Similarity	NPC469778
0.5379	Remote Similarity	NPC283417
0.5379	Remote Similarity	NPC200049
0.5378	Remote Similarity	NPC474589
0.5366	Remote Similarity	NPC164389
0.5362	Remote Similarity	NPC70809
0.5344	Remote Similarity	NPC165204
0.5339	Remote Similarity	NPC48499
0.5325	Remote Similarity	NPC469776
0.5321	Remote Similarity	NPC32723
0.5308	Remote Similarity	NPC313110
0.5287	Remote Similarity	NPC481323
0.5285	Remote Similarity	NPC204392
0.5283	Remote Similarity	NPC481324
0.5276	Remote Similarity	NPC301449
0.5276	Remote Similarity	NPC601290
0.5263	Remote Similarity	NPC475160
0.5263	Remote Similarity	NPC473714
0.5259	Remote Similarity	NPC476068
0.5259	Remote Similarity	NPC57484
0.5247	Remote Similarity	NPC295941
0.5246	Remote Similarity	NPC263756
0.5246	Remote Similarity	NPC213674
0.5245	Remote Similarity	NPC33012
0.5242	Remote Similarity	NPC251768
0.5242	Remote Similarity	NPC480475
0.5234	Remote Similarity	NPC480474
0.5221	Remote Similarity	NPC265841
0.5221	Remote Similarity	NPC488308
0.522	Remote Similarity	NPC135334
0.5214	Remote Similarity	NPC224381
0.5205	Remote Similarity	NPC489208
0.5191	Remote Similarity	NPC200788
0.5191	Remote Similarity	NPC610204
0.5185	Remote Similarity	NPC85154
0.5182	Remote Similarity	NPC312650
0.5175	Remote Similarity	NPC8524
0.5159	Remote Similarity	NPC123796
0.5159	Remote Similarity	NPC470513
0.5159	Remote Similarity	NPC609763
0.5156	Remote Similarity	NPC218954
0.5154	Remote Similarity	NPC75287
0.5143	Remote Similarity	NPC120840
0.5128	Remote Similarity	NPC473538
0.5122	Remote Similarity	NPC469946
0.512	Remote Similarity	NPC488526
0.5118	Remote Similarity	NPC471435
0.5118	Remote Similarity	NPC471434
0.5118	Remote Similarity	NPC302887
0.5116	Remote Similarity	NPC480473
0.5115	Remote Similarity	NPC185466
0.5111	Remote Similarity	NPC488560
0.5109	Remote Similarity	NPC13998
0.5106	Remote Similarity	NPC488309
0.5088	Remote Similarity	NPC57362
0.5081	Remote Similarity	NPC192791
0.5079	Remote Similarity	NPC148417
0.5079	Remote Similarity	NPC470515
0.5079	Remote Similarity	NPC473405
0.5078	Remote Similarity	NPC114484
0.5077	Remote Similarity	NPC104137
0.5077	Remote Similarity	NPC207738
0.5077	Remote Similarity	NPC26626
0.5077	Remote Similarity	NPC187290

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC219180 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7068
0.1-0.2	2022
0.2-0.3	53
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data