NPASS Compound

Natural Product: NPC473824

Natural Product ID	NPC473824
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Beta-D-Xylopyranosyl(1->2)-Alpha-L-Fucopyranosyl(1->6)-[Beta-D-Glucopyranosyl(1->2)-Beta-D-Glucopyranoside
IUPAC Name	(3S,4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxymethyl]-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL452874
PubChem CID	21638101
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 162170 0 0 0 0 0 0 0 0999 V2000 10.8981 -0.6449 -1.1091 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5501 0.0434 -1.1018 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1377 0.3202 0.3065 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4815 -0.8390 1.0009 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9179 -1.7695 -0.0129 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4685 -0.9780 -1.2245 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6147 -0.5768 -1.8868 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6324 0.0412 -0.8368 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3305 -0.1356 -1.3166 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4402 1.0321 -0.9353 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6553 1.4704 0.4690 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6355 2.4192 0.9891 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8136 2.8986 -0.2257 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1906 1.6573 -0.7731 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1586 0.8893 -1.3592 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3988 0.9953 0.1586 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0485 0.9141 -0.2142 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7070 1.6384 0.8605 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1655 1.4217 0.9404 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7057 0.3125 0.0393 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7362 -0.8095 0.1354 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3290 -0.5189 -0.3445 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0132 -1.0687 -1.7119 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6677 -1.3074 0.5464 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2643 -2.0660 -0.4399 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7342 -2.3132 -0.3325 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2790 -1.5340 0.8922 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0520 -0.1339 0.4910 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8025 0.7799 1.4055 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2407 0.5968 1.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6692 -0.6448 0.8636 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7569 -1.7716 1.0827 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1588 -3.0202 0.3131 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6286 -3.2294 0.2911 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2358 -2.0046 -0.4172 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0892 -0.8833 0.5244 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8116 0.3218 -0.0091 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2971 -0.0467 0.0294 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6359 -1.2374 -0.7824 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6419 -2.3089 -0.8503 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8838 -1.7639 -0.3658 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6381 -0.3266 1.4786 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1384 1.1671 -0.3779 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4058 -1.7639 -1.6206 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8327 -0.6873 -1.8932 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2430 -2.8176 -2.5311 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2106 -3.4806 1.5071 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0613 -2.1744 2.5500 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5071 -2.1042 2.0402 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7753 0.9597 -1.3536 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9628 3.9125 0.1314 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2630 5.1342 -0.4943 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1687 5.5858 -1.3813 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2078 6.5785 -0.8193 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6065 7.0761 0.5229 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0691 7.1075 0.7669 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7969 6.0441 0.3712 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7291 8.3597 0.1673 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7724 8.3267 -1.2040 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0578 6.4104 1.5650 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0864 7.6101 -1.7177 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4852 4.4496 -1.8749 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2296 3.4907 1.6225 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9159 2.0489 0.6640 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9546 -2.6437 0.4278 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3189 -3.9770 0.2861 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3116 -4.7688 1.5496 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5997 -6.2064 1.2051 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1649 -6.3303 -0.2074 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1558 -5.7677 -1.1580 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5356 -4.6162 -0.6867 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3600 -7.6718 -0.5407 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4344 -6.9792 1.2274 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2492 -4.3100 2.4540 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4733 -0.3358 1.8445 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3272 0.6157 1.0144 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1817 -1.0249 -2.1137 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9605 -1.4259 -0.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7053 0.0996 -0.8387 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7326 1.0516 -1.5780 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5295 1.2659 0.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2020 -1.3359 1.6934 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7795 -2.4103 -0.3745 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9444 -1.7287 -1.8734 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9161 -1.1080 -1.0241 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4257 -0.1587 -2.4414 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8670 1.8844 -1.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6380 0.5496 1.1148 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9761 1.9227 1.7428 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5687 3.2639 -0.9559 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4996 1.9636 -1.6105 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0056 1.4027 -1.1927 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4140 2.7196 0.7961 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2639 1.2961 1.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6667 2.3579 0.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5310 1.2645 1.9834 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5583 -0.8623 1.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4785 -0.5778 -2.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0980 -0.8598 -1.8419 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0457 -2.1818 -1.7143 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6530 -1.1157 0.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5267 -1.0714 1.5986 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4316 -2.4002 0.4008 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6631 -2.9742 -0.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0462 -2.0158 -1.5526 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8774 -3.3915 -0.1885 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2421 -1.8612 -1.1871 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6541 -0.0754 -0.4899 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7308 0.5428 2.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5078 1.8447 1.3031 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8253 1.4951 0.8728 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8012 -3.0566 -0.7128 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6959 -3.8743 0.8625 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8148 -4.1422 -0.3364 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6772 -1.1690 1.4563 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7490 1.2190 0.6473 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5741 0.5972 -1.0370 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8444 -0.8789 -1.8358 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5824 -2.7456 -1.8911 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9900 -3.1712 -0.2199 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4633 -0.9594 -0.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6718 0.0714 1.7077 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7112 -1.4107 1.7010 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9759 0.2327 2.1718 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1326 1.1316 0.1115 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6414 2.1050 -0.1409 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3517 1.0683 -1.4769 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5987 -2.7723 -3.2988 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9802 -4.0619 1.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1316 -1.8574 2.7547 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1096 -3.2528 2.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4945 -1.5839 3.2688 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1712 -2.8836 2.5340 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6786 -2.8143 1.7314 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2425 -1.4253 2.8430 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8759 1.2572 -1.4395 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6414 0.2571 -2.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2695 1.9227 -1.4164 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1393 4.8600 -1.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6300 6.0880 -2.2884 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7818 6.0465 -0.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2375 8.1426 0.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1948 7.2712 1.8831 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2525 9.2834 0.5099 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7982 8.3598 0.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6078 9.1877 -1.6496 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5887 5.7075 1.8853 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1390 8.4828 -1.2123 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2701 4.3013 -1.2442 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0639 3.1940 2.0965 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1026 2.7640 -0.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3522 -3.9979 -0.1385 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3287 -4.7642 2.0664 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3011 -6.6620 1.9434 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1699 -5.8556 -0.2917 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6947 -5.4431 -2.0942 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4628 -6.5510 -1.4639 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8459 -8.1652 0.1601 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4735 -7.6850 0.5102 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1288 -4.8156 3.3080 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7902 0.4851 2.3236 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4236 1.5557 1.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 21 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 38 42 1 0 38 43 1 0 35 44 1 0 44 45 2 0 44 46 1 0 34 47 1 0 32 48 1 0 27 49 1 0 20 50 1 0 13 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 55 60 1 0 54 61 1 0 53 62 1 0 12 63 1 0 11 64 1 0 5 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 67 74 1 0 4 75 1 0 3 76 1 0 7 2 1 0 15 10 1 0 22 17 1 0 28 20 1 0 32 27 1 0 36 31 1 0 40 35 1 0 57 52 1 0 71 66 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 0 3 81 1 0 4 82 1 0 5 83 1 0 6 84 1 0 9 85 1 0 9 86 1 0 10 87 1 0 11 88 1 0 12 89 1 0 13 90 1 0 14 91 1 0 17 92 1 0 18 93 1 0 18 94 1 0 19 95 1 0 19 96 1 0 21 97 1 0 23 98 1 0 23 99 1 0 23100 1 0 24101 1 0 24102 1 0 24103 1 0 25104 1 0 25105 1 0 26106 1 0 26107 1 0 28108 1 0 29109 1 0 29110 1 0 30111 1 0 33112 1 0 33113 1 0 34114 1 0 36115 1 0 37116 1 0 37117 1 0 39118 1 0 40119 1 0 40120 1 0 41121 1 0 42122 1 0 42123 1 0 42124 1 0 43125 1 0 43126 1 0 43127 1 0 46128 1 0 47129 1 0 48130 1 0 48131 1 0 48132 1 0 49133 1 0 49134 1 0 49135 1 0 50136 1 0 50137 1 0 50138 1 0 52139 1 0 53140 1 0 54141 1 0 55142 1 0 56143 1 0 58144 1 0 58145 1 0 59146 1 0 60147 1 0 61148 1 0 62149 1 0 63150 1 0 64151 1 0 66152 1 0 67153 1 0 68154 1 0 69155 1 0 70156 1 0 70157 1 0 72158 1 0 73159 1 0 74160 1 0 75161 1 0 76162 1 0 M END

Standard InCHIKey	ZPWLXSJQNCLIRK-ILXUNCSSSA-N
Standard InCHI	InChI=1S/C53H86O23/c1-21-32(58)37(63)41(75-43-39(65)33(59)24(55)19-69-43)45(71-21)70-20-26-35(61)38(64)42(76-44-40(66)36(62)34(60)25(18-54)72-44)46(73-26)74-31-12-13-50(6)27(49(31,4)5)11-14-51(7)28(50)10-9-22-23-15-48(2,3)29(56)17-53(23,47(67)68)30(57)16-52(22,51)8/h9,21,23-46,54-66H,10-20H2,1-8H3,(H,67,68)/t21-,23+,24-,25-,26-,27+,28-,29+,30-,31+,32+,33+,34-,35-,36+,37+,38+,39-,40-,41-,42-,43+,44+,45-,46+,50+,51-,52-,53-/m1/s1
SMILES	CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3CCC4(C(C3(C)C)CCC5(C4CC=C6C5(CC(C7(C6CC(C(C7)O)(C)C)C(=O)O)O)C)C)C)OC8C(C(C(C(O8)CO)O)O)O)O)O)OC9C(C(C(CO9)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1090.56	Volume:	1045.138 ? Van der Waals volume.
Dense:	1.043	LogP:	-0.209 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.903 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.23 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	51.0
TPSA:	374.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.08	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.906	Fsp³:	0.943
MCE-18:	199.922 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.003	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.397 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.428	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.665	MDCK Permeability:	-4.866
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.471	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	29.512%	Volume Distribution (VD):	-0.424
Fu:	34.057% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.084	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.007	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.596	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.016	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.353

Half-life (T1/2):

4.396

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.091
Human Hepatotoxicity (H-HT):	0.175	Drug-induced Liver Injury (DILI):	0.146
AMES Toxicity:	0.198	Rat Oral Acute Toxicity:	0.108
Maximum Recommended Daily Dose:	0.274	Skin Sensitization:	0.001
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.151	Ototoxicity:	1.0
Hematotoxicity:	0.002	Drug-induced Nephrotoxicity:	0.009
Genotoxicity:	0.005	RPMI-8226 Immunitoxicity:	0.044
A549 Cytotoxicity:	0.006	Hek293 Cytotoxicity:	0.648
BCF:	0.118 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.917 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.127 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.987 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	fruits	myanmar	n.a.	PMID[11141109]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3615	Acacia concinna	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell line	HT-1080	Homo sapiens	ED50	>	100.0	ug ml-1	PMID[18590312]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473824 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24120
0.1-0.2	21321
0.2-0.3	2983
0.3-0.4	802
0.4-0.5	429
0.5-0.6	158
0.6-0.7	19
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9118	High Similarity	NPC475119
0.91	High Similarity	NPC291903
0.8812	High Similarity	NPC37134
0.8333	Intermediate Similarity	NPC243680
0.8056	Intermediate Similarity	NPC288205
0.8056	Intermediate Similarity	NPC51465
0.75	Intermediate Similarity	NPC200788
0.75	Intermediate Similarity	NPC484832
0.7273	Intermediate Similarity	NPC145899
0.7103	Intermediate Similarity	NPC80843
0.708	Intermediate Similarity	NPC207738
0.7027	Intermediate Similarity	NPC488515
0.6949	Remote Similarity	NPC475140
0.6697	Remote Similarity	NPC488516
0.6638	Remote Similarity	NPC475486
0.6525	Remote Similarity	NPC185466
0.6466	Remote Similarity	NPC75318
0.6396	Remote Similarity	NPC488561
0.6381	Remote Similarity	NPC242611
0.6311	Remote Similarity	NPC166422
0.6286	Remote Similarity	NPC31839
0.6281	Remote Similarity	NPC151543
0.623	Remote Similarity	NPC471384
0.6207	Remote Similarity	NPC257468
0.6161	Remote Similarity	NPC480424
0.6161	Remote Similarity	NPC127056
0.6121	Remote Similarity	NPC105800
0.605	Remote Similarity	NPC481079
0.605	Remote Similarity	NPC606145
0.6034	Remote Similarity	NPC104400
0.6034	Remote Similarity	NPC10320
0.5984	Remote Similarity	NPC172365
0.5946	Remote Similarity	NPC164194
0.5935	Remote Similarity	NPC610204
0.5932	Remote Similarity	NPC123796
0.5929	Remote Similarity	NPC25605
0.592	Remote Similarity	NPC219180
0.592	Remote Similarity	NPC603137
0.584	Remote Similarity	NPC323341
0.5806	Remote Similarity	NPC607904
0.5806	Remote Similarity	NPC610461
0.5789	Remote Similarity	NPC56713
0.5785	Remote Similarity	NPC324875
0.5785	Remote Similarity	NPC292677
0.5772	Remote Similarity	NPC280941
0.5772	Remote Similarity	NPC470915
0.5772	Remote Similarity	NPC235772
0.5763	Remote Similarity	NPC173859
0.575	Remote Similarity	NPC79718
0.575	Remote Similarity	NPC119794
0.5748	Remote Similarity	NPC283417
0.5748	Remote Similarity	NPC200049
0.5738	Remote Similarity	NPC488564
0.5735	Remote Similarity	NPC120667
0.5735	Remote Similarity	NPC278272
0.5726	Remote Similarity	NPC469945
0.5714	Remote Similarity	NPC139044
0.5691	Remote Similarity	NPC609281
0.569	Remote Similarity	NPC470512
0.5678	Remote Similarity	NPC114304
0.5652	Remote Similarity	NPC59804
0.5645	Remote Similarity	NPC606553
0.5641	Remote Similarity	NPC469946
0.5573	Remote Similarity	NPC488308
0.5556	Remote Similarity	NPC472949
0.5547	Remote Similarity	NPC609305
0.5538	Remote Similarity	NPC4749
0.5537	Remote Similarity	NPC470514
0.5537	Remote Similarity	NPC481082
0.5537	Remote Similarity	NPC73829
0.5537	Remote Similarity	NPC164419
0.553	Remote Similarity	NPC312650
0.5528	Remote Similarity	NPC301449
0.5528	Remote Similarity	NPC323359
0.5528	Remote Similarity	NPC601290
0.55	Remote Similarity	NPC164389
0.55	Remote Similarity	NPC488526
0.55	Remote Similarity	NPC232237
0.55	Remote Similarity	NPC148603
0.5492	Remote Similarity	NPC64715
0.5489	Remote Similarity	NPC471385
0.5462	Remote Similarity	NPC54636
0.5455	Remote Similarity	NPC265841
0.5455	Remote Similarity	NPC63159
0.5442	Remote Similarity	NPC300655
0.5442	Remote Similarity	NPC13989
0.5442	Remote Similarity	NPC196874
0.5441	Remote Similarity	NPC488309
0.5431	Remote Similarity	NPC12288
0.5426	Remote Similarity	NPC251263
0.5414	Remote Similarity	NPC271610
0.5414	Remote Similarity	NPC470876
0.541	Remote Similarity	NPC470513
0.541	Remote Similarity	NPC297263
0.5397	Remote Similarity	NPC210729
0.5397	Remote Similarity	NPC82931
0.5391	Remote Similarity	NPC123522
0.5391	Remote Similarity	NPC1046
0.5385	Remote Similarity	NPC174679
0.5385	Remote Similarity	NPC279554
0.5379	Remote Similarity	NPC21691
0.5373	Remote Similarity	NPC161717
0.5366	Remote Similarity	NPC471435
0.5366	Remote Similarity	NPC471434
0.5366	Remote Similarity	NPC302887
0.5364	Remote Similarity	NPC283849
0.5364	Remote Similarity	NPC606107
0.536	Remote Similarity	NPC488209
0.536	Remote Similarity	NPC160452
0.5349	Remote Similarity	NPC284449
0.5333	Remote Similarity	NPC136768
0.5333	Remote Similarity	NPC478559
0.5333	Remote Similarity	NPC478560
0.5333	Remote Similarity	NPC112352
0.5323	Remote Similarity	NPC78034
0.5323	Remote Similarity	NPC276093
0.5317	Remote Similarity	NPC104137
0.5317	Remote Similarity	NPC31838
0.5317	Remote Similarity	NPC26626
0.531	Remote Similarity	NPC128925
0.5308	Remote Similarity	NPC123199
0.5299	Remote Similarity	NPC136877
0.5298	Remote Similarity	NPC222951
0.5294	Remote Similarity	NPC302543
0.5289	Remote Similarity	NPC117714
0.5289	Remote Similarity	NPC30289
0.528	Remote Similarity	NPC23275
0.5276	Remote Similarity	NPC480939
0.5274	Remote Similarity	NPC329893
0.5267	Remote Similarity	NPC191827
0.5263	Remote Similarity	NPC488619
0.5259	Remote Similarity	NPC484059
0.5259	Remote Similarity	NPC484060
0.5259	Remote Similarity	NPC76999
0.5246	Remote Similarity	NPC480475
0.5231	Remote Similarity	NPC470911
0.5217	Remote Similarity	NPC484063
0.5217	Remote Similarity	NPC220160
0.5217	Remote Similarity	NPC484064
0.5205	Remote Similarity	NPC484831
0.5205	Remote Similarity	NPC484830
0.5203	Remote Similarity	NPC471383
0.52	Remote Similarity	NPC470914
0.5197	Remote Similarity	NPC481078
0.5197	Remote Similarity	NPC187290
0.5195	Remote Similarity	NPC113620
0.5191	Remote Similarity	NPC135904
0.518	Remote Similarity	NPC250247
0.5168	Remote Similarity	NPC220838
0.5164	Remote Similarity	NPC160415
0.5156	Remote Similarity	NPC473688
0.5156	Remote Similarity	NPC11242
0.5154	Remote Similarity	NPC79643
0.5152	Remote Similarity	NPC602995
0.5141	Remote Similarity	NPC33012
0.5128	Remote Similarity	NPC100612
0.5127	Remote Similarity	NPC319719
0.5124	Remote Similarity	NPC22956
0.5122	Remote Similarity	NPC251768
0.5122	Remote Similarity	NPC473383
0.5113	Remote Similarity	NPC25663
0.5111	Remote Similarity	NPC110633
0.5111	Remote Similarity	NPC286457
0.5103	Remote Similarity	NPC475177
0.5102	Remote Similarity	NPC40085
0.5098	Remote Similarity	NPC488618
0.5096	Remote Similarity	NPC488620
0.5083	Remote Similarity	NPC109079
0.5079	Remote Similarity	NPC77717
0.5075	Remote Similarity	NPC71391
0.5075	Remote Similarity	NPC192765
0.5074	Remote Similarity	NPC258617
0.5072	Remote Similarity	NPC309223
0.507	Remote Similarity	NPC8524
0.5067	Remote Similarity	NPC233223
0.5067	Remote Similarity	NPC183816
0.5067	Remote Similarity	NPC43589
0.5043	Remote Similarity	NPC90856
0.5041	Remote Similarity	NPC605226
0.5039	Remote Similarity	NPC610948
0.5038	Remote Similarity	NPC126753
0.5038	Remote Similarity	NPC470218
0.5037	Remote Similarity	NPC178264
0.5037	Remote Similarity	NPC484061
0.5037	Remote Similarity	NPC484062
0.5037	Remote Similarity	NPC57484
0.5035	Remote Similarity	NPC102505
0.5035	Remote Similarity	NPC488514
0.5034	Remote Similarity	NPC264270

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473824 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7052
0.1-0.2	2044
0.2-0.3	50
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data