NPASS Compound

Natural Product: NPC47995

Natural Product ID	NPC47995
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Alpha-L-Rhamnopyranosyl-(1->4)-Beta-D-Galactopyranosyl-(1->3)-[Beta-D-Glucopyranosyl-(1->2)]-Beta-D-Glucuronopyranosyl 22-O-Angeloylerythrodiol
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9S,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9-[(Z)-2-methylbut-2-enoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL500974
PubChem CID	24879068
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 177185 0 0 0 0 0 0 0 0999 V2000 1.5782 -6.1823 -2.7290 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9330 -6.0094 -2.9310 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1660 -4.7181 -3.7381 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6548 -3.7035 -3.0161 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4181 -2.6405 -2.6553 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1069 -2.9585 -1.5182 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7669 -2.1288 -0.4260 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7392 -2.8494 0.3905 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1413 -3.4694 1.5292 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1218 -2.9568 2.2956 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3053 -2.6062 1.4599 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9186 -1.6543 0.3570 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6774 -0.4120 0.9630 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6408 0.5372 0.6471 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3144 0.9872 1.7713 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9782 2.1724 1.6308 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2572 3.3310 2.3075 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9787 4.5169 2.1341 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2886 2.5065 0.1851 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0044 2.6774 -0.5976 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0106 1.6123 -0.1875 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5264 1.0217 -1.3509 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4085 3.9157 -0.3823 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1438 3.5736 0.1215 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3914 3.2810 -0.4385 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4188 3.3921 0.4549 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0619 4.5963 0.5181 C 0 0 1 0 0 0 0 0 0 0 0 0 12.2454 4.4722 1.4575 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6397 4.9095 -0.8688 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4101 5.2031 -1.7297 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5514 3.9823 -1.7391 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9935 3.0860 -2.7135 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8444 5.4356 -3.0411 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5154 5.9713 -0.8441 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8888 -3.7801 0.9869 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6103 -1.8337 3.1199 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4225 -1.4359 3.1518 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5019 -1.1373 3.9452 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6696 -2.0248 0.7762 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4383 -2.3727 0.2821 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5299 -2.9542 1.2474 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4171 -2.0993 2.0316 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8806 -0.7998 1.3621 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5862 -0.9590 -0.0731 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1629 -1.2363 -0.4732 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6951 -0.0226 -0.5021 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3056 -1.7057 -1.9404 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2212 0.0891 -0.9285 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7353 -0.0031 -0.7286 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1248 0.2656 0.7382 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3867 -0.7740 1.4923 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8573 -0.8515 2.9012 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2873 -1.3120 2.7612 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0960 -0.8581 1.8514 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5936 0.1528 0.9060 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1848 0.0521 -0.4877 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2954 1.4245 1.4391 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5125 1.1979 2.2311 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3018 -0.0678 2.1177 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5115 -1.3075 1.8332 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9135 -2.2157 0.7553 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2861 -2.0832 0.1948 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0644 -3.4181 0.3075 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2748 -1.8281 -1.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1754 -1.0823 0.8202 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5374 0.1708 1.3123 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4209 1.1605 0.3161 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0898 2.3430 0.2218 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9175 2.6289 1.1080 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8854 3.3000 -0.8674 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5359 4.4417 -0.9278 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5096 4.8310 0.0961 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8951 2.9224 -1.9192 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8674 -0.2212 3.5751 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6201 -1.3744 3.5811 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7350 1.6880 1.0045 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2048 0.2876 2.1067 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2919 -2.1044 -3.7636 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8933 -3.2244 -4.5782 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6551 -4.5605 -3.8936 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2094 -5.5961 -4.6460 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2611 -3.0869 -4.7642 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6172 -1.2544 -4.6234 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4308 -6.8992 -2.0708 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4642 -5.9515 -1.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2945 -6.8921 -3.5041 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6742 -4.8709 -4.7271 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7408 -1.8042 -2.3936 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1655 -1.2557 -0.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3044 -3.6984 -0.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4006 -3.7963 3.0307 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0327 -2.0758 2.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8333 -1.4532 -0.2854 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4230 0.0667 -0.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9582 2.0899 2.1516 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2073 3.4338 1.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1819 3.1706 3.4026 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3282 5.2531 2.0918 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7736 1.5801 -0.2364 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1691 2.5879 -1.6873 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1111 2.0564 0.3215 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1847 0.4062 -1.7643 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8798 4.6004 -0.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3216 2.1728 -0.6814 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4215 5.4647 0.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1183 4.0488 0.8928 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0185 3.7587 2.2826 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5795 5.4663 1.8181 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1012 3.9725 -1.2473 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8782 6.0771 -1.3315 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5240 4.3232 -2.0656 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9519 3.2487 -2.8778 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7332 5.8723 -2.9479 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2890 5.7196 -0.2921 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8480 -4.4822 1.6833 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1981 -0.2847 4.3575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6835 -3.2570 -0.4059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0026 -3.6288 1.9870 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1623 -3.7101 0.6785 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9439 -1.8956 3.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3084 -2.7434 2.3230 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1308 -1.9181 -0.3683 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1707 0.9504 -0.5051 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4721 0.0006 0.2907 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2781 0.0039 -1.4745 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3164 -2.1792 -2.0863 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4530 -2.4618 -2.1278 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2177 -0.8135 -2.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0951 -0.2813 -1.9955 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8069 1.0734 -0.9250 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8968 -1.1121 -0.9121 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1641 0.6633 -1.4453 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6935 -1.7580 1.0134 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8343 0.1466 3.4211 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2743 -1.5062 3.5735 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5833 -2.0769 3.5095 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2887 0.0315 -0.4863 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9919 1.0883 -0.9213 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7370 -0.6464 -1.1671 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4972 2.1464 0.6087 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5860 1.9934 2.1119 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2407 2.0313 1.9548 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3201 1.4892 3.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6302 -1.9656 2.7644 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8342 -3.3167 1.0685 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1942 -2.2412 -0.0959 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1101 -3.2427 0.0147 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9292 -3.8611 1.2907 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6497 -4.1223 -0.4554 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0555 -2.3801 -1.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2922 -2.2113 -1.6658 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2887 -0.7414 -1.5464 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9306 -0.7503 0.0369 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8177 -1.5390 1.6036 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3450 0.6222 1.9911 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2995 5.0764 -1.7932 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8557 5.8797 -0.1521 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4229 4.2185 0.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0407 4.9481 1.1065 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2999 1.9903 -2.4031 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9471 2.7043 -1.3977 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8103 3.7113 -2.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0029 -0.2994 4.2532 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5310 0.6359 3.7777 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4934 -1.9706 4.3350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8021 2.0236 0.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5770 1.9453 2.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5038 2.3354 0.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9115 1.1788 1.5749 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8642 0.5143 3.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2568 -0.0890 2.6016 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1160 -1.5344 -3.3078 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4338 -3.3085 -5.5802 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1428 -4.5193 -2.9075 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9217 -6.0371 -4.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5497 -2.2059 -4.4321 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6388 -1.2462 -4.4928 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 0 19 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 29 34 1 0 11 35 1 0 10 36 1 0 36 37 2 0 36 38 1 0 8 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 1 6 55 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 62 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 2 0 68 70 1 0 70 71 2 0 71 72 1 0 70 73 1 0 59 74 1 1 74 75 1 0 50 76 1 1 43 77 1 1 5 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 79 82 1 0 78 83 1 0 80 3 1 0 12 7 1 0 21 14 1 0 31 25 1 0 45 40 1 0 55 50 1 0 66 59 1 0 51 43 1 0 60 54 1 0 1 84 1 0 2 85 1 0 2 86 1 0 3 87 1 6 5 88 1 1 7 89 1 6 8 90 1 6 10 91 1 1 11 92 1 1 12 93 1 6 14 94 1 6 16 95 1 1 17 96 1 0 17 97 1 0 18 98 1 0 19 99 1 6 20100 1 6 21101 1 1 22102 1 0 23103 1 0 25104 1 6 27105 1 1 28106 1 0 28107 1 0 28108 1 0 29109 1 6 30110 1 1 31111 1 6 32112 1 0 33113 1 0 34114 1 0 35115 1 0 38116 1 0 40117 1 6 41118 1 0 41119 1 0 42120 1 0 42121 1 0 44122 1 6 46123 1 0 46124 1 0 46125 1 0 47126 1 0 47127 1 0 47128 1 0 48129 1 0 48130 1 0 49131 1 0 49132 1 0 51133 1 6 52134 1 0 52135 1 0 53136 1 0 56137 1 0 56138 1 0 56139 1 0 57140 1 0 57141 1 0 58142 1 0 58143 1 0 60144 1 1 61145 1 0 61146 1 0 63147 1 0 63148 1 0 63149 1 0 64150 1 0 64151 1 0 64152 1 0 65153 1 0 65154 1 0 66155 1 1 71156 1 0 72157 1 0 72158 1 0 72159 1 0 73160 1 0 73161 1 0 73162 1 0 74163 1 0 74164 1 0 75165 1 0 76166 1 0 76167 1 0 76168 1 0 77169 1 0 77170 1 0 77171 1 0 78172 1 1 79173 1 6 80174 1 1 81175 1 0 82176 1 0 83177 1 0 M END

Standard InCHIKey	HHQFCVJVCYKWPA-MUZMSYBLSA-N
Standard InCHI	InChI=1S/C59H94O24/c1-11-25(2)49(74)78-34-21-54(4,5)20-28-27-12-13-32-56(8)16-15-33(55(6,7)31(56)14-17-58(32,10)57(27,9)18-19-59(28,34)24-62)79-53-47(83-51-41(69)38(66)36(64)29(22-60)76-51)45(43(71)46(82-53)48(72)73)81-52-42(70)39(67)44(30(23-61)77-52)80-50-40(68)37(65)35(63)26(3)75-50/h11-12,26,28-47,50-53,60-71H,13-24H2,1-10H3,(H,72,73)/b25-11-/t26-,28-,29+,30+,31-,32+,33-,34-,35-,36+,37+,38-,39+,40+,41+,42+,43-,44-,45-,46-,47+,50-,51-,52-,53+,56-,57+,58+,59-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2O[C@H](CO)[C@@H]([C@@H]([C@H]2O)O)O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@@H]2OC(=O)/C(=CC)/C)CO)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1186.61	Volume:	1152.431 ? Van der Waals volume.
Dense:	1.03	LogP:	1.156 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.14 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.348 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	53.0
TPSA:	380.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	13.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.047	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.164	Fsp³:	0.898
MCE-18:	200.857 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.919	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.266	Promiscuous compounds:	0.212

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.272	MDCK Permeability:	-5.102
Pgp-inhibitor:	0.0	Pgp-substrate:	0.653
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.976
20% Bioavailability (F20%):	0.933	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.814
Plasma Protein Binding (PPB):	67.535%	Volume Distribution (VD):	-0.421
Fu:	18.818% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.919	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.032	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.657
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.43

Half-life (T1/2):

3.31

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.487	Drug-induced Liver Injury (DILI):	0.896
AMES Toxicity:	0.96	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.034	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.727	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.24	RPMI-8226 Immunitoxicity:	0.117
A549 Cytotoxicity:	0.793	Hek293 Cytotoxicity:	0.243
BCF:	0.349 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.475 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.313 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.109 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32654	schima noronhae	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18351742]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	3800.0	nM	PubChem BioAssay data set

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC47995 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22482
0.1-0.2	23340
0.2-0.3	2857
0.3-0.4	668
0.4-0.5	332
0.5-0.6	136
0.6-0.7	25
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.823	Intermediate Similarity	NPC473918
0.7479	Intermediate Similarity	NPC484061
0.7479	Intermediate Similarity	NPC484062
0.7295	Intermediate Similarity	NPC484059
0.7295	Intermediate Similarity	NPC484060
0.7167	Intermediate Similarity	NPC277212
0.7167	Intermediate Similarity	NPC30279
0.7034	Intermediate Similarity	NPC609119
0.6949	Remote Similarity	NPC25998
0.6855	Remote Similarity	NPC265841
0.6842	Remote Similarity	NPC475591
0.6842	Remote Similarity	NPC236870
0.6723	Remote Similarity	NPC605294
0.6639	Remote Similarity	NPC329976
0.656	Remote Similarity	NPC71391
0.656	Remote Similarity	NPC329828
0.6532	Remote Similarity	NPC602995
0.65	Remote Similarity	NPC187290
0.648	Remote Similarity	NPC46823
0.6466	Remote Similarity	NPC44716
0.6379	Remote Similarity	NPC605226
0.6348	Remote Similarity	NPC22956
0.6288	Remote Similarity	NPC484063
0.6288	Remote Similarity	NPC484064
0.6279	Remote Similarity	NPC258617
0.6231	Remote Similarity	NPC476779
0.6167	Remote Similarity	NPC302887
0.6154	Remote Similarity	NPC271610
0.6154	Remote Similarity	NPC225791
0.6136	Remote Similarity	NPC302543
0.6121	Remote Similarity	NPC603026
0.6047	Remote Similarity	NPC181066
0.6016	Remote Similarity	NPC160452
0.5923	Remote Similarity	NPC192765
0.5891	Remote Similarity	NPC283417
0.5891	Remote Similarity	NPC200049
0.5887	Remote Similarity	NPC187618
0.5878	Remote Similarity	NPC178264
0.5854	Remote Similarity	NPC114484
0.5833	Remote Similarity	NPC476774
0.5814	Remote Similarity	NPC135904
0.5785	Remote Similarity	NPC46665
0.5781	Remote Similarity	NPC478155
0.5781	Remote Similarity	NPC478154
0.5714	Remote Similarity	NPC469947
0.5714	Remote Similarity	NPC488308
0.5714	Remote Similarity	NPC480948
0.5714	Remote Similarity	NPC476780
0.5703	Remote Similarity	NPC475287
0.568	Remote Similarity	NPC23275
0.568	Remote Similarity	NPC477076
0.5672	Remote Similarity	NPC312650
0.5669	Remote Similarity	NPC480939
0.5656	Remote Similarity	NPC251768
0.5625	Remote Similarity	NPC470475
0.562	Remote Similarity	NPC192791
0.562	Remote Similarity	NPC476775
0.56	Remote Similarity	NPC114692
0.5594	Remote Similarity	NPC475368
0.5588	Remote Similarity	NPC476777
0.5581	Remote Similarity	NPC60557
0.5581	Remote Similarity	NPC313110
0.5581	Remote Similarity	NPC67857
0.5573	Remote Similarity	NPC251263
0.5565	Remote Similarity	NPC470478
0.5565	Remote Similarity	NPC131469
0.5556	Remote Similarity	NPC477079
0.5537	Remote Similarity	NPC263756
0.5537	Remote Similarity	NPC213674
0.553	Remote Similarity	NPC100639
0.5528	Remote Similarity	NPC159309
0.5528	Remote Similarity	NPC86222
0.5522	Remote Similarity	NPC21691
0.552	Remote Similarity	NPC95437
0.5512	Remote Similarity	NPC477077
0.5504	Remote Similarity	NPC478152
0.5504	Remote Similarity	NPC478151
0.5492	Remote Similarity	NPC112352
0.5476	Remote Similarity	NPC281148
0.5474	Remote Similarity	NPC305981
0.5468	Remote Similarity	NPC488309
0.5455	Remote Similarity	NPC157868
0.5435	Remote Similarity	NPC261506
0.5435	Remote Similarity	NPC4328
0.5433	Remote Similarity	NPC301449
0.5433	Remote Similarity	NPC477075
0.5433	Remote Similarity	NPC601290
0.5429	Remote Similarity	NPC476778
0.5426	Remote Similarity	NPC470915
0.5407	Remote Similarity	NPC470518
0.5407	Remote Similarity	NPC57484
0.5403	Remote Similarity	NPC40775
0.5397	Remote Similarity	NPC64715
0.5391	Remote Similarity	NPC295823
0.5391	Remote Similarity	NPC174720
0.5391	Remote Similarity	NPC475467
0.539	Remote Similarity	NPC476776
0.5372	Remote Similarity	NPC109079
0.5338	Remote Similarity	NPC470476
0.5338	Remote Similarity	NPC478150
0.5328	Remote Similarity	NPC41061
0.5328	Remote Similarity	NPC227551
0.5299	Remote Similarity	NPC475160
0.5299	Remote Similarity	NPC264566
0.5299	Remote Similarity	NPC473714
0.529	Remote Similarity	NPC43550
0.529	Remote Similarity	NPC484833
0.5289	Remote Similarity	NPC235405
0.5285	Remote Similarity	NPC161674
0.5285	Remote Similarity	NPC76497
0.528	Remote Similarity	NPC10607
0.5276	Remote Similarity	NPC79718
0.5271	Remote Similarity	NPC120116
0.5263	Remote Similarity	NPC284449
0.5263	Remote Similarity	NPC165204
0.5259	Remote Similarity	NPC54636
0.5255	Remote Similarity	NPC286457
0.5248	Remote Similarity	NPC220160
0.5246	Remote Similarity	NPC249848
0.5246	Remote Similarity	NPC107966
0.5238	Remote Similarity	NPC148417
0.5238	Remote Similarity	NPC68175
0.5234	Remote Similarity	NPC236657
0.5227	Remote Similarity	NPC76972
0.5227	Remote Similarity	NPC469782
0.5227	Remote Similarity	NPC204414
0.5211	Remote Similarity	NPC250247
0.5203	Remote Similarity	NPC472949
0.52	Remote Similarity	NPC273962
0.5194	Remote Similarity	NPC218954
0.5182	Remote Similarity	NPC476068
0.518	Remote Similarity	NPC161717
0.5164	Remote Similarity	NPC25605
0.5159	Remote Similarity	NPC164389
0.5152	Remote Similarity	NPC472267
0.5152	Remote Similarity	NPC115656
0.5149	Remote Similarity	NPC133818
0.5149	Remote Similarity	NPC470911
0.5143	Remote Similarity	NPC110700
0.5143	Remote Similarity	NPC236638
0.5143	Remote Similarity	NPC294453
0.5122	Remote Similarity	NPC127056
0.512	Remote Similarity	NPC179429
0.5111	Remote Similarity	NPC155410
0.5109	Remote Similarity	NPC4749
0.5109	Remote Similarity	NPC481080
0.5108	Remote Similarity	NPC470876
0.5106	Remote Similarity	NPC298034
0.5106	Remote Similarity	NPC71065
0.5081	Remote Similarity	NPC473884
0.5079	Remote Similarity	NPC117714
0.5079	Remote Similarity	NPC30289
0.5078	Remote Similarity	NPC257468
0.5076	Remote Similarity	NPC11242
0.5076	Remote Similarity	NPC62725
0.5075	Remote Similarity	NPC123522
0.5074	Remote Similarity	NPC269484
0.5074	Remote Similarity	NPC470218
0.5074	Remote Similarity	NPC97918
0.5071	Remote Similarity	NPC478153
0.5041	Remote Similarity	NPC56713
0.5039	Remote Similarity	NPC2370
0.5038	Remote Similarity	NPC107536
0.5038	Remote Similarity	NPC241909
0.5038	Remote Similarity	NPC80986
0.5038	Remote Similarity	NPC280029
0.5038	Remote Similarity	NPC9470
0.5038	Remote Similarity	NPC477078
0.5036	Remote Similarity	NPC488560

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC47995 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7065
0.1-0.2	2022
0.2-0.3	58
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data