NPASS Compound

Natural Product: NPC488516

Natural Product ID	NPC488516
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YOFVOAYCIARLQE-VBHJJZTMSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584167
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 120126 0 0 0 0 0 0 0 0999 V2000 -9.1685 -2.6083 -1.0224 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7013 -1.2882 -0.3932 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6318 -1.0316 0.7678 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9312 -0.2358 -1.4335 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4920 1.1243 -1.0071 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1140 1.0455 -0.3258 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4676 -0.2654 -0.5752 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2467 -1.3823 0.0181 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0144 -0.2641 -0.2333 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4398 -1.3472 0.2589 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0370 -1.5267 0.6459 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2366 -0.3226 0.2591 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8176 -0.3242 0.7309 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6097 -0.7089 2.1475 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0816 -1.3863 -0.1063 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3993 -1.3441 0.2154 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9648 -0.0011 -0.2372 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2205 1.1662 0.3230 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7900 1.6195 1.6585 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5173 2.3219 -0.6532 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2385 1.0014 0.3221 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9513 2.1129 1.0946 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3278 2.2039 0.4690 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0429 0.9024 0.5695 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6537 0.8588 1.9516 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1700 0.9383 -0.4406 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6169 0.7991 -1.8633 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9470 2.2146 -0.4222 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3194 2.1674 -0.9631 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4310 2.1938 -2.3445 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2866 0.0798 0.1271 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1965 0.0449 -0.9225 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1194 1.2260 -0.9913 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4033 0.9004 -1.7246 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2754 -0.3693 -2.5405 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7296 -1.5087 -1.7479 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8430 -2.3877 -1.1754 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6356 -1.6908 -0.2949 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6600 -2.4314 0.2650 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0156 -1.8255 0.0240 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5824 -1.0753 1.1863 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5410 -0.4391 2.0539 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2430 -1.2097 2.1141 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5139 -2.5222 1.6662 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3233 0.8603 1.6319 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3808 -0.0337 0.6734 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9523 -2.8325 -0.3228 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9758 -1.0886 -0.6861 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4645 -0.1615 -3.6548 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5028 0.8604 -0.8732 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5678 2.3263 -1.6477 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3552 1.3817 1.0844 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1506 0.6014 2.0459 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8431 2.6420 1.3990 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0686 -2.3922 -1.6609 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3559 -2.9872 -1.6588 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4871 -3.2927 -0.2366 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9590 0.0452 0.8274 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1882 -1.3175 1.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5931 -1.6120 0.6680 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0420 -0.1898 -1.5991 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4779 -0.4856 -2.4157 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2558 1.5795 -0.3182 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4802 1.7854 -1.8915 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4911 -0.4336 -1.6965 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8701 -2.3646 -0.4121 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1837 -1.5099 1.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0821 -2.2390 0.4071 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9815 -1.8315 1.6881 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5992 -2.3941 0.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1536 -0.3657 -0.8704 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5457 -1.8376 2.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2878 -0.3014 2.8888 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4151 -0.3855 2.4418 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1985 -1.1168 -1.1673 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4663 -2.3859 0.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8801 -2.1089 -0.4256 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6383 -1.5891 1.2567 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8052 -0.0170 -1.3493 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0046 1.9377 2.3755 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4727 2.4897 1.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4563 0.8099 2.0826 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2971 2.9549 -0.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7850 1.9094 -1.6647 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6156 2.9545 -0.7696 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5760 1.1428 -0.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0093 1.8122 2.1641 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4193 3.0425 0.9294 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1882 2.6031 -0.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8900 2.9643 1.0508 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8542 -0.1320 2.3451 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9593 1.3697 2.6904 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5892 1.4412 2.0421 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2768 1.3540 -2.5774 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6273 1.2502 -1.9882 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6750 -0.2555 -2.1991 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9902 2.7031 0.5767 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3648 2.9492 -1.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8426 3.1109 -0.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6720 1.3242 -2.7074 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6897 -0.0595 -1.8989 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4074 1.5875 0.0289 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6545 1.6965 -2.4866 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2755 -0.6384 -2.9186 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1010 -2.1832 -2.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3946 -3.2431 -0.6456 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4657 -2.7565 -2.0158 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6646 -3.4987 -0.1005 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9775 -1.1463 -0.8598 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2595 -1.7359 1.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9703 -0.3607 3.1015 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8490 -1.2569 3.1617 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5025 -0.7592 1.4143 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7512 1.0014 0.7589 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3004 -0.3647 0.6302 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5729 -3.0061 0.4334 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7780 -0.7852 -4.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1309 1.6143 -1.0028 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3049 2.8712 -1.9831 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7858 3.0549 2.3330 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 1 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 41 46 1 0 40 47 1 0 36 48 1 0 35 49 1 0 34 50 1 0 33 51 1 0 6 52 1 1 52 53 2 0 52 54 1 0 8 2 1 0 26 9 1 0 48 32 1 0 29 6 1 0 44 39 1 0 24 12 1 0 21 13 1 0 1 55 1 0 1 56 1 0 1 57 1 0 3 58 1 0 3 59 1 0 3 60 1 0 4 61 1 0 4 62 1 0 5 63 1 0 5 64 1 0 7 65 1 6 8 66 1 0 8 67 1 0 10 68 1 0 11 69 1 0 11 70 1 0 12 71 1 6 14 72 1 0 14 73 1 0 14 74 1 0 15 75 1 0 15 76 1 0 16 77 1 0 16 78 1 0 17 79 1 6 19 80 1 0 19 81 1 0 19 82 1 0 20 83 1 0 20 84 1 0 20 85 1 0 21 86 1 6 22 87 1 0 22 88 1 0 23 89 1 0 23 90 1 0 25 91 1 0 25 92 1 0 25 93 1 0 27 94 1 0 27 95 1 0 27 96 1 0 28 97 1 0 28 98 1 0 29 99 1 1 30100 1 0 32101 1 6 33102 1 1 34103 1 6 35104 1 6 36105 1 6 37106 1 0 37107 1 0 39108 1 6 40109 1 6 41110 1 1 42111 1 1 43112 1 0 43113 1 0 45114 1 0 46115 1 0 47116 1 0 49117 1 0 50118 1 0 51119 1 0 54120 1 0 M END

Standard InCHIKey	YOFVOAYCIARLQE-VBHJJZTMSA-N
Standard InCHI	InChI=1S/C41H66O13/c1-36(2)14-15-41(35(49)50)21(16-36)20-8-9-25-38(5)12-11-27(37(3,4)24(38)10-13-39(25,6)40(20,7)17-26(41)43)54-34-32(48)30(46)29(45)23(53-34)19-52-33-31(47)28(44)22(42)18-51-33/h8,21-34,42-48H,9-19H2,1-7H3,(H,49,50)/t21-,22+,23-,24+,25-,26-,27+,28+,29-,30+,31-,32-,33+,34+,38+,39-,40-,41-/m1/s1
SMILES	CC1(C)CC[C@]2([C@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O)O1)O)O)O)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	766.45	Volume:	766.797 ? Van der Waals volume.
Dense:	1.0	LogP:	2.435 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.891 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.618 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	39.0
TPSA:	215.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.144	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.817	Fsp³:	0.927
MCE-18:	151.772 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.818	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.016 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.178	Promiscuous compounds:	0.096

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.952	MDCK Permeability:	-5.174
Pgp-inhibitor:	0.0	Pgp-substrate:	0.045
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.03
20% Bioavailability (F20%):	0.081	30% Bioavailability (F30%):	0.636
50% Bioavailability (F50%):	0.982

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.764
Plasma Protein Binding (PPB):	76.112%	Volume Distribution (VD):	-0.526
Fu:	17.574% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.002
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.934
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.108
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.368

Half-life (T1/2):

1.952

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.01
Human Hepatotoxicity (H-HT):	0.762	Drug-induced Liver Injury (DILI):	0.854
AMES Toxicity:	0.897	Rat Oral Acute Toxicity:	0.026
Maximum Recommended Daily Dose:	0.028	Skin Sensitization:	0.999
Carcinogencity:	0.476	Eye Corrosion:	0.0
Eye Irritation:	0.02	Respiratory Toxicity:	0.101
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.98
Hematotoxicity:	0.553	Drug-induced Nephrotoxicity:	0.978
Genotoxicity:	0.534	RPMI-8226 Immunitoxicity:	0.082
A549 Cytotoxicity:	0.797	Hek293 Cytotoxicity:	0.366
BCF:	1.262 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.754 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.391 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.522 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	=	50000.0	nM	PMID[7494144]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	13000.0	nM	PMID[7494144]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488516 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20496
0.1-0.2	24379
0.2-0.3	3564
0.3-0.4	919
0.4-0.5	369
0.5-0.6	84
0.6-0.7	28
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8817	High Similarity	NPC488515
0.8764	High Similarity	NPC480424
0.8588	High Similarity	NPC242611
0.8061	Intermediate Similarity	NPC75318
0.7841	Intermediate Similarity	NPC31839
0.7745	Intermediate Similarity	NPC288205
0.7745	Intermediate Similarity	NPC51465
0.7604	Intermediate Similarity	NPC80843
0.7426	Intermediate Similarity	NPC37134
0.7374	Intermediate Similarity	NPC104400
0.7374	Intermediate Similarity	NPC10320
0.7353	Intermediate Similarity	NPC291903
0.7033	Intermediate Similarity	NPC283849
0.6923	Remote Similarity	NPC145899
0.6887	Remote Similarity	NPC475486
0.6759	Remote Similarity	NPC475119
0.6731	Remote Similarity	NPC73829
0.6697	Remote Similarity	NPC473824
0.65	Remote Similarity	NPC136877
0.6489	Remote Similarity	NPC606107
0.6471	Remote Similarity	NPC488561
0.6373	Remote Similarity	NPC127056
0.6355	Remote Similarity	NPC484832
0.6316	Remote Similarity	NPC28198
0.6316	Remote Similarity	NPC476123
0.6275	Remote Similarity	NPC56713
0.6264	Remote Similarity	NPC601365
0.625	Remote Similarity	NPC200788
0.6228	Remote Similarity	NPC166422
0.6204	Remote Similarity	NPC79718
0.619	Remote Similarity	NPC469945
0.6154	Remote Similarity	NPC6377
0.6154	Remote Similarity	NPC208381
0.614	Remote Similarity	NPC243680
0.6139	Remote Similarity	NPC76999
0.6122	Remote Similarity	NPC100383
0.6111	Remote Similarity	NPC257468
0.6087	Remote Similarity	NPC219180
0.6071	Remote Similarity	NPC280941
0.6071	Remote Similarity	NPC235772
0.6055	Remote Similarity	NPC119794
0.598	Remote Similarity	NPC164194
0.5963	Remote Similarity	NPC481082
0.5963	Remote Similarity	NPC164419
0.5926	Remote Similarity	NPC488526
0.5905	Remote Similarity	NPC480420
0.5893	Remote Similarity	NPC488564
0.5876	Remote Similarity	NPC204407
0.581	Remote Similarity	NPC25605
0.581	Remote Similarity	NPC59804
0.5804	Remote Similarity	NPC324875
0.5804	Remote Similarity	NPC292677
0.578	Remote Similarity	NPC180550
0.578	Remote Similarity	NPC35405
0.5778	Remote Similarity	NPC228784
0.5778	Remote Similarity	NPC324341
0.5778	Remote Similarity	NPC601810
0.5763	Remote Similarity	NPC475140
0.5738	Remote Similarity	NPC161717
0.5726	Remote Similarity	NPC323341
0.5701	Remote Similarity	NPC472949
0.57	Remote Similarity	NPC286347
0.5686	Remote Similarity	NPC284807
0.5673	Remote Similarity	NPC1046
0.566	Remote Similarity	NPC174679
0.566	Remote Similarity	NPC279554
0.5648	Remote Similarity	NPC22956
0.5636	Remote Similarity	NPC232237
0.5619	Remote Similarity	NPC48499
0.5614	Remote Similarity	NPC488209
0.5607	Remote Similarity	NPC114441
0.5607	Remote Similarity	NPC109079
0.5586	Remote Similarity	NPC105800
0.5586	Remote Similarity	NPC139044
0.5545	Remote Similarity	NPC114304
0.5524	Remote Similarity	NPC270667
0.5517	Remote Similarity	NPC62725
0.5478	Remote Similarity	NPC295823
0.5478	Remote Similarity	NPC174720
0.5478	Remote Similarity	NPC475467
0.5462	Remote Similarity	NPC471384
0.5455	Remote Similarity	NPC54636
0.5446	Remote Similarity	NPC471383
0.5429	Remote Similarity	NPC480938
0.5426	Remote Similarity	NPC222047
0.5417	Remote Similarity	NPC251263
0.5413	Remote Similarity	NPC295371
0.5391	Remote Similarity	NPC323359
0.5391	Remote Similarity	NPC481079
0.5385	Remote Similarity	NPC120667
0.5385	Remote Similarity	NPC278272
0.536	Remote Similarity	NPC471385
0.5357	Remote Similarity	NPC473383
0.5323	Remote Similarity	NPC13998
0.5321	Remote Similarity	NPC173583
0.531	Remote Similarity	NPC63159
0.5304	Remote Similarity	NPC276093
0.5294	Remote Similarity	NPC177246
0.5278	Remote Similarity	NPC12288
0.5254	Remote Similarity	NPC480939
0.5254	Remote Similarity	NPC11242
0.5234	Remote Similarity	NPC127853
0.5213	Remote Similarity	NPC201657
0.5161	Remote Similarity	NPC481080
0.5156	Remote Similarity	NPC309223
0.5143	Remote Similarity	NPC128925
0.514	Remote Similarity	NPC475472
0.5135	Remote Similarity	NPC470512
0.5133	Remote Similarity	NPC117714
0.5133	Remote Similarity	NPC30289
0.5128	Remote Similarity	NPC301449
0.5128	Remote Similarity	NPC601290
0.5122	Remote Similarity	NPC283417
0.5122	Remote Similarity	NPC200049
0.5094	Remote Similarity	NPC475633
0.5088	Remote Similarity	NPC164389
0.5083	Remote Similarity	NPC185466
0.5081	Remote Similarity	NPC488560
0.5047	Remote Similarity	NPC191410
0.5042	Remote Similarity	NPC104137
0.5042	Remote Similarity	NPC207738
0.5042	Remote Similarity	NPC26626
0.5042	Remote Similarity	NPC187290
0.5041	Remote Similarity	NPC123199
0.504	Remote Similarity	NPC4749

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488516 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6526
0.1-0.2	2567
0.2-0.3	48
0.3-0.4	8
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data