NPASS Compound

Natural Product: NPC606107

Natural Product ID	NPC606107
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZNFRITHWVZXJRK-YHFBEQRYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2047219
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 102107 0 0 0 0 0 0 0 0999 V2000 -7.8553 0.0569 -1.5399 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0022 1.1900 -1.0366 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2969 2.4388 -1.8088 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2656 1.4363 0.4484 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0451 0.1352 1.1386 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6475 -0.4220 1.0032 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7522 -1.8450 1.4415 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5077 -2.7863 0.6670 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1389 -2.1126 2.7690 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8108 0.2942 2.0516 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4556 -0.3197 2.0536 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7398 0.0362 0.7663 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4358 1.5064 0.8185 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5909 -0.3062 -0.4183 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0075 -0.6317 -1.5406 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5668 -0.7168 -1.8261 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7708 -0.2982 -0.6068 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6851 -0.5392 -0.7374 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0367 -1.6994 -1.6237 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2939 0.6786 -1.4690 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7711 0.5648 -1.5746 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4994 0.2261 -0.3213 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7383 -0.3115 -0.6921 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7617 0.5348 -0.2833 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4029 0.9433 -1.4662 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5583 1.6672 -1.1984 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1067 2.1330 -2.5314 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2739 2.8754 -2.3944 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6035 0.8580 -0.4865 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9238 1.4607 0.7348 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9703 -0.4959 -0.1626 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5449 -1.0789 -1.3563 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7100 -0.1812 0.6329 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1056 0.6242 1.7005 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8308 -0.7126 0.6153 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2633 -2.1470 0.4400 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2435 -0.3120 2.0257 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3431 -0.5261 0.5920 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6359 -1.4012 1.6179 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6894 -0.6640 1.8835 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4743 -0.7983 0.5956 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9081 -2.2421 0.5530 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0794 -0.2975 -0.3550 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5289 0.9054 -1.1449 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8767 0.2091 -1.0879 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4749 -0.9337 -1.2250 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9899 0.1399 -2.6234 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4031 2.5802 -1.8131 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8587 3.3415 -1.3498 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9849 2.3058 -2.8629 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2941 1.7564 0.6295 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5112 2.1757 0.7911 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7683 -0.6153 0.8085 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2297 0.2917 2.2324 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2301 -3.0962 3.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8747 1.3581 1.8054 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3126 0.1369 3.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5542 -1.3994 2.1698 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8214 0.1148 2.8777 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7202 2.0396 -0.1354 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0221 2.0101 1.6137 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3762 1.7460 1.0900 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6493 -0.8827 -2.4132 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2854 -0.0588 -2.6745 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3522 -1.7526 -2.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9180 0.8288 -0.6126 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1232 -1.7474 -1.7958 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5998 -1.4562 -2.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6897 -2.6743 -1.3129 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8471 0.7264 -2.4591 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0591 1.6028 -0.8918 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1388 1.5825 -1.9061 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1023 -0.0907 -2.4345 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6915 1.2005 0.2171 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3838 1.4385 0.2579 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3268 2.6086 -0.6237 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2945 2.7501 -3.0069 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2484 1.2507 -3.1711 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0718 3.6758 -1.8519 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5161 0.6979 -1.0941 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8929 1.3273 0.8752 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6618 -1.1458 0.3903 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8178 -1.7291 -1.1760 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2714 -1.1082 1.0684 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2808 0.0942 2.5287 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8542 -2.5343 1.3242 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4477 -2.8555 0.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0201 -2.1575 -0.3930 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4776 0.3089 2.5377 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4848 -1.2262 2.6419 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1996 0.2428 1.9682 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2000 0.5306 0.9891 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2460 -1.4246 2.5324 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4135 -2.4095 1.2125 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3981 0.3533 2.1437 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2644 -1.1810 2.6721 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2077 -2.9288 0.0884 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8897 -2.4155 0.0781 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0445 -2.6467 1.6031 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4509 -1.1892 -0.9461 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9880 1.8305 -0.8722 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3427 0.6829 -2.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 1 7 8 2 0 7 9 1 0 6 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 12 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 6 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 26 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 22 35 1 0 35 36 1 0 35 37 1 0 35 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 6 14 43 1 0 43 44 1 0 44 2 1 0 43 6 1 0 41 12 1 0 41 17 1 0 38 18 1 0 33 24 1 0 1 45 1 0 1 46 1 0 1 47 1 0 3 48 1 0 3 49 1 0 3 50 1 0 4 51 1 0 4 52 1 0 5 53 1 0 5 54 1 0 9 55 1 0 10 56 1 0 10 57 1 0 11 58 1 0 11 59 1 0 13 60 1 0 13 61 1 0 13 62 1 0 15 63 1 0 16 64 1 0 16 65 1 0 17 66 1 1 19 67 1 0 19 68 1 0 19 69 1 0 20 70 1 0 20 71 1 0 21 72 1 0 21 73 1 0 22 74 1 1 24 75 1 1 26 76 1 1 27 77 1 0 27 78 1 0 28 79 1 0 29 80 1 6 30 81 1 0 31 82 1 1 32 83 1 0 33 84 1 1 34 85 1 0 36 86 1 0 36 87 1 0 36 88 1 0 37 89 1 0 37 90 1 0 37 91 1 0 38 92 1 1 39 93 1 0 39 94 1 0 40 95 1 0 40 96 1 0 42 97 1 0 42 98 1 0 42 99 1 0 43100 1 6 44101 1 0 44102 1 0 M END

Standard InCHIKey	ZNFRITHWVZXJRK-YHFBEQRYSA-N
Standard InCHI	InChI=1S/C36H58O8/c1-31(2)14-16-36(30(41)42)17-15-34(6)20(21(36)18-31)8-9-24-33(5)12-11-25(32(3,4)23(33)10-13-35(24,34)7)44-29-28(40)27(39)26(38)22(19-37)43-29/h8,21-29,37-40H,9-19H2,1-7H3,(H,41,42)/t21-,22+,23-,24+,25-,26+,27-,28+,29-,33-,34+,35+,36-/m0/s1
SMILES	CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	618.41	Volume:	644.922 ? Van der Waals volume.
Dense:	0.959	LogP:	3.419 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.222 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.27 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	33.0
TPSA:	136.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	5.0	Rings:	6.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.218	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.164	Fsp³:	0.917
MCE-18:	128.058 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.975	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.201	Promiscuous compounds:	0.114

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.679	MDCK Permeability:	-5.107
Pgp-inhibitor:	0.011	Pgp-substrate:	0.001
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.006
20% Bioavailability (F20%):	0.085	30% Bioavailability (F30%):	0.24
50% Bioavailability (F50%):	0.92

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	0.786
Plasma Protein Binding (PPB):	86.146%	Volume Distribution (VD):	-0.58
Fu:	9.249% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.988	BCRP inhibitor:	0.001
BSEP inhibitor:	0.22

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.112	CYP2C19-substrate:	0.018
CYP2C9-inhibitor:	0.001	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.003
CYP3A4-inhibitor:	0.114	CYP3A4-substrate:	0.073
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.009
HLM stability:	0.154 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.935

Half-life (T1/2):

1.721

ADMET: Toxicity

hERG Blockers:	0.013	hERG Blockers (10um):	0.014
Human Hepatotoxicity (H-HT):	0.801	Drug-induced Liver Injury (DILI):	0.918
AMES Toxicity:	0.68	Rat Oral Acute Toxicity:	0.066
Maximum Recommended Daily Dose:	0.045	Skin Sensitization:	0.998
Carcinogencity:	0.72	Eye Corrosion:	0.0
Eye Irritation:	0.043	Respiratory Toxicity:	0.186
Drug-induced Neurotoxicity:	0.01	Ototoxicity:	0.962
Hematotoxicity:	0.599	Drug-induced Nephrotoxicity:	0.959
Genotoxicity:	0.605	RPMI-8226 Immunitoxicity:	0.045
A549 Cytotoxicity:	0.193	Hek293 Cytotoxicity:	0.123
BCF:	1.373 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.823 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.431 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.664 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO14520	Bassia muricata	Species	Chenopodiaceae	Eukaryota	n.a.	aerial part	n.a.	PMID[11454355]
NPO14520	Bassia muricata	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14520	Bassia muricata	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Individual protein	1
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT677	Individual protein	Coagulation factor III	Homo sapiens	IC50	=	0.095	nM	PMID[28109788]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT29363	Cell line	Mast cell	Mus musculus	IC50	=	152500.0	nM	PMID[22704889]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC606107 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20170
0.1-0.2	24009
0.2-0.3	4020
0.3-0.4	962
0.4-0.5	453
0.5-0.6	116
0.6-0.7	48
0.7-0.8	0
0.8-0.85	9
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9054	High Similarity	NPC204407
0.875	High Similarity	NPC164194
0.8333	Intermediate Similarity	NPC127056
0.8333	Intermediate Similarity	NPC109079
0.8235	Intermediate Similarity	NPC472949
0.8228	Intermediate Similarity	NPC31839
0.8214	Intermediate Similarity	NPC25605
0.814	Intermediate Similarity	NPC22956
0.8072	Intermediate Similarity	NPC270667
0.8068	Intermediate Similarity	NPC180550
0.8068	Intermediate Similarity	NPC35405
0.7975	Intermediate Similarity	NPC283849
0.7955	Intermediate Similarity	NPC114304
0.7882	Intermediate Similarity	NPC136877
0.7778	Intermediate Similarity	NPC286347
0.7692	Intermediate Similarity	NPC257468
0.7614	Intermediate Similarity	NPC488561
0.7609	Intermediate Similarity	NPC79718
0.7586	Intermediate Similarity	NPC59804
0.75	Intermediate Similarity	NPC114441
0.7471	Intermediate Similarity	NPC12288
0.7447	Intermediate Similarity	NPC324875
0.7447	Intermediate Similarity	NPC292677
0.7419	Intermediate Similarity	NPC119794
0.7412	Intermediate Similarity	NPC191410
0.7386	Intermediate Similarity	NPC56713
0.7368	Intermediate Similarity	NPC488564
0.7326	Intermediate Similarity	NPC475472
0.7317	Intermediate Similarity	NPC28198
0.7317	Intermediate Similarity	NPC476123
0.7216	Intermediate Similarity	NPC62725
0.7108	Intermediate Similarity	NPC57362
0.7097	Intermediate Similarity	NPC104400
0.7097	Intermediate Similarity	NPC10320
0.7021	Intermediate Similarity	NPC139044
0.6957	Remote Similarity	NPC80843
0.6863	Remote Similarity	NPC166422
0.6863	Remote Similarity	NPC219180
0.6863	Remote Similarity	NPC251263
0.686	Remote Similarity	NPC100383
0.6848	Remote Similarity	NPC6377
0.6848	Remote Similarity	NPC208381
0.6813	Remote Similarity	NPC174679
0.6813	Remote Similarity	NPC279554
0.6804	Remote Similarity	NPC276093
0.6753	Remote Similarity	NPC120840
0.6735	Remote Similarity	NPC323359
0.6731	Remote Similarity	NPC54636
0.6705	Remote Similarity	NPC294112
0.6705	Remote Similarity	NPC284807
0.6702	Remote Similarity	NPC469945
0.6667	Remote Similarity	NPC242611
0.6556	Remote Similarity	NPC473481
0.6517	Remote Similarity	NPC475633
0.6489	Remote Similarity	NPC488516
0.6429	Remote Similarity	NPC481082
0.6429	Remote Similarity	NPC73829
0.6429	Remote Similarity	NPC164419
0.6364	Remote Similarity	NPC480946
0.6364	Remote Similarity	NPC130577
0.6364	Remote Similarity	NPC142415
0.6364	Remote Similarity	NPC102683
0.6327	Remote Similarity	NPC471383
0.6286	Remote Similarity	NPC323341
0.6286	Remote Similarity	NPC133818
0.6282	Remote Similarity	NPC270768
0.6282	Remote Similarity	NPC59263
0.6282	Remote Similarity	NPC210106
0.6277	Remote Similarity	NPC108748
0.6275	Remote Similarity	NPC475486
0.6214	Remote Similarity	NPC480939
0.6196	Remote Similarity	NPC480938
0.6154	Remote Similarity	NPC288205
0.6154	Remote Similarity	NPC51465
0.6129	Remote Similarity	NPC76999
0.6076	Remote Similarity	NPC275809
0.6058	Remote Similarity	NPC280941
0.6058	Remote Similarity	NPC235772
0.604	Remote Similarity	NPC488515
0.6023	Remote Similarity	NPC274507
0.6019	Remote Similarity	NPC488209
0.6	Remote Similarity	NPC158141
0.6	Remote Similarity	NPC476992
0.5982	Remote Similarity	NPC161717
0.5979	Remote Similarity	NPC157868
0.5978	Remote Similarity	NPC473538
0.5926	Remote Similarity	NPC298554
0.5904	Remote Similarity	NPC296164
0.59	Remote Similarity	NPC40775
0.59	Remote Similarity	NPC159309
0.59	Remote Similarity	NPC473383
0.59	Remote Similarity	NPC86222
0.5859	Remote Similarity	NPC192791
0.5851	Remote Similarity	NPC214484
0.5842	Remote Similarity	NPC258885
0.5841	Remote Similarity	NPC471385
0.5833	Remote Similarity	NPC96580
0.5802	Remote Similarity	NPC231063
0.5802	Remote Similarity	NPC282395
0.5802	Remote Similarity	NPC110308
0.5743	Remote Similarity	NPC44716
0.5743	Remote Similarity	NPC251768
0.5729	Remote Similarity	NPC48499
0.5714	Remote Similarity	NPC177246
0.5699	Remote Similarity	NPC471967
0.5698	Remote Similarity	NPC601365
0.5688	Remote Similarity	NPC471384
0.5686	Remote Similarity	NPC475591
0.5686	Remote Similarity	NPC236870
0.5679	Remote Similarity	NPC182797
0.5679	Remote Similarity	NPC282616
0.5679	Remote Similarity	NPC84319
0.5679	Remote Similarity	NPC52021
0.5679	Remote Similarity	NPC52169
0.5679	Remote Similarity	NPC488562
0.5679	Remote Similarity	NPC599947
0.5673	Remote Similarity	NPC281148
0.5673	Remote Similarity	NPC114484
0.5652	Remote Similarity	NPC111466
0.5641	Remote Similarity	NPC604575
0.5638	Remote Similarity	NPC209894
0.5625	Remote Similarity	NPC1046
0.5619	Remote Similarity	NPC291903
0.5612	Remote Similarity	NPC235405
0.5612	Remote Similarity	NPC475516
0.561	Remote Similarity	NPC481360
0.5604	Remote Similarity	NPC88744
0.5577	Remote Similarity	NPC302887
0.5556	Remote Similarity	NPC480424
0.5556	Remote Similarity	NPC249848
0.5556	Remote Similarity	NPC198664
0.5556	Remote Similarity	NPC107966
0.5545	Remote Similarity	NPC75417
0.5521	Remote Similarity	NPC90856
0.5521	Remote Similarity	NPC475611
0.55	Remote Similarity	NPC473884
0.55	Remote Similarity	NPC39211
0.549	Remote Similarity	NPC605226
0.5488	Remote Similarity	NPC121798
0.5488	Remote Similarity	NPC37038
0.5488	Remote Similarity	NPC234346
0.5474	Remote Similarity	NPC480937
0.5472	Remote Similarity	NPC75318
0.5464	Remote Similarity	NPC211798
0.5446	Remote Similarity	NPC263756
0.5446	Remote Similarity	NPC76497
0.5446	Remote Similarity	NPC213674
0.5429	Remote Similarity	NPC64715
0.5422	Remote Similarity	NPC106112
0.5422	Remote Similarity	NPC261935
0.5422	Remote Similarity	NPC482135
0.5421	Remote Similarity	NPC160452
0.5413	Remote Similarity	NPC475119
0.5392	Remote Similarity	NPC223301
0.5392	Remote Similarity	NPC171544
0.537	Remote Similarity	NPC187290
0.5368	Remote Similarity	NPC128925
0.5364	Remote Similarity	NPC473824
0.5361	Remote Similarity	NPC30397
0.5357	Remote Similarity	NPC200752
0.5349	Remote Similarity	NPC488521
0.5347	Remote Similarity	NPC470512
0.5347	Remote Similarity	NPC603026
0.534	Remote Similarity	NPC30735
0.5327	Remote Similarity	NPC301449
0.5327	Remote Similarity	NPC23275
0.5327	Remote Similarity	NPC601290
0.5321	Remote Similarity	NPC480936
0.5315	Remote Similarity	NPC151543
0.5309	Remote Similarity	NPC280654
0.5306	Remote Similarity	NPC22676
0.5306	Remote Similarity	NPC127853
0.5294	Remote Similarity	NPC474963
0.5275	Remote Similarity	NPC484195
0.5253	Remote Similarity	NPC235841
0.5253	Remote Similarity	NPC297208
0.5243	Remote Similarity	NPC242840
0.5243	Remote Similarity	NPC112352
0.5238	Remote Similarity	NPC130278
0.5238	Remote Similarity	NPC235438
0.5238	Remote Similarity	NPC118440
0.5233	Remote Similarity	NPC608622
0.5229	Remote Similarity	NPC469947
0.5229	Remote Similarity	NPC480948
0.5227	Remote Similarity	NPC474727
0.5217	Remote Similarity	NPC488211
0.5204	Remote Similarity	NPC204458
0.5204	Remote Similarity	NPC171007
0.5204	Remote Similarity	NPC190849
0.5196	Remote Similarity	NPC610795
0.5182	Remote Similarity	NPC11242
0.5176	Remote Similarity	NPC228784
0.5176	Remote Similarity	NPC324341
0.5176	Remote Similarity	NPC601810
0.5175	Remote Similarity	NPC475140
0.5152	Remote Similarity	NPC78046
0.5149	Remote Similarity	NPC309780
0.5146	Remote Similarity	NPC475171
0.5146	Remote Similarity	NPC469946

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC606107 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6437
0.1-0.2	2608
0.2-0.3	91
0.3-0.4	12
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data