NPASS Compound

Natural Product: NPC68175

Natural Product ID	NPC68175
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Kudinoside G
IUPAC Name	[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-1-hydroxy-10-[(2S,3R,4S,5S)-5-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	Kudinoside G
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL505926
PubChem CID	44566332
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 161169 0 0 0 0 0 0 0 0999 V2000 -9.7440 5.5167 -1.5486 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5851 4.4075 -1.6654 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0137 3.2529 -0.8654 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7655 2.9376 -1.3489 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1789 1.8780 -0.6499 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0581 1.3930 -1.2815 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1311 0.0589 -1.6018 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1390 -0.0145 -3.1391 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1423 0.8197 -3.6209 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8134 0.5975 -3.5649 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1543 1.1459 -2.4646 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6351 0.0703 -1.6504 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8413 -0.6497 -1.1514 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8888 -1.9853 -1.5537 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0630 -2.7866 -0.4424 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9645 -3.6310 -0.2045 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2802 -4.5683 0.7462 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0239 -4.8858 1.5646 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3900 -4.1669 1.6888 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6725 -4.0546 0.8594 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2839 -3.6773 -0.5519 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3245 -3.1069 -1.2328 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4983 -3.1436 1.4720 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5238 -5.1832 2.6387 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9929 0.7292 -0.6325 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6464 0.6510 -0.6134 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9537 1.9605 -0.9036 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4541 1.8246 -0.8821 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0663 1.2657 0.4367 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6871 0.0191 0.7124 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1603 0.0096 0.6448 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8618 0.5078 1.8786 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5659 -1.4723 0.5473 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1231 -0.7095 1.9174 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2840 -1.1248 1.5339 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2052 0.0773 1.2192 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4729 0.8023 0.1549 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3187 1.8203 -0.4977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4705 1.0734 -1.0710 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0612 0.0627 -0.4970 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5626 -0.3973 0.8209 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5747 -1.8876 1.0473 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7179 0.0719 1.7274 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9810 0.3795 1.0281 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4236 -0.3796 -0.1646 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2738 -0.5105 -1.1377 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1302 -1.7396 -1.9233 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0995 -1.4515 -3.4587 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8719 -2.3686 -1.8140 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1661 -2.8018 -1.7721 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6174 -4.1195 -1.2117 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3854 -2.4533 -1.0045 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1516 -1.6056 0.2015 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5229 0.5088 -0.7518 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3556 0.8915 -1.9266 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 0.8882 -0.0782 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6251 1.7193 -0.7114 C 0 0 2 0 0 0 0 0 0 0 0 0 10.7600 0.9604 -0.8472 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4944 0.7391 0.2811 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8928 -0.2680 1.2434 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7460 -0.4159 2.3614 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8735 2.0177 1.0030 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6650 2.9092 1.2036 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8296 3.0248 -0.0263 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5246 3.8612 -0.9135 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9419 2.5211 2.3078 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8368 2.6932 0.2679 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3407 0.7780 2.5443 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0719 2.3590 1.4307 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7777 2.3252 0.7511 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4801 3.6481 1.0458 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9046 3.6408 0.5814 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6632 2.7708 1.3637 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7276 4.6512 0.4375 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0657 1.3715 1.7096 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3307 6.3122 -1.4388 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5956 4.6236 -1.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6835 4.1519 -2.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7456 2.4029 -1.0137 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9139 1.0448 -0.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0416 -0.4337 -1.2863 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2546 -1.0530 -3.4555 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8069 1.6362 -4.0708 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9399 1.3518 -4.3489 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1773 -0.2180 -3.9615 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9790 -0.5336 -2.3124 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8668 -0.6289 -0.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1623 -2.1901 0.4857 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5851 -5.5024 0.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9861 -5.9435 1.8454 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0628 -4.2555 2.4822 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1449 -4.5560 0.9777 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1346 -3.2504 2.2166 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1779 -5.0493 0.9067 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9732 -4.6574 -1.0302 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2453 -3.2394 -2.2112 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3677 -3.0432 1.0339 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5998 -6.0866 2.2178 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3418 -0.0107 -1.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3145 2.7839 -0.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2216 2.2426 -1.9411 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0783 1.2949 -1.7589 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0987 2.9007 -0.9095 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3826 -0.6819 -0.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4765 -0.0506 2.7475 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8318 1.5984 2.0105 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9298 0.2218 1.7820 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6832 -2.1154 0.3163 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2484 -1.6046 -0.3266 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1052 -1.8299 1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6843 -1.6663 1.9793 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2524 -0.2268 2.8656 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6301 -1.7642 2.3170 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0827 -1.6229 0.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2989 0.0023 -0.6431 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8093 2.3921 -1.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6748 2.6260 0.2125 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8431 1.4024 -2.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4900 -2.4082 0.7897 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7603 -2.4745 0.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5661 -1.9791 2.1886 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9152 -0.6378 2.5549 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4664 1.0362 2.2488 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0783 1.4944 0.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8132 0.2540 1.7919 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6021 0.2348 -1.9517 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0193 -0.8425 -3.6880 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1923 -2.4196 -3.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2037 -0.8852 -3.7238 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7889 -3.0412 -2.5187 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5738 -3.1395 -2.7819 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1562 -4.3799 -0.2556 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7586 -4.9711 -1.8889 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5582 -4.0369 -0.9297 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1504 -2.0404 -1.6904 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8412 -3.4161 -0.6212 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7427 -2.2174 1.0106 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1730 -1.3010 0.5648 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2708 1.9249 -1.7677 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4675 0.2853 -0.0527 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8427 -1.2438 0.7544 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9329 0.0886 1.6850 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5625 -0.8943 2.0291 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2969 1.7625 1.9846 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0831 3.9403 1.4087 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8480 3.4619 0.2440 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0160 3.2922 -1.5550 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3151 3.2424 2.5537 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1089 2.2438 -0.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6689 1.8101 2.5149 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4088 0.7866 3.1582 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9875 0.0951 3.1783 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8703 2.9472 1.4398 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4424 2.0663 2.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8347 3.1278 1.0921 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6888 2.5327 0.7983 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4706 3.7548 2.1545 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3536 4.6474 0.7154 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6237 2.9912 1.1823 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8210 4.6398 0.8170 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8392 0.8413 1.3886 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 19 24 1 0 12 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 30 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 6 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 1 47 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 45 54 1 6 54 55 2 0 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 62 67 1 0 36 68 1 1 29 69 1 1 5 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 71 74 1 0 70 75 1 0 72 3 1 0 13 7 1 0 21 15 1 0 31 26 1 0 41 36 1 0 53 45 1 0 64 57 1 0 37 29 1 0 46 40 1 0 1 76 1 0 2 77 1 0 2 78 1 0 3 79 1 1 5 80 1 1 7 81 1 1 8 82 1 1 9 83 1 0 10 84 1 0 10 85 1 0 12 86 1 6 13 87 1 1 15 88 1 1 17 89 1 6 18 90 1 0 18 91 1 0 18 92 1 0 19 93 1 1 20 94 1 6 21 95 1 6 22 96 1 0 23 97 1 0 24 98 1 0 26 99 1 6 27100 1 0 27101 1 0 28102 1 0 28103 1 0 30104 1 6 32105 1 0 32106 1 0 32107 1 0 33108 1 0 33109 1 0 33110 1 0 34111 1 0 34112 1 0 35113 1 0 35114 1 0 37115 1 6 38116 1 0 38117 1 0 39118 1 0 42119 1 0 42120 1 0 42121 1 0 43122 1 0 43123 1 0 44124 1 0 44125 1 0 46126 1 6 48127 1 0 48128 1 0 48129 1 0 49130 1 0 50131 1 6 51132 1 0 51133 1 0 51134 1 0 52135 1 0 52136 1 0 53137 1 0 53138 1 0 57139 1 6 59140 1 6 60141 1 0 60142 1 0 61143 1 0 62144 1 1 63145 1 1 64146 1 1 65147 1 0 66148 1 0 67149 1 0 68150 1 0 68151 1 0 68152 1 0 69153 1 0 69154 1 0 69155 1 0 70156 1 6 71157 1 1 72158 1 6 73159 1 0 74160 1 0 75161 1 0 M END

Standard InCHIKey	XPHZAIDDYJZVAV-KBYFSKQLSA-N
Standard InCHI	InChI=1S/C53H86O22/c1-22-11-16-53(47(66)75-45-39(65)36(62)33(59)27(20-55)71-45)18-17-50(6)24(42(53)52(22,8)67)9-10-29-49(5)14-13-30(48(3,4)28(49)12-15-51(29,50)7)72-46-41(74-43-37(63)34(60)31(57)23(2)69-43)40(25(56)21-68-46)73-44-38(64)35(61)32(58)26(19-54)70-44/h9,22-23,25-46,54-65,67H,10-21H2,1-8H3/t22-,23+,25+,26-,27-,28+,29-,30+,31+,32-,33-,34-,35+,36+,37-,38-,39-,40+,41-,42-,43+,44+,45+,46+,49+,50-,51-,52-,53+/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)CO[C@H]([C@@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3[C@](C)(O)[C@H](C)CC2)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33035	ilex kudincha	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10425145]
NPO33035	ilex kudincha	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10479318]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	3

Activity Type	# Activity
Individual protein	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1214	Individual protein	Acyl coenzyme A:cholesterol acyltransferase 1	Homo sapiens	Inhibition	=	31.8	%	PMID[23398362]
NPT1214	Individual protein	Acyl coenzyme A:cholesterol acyltransferase 1	Homo sapiens	Inhibition	=	10.3	%	PMID[3655795]
NPT1214	Individual protein	Acyl coenzyme A:cholesterol acyltransferase 1	Homo sapiens	Inhibition	=	10.9	%	PMID[17243726]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC68175 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22599
0.1-0.2	22967
0.2-0.3	3043
0.3-0.4	773
0.4-0.5	319
0.5-0.6	115
0.6-0.7	24
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8969	High Similarity	NPC36831
0.8333	Intermediate Similarity	NPC160415
0.8316	Intermediate Similarity	NPC161674
0.8247	Intermediate Similarity	NPC46665
0.7551	Intermediate Similarity	NPC58448
0.7477	Intermediate Similarity	NPC268184
0.7396	Intermediate Similarity	NPC204458
0.6827	Remote Similarity	NPC112352
0.6768	Remote Similarity	NPC47063
0.67	Remote Similarity	NPC189884
0.67	Remote Similarity	NPC138334
0.6667	Remote Similarity	NPC75417
0.6632	Remote Similarity	NPC46388
0.6609	Remote Similarity	NPC100639
0.6571	Remote Similarity	NPC263756
0.65	Remote Similarity	NPC481081
0.6495	Remote Similarity	NPC37739
0.6429	Remote Similarity	NPC310014
0.6429	Remote Similarity	NPC269315
0.6389	Remote Similarity	NPC10607
0.6364	Remote Similarity	NPC271138
0.633	Remote Similarity	NPC475591
0.633	Remote Similarity	NPC236870
0.6239	Remote Similarity	NPC135904
0.6195	Remote Similarity	NPC80986
0.6182	Remote Similarity	NPC148417
0.614	Remote Similarity	NPC187290
0.6132	Remote Similarity	NPC475516
0.6078	Remote Similarity	NPC128925
0.6036	Remote Similarity	NPC63159
0.6	Remote Similarity	NPC117714
0.5983	Remote Similarity	NPC60557
0.5983	Remote Similarity	NPC67857
0.5981	Remote Similarity	NPC235405
0.5946	Remote Similarity	NPC480475
0.5943	Remote Similarity	NPC48499
0.5926	Remote Similarity	NPC249848
0.5926	Remote Similarity	NPC107966
0.5917	Remote Similarity	NPC475160
0.5917	Remote Similarity	NPC473714
0.5905	Remote Similarity	NPC214484
0.5862	Remote Similarity	NPC481078
0.584	Remote Similarity	NPC305981
0.5833	Remote Similarity	NPC155410
0.5818	Remote Similarity	NPC469946
0.5798	Remote Similarity	NPC79643
0.5794	Remote Similarity	NPC261506
0.5794	Remote Similarity	NPC4328
0.5772	Remote Similarity	NPC476068
0.5772	Remote Similarity	NPC57484
0.5766	Remote Similarity	NPC192791
0.5755	Remote Similarity	NPC90856
0.5752	Remote Similarity	NPC235438
0.575	Remote Similarity	NPC165204
0.5739	Remote Similarity	NPC114484
0.5727	Remote Similarity	NPC39211
0.5714	Remote Similarity	NPC30735
0.5702	Remote Similarity	NPC222580
0.5701	Remote Similarity	NPC78046
0.569	Remote Similarity	NPC481079
0.568	Remote Similarity	NPC41061
0.568	Remote Similarity	NPC227551
0.568	Remote Similarity	NPC258617
0.5676	Remote Similarity	NPC213674
0.5664	Remote Similarity	NPC251768
0.5641	Remote Similarity	NPC295823
0.5641	Remote Similarity	NPC174720
0.5641	Remote Similarity	NPC475467
0.5635	Remote Similarity	NPC43550
0.56	Remote Similarity	NPC110633
0.5583	Remote Similarity	NPC475287
0.5574	Remote Similarity	NPC123199
0.5565	Remote Similarity	NPC297263
0.5526	Remote Similarity	NPC164389
0.5508	Remote Similarity	NPC480473
0.5508	Remote Similarity	NPC480474
0.5487	Remote Similarity	NPC223301
0.5487	Remote Similarity	NPC171544
0.5484	Remote Similarity	NPC488560
0.5472	Remote Similarity	NPC256798
0.547	Remote Similarity	NPC281148
0.5469	Remote Similarity	NPC136768
0.5469	Remote Similarity	NPC236638
0.5469	Remote Similarity	NPC294453
0.5455	Remote Similarity	NPC76972
0.5455	Remote Similarity	NPC469782
0.5455	Remote Similarity	NPC204414
0.5446	Remote Similarity	NPC157868
0.5424	Remote Similarity	NPC301449
0.5424	Remote Similarity	NPC601290
0.542	Remote Similarity	NPC250247
0.5403	Remote Similarity	NPC471550
0.5391	Remote Similarity	NPC293330
0.5391	Remote Similarity	NPC40775
0.5391	Remote Similarity	NPC159309
0.5391	Remote Similarity	NPC86222
0.5347	Remote Similarity	NPC191763
0.5339	Remote Similarity	NPC104372
0.5333	Remote Similarity	NPC31838
0.5317	Remote Similarity	NPC481080
0.5308	Remote Similarity	NPC298034
0.5308	Remote Similarity	NPC302543
0.5308	Remote Similarity	NPC71065
0.5299	Remote Similarity	NPC470478
0.5268	Remote Similarity	NPC108748
0.525	Remote Similarity	NPC96641
0.525	Remote Similarity	NPC163183
0.5243	Remote Similarity	NPC167383
0.5238	Remote Similarity	NPC47995
0.5192	Remote Similarity	NPC605954
0.5182	Remote Similarity	NPC269095
0.5172	Remote Similarity	NPC309714
0.5172	Remote Similarity	NPC30289
0.5169	Remote Similarity	NPC475504
0.5159	Remote Similarity	NPC283417
0.5159	Remote Similarity	NPC470218
0.5159	Remote Similarity	NPC200049
0.5154	Remote Similarity	NPC65105
0.5145	Remote Similarity	NPC475368
0.5143	Remote Similarity	NPC116794
0.5143	Remote Similarity	NPC237503
0.514	Remote Similarity	NPC110139
0.514	Remote Similarity	NPC108709
0.5135	Remote Similarity	NPC1046
0.513	Remote Similarity	NPC76497
0.5128	Remote Similarity	NPC101744
0.5128	Remote Similarity	NPC173859
0.5128	Remote Similarity	NPC148603
0.5128	Remote Similarity	NPC2370
0.5124	Remote Similarity	NPC241909
0.5113	Remote Similarity	NPC220160
0.5091	Remote Similarity	NPC161434
0.5088	Remote Similarity	NPC473373
0.5088	Remote Similarity	NPC109079
0.5077	Remote Similarity	NPC475514
0.5074	Remote Similarity	NPC480422
0.5047	Remote Similarity	NPC7870
0.5047	Remote Similarity	NPC75747
0.5043	Remote Similarity	NPC295371
0.5043	Remote Similarity	NPC104071
0.5041	Remote Similarity	NPC470915
0.5039	Remote Similarity	NPC484061
0.5039	Remote Similarity	NPC21691
0.5039	Remote Similarity	NPC484062
0.5038	Remote Similarity	NPC70809
0.5037	Remote Similarity	NPC480417

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC68175 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7511
0.1-0.2	1580
0.2-0.3	53
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data