NPASS Compound

Natural Product: NPC605226

Natural Product ID	NPC605226
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	VVNYXPFMBPFXCW-ZTGUKYBKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1095024
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 7.5623 2.8062 -2.4825 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0493 1.9050 -1.3109 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9789 2.8330 -0.5376 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8326 1.5464 -0.5524 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8990 0.3795 0.3364 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6361 -0.3443 0.6099 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0798 -0.2289 1.7913 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8198 -0.9057 2.1911 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9744 -0.9672 0.9730 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5282 -1.3073 1.2751 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2718 -2.6257 1.8637 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1440 -0.3011 2.3849 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3206 -0.1344 2.5487 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1207 0.0579 1.2952 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4539 -0.1917 1.6577 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1539 0.9811 1.5457 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4541 1.5058 2.8375 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6476 2.8650 2.6974 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5584 3.2927 3.7889 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0054 2.4881 4.6263 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9150 4.6236 3.8717 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2122 3.3257 1.4070 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2008 3.9007 0.6387 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9376 2.2880 0.5842 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2900 2.4207 0.9200 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0619 2.8539 -0.1570 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5108 4.1620 0.1047 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7669 4.2998 -0.4175 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7918 4.6890 -1.8838 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1101 4.7995 -2.3201 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4552 2.9603 -0.2120 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9221 2.9537 1.0953 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2712 2.0207 -0.3832 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3128 1.5346 -1.6874 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4933 0.8774 0.8808 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5291 0.0709 -0.2344 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3901 -1.0117 -0.0292 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6695 -2.2153 0.0058 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5390 -3.2577 0.2532 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7679 -4.5407 0.5556 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6858 -5.5535 0.7969 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3944 -3.5581 -0.9775 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0983 -4.7862 -1.5337 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1251 -2.4227 -1.9585 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8556 -2.4716 -2.4797 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3805 -1.1409 -1.1549 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6820 -1.3058 -0.6359 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7269 -0.8163 0.1690 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4240 -2.1267 0.0777 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1194 -0.0200 -1.1001 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7606 -0.8848 0.0863 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2748 -1.5040 -1.1981 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7331 -1.1515 -1.3842 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6057 -1.6160 -0.1942 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5139 -3.1160 -0.2552 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0255 -1.2286 -0.3926 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1430 -0.7740 -1.8352 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0346 -2.4084 -0.3729 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3739 -2.0779 0.1141 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2941 -2.9487 -0.5377 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9321 -0.6722 0.0316 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9063 -0.7525 1.2692 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5257 0.4460 1.4950 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8616 -0.4111 -1.0870 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8936 -1.5192 -2.0010 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7215 0.7682 -1.9443 C 0 0 2 0 0 0 0 0 0 0 0 0 10.0034 1.1147 -2.4399 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3934 3.0788 -3.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8234 2.1895 -3.0299 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0164 3.6718 -2.0493 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9485 3.8746 -0.8965 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0100 2.4614 -0.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6153 2.8443 0.5287 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6046 2.5196 0.0229 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9567 1.5418 -1.2367 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2414 0.8452 1.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5526 0.4095 2.5822 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0041 -1.8927 2.6638 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3564 -0.2861 2.9836 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8850 0.1301 0.6548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2165 -3.5027 1.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9831 -2.7370 2.7355 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2666 -2.5766 2.3869 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6881 0.6324 2.2695 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4718 -0.7906 3.3498 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7831 -0.9819 3.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4784 0.7658 3.1794 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0078 1.1339 1.0140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5612 1.7928 1.0872 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6646 3.3931 2.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2515 5.0609 4.7364 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9437 4.1626 1.5953 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1238 4.8688 0.8438 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7380 2.5125 -0.4658 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3968 2.9313 -1.0347 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3383 5.0815 0.1151 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2613 3.9681 -2.5309 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3221 5.6711 -2.0478 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1603 5.4587 -3.0329 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2189 2.7898 -0.9713 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2552 3.3741 1.6839 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3491 1.1508 0.2987 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1900 1.2220 -1.9651 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1871 0.4182 1.6612 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8739 -0.9489 0.9721 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2212 -3.0747 1.1123 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0587 -4.4199 1.3879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2022 -4.7818 -0.3913 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4337 -6.3958 0.3369 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4767 -3.4968 -0.7199 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8925 -5.3928 -1.4534 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8734 -2.4957 -2.7626 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9061 -2.9158 -3.3761 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3127 -0.3180 -1.8867 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6619 -1.3030 0.3602 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0738 -2.1994 -0.8207 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1091 -2.2529 0.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7354 -2.9939 -0.0189 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2728 -0.7245 -1.9279 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9904 0.6161 -0.9258 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2808 0.6858 -1.3785 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0596 0.2114 -0.0488 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9908 -2.5259 -1.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7551 -0.9192 -2.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7113 -0.0193 -1.3975 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0078 -1.6134 -2.3305 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5417 -3.4909 -0.6847 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7176 -3.6530 0.6601 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2258 -3.4974 -1.0441 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4717 -0.0324 -2.1898 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9291 -1.7334 -2.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2132 -0.6125 -2.1189 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6449 -3.2287 0.2957 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1120 -2.8900 -1.3680 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4573 -2.4880 1.1865 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8531 -3.4635 -1.2505 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2983 -0.9973 2.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5893 -1.5865 1.0810 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4861 0.7548 2.4314 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9575 -0.4093 -0.7505 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7173 -1.4413 -2.5688 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1077 0.4893 -2.8584 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6997 0.8989 -1.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 19 21 1 0 18 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 24 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 14 48 1 0 48 49 1 0 48 50 1 0 48 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 1 54 56 1 0 56 57 1 6 56 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 61 62 1 1 62 63 1 0 61 64 1 0 64 65 1 0 64 66 1 0 66 67 1 0 66 2 1 0 61 5 1 0 56 6 1 0 54 9 1 0 51 10 1 0 35 16 1 0 46 37 1 0 33 26 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 4 75 1 0 5 76 1 1 7 77 1 0 8 78 1 0 8 79 1 0 9 80 1 6 11 81 1 0 11 82 1 0 11 83 1 0 12 84 1 0 12 85 1 0 13 86 1 0 13 87 1 0 14 88 1 6 16 89 1 6 18 90 1 1 21 91 1 0 22 92 1 1 23 93 1 0 24 94 1 6 26 95 1 6 28 96 1 1 29 97 1 0 29 98 1 0 30 99 1 0 31100 1 6 32101 1 0 33102 1 1 34103 1 0 35104 1 1 37105 1 1 39106 1 1 40107 1 0 40108 1 0 41109 1 0 42110 1 1 43111 1 0 44112 1 6 45113 1 0 46114 1 6 47115 1 0 49116 1 0 49117 1 0 49118 1 0 50119 1 0 50120 1 0 50121 1 0 51122 1 6 52123 1 0 52124 1 0 53125 1 0 53126 1 0 55127 1 0 55128 1 0 55129 1 0 57130 1 0 57131 1 0 57132 1 0 58133 1 0 58134 1 0 59135 1 1 60136 1 0 62137 1 0 62138 1 0 63139 1 0 64140 1 1 65141 1 0 66142 1 6 67143 1 0 M END

Standard InCHIKey	VVNYXPFMBPFXCW-ZTGUKYBKSA-N
Standard InCHI	InChI=1S/C47H76O20/c1-42(2)14-20-19-8-9-24-44(5)12-11-26(43(3,4)23(44)10-13-45(24,6)46(19,7)15-25(51)47(20,18-50)37(59)36(42)58)64-41-35(67-40-31(56)29(54)27(52)21(16-48)62-40)33(32(57)34(66-41)38(60)61)65-39-30(55)28(53)22(17-49)63-39/h8,20-37,39-41,48-59H,9-18H2,1-7H3,(H,60,61)/t20-,21+,22-,23-,24+,25+,26-,27-,28-,29-,30+,31+,32-,33-,34-,35+,36-,37-,39-,40-,41+,44-,45+,46+,47-/m0/s1
SMILES	CC1(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O[C@@H]7O[C@@H](CO)[C@H](O)[C@H]7O)[C@H]6O[C@@H]6O[C@H](CO)[C@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@@H](O)[C@@]2(CO)[C@@H](O)[C@@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	960.49	Volume:	923.548 ? Van der Waals volume.
Dense:	1.04	LogP:	0.746 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.867 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.445 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	44.0
TPSA:	335.44 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.085	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.49	Fsp³:	0.936
MCE-18:	178.571 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.672	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.276	Promiscuous compounds:	0.159

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.731	MDCK Permeability:	-4.967
Pgp-inhibitor:	0.0	Pgp-substrate:	0.995
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.405
Plasma Protein Binding (PPB):	63.895%	Volume Distribution (VD):	-0.474
Fu:	25.707% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.93
OATP1B3 inhibitor:	0.005	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.008

Half-life (T1/2):

2.657

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.481	Drug-induced Liver Injury (DILI):	0.833
AMES Toxicity:	0.928	Rat Oral Acute Toxicity:	0.011
Maximum Recommended Daily Dose:	0.007	Skin Sensitization:	1.0
Carcinogencity:	0.054	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.014
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.761	Drug-induced Nephrotoxicity:	0.992
Genotoxicity:	0.679	RPMI-8226 Immunitoxicity:	0.167
A549 Cytotoxicity:	0.37	Hek293 Cytotoxicity:	0.114
BCF:	0.542 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.258 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.739 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.69 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17914881]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
GI	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT306	Cell line	PC-3	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT171	Cell line	MRC5	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT461	Cell line	PANC-1	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT116	Cell line	HL-60	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT81	Cell line	A549	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC605226 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24036
0.1-0.2	21657
0.2-0.3	2936
0.3-0.4	709
0.4-0.5	353
0.5-0.6	113
0.6-0.7	31
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8387	Intermediate Similarity	NPC603026
0.7788	Intermediate Similarity	NPC609119
0.7677	Intermediate Similarity	NPC44716
0.7524	Intermediate Similarity	NPC25998
0.7477	Intermediate Similarity	NPC284449
0.7451	Intermediate Similarity	NPC302887
0.7075	Intermediate Similarity	NPC160452
0.7054	Intermediate Similarity	NPC329828
0.703	Intermediate Similarity	NPC22956
0.697	Remote Similarity	NPC603870
0.6923	Remote Similarity	NPC475591
0.6923	Remote Similarity	NPC236870
0.6875	Remote Similarity	NPC602995
0.6789	Remote Similarity	NPC605294
0.6579	Remote Similarity	NPC283417
0.6579	Remote Similarity	NPC200049
0.6545	Remote Similarity	NPC329976
0.6545	Remote Similarity	NPC187290
0.6514	Remote Similarity	NPC23275
0.6496	Remote Similarity	NPC265841
0.6496	Remote Similarity	NPC488308
0.6441	Remote Similarity	NPC271610
0.6441	Remote Similarity	NPC312650
0.6387	Remote Similarity	NPC484059
0.6387	Remote Similarity	NPC484060
0.6379	Remote Similarity	NPC47995
0.6281	Remote Similarity	NPC302543
0.6218	Remote Similarity	NPC476774
0.6179	Remote Similarity	NPC484063
0.6179	Remote Similarity	NPC484064
0.6179	Remote Similarity	NPC488309
0.6174	Remote Similarity	NPC478155
0.6174	Remote Similarity	NPC478154
0.6106	Remote Similarity	NPC469947
0.6106	Remote Similarity	NPC480948
0.6053	Remote Similarity	NPC480939
0.6036	Remote Similarity	NPC64715
0.6019	Remote Similarity	NPC478066
0.6	Remote Similarity	NPC484061
0.6	Remote Similarity	NPC484062
0.5966	Remote Similarity	NPC473918
0.5963	Remote Similarity	NPC117714
0.5963	Remote Similarity	NPC30289
0.595	Remote Similarity	NPC476780
0.5888	Remote Similarity	NPC109079
0.5854	Remote Similarity	NPC476779
0.584	Remote Similarity	NPC476775
0.5812	Remote Similarity	NPC252657
0.5812	Remote Similarity	NPC88311
0.5806	Remote Similarity	NPC110700
0.5806	Remote Similarity	NPC476777
0.5785	Remote Similarity	NPC181066
0.578	Remote Similarity	NPC263756
0.578	Remote Similarity	NPC213674
0.5766	Remote Similarity	NPC2370
0.5702	Remote Similarity	NPC277212
0.5702	Remote Similarity	NPC30279
0.5702	Remote Similarity	NPC46823
0.5688	Remote Similarity	NPC472949
0.5656	Remote Similarity	NPC71391
0.5656	Remote Similarity	NPC192765
0.5641	Remote Similarity	NPC11242
0.5625	Remote Similarity	NPC251768
0.5625	Remote Similarity	NPC279915
0.5625	Remote Similarity	NPC476778
0.5614	Remote Similarity	NPC79718
0.561	Remote Similarity	NPC470518
0.561	Remote Similarity	NPC178264
0.561	Remote Similarity	NPC21691
0.5586	Remote Similarity	NPC192791
0.5581	Remote Similarity	NPC476776
0.5565	Remote Similarity	NPC281148
0.5534	Remote Similarity	NPC31839
0.5528	Remote Similarity	NPC4749
0.552	Remote Similarity	NPC225791
0.5495	Remote Similarity	NPC76497
0.5495	Remote Similarity	NPC80843
0.549	Remote Similarity	NPC606107
0.5487	Remote Similarity	NPC40775
0.5487	Remote Similarity	NPC159309
0.5487	Remote Similarity	NPC86222
0.5462	Remote Similarity	NPC470475
0.5462	Remote Similarity	NPC472267
0.5462	Remote Similarity	NPC115656
0.5455	Remote Similarity	NPC127056
0.5439	Remote Similarity	NPC118440
0.5424	Remote Similarity	NPC104137
0.5424	Remote Similarity	NPC26626
0.5405	Remote Similarity	NPC157868
0.5391	Remote Similarity	NPC470478
0.5385	Remote Similarity	NPC301449
0.5385	Remote Similarity	NPC601290
0.5378	Remote Similarity	NPC62725
0.537	Remote Similarity	NPC164194
0.537	Remote Similarity	NPC1046
0.5351	Remote Similarity	NPC164389
0.5345	Remote Similarity	NPC603832
0.5333	Remote Similarity	NPC478152
0.5333	Remote Similarity	NPC478151
0.5328	Remote Similarity	NPC477465
0.5299	Remote Similarity	NPC114484
0.5285	Remote Similarity	NPC470476
0.5268	Remote Similarity	NPC470512
0.5254	Remote Similarity	NPC291903
0.5246	Remote Similarity	NPC151543
0.5242	Remote Similarity	NPC269484
0.5242	Remote Similarity	NPC264566
0.5242	Remote Similarity	NPC475140
0.5242	Remote Similarity	NPC97918
0.5225	Remote Similarity	NPC235405
0.5217	Remote Similarity	NPC10607
0.5217	Remote Similarity	NPC46665
0.521	Remote Similarity	NPC187618
0.5207	Remote Similarity	NPC107536
0.5207	Remote Similarity	NPC475119
0.5207	Remote Similarity	NPC280029
0.5207	Remote Similarity	NPC9470
0.5179	Remote Similarity	NPC249848
0.5179	Remote Similarity	NPC107966
0.5169	Remote Similarity	NPC236657
0.5161	Remote Similarity	NPC478150
0.5159	Remote Similarity	NPC82380
0.5159	Remote Similarity	NPC244296
0.5156	Remote Similarity	NPC258617
0.5128	Remote Similarity	NPC470514
0.5128	Remote Similarity	NPC123796
0.5126	Remote Similarity	NPC606145
0.512	Remote Similarity	NPC470218
0.5116	Remote Similarity	NPC484833
0.5093	Remote Similarity	NPC480937
0.5089	Remote Similarity	NPC25605
0.5088	Remote Similarity	NPC161674
0.5086	Remote Similarity	NPC173859
0.5086	Remote Similarity	NPC148603
0.5083	Remote Similarity	NPC488564
0.5083	Remote Similarity	NPC80986
0.5083	Remote Similarity	NPC480474
0.5083	Remote Similarity	NPC477193
0.5079	Remote Similarity	NPC252289
0.5079	Remote Similarity	NPC305793
0.5078	Remote Similarity	NPC286457
0.5075	Remote Similarity	NPC489209
0.5043	Remote Similarity	NPC75417
0.5043	Remote Similarity	NPC235438
0.5042	Remote Similarity	NPC114692
0.5041	Remote Similarity	NPC475486
0.5041	Remote Similarity	NPC473824
0.504	Remote Similarity	NPC251263
0.5039	Remote Similarity	NPC85154
0.5039	Remote Similarity	NPC262796
0.5039	Remote Similarity	NPC45346
0.5038	Remote Similarity	NPC11577
0.5038	Remote Similarity	NPC141600

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC605226 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7016
0.1-0.2	2065
0.2-0.3	64
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data