NPASS Compound

Natural Product: NPC329828

Natural Product ID	NPC329828
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YCRVDLCWSSFGLY-VCUUFROFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	46883105
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 168176 0 0 0 0 0 0 0 0999 V2000 11.4284 -3.4353 -1.5016 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0829 -2.5185 -2.6154 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9824 -1.8018 -2.6482 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7196 -0.9097 -3.8043 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0297 -1.8710 -1.5836 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2358 -2.6256 -0.6016 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8335 -1.1433 -1.5291 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9265 -1.2321 -0.4730 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9046 0.0368 0.3629 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2623 -0.3690 1.6601 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0790 0.9255 2.4654 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2648 -1.2003 2.4434 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9673 -1.0717 1.5583 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6128 -1.7795 0.3113 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2734 -1.4835 -0.2464 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3690 -2.4095 -0.1158 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9653 -2.3589 -0.5854 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6288 -0.8645 -0.4754 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8447 -0.6834 -0.4374 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6081 -1.5804 -1.3756 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3124 -1.1089 0.9639 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8211 0.0157 1.7768 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9400 0.8247 1.1303 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5357 1.2176 -0.2477 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4228 2.7687 -0.1992 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5617 0.9059 -1.2762 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1599 0.7568 -0.5408 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4956 1.3897 -1.7549 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0104 1.2832 -1.4931 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4863 -0.1526 -1.4216 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4995 -0.6675 -2.8335 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9197 -0.2263 -0.9311 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1140 1.0149 -0.0779 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9714 -0.0766 -2.0100 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9857 -1.1576 -2.1004 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5590 -1.7310 -0.8509 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8755 -3.1967 -1.2964 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7544 -3.2180 -2.3514 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0620 -0.6407 -2.8716 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1256 0.1285 1.1238 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0478 0.5784 2.0372 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3876 0.7065 1.4095 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4644 0.1325 2.3502 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1375 0.5149 3.7789 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7865 0.0350 4.1695 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9726 -1.1582 5.0701 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5255 -2.2977 4.7902 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6623 -1.0353 6.2696 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0945 -0.3939 3.0782 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2420 1.9133 3.8608 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3631 -1.2446 2.2642 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5218 -1.9015 1.9466 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3235 -2.6276 0.6321 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8219 -4.0163 0.9208 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5757 -3.8461 2.2128 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9719 -3.3227 1.9716 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5218 -3.0532 3.2388 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8298 -2.8886 2.8823 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7947 -4.9494 1.0354 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1258 -2.0902 -0.3746 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6731 2.0432 1.1763 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0868 2.3379 -0.0939 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5092 2.8735 0.0049 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5243 4.3841 -0.2392 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8193 4.7517 -1.5296 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8443 3.6576 -1.8624 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8122 4.0682 -2.8739 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0319 5.1349 -2.4919 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2374 3.2851 -0.6540 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7507 4.9055 -2.5566 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0100 5.0054 0.8697 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3562 2.3103 -0.9501 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2923 0.2637 0.6875 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9304 1.4322 0.3096 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2437 2.2668 -0.3273 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3364 1.7508 0.6014 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0770 0.6947 1.4279 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1234 2.7716 -0.0204 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6422 3.4638 -1.2691 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5653 3.0670 1.1976 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5296 -2.8672 -0.5303 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7334 -4.2709 -1.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4357 -3.8713 -1.6572 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7894 -2.4490 -3.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7871 0.1374 -3.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5582 -0.9835 -4.5137 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7337 -1.0738 -4.2641 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3635 -1.9964 0.2444 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4789 0.8797 -0.1594 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8616 1.7520 1.7595 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2488 0.7877 3.1762 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0345 1.1737 2.9572 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3032 -1.0218 2.1641 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9754 -2.2854 2.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1412 -0.9697 3.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9433 -1.7351 2.4936 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1236 -0.3707 1.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6449 -2.8664 0.6396 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6299 -3.3590 0.4010 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8161 -2.7360 -1.6096 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2847 -2.9490 0.0699 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9729 -0.5559 0.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6791 -1.7096 -1.0301 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1900 -2.6058 -1.2531 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6770 -1.2526 -2.4042 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0823 -1.8936 0.9379 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4626 -1.5535 1.5503 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2365 -0.4617 2.7179 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0732 0.7292 2.1703 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0842 1.6715 1.8526 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7113 3.2042 -1.1759 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1334 3.1709 0.5528 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4081 3.0728 0.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3380 0.1824 -0.9469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1743 0.5462 -2.2494 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1340 1.8280 -1.5304 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5363 1.2292 0.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8212 1.0266 -2.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7184 2.4705 -1.6917 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0586 1.6853 -0.4259 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4875 1.9089 -2.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5405 -1.1292 -3.1589 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2444 -1.4678 -3.0010 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6212 0.2010 -3.5095 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2115 1.2001 0.1254 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9228 1.8622 -0.7812 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4937 1.1201 0.7825 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5579 0.0569 -3.0303 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5758 0.8778 -1.8934 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5653 -1.9378 -2.8104 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9215 -3.6656 -1.6296 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1951 -3.7515 -0.4009 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2896 -4.0461 -2.3582 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7308 0.0679 -3.4804 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6480 1.4684 2.5461 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4779 0.1541 0.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4662 0.4479 2.1206 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9081 0.1141 4.4588 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2388 0.7820 4.7867 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3113 -1.7625 6.5879 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1333 2.2010 4.1869 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3364 -1.1746 1.8168 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2666 -2.6134 0.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5405 -4.3512 0.1634 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6106 -4.7557 2.8296 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5363 -4.1130 1.4354 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9180 -2.3723 1.3905 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4440 -3.3747 3.2686 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0326 -5.7542 0.5317 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5373 -2.7762 -0.9600 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1374 1.4755 -0.7879 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9280 2.7310 1.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6089 4.6283 -0.3687 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2378 5.6784 -1.3375 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3540 2.7529 -2.2736 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3941 4.4019 -3.7824 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1915 3.2205 -3.2017 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9263 5.8106 -3.2248 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6263 5.0927 -2.1271 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0530 4.8014 0.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2733 2.2670 -0.5656 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0674 1.0895 1.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1251 -0.2569 0.8695 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4881 0.4854 2.3557 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2444 2.6099 -0.0285 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9696 2.7316 -1.8043 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4919 3.7528 -1.9445 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0430 4.3242 -0.9808 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 32 33 1 1 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 6 37 38 1 0 35 39 1 0 23 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 45 49 1 0 44 50 1 0 43 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 54 59 1 0 53 60 1 0 42 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 65 70 1 0 64 71 1 0 63 72 1 0 9 73 1 0 73 74 1 0 74 75 2 0 74 76 1 0 76 77 1 1 76 78 1 0 78 79 1 0 78 80 1 0 36 8 1 0 49 41 1 0 58 52 1 0 69 62 1 0 80 76 1 0 36 14 1 0 32 15 1 0 30 18 1 0 27 19 1 0 1 81 1 0 1 82 1 0 1 83 1 0 2 84 1 0 4 85 1 0 4 86 1 0 4 87 1 0 8 88 1 1 9 89 1 6 11 90 1 0 11 91 1 0 11 92 1 0 12 93 1 0 12 94 1 0 12 95 1 0 13 96 1 0 13 97 1 0 14 98 1 1 16 99 1 0 17100 1 0 17101 1 0 18102 1 1 20103 1 0 20104 1 0 20105 1 0 21106 1 0 21107 1 0 22108 1 0 22109 1 0 23110 1 1 25111 1 0 25112 1 0 25113 1 0 26114 1 0 26115 1 0 26116 1 0 27117 1 1 28118 1 0 28119 1 0 29120 1 0 29121 1 0 31122 1 0 31123 1 0 31124 1 0 33125 1 0 33126 1 0 33127 1 0 34128 1 0 34129 1 0 35130 1 6 37131 1 0 37132 1 0 38133 1 0 39134 1 0 41135 1 1 42136 1 6 43137 1 6 44138 1 1 45139 1 1 48140 1 0 50141 1 0 52142 1 6 53143 1 6 54144 1 6 55145 1 1 56146 1 0 56147 1 0 57148 1 0 59149 1 0 60150 1 0 62151 1 6 63152 1 1 64153 1 6 65154 1 1 66155 1 6 67156 1 0 67157 1 0 68158 1 0 70159 1 0 71160 1 0 72161 1 0 77162 1 0 77163 1 0 77164 1 0 78165 1 1 79166 1 0 79167 1 0 79168 1 0 M END

Standard InCHIKey	YCRVDLCWSSFGLY-VCUUFROFSA-N
Standard InCHI	InChI=1S/C57H88O23/c1-12-24(2)46(70)78-44-43(79-50(71)56(11)25(3)80-56)51(4,5)19-27-26-13-14-31-53(8)17-16-33(52(6,7)30(53)15-18-54(31,9)55(26,10)20-32(61)57(27,44)23-60)74-49-42(77-48-38(66)36(64)34(62)28(21-58)72-48)40(39(67)41(76-49)45(68)69)75-47-37(65)35(63)29(22-59)73-47/h12-13,25,27-44,47-49,58-67H,14-23H2,1-11H3,(H,68,69)/b24-12-/t25-,27+,28-,29+,30+,31-,32-,33+,34-,35+,36+,37-,38-,39+,40+,41+,42-,43+,44+,47+,48+,49-,53+,54-,55-,56-,57+/m1/s1
SMILES	C/C=C(/C)C(=O)O[C@H]1[C@@H](C(C)(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H]([C@@]12CO)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O[C@H]1[C@@H]([C@H]([C@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)[C@@]1(C)[C@@H](C)O1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1140.57	Volume:	1106.412 ? Van der Waals volume.
Dense:	1.031	LogP:	1.654 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.365 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.85 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	50.0
TPSA:	360.11 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	11.0	Rings:	9.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.037	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.081	Fsp³:	0.877
MCE-18:	200.467 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.867	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.23	Promiscuous compounds:	0.175

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.415	MDCK Permeability:	-5.104
Pgp-inhibitor:	0.0	Pgp-substrate:	0.932
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.985
20% Bioavailability (F20%):	0.999	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.92
Plasma Protein Binding (PPB):	69.834%	Volume Distribution (VD):	-0.514
Fu:	21.155% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.598	BCRP inhibitor:	0.0
BSEP inhibitor:	0.052

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.007
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.917	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.152
HLM stability:	0.05 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.127

Half-life (T1/2):

3.149

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.002
Human Hepatotoxicity (H-HT):	0.44	Drug-induced Liver Injury (DILI):	0.947
AMES Toxicity:	0.898	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.059	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.57	Drug-induced Nephrotoxicity:	0.982
Genotoxicity:	0.803	RPMI-8226 Immunitoxicity:	0.097
A549 Cytotoxicity:	0.176	Hek293 Cytotoxicity:	0.081
BCF:	0.273 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.486 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.53 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.343 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19719093]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22512738]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT179	Cell line	A2780	Homo sapiens	IC50	=	700.0	nM	PMID[19719093]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC329828 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22166
0.1-0.2	23632
0.2-0.3	3061
0.3-0.4	595
0.4-0.5	270
0.5-0.6	71
0.6-0.7	41
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9327	High Similarity	NPC25998
0.8559	High Similarity	NPC602995
0.8034	Intermediate Similarity	NPC271610
0.7928	Intermediate Similarity	NPC329976
0.7876	Intermediate Similarity	NPC609119
0.7807	Intermediate Similarity	NPC478155
0.7807	Intermediate Similarity	NPC478154
0.75	Intermediate Similarity	NPC476780
0.7355	Intermediate Similarity	NPC488308
0.7317	Intermediate Similarity	NPC476777
0.7295	Intermediate Similarity	NPC312650
0.7073	Intermediate Similarity	NPC265841
0.7054	Intermediate Similarity	NPC605226
0.7008	Intermediate Similarity	NPC488309
0.6992	Remote Similarity	NPC470518
0.6967	Remote Similarity	NPC46823
0.696	Remote Similarity	NPC484059
0.696	Remote Similarity	NPC484060
0.6949	Remote Similarity	NPC605294
0.6911	Remote Similarity	NPC192765
0.6855	Remote Similarity	NPC178264
0.675	Remote Similarity	NPC107536
0.675	Remote Similarity	NPC280029
0.675	Remote Similarity	NPC9470
0.6696	Remote Similarity	NPC44716
0.6641	Remote Similarity	NPC110700
0.6639	Remote Similarity	NPC477193
0.6612	Remote Similarity	NPC478152
0.6612	Remote Similarity	NPC478151
0.656	Remote Similarity	NPC47995
0.6508	Remote Similarity	NPC82380
0.6508	Remote Similarity	NPC244296
0.6434	Remote Similarity	NPC476779
0.6429	Remote Similarity	NPC473918
0.6406	Remote Similarity	NPC476774
0.64	Remote Similarity	NPC478150
0.6387	Remote Similarity	NPC302887
0.6328	Remote Similarity	NPC484061
0.6328	Remote Similarity	NPC484062
0.6308	Remote Similarity	NPC484833
0.623	Remote Similarity	NPC160452
0.6218	Remote Similarity	NPC475591
0.6218	Remote Similarity	NPC236870
0.6207	Remote Similarity	NPC603026
0.6172	Remote Similarity	NPC277212
0.6172	Remote Similarity	NPC30279
0.6165	Remote Similarity	NPC476775
0.6148	Remote Similarity	NPC477191
0.6124	Remote Similarity	NPC71391
0.6119	Remote Similarity	NPC484063
0.6119	Remote Similarity	NPC484064
0.6094	Remote Similarity	NPC283417
0.6094	Remote Similarity	NPC200049
0.6017	Remote Similarity	NPC22956
0.6	Remote Similarity	NPC477195
0.5968	Remote Similarity	NPC477077
0.5956	Remote Similarity	NPC476778
0.5952	Remote Similarity	NPC477196
0.592	Remote Similarity	NPC187290
0.5912	Remote Similarity	NPC476776
0.5878	Remote Similarity	NPC478597
0.5852	Remote Similarity	NPC302543
0.5806	Remote Similarity	NPC470914
0.5789	Remote Similarity	NPC478596
0.5703	Remote Similarity	NPC472267
0.5703	Remote Similarity	NPC115656
0.5692	Remote Similarity	NPC284449
0.5645	Remote Similarity	NPC470913
0.5635	Remote Similarity	NPC23275
0.563	Remote Similarity	NPC262796
0.563	Remote Similarity	NPC45346
0.56	Remote Similarity	NPC64715
0.56	Remote Similarity	NPC603832
0.5547	Remote Similarity	NPC475377
0.5547	Remote Similarity	NPC476074
0.5547	Remote Similarity	NPC477194
0.5448	Remote Similarity	NPC252289
0.5448	Remote Similarity	NPC305793
0.5426	Remote Similarity	NPC469947
0.5426	Remote Similarity	NPC480948
0.5407	Remote Similarity	NPC181066
0.5407	Remote Similarity	NPC329923
0.5407	Remote Similarity	NPC475281
0.5401	Remote Similarity	NPC225791
0.5396	Remote Similarity	NPC11577
0.5396	Remote Similarity	NPC141600
0.539	Remote Similarity	NPC279915
0.5385	Remote Similarity	NPC480939
0.5362	Remote Similarity	NPC478153
0.5349	Remote Similarity	NPC477078
0.5344	Remote Similarity	NPC470475
0.5319	Remote Similarity	NPC329960
0.5312	Remote Similarity	NPC281148
0.5303	Remote Similarity	NPC252657
0.5303	Remote Similarity	NPC88311
0.528	Remote Similarity	NPC117714
0.528	Remote Similarity	NPC30289
0.5273	Remote Similarity	NPC473160
0.5271	Remote Similarity	NPC477076
0.5267	Remote Similarity	NPC11242
0.5259	Remote Similarity	NPC269484
0.5259	Remote Similarity	NPC97918
0.5255	Remote Similarity	NPC21691
0.5241	Remote Similarity	NPC150893
0.5238	Remote Similarity	NPC2370
0.5214	Remote Similarity	NPC329657
0.5182	Remote Similarity	NPC4749
0.5149	Remote Similarity	NPC478600
0.5149	Remote Similarity	NPC478599
0.5147	Remote Similarity	NPC264566
0.5118	Remote Similarity	NPC251768
0.5115	Remote Similarity	NPC477192
0.5098	Remote Similarity	NPC477470
0.5098	Remote Similarity	NPC477472
0.5081	Remote Similarity	NPC109079
0.5079	Remote Similarity	NPC192791
0.5074	Remote Similarity	NPC470476
0.5072	Remote Similarity	NPC475167
0.5071	Remote Similarity	NPC329993
0.5039	Remote Similarity	NPC470478
0.5039	Remote Similarity	NPC611191
0.5038	Remote Similarity	NPC477197
0.5037	Remote Similarity	NPC1314
0.5037	Remote Similarity	NPC273878
0.5036	Remote Similarity	NPC134914
0.5033	Remote Similarity	NPC477467

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC329828 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7033
0.1-0.2	2061
0.2-0.3	52
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data