NPASS Compound

Natural Product: NPC610795

Natural Product ID	NPC610795
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	COZSPNKIIUVCFK-WVLCZHCKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL4483775
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 102107 0 0 0 0 0 0 0 0999 V2000 11.5039 -0.7903 -0.1951 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2581 -1.2203 -1.5034 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9502 -1.2345 -2.0017 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8997 -0.8181 -1.1970 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5930 -0.8082 -1.6240 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4694 -0.3561 -0.7945 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6180 0.1131 0.4228 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4865 0.5546 1.2240 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6533 1.0181 2.4007 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1821 0.5033 0.7747 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0730 0.9514 1.5736 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4721 2.0709 0.8132 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0446 1.9897 0.4524 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5220 0.5866 0.1705 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1694 0.0832 -1.0539 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9749 0.7648 0.1271 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4719 1.6483 -0.9647 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9347 1.5318 -1.1229 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7451 0.7735 -0.4336 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2068 0.7357 -0.6796 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0189 1.4381 0.3816 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4041 1.6617 -0.2407 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4904 1.5445 0.8068 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4272 3.1050 -0.7405 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6951 0.6863 -1.3307 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1826 -0.6632 -0.9545 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6453 -0.6599 -0.9237 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2261 -1.0688 -2.2819 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5802 -0.2330 -2.9909 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4828 -2.2998 -2.8489 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1046 -1.6694 0.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0968 -1.2092 1.0148 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2059 -0.0839 0.6394 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0905 0.8429 1.8612 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7868 -0.4886 0.2319 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7538 -1.1643 -1.1219 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2723 -1.4821 1.2307 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2464 -1.5650 1.2746 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8155 -0.1914 1.4245 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2080 -0.2147 1.8963 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9627 -1.4840 1.5437 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1171 -0.2754 3.4432 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3735 -1.2461 -2.9310 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4127 -1.6594 -3.7316 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7135 -1.6621 -3.2866 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7852 -2.0784 -4.0842 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5933 -0.7348 0.0027 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0678 0.1944 -0.0095 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0814 -1.5006 0.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1485 -0.4950 -0.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4768 -0.4354 -1.2610 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6000 0.1750 0.8465 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5618 1.3359 2.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0892 2.3769 -0.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5668 3.0041 1.4578 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8618 2.5939 -0.4622 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3953 2.4199 1.2426 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3625 -1.0054 -1.1033 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1970 0.5530 -1.1130 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6611 0.4480 -1.9607 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1865 1.3302 1.0915 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2830 2.7232 -0.6677 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0263 1.5350 -1.9465 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3850 2.1593 -1.9136 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3813 1.3124 -1.6232 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5480 2.3866 0.6269 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1758 0.8623 1.2897 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4224 1.1564 0.3203 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2091 0.8953 1.6486 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7620 2.5355 1.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5490 3.3028 -1.3994 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3933 3.2491 -1.2295 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4118 3.7296 0.1827 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8160 0.5965 -1.3946 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3864 1.0138 -2.3425 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5614 -0.9083 0.0493 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5391 -1.4380 -1.6695 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8213 -2.7154 -3.5133 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0031 -2.0829 0.5944 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7221 -2.5918 -0.4891 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6558 -0.9531 1.9698 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5176 -2.1221 1.3504 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3246 0.5340 2.5677 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0674 0.7410 2.4242 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0693 1.9148 1.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6169 -1.8317 -1.3053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8685 -1.8707 -1.1640 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7456 -0.4482 -1.9717 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5903 -2.5071 0.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7020 -1.3713 2.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5703 -2.1213 0.3965 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4837 -2.1278 2.2186 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1800 0.3098 2.2167 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5122 -2.3892 1.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0693 -1.6068 0.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0135 -1.4411 1.9428 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9820 -1.3219 3.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2945 0.3983 3.7375 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0427 0.1177 3.8913 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3781 -1.2716 -3.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2505 -2.0043 -4.7614 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5674 -2.5865 -3.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 28 29 2 0 28 30 1 0 27 31 1 0 31 32 1 0 32 33 1 0 33 34 1 1 33 35 1 0 35 36 1 6 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 5 43 2 0 43 44 1 0 44 45 2 0 45 46 1 0 45 3 1 0 40 11 1 0 39 14 1 0 35 16 1 0 33 19 1 0 27 20 1 0 1 47 1 0 1 48 1 0 1 49 1 0 4 50 1 0 6 51 1 0 7 52 1 0 11 53 1 1 12 54 1 0 12 55 1 0 13 56 1 0 13 57 1 0 15 58 1 0 15 59 1 0 15 60 1 0 16 61 1 1 17 62 1 0 17 63 1 0 18 64 1 0 20 65 1 6 21 66 1 0 21 67 1 0 23 68 1 0 23 69 1 0 23 70 1 0 24 71 1 0 24 72 1 0 24 73 1 0 25 74 1 0 25 75 1 0 26 76 1 0 26 77 1 0 30 78 1 0 31 79 1 0 31 80 1 0 32 81 1 0 32 82 1 0 34 83 1 0 34 84 1 0 34 85 1 0 36 86 1 0 36 87 1 0 36 88 1 0 37 89 1 0 37 90 1 0 38 91 1 0 38 92 1 0 39 93 1 1 41 94 1 0 41 95 1 0 41 96 1 0 42 97 1 0 42 98 1 0 42 99 1 0 43100 1 0 44101 1 0 46102 1 0 M END

Standard InCHIKey	COZSPNKIIUVCFK-WVLCZHCKSA-N
Standard InCHI	InChI=1S/C40H56O6/c1-35(2)19-21-40(34(43)44)22-20-38(6)26(27(40)24-35)11-13-31-37(5)17-16-32(36(3,4)30(37)15-18-39(31,38)7)46-33(42)14-10-25-9-12-28(41)29(23-25)45-8/h9-12,14,23,27,30-32,41H,13,15-22,24H2,1-8H3,(H,43,44)/b14-10+/t27-,30-,31+,32-,37-,38+,39+,40-/m0/s1
SMILES	COc1cc(/C=C/C(=O)O[C@H]2CC[C@]3(C)[C@H]4CC=C5[C@@H]6CC(C)(C)CC[C@]6(C(=O)O)CC[C@@]5(C)[C@]4(C)CC[C@H]3C2(C)C)ccc1O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO56455	Scaphopetalum thonneri	Species	Malvaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	=	54100.0	nM	PMID[31255927]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC610795 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6665
0.1-0.2	38122
0.2-0.3	4334
0.3-0.4	490
0.4-0.5	172
0.5-0.6	45
0.6-0.7	23
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8298	Intermediate Similarity	NPC601567
0.8298	Intermediate Similarity	NPC606631
0.7527	Intermediate Similarity	NPC22676
0.701	Intermediate Similarity	NPC605663
0.6796	Remote Similarity	NPC481234
0.6796	Remote Similarity	NPC118033
0.6796	Remote Similarity	NPC479431
0.6667	Remote Similarity	NPC172311
0.6667	Remote Similarity	NPC53520
0.6602	Remote Similarity	NPC206232
0.6602	Remote Similarity	NPC14515
0.66	Remote Similarity	NPC205392
0.66	Remote Similarity	NPC105942
0.6531	Remote Similarity	NPC171007
0.6531	Remote Similarity	NPC190849
0.6512	Remote Similarity	NPC120840
0.6509	Remote Similarity	NPC481235
0.6436	Remote Similarity	NPC132126
0.6429	Remote Similarity	NPC477874
0.6392	Remote Similarity	NPC173569
0.63	Remote Similarity	NPC477873
0.6289	Remote Similarity	NPC485587
0.6238	Remote Similarity	NPC198621
0.6238	Remote Similarity	NPC216940
0.6154	Remote Similarity	NPC475311
0.6122	Remote Similarity	NPC307205
0.6019	Remote Similarity	NPC482052
0.5905	Remote Similarity	NPC485425
0.59	Remote Similarity	NPC43353
0.5825	Remote Similarity	NPC488215
0.566	Remote Similarity	NPC304110
0.566	Remote Similarity	NPC25491
0.566	Remote Similarity	NPC27518
0.566	Remote Similarity	NPC611516
0.5566	Remote Similarity	NPC488214
0.5556	Remote Similarity	NPC482051
0.5495	Remote Similarity	NPC310729
0.5495	Remote Similarity	NPC150310
0.5472	Remote Similarity	NPC262970
0.5455	Remote Similarity	NPC473680
0.5437	Remote Similarity	NPC182249
0.5437	Remote Similarity	NPC473591
0.5437	Remote Similarity	NPC248287
0.5437	Remote Similarity	NPC234548
0.5435	Remote Similarity	NPC200752
0.5429	Remote Similarity	NPC469447
0.5426	Remote Similarity	NPC296164
0.537	Remote Similarity	NPC606782
0.5347	Remote Similarity	NPC283849
0.5333	Remote Similarity	NPC8102
0.5333	Remote Similarity	NPC66894
0.5321	Remote Similarity	NPC479739
0.5321	Remote Similarity	NPC178093
0.5312	Remote Similarity	NPC485588
0.5288	Remote Similarity	NPC155192
0.5285	Remote Similarity	NPC488211
0.5278	Remote Similarity	NPC479744
0.5273	Remote Similarity	NPC324798
0.5273	Remote Similarity	NPC479742
0.5263	Remote Similarity	NPC488521
0.5225	Remote Similarity	NPC479745
0.5208	Remote Similarity	NPC96580
0.5196	Remote Similarity	NPC606107
0.5158	Remote Similarity	NPC608622
0.5096	Remote Similarity	NPC286347
0.5096	Remote Similarity	NPC96930
0.5089	Remote Similarity	NPC475454
0.5089	Remote Similarity	NPC473579
0.5078	Remote Similarity	NPC111466
0.5053	Remote Similarity	NPC485589
0.5047	Remote Similarity	NPC475627
0.5044	Remote Similarity	NPC469945

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC610795 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3056
0.1-0.2	5983
0.2-0.3	103
0.3-0.4	7
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.537	Remote Similarity	NPD8166	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data