NPASS Compound

Natural Product: NPC603870

Natural Product ID	NPC603870
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GCGMNWIKLNHQRV-RJSCTWHOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1095022
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 123129 0 0 0 0 0 0 0 0999 V2000 -8.9043 -2.4037 -0.3403 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4094 -2.1718 -0.6007 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8976 -3.5724 -1.0028 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7015 -1.6636 0.5955 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3456 -0.2286 0.6646 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8706 -0.0050 0.7905 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2938 -0.5214 1.8691 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8357 -0.3961 2.1578 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1460 0.0501 0.9469 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6444 0.2363 1.0504 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2989 1.4140 1.8635 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0774 -0.9987 1.7090 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4191 -0.8638 1.8623 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1162 -0.4863 0.5933 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1656 0.3893 0.7552 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4282 -0.1154 0.7398 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9021 -0.0244 2.0296 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4798 1.1037 2.4646 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6915 2.3420 2.5003 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5030 2.4422 2.1799 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3144 3.5392 2.9330 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7800 1.3838 1.7014 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8247 0.9408 2.5068 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7750 0.4652 0.4810 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8318 0.6708 -0.3575 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7195 -0.4105 -0.4368 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9713 0.1135 -0.1933 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8628 -0.8366 -0.6214 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2114 -1.8892 0.4073 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1289 -2.6083 0.8249 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2864 -1.3849 -1.8862 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8898 -0.8715 -3.0290 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8535 -0.9063 -1.8579 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0175 -2.0152 -1.9995 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4117 0.5170 -0.1956 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5092 -0.3362 -1.3289 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2830 -0.1256 -0.5810 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3327 -1.3335 -1.5669 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0492 0.9117 -1.3811 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4451 1.3490 -2.5282 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1405 0.2441 -0.3592 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6541 1.4737 -1.0378 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0265 1.9173 -0.7108 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7986 1.2743 0.3707 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2553 2.2481 1.4560 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1223 0.7575 -0.2426 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7781 -0.0939 -1.4368 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8662 1.9552 -0.7183 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3179 2.0106 -0.4441 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9378 2.8003 -1.4233 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0290 0.6870 -0.2761 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3283 1.1096 0.4691 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9562 1.7510 1.6736 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5148 0.1169 -1.5630 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0863 0.8219 -2.6918 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1804 -1.3238 -1.8095 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0652 -1.7946 -2.8135 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2844 -3.3180 -0.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5085 -1.5637 -0.7132 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0005 -2.3906 0.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9363 -3.4991 -1.5302 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9101 -4.2314 -0.1319 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6291 -4.0017 -1.7401 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2757 -2.0484 1.4935 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7468 -2.2754 0.6698 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6991 0.0853 1.7138 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8376 -1.0755 2.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6273 0.1430 3.0985 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4916 -1.4556 2.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2627 -0.7814 0.1863 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5537 1.2049 2.9253 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8283 1.5260 1.8697 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6543 2.3902 1.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4912 -1.1726 2.7234 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2839 -1.8917 1.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6350 -0.1368 2.7028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7486 -1.8344 2.2956 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6837 -1.4458 0.3484 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4101 -1.2568 0.5739 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7636 0.9038 3.5585 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9906 4.4282 2.6099 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8573 2.4406 1.4383 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6189 1.5027 2.4512 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8653 -0.5628 0.9135 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4124 -1.2458 0.1907 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8406 -0.2997 -0.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9203 -2.5935 -0.1166 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7945 -1.4196 1.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2536 -2.8878 1.7527 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3306 -2.5015 -1.8768 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6136 -0.2484 -2.7140 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6538 -0.1302 -2.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4886 -1.8743 -2.8332 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1410 1.5132 -0.5370 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3656 -1.2709 -1.0065 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0707 -2.2504 -1.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6765 -1.1029 -2.4212 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3694 -1.4203 -1.9338 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9863 0.3825 -1.7342 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4370 1.7261 -0.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6772 2.2482 -2.8061 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7429 -0.5885 -0.8620 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0875 2.3154 -1.0165 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6847 1.2069 -2.1495 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6489 2.0399 -1.6570 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9289 3.0119 -0.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8283 2.0448 2.4437 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8790 3.2685 1.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3546 2.2535 1.6050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7827 0.0303 -1.8406 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4659 0.1406 -2.3064 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9482 -1.1755 -1.2474 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7455 2.0206 -1.8407 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3948 2.9224 -0.3932 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4395 2.6495 0.4856 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7161 3.2949 -1.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9211 1.7941 -0.1707 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9329 0.2584 0.7608 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7513 1.7316 2.2437 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6447 0.1692 -1.6809 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5001 0.3715 -3.4646 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1656 -1.5196 -2.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5728 -2.2032 -3.5631 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 19 21 1 0 18 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 24 35 1 0 35 36 1 0 14 37 1 0 37 38 1 6 37 39 1 0 39 40 1 0 37 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 1 44 46 1 0 46 47 1 6 46 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 1 52 53 1 0 51 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 56 2 1 0 51 5 1 0 46 6 1 0 44 9 1 0 41 10 1 0 35 16 1 0 33 26 1 0 1 58 1 0 1 59 1 0 1 60 1 0 3 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 4 65 1 0 5 66 1 1 7 67 1 0 8 68 1 0 8 69 1 0 9 70 1 6 11 71 1 0 11 72 1 0 11 73 1 0 12 74 1 0 12 75 1 0 13 76 1 0 13 77 1 0 14 78 1 6 16 79 1 6 18 80 1 1 21 81 1 0 22 82 1 6 23 83 1 0 24 84 1 1 26 85 1 1 28 86 1 6 29 87 1 0 29 88 1 0 30 89 1 0 31 90 1 1 32 91 1 0 33 92 1 6 34 93 1 0 35 94 1 6 36 95 1 0 38 96 1 0 38 97 1 0 38 98 1 0 39 99 1 0 39100 1 0 40101 1 0 41102 1 6 42103 1 0 42104 1 0 43105 1 0 43106 1 0 45107 1 0 45108 1 0 45109 1 0 47110 1 0 47111 1 0 47112 1 0 48113 1 0 48114 1 0 49115 1 1 50116 1 0 52117 1 0 52118 1 0 53119 1 0 54120 1 1 55121 1 0 56122 1 6 57123 1 0 M END

Standard InCHIKey	GCGMNWIKLNHQRV-RJSCTWHOSA-N
Standard InCHI	InChI=1S/C41H66O16/c1-36(2)13-19-18-7-8-22-37(3)11-10-24(55-35-28(49)29(27(48)30(57-35)33(52)53)56-34-26(47)25(46)20(15-42)54-34)38(4,16-43)21(37)9-12-39(22,5)40(18,6)14-23(45)41(19,17-44)32(51)31(36)50/h7,19-32,34-35,42-51H,8-17H2,1-6H3,(H,52,53)/t19-,20-,21+,22+,23+,24-,25-,26+,27-,28+,29-,30-,31-,32-,34-,35+,37-,38+,39+,40+,41-/m0/s1
SMILES	CC1(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O[C@@H]7O[C@@H](CO)[C@H](O)[C@H]7O)[C@H]6O)[C@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@@H](O)[C@@]2(CO)[C@@H](O)[C@@H]1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	814.44	Volume:	793.167 ? Van der Waals volume.
Dense:	1.027	LogP:	0.826 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.861 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.589 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	38.0
TPSA:	276.52 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	11.0	Rings:	7.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.108	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.12	Fsp³:	0.927
MCE-18:	155.848 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.677	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.227	Promiscuous compounds:	0.172

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.772	MDCK Permeability:	-5.01
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.466
20% Bioavailability (F20%):	0.997	30% Bioavailability (F30%):	0.993
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.664
Plasma Protein Binding (PPB):	66.774%	Volume Distribution (VD):	-0.466
Fu:	24.177% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.035
OATP1B3 inhibitor:	0.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.004

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.002	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.009 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.323

Half-life (T1/2):

2.606

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.011
Human Hepatotoxicity (H-HT):	0.332	Drug-induced Liver Injury (DILI):	0.539
AMES Toxicity:	0.647	Rat Oral Acute Toxicity:	0.043
Maximum Recommended Daily Dose:	0.044	Skin Sensitization:	0.995
Carcinogencity:	0.074	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.05
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.995
Hematotoxicity:	0.511	Drug-induced Nephrotoxicity:	0.973
Genotoxicity:	0.606	RPMI-8226 Immunitoxicity:	0.097
A549 Cytotoxicity:	0.045	Hek293 Cytotoxicity:	0.087
BCF:	0.566 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.228 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.635 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.701 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17914881]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
GI	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT306	Cell line	PC-3	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT171	Cell line	MRC5	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT116	Cell line	HL-60	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT461	Cell line	PANC-1	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]
NPT81	Cell line	A549	Homo sapiens	GI	n.a.	n.a.	n.a.	PMID[20371180]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC603870 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22146
0.1-0.2	23932
0.2-0.3	2797
0.3-0.4	751
0.4-0.5	184
0.5-0.6	41
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7551	Intermediate Similarity	NPC603832
0.697	Remote Similarity	NPC605226
0.6111	Remote Similarity	NPC477191
0.5877	Remote Similarity	NPC284449
0.5812	Remote Similarity	NPC478597
0.5804	Remote Similarity	NPC11242
0.5794	Remote Similarity	NPC159309
0.5794	Remote Similarity	NPC86222
0.5714	Remote Similarity	NPC478596
0.5714	Remote Similarity	NPC224121
0.5714	Remote Similarity	NPC603026
0.5625	Remote Similarity	NPC477193
0.5586	Remote Similarity	NPC114484
0.5565	Remote Similarity	NPC252657
0.5565	Remote Similarity	NPC88311
0.5526	Remote Similarity	NPC477195
0.5487	Remote Similarity	NPC477192
0.5478	Remote Similarity	NPC477196
0.5472	Remote Similarity	NPC114441
0.5431	Remote Similarity	NPC609119
0.5372	Remote Similarity	NPC21691
0.5349	Remote Similarity	NPC253402
0.5349	Remote Similarity	NPC159168
0.5315	Remote Similarity	NPC118440
0.5289	Remote Similarity	NPC4749
0.5278	Remote Similarity	NPC473884
0.5268	Remote Similarity	NPC611191
0.5254	Remote Similarity	NPC478600
0.5254	Remote Similarity	NPC478599
0.5238	Remote Similarity	NPC270667
0.5225	Remote Similarity	NPC44716
0.5221	Remote Similarity	NPC302887
0.5214	Remote Similarity	NPC472267
0.5214	Remote Similarity	NPC25998
0.5214	Remote Similarity	NPC115656
0.5203	Remote Similarity	NPC476774
0.5175	Remote Similarity	NPC236657
0.5138	Remote Similarity	NPC6377
0.5138	Remote Similarity	NPC208381
0.51	Remote Similarity	NPC204407
0.5091	Remote Similarity	NPC475171
0.5089	Remote Similarity	NPC11551
0.505	Remote Similarity	NPC57362
0.5043	Remote Similarity	NPC477194

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC603870 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6702
0.1-0.2	2397
0.2-0.3	48
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data