NPASS Compound

Natural Product: NPC48499

Natural Product ID	NPC48499
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LVSPBVZWDHHCIY-KXESMRJQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 144151 0 0 0 0 0 0 0 0999 V2000 3.5570 -2.2316 -1.9260 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0987 -2.3257 -1.5488 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6026 -3.6440 -2.1670 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9294 -2.4896 -0.0581 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2510 -1.2473 0.6826 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8730 0.0320 0.0177 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2998 0.9809 1.0029 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0702 0.7108 1.4962 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0399 0.1021 0.5545 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3723 -1.2916 1.0721 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4980 -0.0013 -0.8048 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3495 -0.0302 -1.8277 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8086 0.0289 -1.7581 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3045 0.1412 -0.3640 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7450 0.5547 -0.2099 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0607 1.8974 -0.7590 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5978 -0.4559 -0.9445 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3523 -1.3810 -0.0135 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2886 -0.5344 0.8312 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4763 0.4147 1.6478 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5188 -0.1254 3.0918 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1680 1.7450 1.7110 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0438 0.4482 1.2665 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2574 1.4440 2.0344 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7770 1.2537 1.8425 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3341 0.9340 0.4673 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9799 2.2334 -0.2254 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2336 0.0706 0.0104 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5247 -0.4193 0.2009 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5195 0.6517 0.5362 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2347 1.1438 -0.7162 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.0245 -0.0061 -1.2978 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.3016 -1.2956 -0.9562 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.6930 -2.3724 -1.9567 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3750 -1.9719 -3.2545 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9536 -1.0324 -0.9895 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3275 -0.0159 -0.8138 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2487 1.5993 -1.6105 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4872 0.2166 1.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9703 -0.0874 -1.1439 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2409 -1.2379 -2.0664 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1660 0.6523 -0.4628 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3107 0.9832 -1.6674 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2413 0.8829 0.3818 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4359 1.4603 -0.0942 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8472 2.7184 0.5808 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0098 3.3188 -0.2051 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1110 2.2439 -0.3655 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4666 1.0651 -0.9664 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2576 -0.0416 -1.5173 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8816 -0.8473 -0.6555 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8891 -0.3498 0.0846 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7283 -0.7407 1.5549 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9726 -0.3199 2.2783 C 0 0 2 0 0 0 0 0 0 0 0 0 12.0567 0.2219 1.4067 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1430 -0.3803 0.0429 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4072 -1.1979 -0.1486 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5145 -1.5815 -1.4930 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0478 -1.1310 -0.3059 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0351 1.6264 1.3645 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4073 -1.4236 3.0218 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5623 -0.2277 2.0512 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4927 0.5475 -0.0802 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0171 2.8133 -1.2659 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5482 4.4065 0.4300 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7831 3.6276 0.5189 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7305 -1.5088 -2.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9753 -3.2122 -2.2984 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1997 -1.9930 -1.0284 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4806 -3.5054 -3.2526 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4104 -4.3860 -1.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6635 -3.9678 -1.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8883 -2.8207 0.1132 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5883 -3.3327 0.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7982 -1.3038 1.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3595 -1.2815 0.9048 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9905 1.0130 1.8918 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4127 2.0149 0.5619 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0155 0.1075 2.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4537 1.7030 1.8634 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5520 -1.9839 0.2294 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5475 -1.7236 1.6788 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2486 -1.2972 1.7488 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9234 -0.1049 -2.8469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1356 0.8294 -2.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1719 -0.9197 -2.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2809 -0.9145 0.0508 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5286 2.1036 -1.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1457 1.8850 -1.0814 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8813 2.7555 -0.1138 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0542 -1.0961 -1.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3904 0.0473 -1.5590 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9727 -2.0310 -0.6434 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7191 -1.9919 0.6311 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8583 -1.2850 1.4530 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5098 -0.5674 3.2560 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7222 -0.8598 3.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3785 0.7070 3.8133 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0122 1.7268 2.4638 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6674 1.9759 0.7493 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5368 2.5865 1.9982 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6187 -0.5611 1.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5119 2.4883 1.8577 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4873 1.2655 3.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3359 2.2360 2.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4319 0.5280 2.6170 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9053 2.4994 -0.1042 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1713 2.2184 -1.3175 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5260 3.0994 0.2571 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5460 -1.2044 0.9872 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9925 1.4929 1.0145 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9036 1.9605 -0.4063 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1054 0.1116 -2.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6202 -1.6356 0.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7955 -2.4738 -1.8938 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2145 -3.3180 -1.7004 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0521 -2.7957 -3.7363 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0043 -0.0772 -1.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4572 1.2080 -2.4991 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3644 0.6158 1.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1375 0.8445 -1.7703 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2434 -1.6800 -2.3444 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6657 -0.9170 -3.0625 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2841 1.6862 -1.1902 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1464 2.5654 1.6423 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6295 3.6134 -1.1972 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4939 2.0913 0.6402 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7923 1.4572 -1.8356 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9544 0.3468 -2.3392 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5042 -0.6945 -2.0986 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1176 0.6934 -0.0778 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6321 -1.8642 1.5233 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6823 0.5045 2.9875 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0307 -0.0216 1.9269 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2190 0.4645 -0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3069 -0.6201 0.1281 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3728 -2.0760 0.5088 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6012 -1.7798 -1.7940 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6406 2.0299 2.0434 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3886 -1.4406 2.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8273 -0.8569 1.8693 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6400 3.3642 -0.7458 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3627 4.4641 1.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3594 3.7886 1.3861 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 1 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 19 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 31 38 1 0 30 39 1 0 11 40 1 0 40 41 1 0 6 42 1 6 42 43 2 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 53 62 1 0 49 63 1 0 48 64 1 0 47 65 1 0 46 66 1 0 41 2 1 0 63 45 1 0 40 6 1 0 59 52 1 0 26 9 1 0 36 29 1 0 26 14 1 0 23 15 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 10 81 1 0 10 82 1 0 10 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 1 16 88 1 0 16 89 1 0 16 90 1 0 17 91 1 0 17 92 1 0 18 93 1 0 18 94 1 0 19 95 1 1 21 96 1 0 21 97 1 0 21 98 1 0 22 99 1 0 22100 1 0 22101 1 0 23102 1 1 24103 1 0 24104 1 0 25105 1 0 25106 1 0 27107 1 0 27108 1 0 27109 1 0 29110 1 1 30111 1 1 31112 1 1 32113 1 6 33114 1 1 34115 1 0 34116 1 0 35117 1 0 37118 1 0 38119 1 0 39120 1 0 40121 1 6 41122 1 0 41123 1 0 45124 1 6 46125 1 1 47126 1 6 48127 1 1 49128 1 6 50129 1 0 50130 1 0 52131 1 1 53132 1 6 54133 1 1 55134 1 1 56135 1 6 57136 1 0 57137 1 0 58138 1 0 60139 1 0 61140 1 0 62141 1 0 64142 1 0 65143 1 0 66144 1 0 M END

Standard InCHIKey	LVSPBVZWDHHCIY-KXESMRJQSA-N
Standard InCHI	InChI=1S/C48H78O18/c1-43(2)14-16-48(42(60)66-41-38(59)35(56)32(53)26(64-41)21-61-39-36(57)33(54)30(51)24(19-49)62-39)17-15-46(6)22(23(48)18-43)8-9-28-45(5)12-11-29(44(3,4)27(45)10-13-47(28,46)7)65-40-37(58)34(55)31(52)25(20-50)63-40/h8,23-41,49-59H,9-21H2,1-7H3/t23-,24+,25+,26+,27-,28+,29-,30+,31+,32+,33-,34-,35-,36+,37+,38+,39+,40-,41-,45-,46+,47+,48-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)[C@@H]2C1)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	942.52	Volume:	923.263 ? Van der Waals volume.
Dense:	1.021	LogP:	1.818 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.515 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.405 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	45.0
TPSA:	294.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.083	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.249	Fsp³:	0.938
MCE-18:	173.419 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.873	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.193	Promiscuous compounds:	0.056

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.26	MDCK Permeability:	-5.132
Pgp-inhibitor:	0.001	Pgp-substrate:	0.013
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.646
20% Bioavailability (F20%):	0.291	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.021	MRP1:	0.017
Plasma Protein Binding (PPB):	70.577%	Volume Distribution (VD):	-0.396
Fu:	18.6% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.004	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.011
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.217
HLM stability:	0.046 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.102

Half-life (T1/2):

3.458

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.721	Drug-induced Liver Injury (DILI):	0.909
AMES Toxicity:	0.978	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.084	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.501	Drug-induced Nephrotoxicity:	0.991
Genotoxicity:	0.41	RPMI-8226 Immunitoxicity:	0.184
A549 Cytotoxicity:	0.793	Hek293 Cytotoxicity:	0.321
BCF:	1.651 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.676 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.157 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.364 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[31301930]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[Article]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8622	Stauntonia hexaphylla	Species	Lardizabalaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	IC50	>	50000.0	nM	PMID[31301930]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC48499 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20057
0.1-0.2	24300
0.2-0.3	3848
0.3-0.4	963
0.4-0.5	400
0.5-0.6	68
0.6-0.7	64
0.7-0.8	0
0.8-0.85	5
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8778	High Similarity	NPC63159
0.8427	Intermediate Similarity	NPC295371
0.8161	Intermediate Similarity	NPC214484
0.8068	Intermediate Similarity	NPC29069
0.8022	Intermediate Similarity	NPC39211
0.8	Intermediate Similarity	NPC475516
0.7938	Intermediate Similarity	NPC295823
0.7938	Intermediate Similarity	NPC174720
0.7938	Intermediate Similarity	NPC475467
0.79	Intermediate Similarity	NPC79643
0.7843	Intermediate Similarity	NPC475160
0.7843	Intermediate Similarity	NPC473714
0.7835	Intermediate Similarity	NPC481079
0.7802	Intermediate Similarity	NPC235405
0.7745	Intermediate Similarity	NPC135904
0.7742	Intermediate Similarity	NPC469946
0.7717	Intermediate Similarity	NPC473373
0.7717	Intermediate Similarity	NPC249848
0.7717	Intermediate Similarity	NPC107966
0.7692	Intermediate Similarity	NPC481080
0.767	Intermediate Similarity	NPC470218
0.766	Intermediate Similarity	NPC223301
0.766	Intermediate Similarity	NPC171544
0.766	Intermediate Similarity	NPC112352
0.7604	Intermediate Similarity	NPC235438
0.7579	Intermediate Similarity	NPC30735
0.7573	Intermediate Similarity	NPC123199
0.7556	Intermediate Similarity	NPC90856
0.7551	Intermediate Similarity	NPC104372
0.7526	Intermediate Similarity	NPC222580
0.75	Intermediate Similarity	NPC251768
0.7453	Intermediate Similarity	NPC476068
0.7451	Intermediate Similarity	NPC60557
0.7451	Intermediate Similarity	NPC67857
0.7447	Intermediate Similarity	NPC157868
0.7347	Intermediate Similarity	NPC297263
0.732	Intermediate Similarity	NPC40775
0.732	Intermediate Similarity	NPC159309
0.732	Intermediate Similarity	NPC473459
0.732	Intermediate Similarity	NPC46665
0.732	Intermediate Similarity	NPC86222
0.7315	Intermediate Similarity	NPC41061
0.7315	Intermediate Similarity	NPC227551
0.7315	Intermediate Similarity	NPC258617
0.7292	Intermediate Similarity	NPC192791
0.7264	Intermediate Similarity	NPC488560
0.7248	Intermediate Similarity	NPC43550
0.7245	Intermediate Similarity	NPC148417
0.7228	Intermediate Similarity	NPC241909
0.7209	Intermediate Similarity	NPC167383
0.7182	Intermediate Similarity	NPC305981
0.7182	Intermediate Similarity	NPC481081
0.7157	Intermediate Similarity	NPC31838
0.7143	Intermediate Similarity	NPC10607
0.7129	Intermediate Similarity	NPC301449
0.7129	Intermediate Similarity	NPC601290
0.7117	Intermediate Similarity	NPC261506
0.7117	Intermediate Similarity	NPC4328
0.7071	Intermediate Similarity	NPC475591
0.7071	Intermediate Similarity	NPC236870
0.7059	Intermediate Similarity	NPC80986
0.7045	Intermediate Similarity	NPC237503
0.7041	Intermediate Similarity	NPC104071
0.7033	Intermediate Similarity	NPC128925
0.703	Intermediate Similarity	NPC281148
0.703	Intermediate Similarity	NPC114484
0.7009	Intermediate Similarity	NPC100639
0.699	Remote Similarity	NPC481078
0.699	Remote Similarity	NPC187290
0.697	Remote Similarity	NPC102439
0.693	Remote Similarity	NPC250247
0.6887	Remote Similarity	NPC192600
0.6837	Remote Similarity	NPC473343
0.6809	Remote Similarity	NPC204458
0.68	Remote Similarity	NPC480475
0.6792	Remote Similarity	NPC76972
0.6792	Remote Similarity	NPC469782
0.6792	Remote Similarity	NPC204414
0.6774	Remote Similarity	NPC209894
0.6737	Remote Similarity	NPC1046
0.6737	Remote Similarity	NPC78046
0.6735	Remote Similarity	NPC473884
0.6735	Remote Similarity	NPC470512
0.6726	Remote Similarity	NPC236638
0.6726	Remote Similarity	NPC294453
0.67	Remote Similarity	NPC309714
0.6637	Remote Similarity	NPC65105
0.6633	Remote Similarity	NPC173583
0.6633	Remote Similarity	NPC150400
0.6609	Remote Similarity	NPC70809
0.6606	Remote Similarity	NPC155410
0.66	Remote Similarity	NPC242840
0.6535	Remote Similarity	NPC109588
0.6522	Remote Similarity	NPC298034
0.6522	Remote Similarity	NPC71065
0.6505	Remote Similarity	NPC609763
0.6471	Remote Similarity	NPC173859
0.6471	Remote Similarity	NPC148603
0.6465	Remote Similarity	NPC58448
0.6408	Remote Similarity	NPC470515
0.6364	Remote Similarity	NPC165204
0.6348	Remote Similarity	NPC293330
0.6316	Remote Similarity	NPC256798
0.6262	Remote Similarity	NPC480473
0.6262	Remote Similarity	NPC480474
0.6261	Remote Similarity	NPC475514
0.6228	Remote Similarity	NPC57484
0.6214	Remote Similarity	NPC160415
0.619	Remote Similarity	NPC470513
0.6182	Remote Similarity	NPC475287
0.6176	Remote Similarity	NPC263756
0.6176	Remote Similarity	NPC161674
0.6176	Remote Similarity	NPC76497
0.6176	Remote Similarity	NPC213674
0.6154	Remote Similarity	NPC202828
0.6154	Remote Similarity	NPC119592
0.6154	Remote Similarity	NPC164389
0.6154	Remote Similarity	NPC488526
0.6134	Remote Similarity	NPC224381
0.6132	Remote Similarity	NPC64715
0.6122	Remote Similarity	NPC189884
0.6122	Remote Similarity	NPC138334
0.6117	Remote Similarity	NPC75417
0.6064	Remote Similarity	NPC306746
0.6064	Remote Similarity	NPC199457
0.604	Remote Similarity	NPC139894
0.6038	Remote Similarity	NPC470514
0.6038	Remote Similarity	NPC475504
0.6	Remote Similarity	NPC305267
0.6	Remote Similarity	NPC220160
0.6	Remote Similarity	NPC68419
0.5965	Remote Similarity	NPC191827
0.5943	Remote Similarity	NPC68175
0.5941	Remote Similarity	NPC136877
0.5935	Remote Similarity	NPC480422
0.5909	Remote Similarity	NPC104137
0.5909	Remote Similarity	NPC26626
0.5882	Remote Similarity	NPC136768
0.587	Remote Similarity	NPC191763
0.5865	Remote Similarity	NPC471547
0.5859	Remote Similarity	NPC47063
0.5856	Remote Similarity	NPC11242
0.5856	Remote Similarity	NPC75287
0.5849	Remote Similarity	NPC11551
0.5833	Remote Similarity	NPC604133
0.5825	Remote Similarity	NPC480420
0.5818	Remote Similarity	NPC481030
0.5818	Remote Similarity	NPC470516
0.58	Remote Similarity	NPC269095
0.5789	Remote Similarity	NPC470911
0.5763	Remote Similarity	NPC110633
0.5763	Remote Similarity	NPC480418
0.5755	Remote Similarity	NPC471548
0.5741	Remote Similarity	NPC31193
0.5739	Remote Similarity	NPC480419
0.5729	Remote Similarity	NPC606107
0.5714	Remote Similarity	NPC470915
0.5701	Remote Similarity	NPC473401
0.5701	Remote Similarity	NPC101744
0.57	Remote Similarity	NPC161434
0.569	Remote Similarity	NPC283417
0.569	Remote Similarity	NPC200049
0.5684	Remote Similarity	NPC46388
0.5676	Remote Similarity	NPC96641
0.5676	Remote Similarity	NPC163183
0.5644	Remote Similarity	NPC473481
0.5619	Remote Similarity	NPC488516
0.5607	Remote Similarity	NPC117714
0.5607	Remote Similarity	NPC30289
0.5593	Remote Similarity	NPC4749
0.5581	Remote Similarity	NPC162107
0.5581	Remote Similarity	NPC46912
0.5567	Remote Similarity	NPC37739
0.5565	Remote Similarity	NPC123522
0.5556	Remote Similarity	NPC470517
0.5556	Remote Similarity	NPC232237
0.5556	Remote Similarity	NPC471550
0.5546	Remote Similarity	NPC21691
0.5545	Remote Similarity	NPC119794
0.5534	Remote Similarity	NPC475208
0.5532	Remote Similarity	NPC469778
0.553	Remote Similarity	NPC472268
0.5526	Remote Similarity	NPC185466
0.5521	Remote Similarity	NPC605954
0.5517	Remote Similarity	NPC475899
0.5517	Remote Similarity	NPC481031
0.5512	Remote Similarity	NPC33012
0.551	Remote Similarity	NPC137917
0.5505	Remote Similarity	NPC105800
0.55	Remote Similarity	NPC13998
0.5487	Remote Similarity	NPC207738
0.5487	Remote Similarity	NPC36831
0.5478	Remote Similarity	NPC268184
0.5478	Remote Similarity	NPC610204
0.5468	Remote Similarity	NPC469776
0.5464	Remote Similarity	NPC116794
0.5462	Remote Similarity	NPC85154
0.5461	Remote Similarity	NPC32723
0.5455	Remote Similarity	NPC31839

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC48499 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7126
0.1-0.2	1952
0.2-0.3	63
0.3-0.4	8
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data