NPASS Compound

Natural Product: NPC329976

Natural Product ID	NPC329976
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IKGKAFZGBWHFKI-OHYFOYNPSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	46883104
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 168175 0 0 0 0 0 0 0 0999 V2000 11.0556 1.2846 -4.2614 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7035 1.5130 -2.9500 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0487 1.5180 -1.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7742 1.7548 -0.5298 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6288 1.2890 -1.7770 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9591 1.0771 -2.8162 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9520 1.2986 -0.5589 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5594 1.0786 -0.4828 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3536 -0.1134 0.4210 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9340 -0.3232 0.8548 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0084 -1.1296 2.1550 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6638 -2.3366 1.8280 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2048 0.9440 1.1026 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4095 2.0262 0.0867 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8979 2.3157 0.0338 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4547 2.8100 1.3400 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0869 3.4161 -1.0064 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7427 0.6778 1.3356 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1493 1.4077 2.2912 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7197 1.2919 2.6690 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0095 0.5881 1.5338 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4723 0.5344 1.6698 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9489 0.3747 3.0853 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9639 1.9308 1.2450 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4293 2.0084 1.1668 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1230 0.9130 0.3894 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5181 -0.4181 0.5173 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2381 -1.2209 1.5654 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7729 -1.1482 -0.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0286 -0.4209 0.6962 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4803 -1.7818 0.9431 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9838 -1.7196 0.4988 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7457 -0.6880 1.2833 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1583 -1.3648 2.5818 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0043 -0.3366 0.5205 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6421 0.4121 -0.7747 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8312 -1.5265 0.1434 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2624 -1.2149 -0.1491 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3941 -0.7964 -1.4522 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3077 -2.0708 -1.0603 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4614 1.0374 0.7476 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2532 1.4944 -0.2667 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5422 0.7289 -0.3537 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0598 0.9053 -1.7300 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6657 2.3161 -2.1931 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3858 3.2849 -1.1141 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6073 4.0426 -0.6762 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3546 4.5009 -1.5820 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9377 4.2530 0.6446 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6558 2.8399 -0.0365 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6306 2.3003 -3.1149 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4383 0.7593 -1.8918 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6817 -0.0875 -2.9711 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6525 -1.1464 -2.6367 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8351 -0.8486 -3.5634 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1385 -0.1309 -4.6900 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5279 -1.1304 -5.6500 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7979 -0.5116 -6.6492 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2294 0.6583 -4.0399 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6430 0.0687 -2.8987 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1879 -2.4351 -2.8614 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3625 -0.5382 0.1321 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1035 -0.7816 1.2563 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8691 -2.0445 1.3161 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9605 -1.8263 2.3791 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3162 -1.3815 3.6779 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1780 -0.4340 3.4788 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4400 -0.2655 4.7894 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3878 0.0683 5.7597 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3156 -0.7657 2.4416 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3191 -0.6564 4.3652 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7585 -2.9234 2.5601 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4333 -2.3487 0.1089 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9201 -1.2281 -0.1928 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0635 -1.8606 0.3400 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5544 -1.3818 1.3893 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6447 -3.0176 -0.3043 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7107 -3.6175 0.1849 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3906 -3.1598 1.4199 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0331 -3.5478 -1.5407 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8510 1.3765 -5.0438 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5711 0.2923 -4.2881 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2820 2.0527 -4.4516 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7751 1.6912 -2.8831 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0436 2.1386 0.2069 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1470 0.7925 -0.1102 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5833 2.5061 -0.6404 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1897 0.9125 -1.5115 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9560 0.1202 1.3463 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0393 -1.3133 2.6126 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6909 -0.5838 2.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0230 -3.0929 1.7482 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6417 1.3609 2.0643 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9276 2.9489 0.4876 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1036 1.7878 -0.9352 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8674 3.6454 1.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6196 2.0002 2.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4679 3.2256 1.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5887 4.3394 -0.5900 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4618 3.1383 -1.8849 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1353 3.5815 -1.2473 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7376 2.1390 2.8350 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3092 2.3122 2.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5989 0.7949 3.6530 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2165 1.2519 0.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9525 -0.6414 3.4632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3386 1.0541 3.7365 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9651 0.7699 3.1581 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5511 2.0559 0.2156 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6004 2.7082 1.9319 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9445 2.1882 2.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6673 2.9746 0.6172 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0949 1.2461 -0.6977 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6146 -2.0450 1.9743 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6513 -0.6206 2.3960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1295 -1.7620 1.1266 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5115 -1.9671 -0.7056 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0707 -0.4279 -1.6177 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8555 -1.6396 -1.2016 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6246 -0.1041 -0.3167 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4589 -2.0864 1.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9384 -2.5872 0.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3963 -2.7225 0.7334 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9746 -1.5995 -0.5779 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2360 -1.5699 3.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6213 -2.3516 2.4387 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8090 -0.7810 3.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2438 0.0286 -1.6408 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7466 1.5101 -0.6654 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5957 0.2483 -1.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8111 -2.3671 0.8486 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8265 -2.1941 -0.0950 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7488 -1.4640 -2.0854 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9951 -2.7078 -1.4094 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7250 1.5453 -1.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2905 1.2332 0.3758 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5389 0.2416 -2.4386 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5797 2.7200 -2.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7425 4.0956 -1.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3611 5.1355 0.9533 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9663 2.4294 -4.0418 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7531 -0.5160 -3.4088 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0420 -1.1002 -1.5991 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3481 -1.7587 -3.8714 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8426 0.5145 -5.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3248 -1.7283 -6.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8841 -1.8565 -5.1117 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8407 -0.4707 -6.4255 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2639 0.9844 -3.0528 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7999 -3.0716 -2.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7940 0.0956 1.4395 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2057 -2.8881 1.6400 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5436 -0.9550 2.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0709 -2.2392 4.3066 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6182 0.5651 3.1923 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8921 -1.1879 5.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7582 0.6009 4.7066 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5246 1.0636 5.7782 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4597 0.1880 3.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0082 -3.3144 1.6814 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0649 -3.1481 -0.3457 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1260 -4.4947 -0.3292 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6714 -3.1908 2.2802 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7437 -2.1247 1.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2558 -3.8444 1.6259 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9400 -3.3427 -1.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5662 -3.1430 -2.4498 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2199 -4.6446 -1.5679 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 13 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 27 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 1 33 35 1 0 35 36 1 6 35 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 26 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 46 50 1 0 45 51 1 0 44 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 43 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 66 71 1 0 65 72 1 0 64 73 1 0 9 74 1 0 74 75 1 0 75 76 2 0 75 77 1 0 77 78 2 0 78 79 1 0 77 80 1 0 15 8 1 0 35 18 1 0 50 42 1 0 59 53 1 0 70 63 1 0 38 10 1 0 33 21 1 0 30 22 1 0 1 81 1 0 1 82 1 0 1 83 1 0 2 84 1 0 4 85 1 0 4 86 1 0 4 87 1 0 8 88 1 6 9 89 1 1 11 90 1 0 11 91 1 0 12 92 1 0 13 93 1 1 14 94 1 0 14 95 1 0 16 96 1 0 16 97 1 0 16 98 1 0 17 99 1 0 17100 1 0 17101 1 0 19102 1 0 20103 1 0 20104 1 0 21105 1 6 23106 1 0 23107 1 0 23108 1 0 24109 1 0 24110 1 0 25111 1 0 25112 1 0 26113 1 6 28114 1 0 28115 1 0 28116 1 0 29117 1 0 29118 1 0 29119 1 0 30120 1 6 31121 1 0 31122 1 0 32123 1 0 32124 1 0 34125 1 0 34126 1 0 34127 1 0 36128 1 0 36129 1 0 36130 1 0 37131 1 1 38132 1 6 39133 1 0 40134 1 0 42135 1 6 43136 1 1 44137 1 6 45138 1 6 46139 1 6 49140 1 0 51141 1 0 53142 1 6 54143 1 1 55144 1 6 56145 1 6 57146 1 0 57147 1 0 58148 1 0 60149 1 0 61150 1 0 63151 1 1 64152 1 1 65153 1 6 66154 1 1 67155 1 6 68156 1 0 68157 1 0 69158 1 0 71159 1 0 72160 1 0 73161 1 0 78162 1 0 79163 1 0 79164 1 0 79165 1 0 80166 1 0 80167 1 0 80168 1 0 M END

Standard InCHIKey	IKGKAFZGBWHFKI-OHYFOYNPSA-N
Standard InCHI	InChI=1S/C57H88O23/c1-12-24(3)47(71)79-44-45(80-48(72)25(4)13-2)57(23-60)27(20-52(44,5)6)26-14-15-31-54(9)18-17-32(53(7,8)30(54)16-19-55(31,10)56(26,11)42(67)43(57)68)75-51-41(78-50-37(65)35(63)33(61)28(21-58)73-50)39(38(66)40(77-51)46(69)70)76-49-36(64)34(62)29(22-59)74-49/h12-14,27-45,49-51,58-68H,15-23H2,1-11H3,(H,69,70)/b24-12-,25-13-/t27-,28+,29-,30-,31+,32-,33+,34-,35-,36+,37+,38-,39-,40-,41+,42-,43+,44-,45-,49-,50-,51+,54-,55+,56-,57-/m0/s1
SMILES	C/C=C(/C)C(=O)O[C@H]1[C@@H]([C@@]2(CO)[C@@H](CC1(C)C)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)[C@H]([C@H]2O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O[C@H]1[C@@H]([C@H]([C@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)/C(=CC)/C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1140.57	Volume:	1112.332 ? Van der Waals volume.
Dense:	1.025	LogP:	1.164 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.128 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.454 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	367.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.048	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.058	Fsp³:	0.842
MCE-18:	185.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.822	Fluc inhibitor:	0.012 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.0 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.243	Promiscuous compounds:	0.267

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.319	MDCK Permeability:	-5.165
Pgp-inhibitor:	0.0	Pgp-substrate:	0.055
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.319
20% Bioavailability (F20%):	0.947	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.964
Plasma Protein Binding (PPB):	76.309%	Volume Distribution (VD):	-0.487
Fu:	14.46% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.806	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.003
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.481	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.293
HLM stability:	0.011 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.104

Half-life (T1/2):

3.058

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.46	Drug-induced Liver Injury (DILI):	0.979
AMES Toxicity:	0.96	Rat Oral Acute Toxicity:	0.009
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.132	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.885	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.914	RPMI-8226 Immunitoxicity:	0.189
A549 Cytotoxicity:	0.947	Hek293 Cytotoxicity:	0.37
BCF:	0.305 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.439 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.503 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.193 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19719093]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22512738]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12477	Dodonaea viscosa	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT179	Cell line	A2780	Homo sapiens	IC50	=	790.0	nM	PMID[19719093]
NPT457	Cell line	BT-549	Homo sapiens	IC50	>	5000.0	nM	PMID[19719093]
NPT90	Cell line	DU-145	Homo sapiens	IC50	>	5000.0	nM	PMID[19719093]
NPT397	Cell line	NCI-H460	Homo sapiens	IC50	>	5000.0	nM	PMID[19719093]
NPT391	Cell line	HCC 2998	Homo sapiens	IC50	>	5000.0	nM	PMID[19719093]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC329976 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21499
0.1-0.2	23947
0.2-0.3	3381
0.3-0.4	650
0.4-0.5	246
0.5-0.6	59
0.6-0.7	44
0.7-0.8	0
0.8-0.85	4
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8679	High Similarity	NPC46823
0.8598	High Similarity	NPC192765
0.8519	High Similarity	NPC178264
0.8462	Intermediate Similarity	NPC25998
0.8365	Intermediate Similarity	NPC605294
0.8286	Intermediate Similarity	NPC478152
0.8286	Intermediate Similarity	NPC478151
0.7982	Intermediate Similarity	NPC478150
0.7928	Intermediate Similarity	NPC329828
0.7838	Intermediate Similarity	NPC473918
0.7807	Intermediate Similarity	NPC484833
0.7748	Intermediate Similarity	NPC602995
0.7549	Intermediate Similarity	NPC603026
0.7522	Intermediate Similarity	NPC277212
0.7522	Intermediate Similarity	NPC30279
0.75	Intermediate Similarity	NPC477077
0.7456	Intermediate Similarity	NPC71391
0.7387	Intermediate Similarity	NPC609119
0.7315	Intermediate Similarity	NPC470914
0.7265	Intermediate Similarity	NPC271610
0.713	Intermediate Similarity	NPC470913
0.7018	Intermediate Similarity	NPC478155
0.7018	Intermediate Similarity	NPC478154
0.6975	Remote Similarity	NPC262796
0.6975	Remote Similarity	NPC45346
0.686	Remote Similarity	NPC475377
0.686	Remote Similarity	NPC476074
0.675	Remote Similarity	NPC476780
0.6726	Remote Similarity	NPC477078
0.6723	Remote Similarity	NPC329923
0.6723	Remote Similarity	NPC475281
0.6639	Remote Similarity	NPC47995
0.6612	Remote Similarity	NPC488308
0.6585	Remote Similarity	NPC476777
0.656	Remote Similarity	NPC329960
0.6557	Remote Similarity	NPC225791
0.6557	Remote Similarity	NPC312650
0.6545	Remote Similarity	NPC605226
0.6504	Remote Similarity	NPC484059
0.6504	Remote Similarity	NPC484060
0.6491	Remote Similarity	NPC477076
0.6475	Remote Similarity	NPC265841
0.6452	Remote Similarity	NPC329657
0.6441	Remote Similarity	NPC478600
0.6441	Remote Similarity	NPC478599
0.6434	Remote Similarity	NPC150893
0.6393	Remote Similarity	NPC484061
0.6393	Remote Similarity	NPC484062
0.6325	Remote Similarity	NPC477197
0.6299	Remote Similarity	NPC488309
0.6283	Remote Similarity	NPC475591
0.6283	Remote Similarity	NPC236870
0.6281	Remote Similarity	NPC264566
0.626	Remote Similarity	NPC470518
0.624	Remote Similarity	NPC478153
0.6216	Remote Similarity	NPC22956
0.6195	Remote Similarity	NPC44716
0.6186	Remote Similarity	NPC606553
0.6179	Remote Similarity	NPC475167
0.6129	Remote Similarity	NPC134914
0.6129	Remote Similarity	NPC473755
0.6129	Remote Similarity	NPC478598
0.6032	Remote Similarity	NPC475513
0.6032	Remote Similarity	NPC329993
0.6	Remote Similarity	NPC107536
0.6	Remote Similarity	NPC280029
0.6	Remote Similarity	NPC9470
0.5966	Remote Similarity	NPC187290
0.5952	Remote Similarity	NPC476774
0.5938	Remote Similarity	NPC110700
0.5897	Remote Similarity	NPC302887
0.5891	Remote Similarity	NPC173435
0.5891	Remote Similarity	NPC172374
0.5891	Remote Similarity	NPC478064
0.5882	Remote Similarity	NPC477193
0.5859	Remote Similarity	NPC476779
0.584	Remote Similarity	NPC470912
0.5802	Remote Similarity	NPC295408
0.5798	Remote Similarity	NPC477075
0.5794	Remote Similarity	NPC82380
0.5794	Remote Similarity	NPC244296
0.575	Remote Similarity	NPC160452
0.5739	Remote Similarity	NPC478066
0.5725	Remote Similarity	NPC476775
0.5702	Remote Similarity	NPC469947
0.5702	Remote Similarity	NPC480948
0.5682	Remote Similarity	NPC484063
0.5682	Remote Similarity	NPC484064
0.5672	Remote Similarity	NPC69425
0.5669	Remote Similarity	NPC181066
0.5667	Remote Similarity	NPC477079
0.5656	Remote Similarity	NPC480939
0.5635	Remote Similarity	NPC283417
0.5635	Remote Similarity	NPC200049
0.561	Remote Similarity	NPC470475
0.5545	Remote Similarity	NPC475263
0.5537	Remote Similarity	NPC23275
0.5522	Remote Similarity	NPC476778
0.5481	Remote Similarity	NPC476776
0.5447	Remote Similarity	NPC477194
0.5426	Remote Similarity	NPC301639
0.5426	Remote Similarity	NPC478065
0.5417	Remote Similarity	NPC470478
0.5414	Remote Similarity	NPC302543
0.541	Remote Similarity	NPC477191
0.5323	Remote Similarity	NPC609281
0.5312	Remote Similarity	NPC470476
0.5308	Remote Similarity	NPC478597
0.528	Remote Similarity	NPC477195
0.5241	Remote Similarity	NPC477467
0.5238	Remote Similarity	NPC472267
0.5238	Remote Similarity	NPC115656
0.5238	Remote Similarity	NPC477196
0.5234	Remote Similarity	NPC284449
0.5214	Remote Similarity	NPC109079
0.5205	Remote Similarity	NPC477470
0.5205	Remote Similarity	NPC477472
0.5124	Remote Similarity	NPC251768
0.5122	Remote Similarity	NPC79718
0.5122	Remote Similarity	NPC64715
0.5122	Remote Similarity	NPC603832
0.5113	Remote Similarity	NPC478596
0.5083	Remote Similarity	NPC192791
0.5081	Remote Similarity	NPC281148
0.5068	Remote Similarity	NPC477474
0.5042	Remote Similarity	NPC472949

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC329976 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6795
0.1-0.2	2293
0.2-0.3	58
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data