NPASS Compound

Natural Product: NPC11551

Natural Product ID	NPC11551
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	20(29)-Ene-30-Norhederagenin-3-O-Beta-D-Glucuronopyranosyl-28-O-Beta-D-Glucopyranoside
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4R,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4-(hydroxymethyl)-4,6a,6b,14b-tetramethyl-11-methylidene-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2043374
PubChem CID	10819104
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001755] Diterpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 118124 0 0 0 0 0 0 0 0999 V2000 -6.1714 2.9490 -3.6746 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7349 1.6261 -3.6321 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9422 0.7365 -3.4097 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6244 -0.5928 -3.3525 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9027 -1.2095 -2.1589 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1379 -0.6334 -1.1455 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1995 -1.3259 -0.3833 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0518 -2.5412 -0.6441 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4126 -0.6179 0.7003 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4911 -0.1154 1.6379 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9844 0.8111 2.6987 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3996 1.9566 1.9468 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6818 3.1617 2.3657 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5408 1.7629 0.7827 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5313 0.4212 0.1427 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0986 0.0205 -0.0397 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4164 0.6484 -0.9963 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0111 0.3889 -1.3272 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6220 -0.2164 -0.0838 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1289 -1.4496 0.2287 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4694 -1.0338 0.8201 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4593 -2.1925 0.7529 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7096 -1.7215 1.4562 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3229 -0.5954 2.2498 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5192 -2.2331 -1.0348 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5130 -2.3852 1.1885 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0118 -2.3011 1.2554 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5394 -0.9086 1.1654 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1165 -0.3122 -0.1439 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6120 -1.0255 -1.3483 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6391 1.1242 -0.2470 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6234 1.4613 0.8041 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6729 0.4114 1.0702 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9857 -0.8387 1.4990 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7478 -2.0713 1.0153 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0901 -0.8990 3.0343 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4230 -0.8365 3.4323 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5718 0.2710 0.0357 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8593 0.7135 0.3341 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1598 1.7069 -0.5606 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4182 2.2761 -0.4015 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7995 3.0837 -1.5757 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0134 3.1756 -2.5378 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0104 3.7338 -1.6178 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4675 1.2443 -0.0560 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0584 -0.1323 -0.5375 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7856 -0.4763 0.2287 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2041 -0.8567 1.5031 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8065 -0.0720 -1.9012 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6426 1.2132 1.3058 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3897 -1.1325 -1.8952 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8125 0.2987 -1.8274 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7186 1.2479 -2.2379 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3413 2.4377 -2.6390 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1995 0.6354 -0.5332 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0180 -1.7600 -2.9866 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1168 3.3839 -2.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9617 1.4933 -2.8738 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2854 1.3653 -4.6181 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5921 0.8857 -4.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6523 -2.2837 -2.2614 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9820 -1.0119 2.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2924 0.4079 1.0693 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8703 1.1324 3.2894 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2060 0.3936 3.3370 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2762 4.0194 1.8460 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3206 3.3650 3.2334 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5041 2.0894 1.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8131 2.5990 0.0634 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8936 0.5926 -0.9220 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9127 1.4071 -1.5915 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4886 1.3120 -1.6462 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0092 -0.2996 -2.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3982 0.5298 0.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7513 -2.3953 -0.2974 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0966 -3.0761 1.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5498 -1.4272 2.5113 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3872 -2.6161 1.5018 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2946 -0.2930 2.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9729 0.2359 2.5232 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5688 -1.4316 2.9696 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3233 -1.7463 -1.5921 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3285 -2.4848 -1.6603 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9216 -3.2151 -0.6469 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1385 -2.2679 2.2352 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2628 -3.4391 0.9091 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4479 -2.9976 0.4948 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3462 -2.7250 2.2262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0052 -0.3132 1.9608 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9934 -0.6736 -2.2272 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6630 -2.1090 -1.3083 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6498 -0.6932 -1.6559 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1031 1.3304 -1.2388 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8073 1.8730 -0.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1695 2.3795 0.4887 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1328 1.7031 1.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2823 0.8531 1.9178 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2252 -2.9490 1.4758 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -2.1183 -0.0678 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7294 -2.0312 1.5442 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6175 -1.7885 3.4575 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5833 -0.0067 3.4555 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5851 -0.1378 4.1187 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8832 1.0958 1.3736 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3516 2.9782 0.4547 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4327 3.9193 -2.5300 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4115 1.5567 -0.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8785 -0.8323 -0.2851 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3169 -1.3226 -0.2868 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4300 -1.8087 1.4743 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4241 -0.6595 -2.4272 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3445 0.5566 1.5263 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6342 -1.6860 -0.9777 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6611 0.4646 -2.5227 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0668 1.5302 -1.3674 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2465 2.2354 -2.9683 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6703 -0.1279 -0.1058 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4402 -1.7516 -3.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 9 7 1 6 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 1 20 25 1 6 20 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 6 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 6 34 36 1 0 36 37 1 0 33 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 2 0 42 44 1 0 41 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 5 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 53 3 1 0 23 9 1 0 34 28 1 0 47 39 1 0 15 9 1 0 21 16 1 0 29 19 1 0 1 57 1 0 2 58 1 0 2 59 1 0 3 60 1 6 5 61 1 6 10 62 1 0 10 63 1 0 11 64 1 0 11 65 1 0 13 66 1 0 13 67 1 0 14 68 1 0 14 69 1 0 15 70 1 6 17 71 1 0 18 72 1 0 18 73 1 0 19 74 1 1 22 75 1 0 22 76 1 0 23 77 1 0 23 78 1 0 24 79 1 0 24 80 1 0 24 81 1 0 25 82 1 0 25 83 1 0 25 84 1 0 26 85 1 0 26 86 1 0 27 87 1 0 27 88 1 0 28 89 1 1 30 90 1 0 30 91 1 0 30 92 1 0 31 93 1 0 31 94 1 0 32 95 1 0 32 96 1 0 33 97 1 1 35 98 1 0 35 99 1 0 35100 1 0 36101 1 0 36102 1 0 37103 1 0 39104 1 1 41105 1 1 44106 1 0 45107 1 6 46108 1 6 47109 1 6 48110 1 0 49111 1 0 50112 1 0 51113 1 1 52114 1 6 53115 1 1 54116 1 0 55117 1 0 56118 1 0 M END

Standard InCHIKey	XZLYKCFSWUWOSX-GUZNCPQZSA-N
Standard InCHI	InChI=1S/C41H62O15/c1-19-8-13-41(36(52)56-34-30(48)27(45)26(44)22(17-42)53-34)15-14-39(4)20(21(41)16-19)6-7-24-37(2)11-10-25(38(3,18-43)23(37)9-12-40(24,39)5)54-35-31(49)28(46)29(47)32(55-35)33(50)51/h6,21-32,34-35,42-49H,1,7-18H2,2-5H3,(H,50,51)/t21-,22+,23+,24+,25-,26+,27-,28-,29-,30+,31+,32-,34-,35+,37-,38-,39+,40+,41-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC(=O)[C@@]23CCC(=C)C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H]([C@@]2(C)CO)O[C@@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	794.41	Volume:	779.104 ? Van der Waals volume.
Dense:	1.02	LogP:	1.113 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.008 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.243 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	41.0
TPSA:	253.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	9.0	Rings:	7.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.099	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.974	Fsp³:	0.854
MCE-18:	149.211 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.821	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.164	Promiscuous compounds:	0.12

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.294	MDCK Permeability:	-5.106
Pgp-inhibitor:	0.0	Pgp-substrate:	0.212
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.005
20% Bioavailability (F20%):	0.116	30% Bioavailability (F30%):	0.758
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.081	MRP1:	0.926
Plasma Protein Binding (PPB):	68.442%	Volume Distribution (VD):	-0.487
Fu:	25.686% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.996
OATP1B3 inhibitor:	0.042	BCRP inhibitor:	0.009
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.051
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.328

Half-life (T1/2):

3.158

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.638	Drug-induced Liver Injury (DILI):	0.94
AMES Toxicity:	0.779	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.157	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.996
Hematotoxicity:	0.535	Drug-induced Nephrotoxicity:	0.988
Genotoxicity:	0.808	RPMI-8226 Immunitoxicity:	0.057
A549 Cytotoxicity:	0.18	Hek293 Cytotoxicity:	0.074
BCF:	0.634 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.458 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.997 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.171 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO25076	Salicornia herbacea	Species	Chenopodiaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[16276965]
NPO25076	Salicornia herbacea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22652051]
NPO25076	Salicornia herbacea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25076	Salicornia herbacea	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Others	1
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	<	1000.0	nM	PMID[22652051]
NPT1	Others	Radical scavenging activity	n.a.	IC50	=	390000.0	nM	PMID[18656987]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC11551 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17588
0.1-0.2	27091
0.2-0.3	3980
0.3-0.4	777
0.4-0.5	301
0.5-0.6	88
0.6-0.7	14
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8936	High Similarity	NPC31193
0.8495	Intermediate Similarity	NPC473884
0.7835	Intermediate Similarity	NPC475171
0.7732	Intermediate Similarity	NPC157868
0.7576	Intermediate Similarity	NPC242840
0.7059	Intermediate Similarity	NPC75417
0.6604	Remote Similarity	NPC251768
0.6604	Remote Similarity	NPC159309
0.6604	Remote Similarity	NPC86222
0.6449	Remote Similarity	NPC40775
0.6429	Remote Similarity	NPC224121
0.6364	Remote Similarity	NPC114484
0.6306	Remote Similarity	NPC301449
0.6306	Remote Similarity	NPC601290
0.6286	Remote Similarity	NPC473373
0.6262	Remote Similarity	NPC192791
0.6239	Remote Similarity	NPC475591
0.6239	Remote Similarity	NPC236870
0.6226	Remote Similarity	NPC295371
0.6071	Remote Similarity	NPC281148
0.598	Remote Similarity	NPC256798
0.5962	Remote Similarity	NPC90856
0.5922	Remote Similarity	NPC209894
0.5913	Remote Similarity	NPC187290
0.5849	Remote Similarity	NPC48499
0.5833	Remote Similarity	NPC482748
0.581	Remote Similarity	NPC189884
0.581	Remote Similarity	NPC214484
0.581	Remote Similarity	NPC138334
0.5804	Remote Similarity	NPC118440
0.58	Remote Similarity	NPC237503
0.5766	Remote Similarity	NPC309714
0.5758	Remote Similarity	NPC167383
0.5741	Remote Similarity	NPC235405
0.5726	Remote Similarity	NPC258617
0.569	Remote Similarity	NPC480473
0.569	Remote Similarity	NPC480474
0.5688	Remote Similarity	NPC249848
0.5688	Remote Similarity	NPC107966
0.5652	Remote Similarity	NPC114692
0.5636	Remote Similarity	NPC39211
0.5619	Remote Similarity	NPC480937
0.5596	Remote Similarity	NPC475516
0.5574	Remote Similarity	NPC470218
0.5565	Remote Similarity	NPC95437
0.5565	Remote Similarity	NPC64715
0.5556	Remote Similarity	NPC187618
0.5534	Remote Similarity	NPC68419
0.5526	Remote Similarity	NPC235438
0.5517	Remote Similarity	NPC236657
0.549	Remote Similarity	NPC204407
0.5487	Remote Similarity	NPC30735
0.5478	Remote Similarity	NPC131469
0.5478	Remote Similarity	NPC611191
0.5463	Remote Similarity	NPC78046
0.5463	Remote Similarity	NPC29069
0.5455	Remote Similarity	NPC139894
0.5446	Remote Similarity	NPC473343
0.5437	Remote Similarity	NPC57362
0.5424	Remote Similarity	NPC120116
0.5405	Remote Similarity	NPC150400
0.5398	Remote Similarity	NPC223301
0.5398	Remote Similarity	NPC171544
0.5385	Remote Similarity	NPC247315
0.5385	Remote Similarity	NPC482728
0.5385	Remote Similarity	NPC137917
0.5377	Remote Similarity	NPC128925
0.537	Remote Similarity	NPC473481
0.537	Remote Similarity	NPC269095
0.5333	Remote Similarity	NPC286347
0.5333	Remote Similarity	NPC11242
0.5327	Remote Similarity	NPC294112
0.531	Remote Similarity	NPC469946
0.5304	Remote Similarity	NPC480475
0.5294	Remote Similarity	NPC241909
0.5285	Remote Similarity	NPC165204
0.5263	Remote Similarity	NPC112352
0.5259	Remote Similarity	NPC63159
0.5254	Remote Similarity	NPC104372
0.5248	Remote Similarity	NPC191763
0.5246	Remote Similarity	NPC313110
0.5229	Remote Similarity	NPC204458
0.5225	Remote Similarity	NPC136877
0.5217	Remote Similarity	NPC109588
0.5214	Remote Similarity	NPC222580
0.521	Remote Similarity	NPC218954
0.52	Remote Similarity	NPC100639
0.52	Remote Similarity	NPC471550
0.5179	Remote Similarity	NPC309780
0.5179	Remote Similarity	NPC108748
0.5172	Remote Similarity	NPC10607
0.5172	Remote Similarity	NPC46665
0.5143	Remote Similarity	NPC37739
0.514	Remote Similarity	NPC220984
0.5138	Remote Similarity	NPC47063
0.5138	Remote Similarity	NPC195132
0.5096	Remote Similarity	NPC46388
0.5089	Remote Similarity	NPC603870
0.5088	Remote Similarity	NPC472949
0.5085	Remote Similarity	NPC475504
0.5085	Remote Similarity	NPC297263
0.5081	Remote Similarity	NPC192600
0.5048	Remote Similarity	NPC116794
0.5047	Remote Similarity	NPC102914
0.5047	Remote Similarity	NPC110139
0.5047	Remote Similarity	NPC108709
0.5045	Remote Similarity	NPC270667
0.5041	Remote Similarity	NPC80986

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC11551 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6040
0.1-0.2	3042
0.2-0.3	61
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data