NPASS Compound

Natural Product: NPC488561

Natural Product ID	NPC488561
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PDCALJUWWJEWKR-LFGJQLCQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101591989
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 119125 0 0 0 0 0 0 0 0999 V2000 -8.8972 -0.4326 -1.9911 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3797 -0.4180 -0.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1433 -1.5554 0.1394 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7270 0.9262 0.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4628 1.7975 0.0041 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5589 1.1530 1.0749 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5387 2.1324 1.5249 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1526 1.6220 1.6995 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7012 0.8763 0.5084 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4820 1.8790 -0.6053 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6757 -0.1487 0.0366 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2020 -1.0463 -0.8014 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8308 -1.1553 -1.3227 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8744 -0.3139 -0.5585 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4502 -0.8039 -0.5610 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2838 -2.2702 -0.3922 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0823 -0.5145 -1.9822 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5297 -0.8747 -2.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4177 -0.3200 -1.0296 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8402 -0.1936 0.3329 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2659 -1.3058 1.2660 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4501 1.0875 0.9516 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3732 0.0704 0.3230 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1844 0.2203 1.7294 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5153 0.9164 1.5965 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4244 0.0525 0.7670 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8550 -1.1127 1.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5658 -1.1110 -1.0718 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7026 -0.4730 -1.4935 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7109 -0.4920 -0.3723 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5898 -1.7451 -0.4418 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7870 -2.7833 -1.1964 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6351 -2.2832 -2.6027 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7035 -3.1488 -3.4239 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0823 -4.4879 -3.3826 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2113 -0.9755 -2.6826 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6051 -3.9364 -1.2814 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8318 -2.2616 0.8306 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4985 0.6529 -0.3128 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3754 1.2727 0.9018 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6617 1.3312 1.6869 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6079 2.3835 1.2056 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9222 3.7078 0.9601 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7011 3.4105 0.1158 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8760 2.5734 0.8345 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8214 4.5494 0.3398 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3006 1.9555 0.0559 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3304 1.6118 3.0123 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0926 -0.1324 0.5204 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9154 -0.6894 -0.6197 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4836 0.9100 2.2288 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6210 -0.2476 2.6524 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1531 1.9755 2.7855 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1110 -0.0897 -2.6908 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1483 -1.4801 -2.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8112 0.1529 -2.0822 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4934 -2.3120 -0.5963 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0500 -1.1808 0.6687 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4838 -2.1252 0.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4721 1.4832 -0.6115 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1421 0.8369 1.0131 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6888 2.8261 0.2780 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0094 1.7707 -0.9865 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8314 2.5649 2.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6067 3.0388 0.8612 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0874 1.0918 2.6595 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4855 2.5244 1.8083 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2428 2.6882 -0.5652 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5142 2.4472 -0.4889 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6098 1.4433 -1.6176 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9129 -1.8134 -1.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5274 -2.2211 -1.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8826 -0.8144 -2.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8173 0.6709 -1.1278 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5897 -2.7535 -1.3706 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8546 -2.7583 0.3874 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8072 -2.5102 -0.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0139 0.5710 -2.1120 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4797 -1.0941 -2.7157 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6779 -1.9936 -2.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8886 -0.4854 -3.0701 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7496 0.6929 -1.3756 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8933 -2.0683 0.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9628 -0.9599 2.0750 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -1.7755 1.8174 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4996 1.1997 0.6230 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8262 1.9596 0.7371 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4921 0.9652 2.0540 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2646 1.1142 -0.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2164 -0.6969 2.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4739 0.9262 2.2737 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9614 1.0524 2.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3515 1.9178 1.1579 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1335 -1.3346 2.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0178 -2.0503 1.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8042 -0.8862 2.1498 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4583 0.5864 -1.7076 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1929 -0.5744 0.6036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5280 -1.5384 -0.9839 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8406 -3.0175 -0.6868 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6341 -2.3374 -3.0850 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6587 -2.9818 -3.1225 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7840 -2.8281 -4.4852 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5177 -4.9051 -2.6596 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5507 -3.6560 -1.3164 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7629 -2.5826 0.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6548 0.7090 1.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2038 0.3655 1.6921 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3788 2.5439 1.9856 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6499 4.1304 1.9575 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0492 2.9935 -0.8332 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1573 4.3785 -0.0103 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4228 4.9054 1.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9218 1.2383 0.3546 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3826 1.3675 3.2076 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2131 -0.9003 1.3505 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5418 -0.3319 -1.6048 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8124 -1.8186 -0.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6703 1.8835 3.6642 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 6 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 19 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 31 38 1 0 30 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 42 47 1 0 41 48 1 0 11 49 1 0 49 50 1 0 6 51 1 1 51 52 2 0 51 53 1 0 50 2 1 0 49 6 1 0 26 9 1 0 36 29 1 0 45 40 1 0 26 14 1 0 23 15 1 0 1 54 1 0 1 55 1 0 1 56 1 0 3 57 1 0 3 58 1 0 3 59 1 0 4 60 1 0 4 61 1 0 5 62 1 0 5 63 1 0 7 64 1 0 7 65 1 0 8 66 1 0 8 67 1 0 10 68 1 0 10 69 1 0 10 70 1 0 12 71 1 0 13 72 1 0 13 73 1 0 14 74 1 6 16 75 1 0 16 76 1 0 16 77 1 0 17 78 1 0 17 79 1 0 18 80 1 0 18 81 1 0 19 82 1 6 21 83 1 0 21 84 1 0 21 85 1 0 22 86 1 0 22 87 1 0 22 88 1 0 23 89 1 6 24 90 1 0 24 91 1 0 25 92 1 0 25 93 1 0 27 94 1 0 27 95 1 0 27 96 1 0 29 97 1 6 30 98 1 1 31 99 1 6 32100 1 1 33101 1 6 34102 1 0 34103 1 0 35104 1 0 37105 1 0 38106 1 0 40107 1 1 41108 1 1 42109 1 1 43110 1 1 44111 1 0 44112 1 0 46113 1 0 47114 1 0 48115 1 0 49116 1 1 50117 1 0 50118 1 0 53119 1 0 M END

Standard InCHIKey	PDCALJUWWJEWKR-LFGJQLCQSA-N
Standard InCHI	InChI=1S/C41H66O12/c1-36(2)14-16-41(35(48)49)17-15-39(6)21(22(41)18-36)8-9-26-38(5)12-11-27(37(3,4)25(38)10-13-40(26,39)7)52-34-32(30(46)29(45)24(19-42)51-34)53-33-31(47)28(44)23(43)20-50-33/h8,22-34,42-47H,9-20H2,1-7H3,(H,48,49)/t22-,23-,24+,25-,26+,27-,28-,29+,30-,31+,32+,33-,34-,38-,39+,40+,41-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	750.46	Volume:	758.006 ? Van der Waals volume.
Dense:	0.99	LogP:	2.594 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.897 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.734 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	39.0
TPSA:	195.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	12.0
H-Bond Donor:	7.0	Rings:	7.0
Heavy Atoms:	12.0

MedChem Properties

QED Drug-Likeness Score:	0.155	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.671	Fsp³:	0.927
MCE-18:	149.013 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.952	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.183	Promiscuous compounds:	0.126

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.915	MDCK Permeability:	-5.127
Pgp-inhibitor:	0.001	Pgp-substrate:	0.005
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.063
20% Bioavailability (F20%):	0.286	30% Bioavailability (F30%):	0.701
50% Bioavailability (F50%):	0.986

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	0.831
Plasma Protein Binding (PPB):	80.396%	Volume Distribution (VD):	-0.568
Fu:	12.692% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.991	BCRP inhibitor:	0.0
BSEP inhibitor:	0.026

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.166	CYP2C19-substrate:	0.002
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.01	CYP3A4-substrate:	0.026
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.698 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.34

Half-life (T1/2):

1.905

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.84	Drug-induced Liver Injury (DILI):	0.948
AMES Toxicity:	0.807	Rat Oral Acute Toxicity:	0.028
Maximum Recommended Daily Dose:	0.012	Skin Sensitization:	1.0
Carcinogencity:	0.603	Eye Corrosion:	0.0
Eye Irritation:	0.035	Respiratory Toxicity:	0.168
Drug-induced Neurotoxicity:	0.005	Ototoxicity:	0.985
Hematotoxicity:	0.74	Drug-induced Nephrotoxicity:	0.99
Genotoxicity:	0.544	RPMI-8226 Immunitoxicity:	0.079
A549 Cytotoxicity:	0.631	Hek293 Cytotoxicity:	0.195
BCF:	1.306 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.737 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.345 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.531 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[31301930]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	=	3100.0	nM	PMID[31301930]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488561 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21807
0.1-0.2	23247
0.2-0.3	3283
0.3-0.4	785
0.4-0.5	505
0.5-0.6	119
0.6-0.7	40
0.7-0.8	0
0.8-0.85	6
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8736	High Similarity	NPC164194
0.8478	Intermediate Similarity	NPC469945
0.8444	Intermediate Similarity	NPC25605
0.8352	Intermediate Similarity	NPC127056
0.8235	Intermediate Similarity	NPC283849
0.8041	Intermediate Similarity	NPC79718
0.8	Intermediate Similarity	NPC114304
0.7755	Intermediate Similarity	NPC481082
0.7755	Intermediate Similarity	NPC164419
0.7742	Intermediate Similarity	NPC12288
0.7732	Intermediate Similarity	NPC104400
0.7732	Intermediate Similarity	NPC10320
0.7684	Intermediate Similarity	NPC472949
0.766	Intermediate Similarity	NPC56713
0.766	Intermediate Similarity	NPC59804
0.7619	Intermediate Similarity	NPC166422
0.7614	Intermediate Similarity	NPC28198
0.7614	Intermediate Similarity	NPC476123
0.7614	Intermediate Similarity	NPC606107
0.7525	Intermediate Similarity	NPC324875
0.7525	Intermediate Similarity	NPC292677
0.74	Intermediate Similarity	NPC257468
0.7308	Intermediate Similarity	NPC280941
0.7308	Intermediate Similarity	NPC235772
0.7238	Intermediate Similarity	NPC288205
0.7238	Intermediate Similarity	NPC51465
0.7228	Intermediate Similarity	NPC73829
0.7216	Intermediate Similarity	NPC109079
0.7174	Intermediate Similarity	NPC100383
0.7157	Intermediate Similarity	NPC119794
0.7143	Intermediate Similarity	NPC6377
0.7143	Intermediate Similarity	NPC208381
0.713	Intermediate Similarity	NPC219180
0.7128	Intermediate Similarity	NPC191410
0.7115	Intermediate Similarity	NPC488564
0.7113	Intermediate Similarity	NPC174679
0.7113	Intermediate Similarity	NPC279554
0.7071	Intermediate Similarity	NPC80843
0.7071	Intermediate Similarity	NPC22956
0.7037	Intermediate Similarity	NPC323341
0.6989	Remote Similarity	NPC242611
0.6972	Remote Similarity	NPC251263
0.6923	Remote Similarity	NPC204407
0.6923	Remote Similarity	NPC276093
0.6837	Remote Similarity	NPC136877
0.6796	Remote Similarity	NPC139044
0.6792	Remote Similarity	NPC488209
0.6733	Remote Similarity	NPC469946
0.6699	Remote Similarity	NPC180550
0.6699	Remote Similarity	NPC35405
0.6667	Remote Similarity	NPC488515
0.6552	Remote Similarity	NPC471385
0.6549	Remote Similarity	NPC54636
0.6542	Remote Similarity	NPC323359
0.6542	Remote Similarity	NPC291903
0.6526	Remote Similarity	NPC286347
0.6514	Remote Similarity	NPC480939
0.6514	Remote Similarity	NPC62725
0.6471	Remote Similarity	NPC488516
0.6465	Remote Similarity	NPC270667
0.6455	Remote Similarity	NPC475119
0.6429	Remote Similarity	NPC471384
0.6429	Remote Similarity	NPC133818
0.6422	Remote Similarity	NPC475486
0.641	Remote Similarity	NPC161717
0.6396	Remote Similarity	NPC473824
0.6364	Remote Similarity	NPC475472
0.6354	Remote Similarity	NPC31839
0.6327	Remote Similarity	NPC284807
0.6321	Remote Similarity	NPC471383
0.6239	Remote Similarity	NPC301449
0.6239	Remote Similarity	NPC75318
0.6239	Remote Similarity	NPC601290
0.6174	Remote Similarity	NPC475140
0.6161	Remote Similarity	NPC476992
0.6124	Remote Similarity	NPC40085
0.6111	Remote Similarity	NPC297263
0.6082	Remote Similarity	NPC177246
0.6058	Remote Similarity	NPC114441
0.6031	Remote Similarity	NPC264270
0.598	Remote Similarity	NPC127853
0.598	Remote Similarity	NPC76999
0.5955	Remote Similarity	NPC120840
0.595	Remote Similarity	NPC111466
0.5943	Remote Similarity	NPC213674
0.5909	Remote Similarity	NPC302887
0.5909	Remote Similarity	NPC484832
0.5905	Remote Similarity	NPC480424
0.5856	Remote Similarity	NPC37134
0.5841	Remote Similarity	NPC31838
0.5826	Remote Similarity	NPC610204
0.5804	Remote Similarity	NPC606145
0.5794	Remote Similarity	NPC263756
0.5776	Remote Similarity	NPC151543
0.5752	Remote Similarity	NPC160452
0.5702	Remote Similarity	NPC187290
0.5702	Remote Similarity	NPC609281
0.5686	Remote Similarity	NPC294112
0.5686	Remote Similarity	NPC473538
0.5664	Remote Similarity	NPC481079
0.5664	Remote Similarity	NPC23275
0.5636	Remote Similarity	NPC251768
0.5636	Remote Similarity	NPC480475
0.563	Remote Similarity	NPC283417
0.563	Remote Similarity	NPC200049
0.5593	Remote Similarity	NPC243680
0.5577	Remote Similarity	NPC194842
0.5577	Remote Similarity	NPC90856
0.5565	Remote Similarity	NPC469947
0.5565	Remote Similarity	NPC480948
0.5565	Remote Similarity	NPC481078
0.5556	Remote Similarity	NPC313110
0.5556	Remote Similarity	NPC200788
0.5556	Remote Similarity	NPC610461
0.5545	Remote Similarity	NPC30289
0.5537	Remote Similarity	NPC488211
0.5517	Remote Similarity	NPC606553
0.5514	Remote Similarity	NPC488205
0.5508	Remote Similarity	NPC123522
0.55	Remote Similarity	NPC57362
0.5495	Remote Similarity	NPC473383
0.5487	Remote Similarity	NPC64715
0.5478	Remote Similarity	NPC480474
0.5455	Remote Similarity	NPC192791
0.5455	Remote Similarity	NPC112352
0.5447	Remote Similarity	NPC265841
0.5447	Remote Similarity	NPC488308
0.5446	Remote Similarity	NPC63159
0.5446	Remote Similarity	NPC118440
0.5444	Remote Similarity	NPC480946
0.5444	Remote Similarity	NPC130577
0.5444	Remote Similarity	NPC142415
0.5444	Remote Similarity	NPC102683
0.5439	Remote Similarity	NPC145899
0.5437	Remote Similarity	NPC128925
0.5431	Remote Similarity	NPC207738
0.5424	Remote Similarity	NPC607904
0.5417	Remote Similarity	NPC603137
0.5413	Remote Similarity	NPC488207
0.541	Remote Similarity	NPC4749
0.5405	Remote Similarity	NPC117714
0.5403	Remote Similarity	NPC312650
0.5403	Remote Similarity	NPC470876
0.5398	Remote Similarity	NPC131469
0.5385	Remote Similarity	NPC270768
0.5385	Remote Similarity	NPC59263
0.5385	Remote Similarity	NPC210106
0.5385	Remote Similarity	NPC475633
0.5377	Remote Similarity	NPC1046
0.5377	Remote Similarity	NPC78046
0.5372	Remote Similarity	NPC191827
0.537	Remote Similarity	NPC475296
0.537	Remote Similarity	NPC309780
0.5357	Remote Similarity	NPC148603
0.5351	Remote Similarity	NPC95437
0.5345	Remote Similarity	NPC480473
0.5339	Remote Similarity	NPC185466
0.5312	Remote Similarity	NPC488309
0.5304	Remote Similarity	NPC114692
0.5304	Remote Similarity	NPC236657
0.5299	Remote Similarity	NPC104137
0.5299	Remote Similarity	NPC26626
0.5294	Remote Similarity	NPC300419
0.5289	Remote Similarity	NPC123199
0.5285	Remote Similarity	NPC181066
0.5285	Remote Similarity	NPC71391
0.5283	Remote Similarity	NPC204458
0.5283	Remote Similarity	NPC473481
0.5283	Remote Similarity	NPC475611
0.5283	Remote Similarity	NPC480938
0.528	Remote Similarity	NPC271610
0.5273	Remote Similarity	NPC470512
0.5268	Remote Similarity	NPC480947
0.5263	Remote Similarity	NPC296164
0.5263	Remote Similarity	NPC222580
0.5263	Remote Similarity	NPC123796
0.5254	Remote Similarity	NPC11242
0.5254	Remote Similarity	NPC480936
0.5242	Remote Similarity	NPC484061
0.5242	Remote Similarity	NPC484062
0.5242	Remote Similarity	NPC57484
0.5221	Remote Similarity	NPC164389
0.5217	Remote Similarity	NPC275809
0.5214	Remote Similarity	NPC187618
0.5214	Remote Similarity	NPC120116
0.5208	Remote Similarity	NPC96580
0.5194	Remote Similarity	NPC482010
0.5194	Remote Similarity	NPC488212
0.5175	Remote Similarity	NPC475591
0.5175	Remote Similarity	NPC236870
0.5164	Remote Similarity	NPC609305
0.5161	Remote Similarity	NPC231063
0.5161	Remote Similarity	NPC282395
0.5161	Remote Similarity	NPC158141
0.5161	Remote Similarity	NPC192765
0.5152	Remote Similarity	NPC488210
0.5135	Remote Similarity	NPC295371
0.5133	Remote Similarity	NPC471965
0.5133	Remote Similarity	NPC482749

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488561 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6594
0.1-0.2	2498
0.2-0.3	49
0.3-0.4	7
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data