NPASS Compound

Natural Product: NPC329960

Natural Product ID	NPC329960
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Symplocososide P
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bR)-10-benzoyloxy-7,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methylbutanoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-acetyloxy-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	symplocososide P
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL502899
PubChem CID	16099391
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 175183 0 0 0 0 0 0 0 0999 V2000 8.4815 1.3829 4.7928 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6742 0.1123 4.9308 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3597 -1.0092 4.2095 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7425 -1.3306 4.6896 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4065 -0.6538 2.7745 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4128 -0.1121 2.3058 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4187 -0.8700 1.8553 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4891 -0.5024 0.4904 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8486 -1.6520 -0.4064 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9656 -2.0514 -1.4973 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8452 -1.1330 -1.8664 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3310 -0.5434 -0.5800 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3468 0.3325 -0.0137 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8719 1.3201 1.0036 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4650 1.2878 1.4205 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4487 0.6759 0.5215 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0336 0.1684 -0.7383 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4574 0.3288 -1.9025 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1485 1.0314 -2.0900 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3982 0.9082 -0.7592 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2204 1.5616 0.3005 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5110 1.7533 1.5859 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1541 1.1321 1.6519 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7083 1.5386 0.4388 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0503 1.2044 -0.8593 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6711 -0.0964 -1.4230 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1304 0.0265 -1.6280 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8948 0.5903 -0.4627 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0621 0.9915 0.6854 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0687 -0.1653 1.6822 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8367 2.1072 1.4363 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8079 -0.3933 -0.1038 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0825 -0.1386 -0.0440 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8695 -1.5711 -0.6514 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2895 -0.7325 -1.2166 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2009 0.6877 -1.1146 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9479 1.3017 -1.6862 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9266 0.3598 -1.6389 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0664 1.7137 -3.0947 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7169 2.6101 -3.6007 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3009 0.9454 -4.0629 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2428 1.2576 -1.9039 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2109 1.8042 -1.0678 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2627 3.2986 -1.0369 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3742 3.6357 -1.9760 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1372 2.3529 -2.0335 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4632 1.3728 -1.3544 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4290 2.5741 -1.2158 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0305 2.9297 0.0776 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8846 3.9896 -3.2215 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1106 3.9611 -1.3450 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4788 -1.3198 -2.4662 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4682 -2.3096 -2.7228 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1657 -2.6190 -1.7664 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5303 -2.8372 -4.1090 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4254 -1.8825 0.4645 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3904 -1.3004 1.6586 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9488 -2.2593 2.7314 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0776 -3.2825 2.8969 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2107 -2.5055 3.4728 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5919 -1.3341 2.5692 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5891 -0.6902 2.0082 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7226 -1.8049 1.6637 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2297 -0.6503 1.0234 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3100 -3.3182 3.6506 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4958 -3.6833 1.5959 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8089 -2.9734 2.3292 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3985 2.2565 -1.8773 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6987 2.9391 -0.1638 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9921 -0.6090 1.2406 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3919 0.7261 2.7278 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2170 2.6487 0.6455 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9630 1.1745 -1.1529 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9995 1.9940 -0.6286 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7539 -2.2051 -2.8278 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3845 -3.4514 -1.3313 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1371 -1.4329 -0.9565 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2709 -2.1866 -0.6571 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1739 -3.1336 0.1490 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5541 -1.8840 -1.2735 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6872 -0.7725 -2.1065 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8862 -0.4995 -2.7535 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9552 -1.3305 -2.5726 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8486 -2.4446 -1.7475 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6287 -2.6721 -1.1261 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8932 2.1170 4.2031 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4560 1.1039 4.2930 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7448 1.8553 5.7513 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6903 0.2371 4.4048 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5169 -0.1636 5.9732 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7116 -1.9575 4.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7826 -1.4797 5.7953 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9765 -2.3433 4.2147 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5106 -0.5994 4.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3953 0.1368 0.4746 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0042 -2.5435 0.2776 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9792 -1.7510 -2.2706 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0556 -0.4236 -2.6711 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0824 -1.4466 0.0353 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5437 1.1592 1.9182 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1275 2.3458 1.6386 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9354 -0.0528 -2.7908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3437 2.0424 -2.4108 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6184 0.4944 -2.8874 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4648 -0.2038 -0.5510 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3261 2.8684 1.7614 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0722 1.4629 2.5022 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3821 1.6279 2.5164 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1134 0.0671 1.8240 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7168 2.6677 0.5018 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1797 -0.2399 -2.4043 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3621 -0.9577 -0.7927 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3720 0.6349 -2.5190 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4904 -1.0114 -1.9242 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4583 1.5284 -0.7687 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7272 0.1159 2.6836 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6167 -1.0771 1.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1708 -0.3803 1.8224 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8819 1.9246 2.5110 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8576 2.2122 0.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3367 3.0935 1.2802 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8424 0.5141 -0.0455 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4353 -1.3252 -1.5170 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9832 -1.2066 -0.5418 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4417 1.0841 -0.1017 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6564 2.1673 -1.0850 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0918 1.4338 -4.9511 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9447 1.5011 0.0054 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5394 3.6411 0.0124 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9787 4.4837 -1.5492 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4102 2.0732 -3.0833 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9567 1.6211 -1.2492 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9348 3.4016 -1.7229 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6457 2.4503 0.7207 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4096 3.2401 -3.6370 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4522 3.8531 -0.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7928 -2.3340 -4.7528 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3009 -3.9392 -4.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5363 -2.6968 -4.5501 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6640 -0.4189 1.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8496 -1.7707 3.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8277 -4.1354 3.5186 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9026 -2.1159 4.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1160 -0.6201 3.2866 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5986 -2.1082 2.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4403 -2.5782 0.9566 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2524 -0.8251 0.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3213 -3.7235 4.5487 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1663 -4.4139 1.7917 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0158 -2.4520 2.5035 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1548 2.9656 -1.5130 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8337 1.8296 -2.8298 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4451 2.8643 -2.2398 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8122 3.5359 -0.5097 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9998 3.5237 0.7481 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5384 2.9216 -0.8372 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6036 -1.3495 0.5133 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3867 -0.4297 2.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9374 -1.1110 1.6237 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0170 -0.0202 2.8338 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4877 3.2563 0.9523 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5781 0.4565 -1.7896 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2472 1.7569 -1.7005 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9415 2.8465 -1.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1027 -1.9608 -3.6973 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6092 -1.4867 -2.7739 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1749 -3.2153 -2.9153 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5935 -3.4089 -0.5459 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9394 -3.8051 -2.2874 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2331 -4.1198 -1.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8489 -0.1297 -2.2460 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9867 0.3588 -3.3935 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9189 -1.1542 -3.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7112 -3.0580 -1.6500 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6365 -3.5728 -0.4947 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 28 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 37 39 1 0 39 40 2 0 39 41 1 0 36 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 45 50 1 0 44 51 1 0 35 52 1 0 52 53 1 0 53 54 2 0 53 55 1 0 34 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 60 65 1 0 59 66 1 0 58 67 1 0 25 68 1 0 21 69 1 0 16 70 1 0 15 71 1 0 14 72 1 0 13 73 1 0 73 74 1 0 10 75 1 0 10 76 1 0 9 77 1 0 77 78 1 0 78 79 2 0 78 80 1 0 80 81 2 0 81 82 1 0 82 83 2 0 83 84 1 0 84 85 2 0 13 8 1 0 17 12 1 0 21 16 1 0 25 20 1 0 29 24 1 0 38 33 1 0 47 43 1 0 62 57 1 0 85 80 1 0 1 86 1 0 1 87 1 0 1 88 1 0 2 89 1 0 2 90 1 0 3 91 1 0 4 92 1 0 4 93 1 0 4 94 1 0 8 95 1 0 9 96 1 0 11 97 1 0 11 98 1 0 12 99 1 0 14100 1 0 15101 1 0 18102 1 0 19103 1 0 19104 1 0 20105 1 0 22106 1 0 22107 1 0 23108 1 0 23109 1 0 24110 1 0 26111 1 0 26112 1 0 27113 1 0 27114 1 0 28115 1 0 30116 1 0 30117 1 0 30118 1 0 31119 1 0 31120 1 0 31121 1 0 33122 1 0 34123 1 0 35124 1 0 36125 1 0 37126 1 0 41127 1 0 43128 1 0 44129 1 0 45130 1 0 46131 1 0 48132 1 0 48133 1 0 49134 1 0 50135 1 0 51136 1 0 55137 1 0 55138 1 0 55139 1 0 57140 1 0 58141 1 0 59142 1 0 60143 1 0 61144 1 0 63145 1 0 63146 1 0 64147 1 0 65148 1 0 66149 1 0 67150 1 0 68151 1 0 68152 1 0 68153 1 0 69154 1 0 69155 1 0 69156 1 0 70157 1 0 70158 1 0 70159 1 0 71160 1 0 72161 1 0 73162 1 0 73163 1 0 74164 1 0 75165 1 0 75166 1 0 75167 1 0 76168 1 0 76169 1 0 76170 1 0 81171 1 0 82172 1 0 83173 1 0 84174 1 0 85175 1 0 M END

Standard InCHIKey	KVGBTCLZIJIZOM-SQSZGAPHSA-N
Standard InCHI	InChI=1S/C61H90O24/c1-11-27(2)51(75)85-49-48(84-52(76)29-15-13-12-14-16-29)56(4,5)23-31-30-17-18-35-58(8)21-20-36(57(6,7)34(58)19-22-59(35,9)60(30,10)46(71)47(72)61(31,49)26-64)80-55-45(83-54-41(70)39(68)37(66)32(24-62)78-54)43(77-28(3)65)42(44(82-55)50(73)74)81-53-40(69)38(67)33(25-63)79-53/h12-17,27,31-49,53-55,62-64,66-72H,11,18-26H2,1-10H3,(H,73,74)/t27?,31-,32+,33-,34-,35+,36-,37+,38-,39-,40+,41+,42-,43-,44-,45+,46-,47+,48-,49-,53-,54-,55+,58-,59+,60-,61-/m0/s1
SMILES	CCC(C)C(=O)OC1C(C(CC2C1(C(C(C3(C2=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(O7)CO)O)O)OC(=O)C)OC8C(C(C(C(O8)CO)O)O)O)C)C)C)O)O)CO)(C)C)OC(=O)C9=CC=CC=C9

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1206.58	Volume:	1176.477 ? Van der Waals volume.
Dense:	1.026	LogP:	2.45 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.299 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.743 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	53.0
TPSA:	373.88 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	11.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.048	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.027	Fsp³:	0.803
MCE-18:	267.745 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.111	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.523 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.402	Promiscuous compounds:	0.0

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.28	MDCK Permeability:	-5.191
Pgp-inhibitor:	0.0	Pgp-substrate:	0.992
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.692	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	56.252%	Volume Distribution (VD):	-0.557
Fu:	33.666% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.017	BCRP inhibitor:	0.0
BSEP inhibitor:	0.063

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.01	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.628	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.017 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.295

Half-life (T1/2):

3.812

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.106
Human Hepatotoxicity (H-HT):	0.129	Drug-induced Liver Injury (DILI):	0.294
AMES Toxicity:	0.033	Rat Oral Acute Toxicity:	0.018
Maximum Recommended Daily Dose:	0.126	Skin Sensitization:	0.011
Carcinogencity:	0.008	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.196	Ototoxicity:	1.0
Hematotoxicity:	0.001	Drug-induced Nephrotoxicity:	0.017
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.048
A549 Cytotoxicity:	0.008	Hek293 Cytotoxicity:	0.687
BCF:	-0.091 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.246 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.636 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.514 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	n.a.	n.a.	PMID[15620235]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	Nanning City, Guangxi Province, People's Republic of China	1997-Jan	PMID[17190442]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT180	Cell line	HCT-8	Homo sapiens	IC50	>	10000.0	nM	DOI[10.1039/C3MD00097D]
NPT181	Cell line	Bel-7402	Homo sapiens	IC50	>	10000.0	nM	PMID[19029333]
NPT547	Cell line	BGC-823	Homo sapiens	IC50	>	10000.0	nM	PMID[19188388]
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[18977148]
NPT179	Cell line	A2780	Homo sapiens	IC50	=	3300.0	nM	PMID[19721073]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC329960 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14834
0.1-0.2	30010
0.2-0.3	4224
0.3-0.4	602
0.4-0.5	138
0.5-0.6	33
0.6-0.7	9
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8468	Intermediate Similarity	NPC150893
0.7967	Intermediate Similarity	NPC475377
0.7967	Intermediate Similarity	NPC476074
0.752	Intermediate Similarity	NPC262796
0.752	Intermediate Similarity	NPC45346
0.7222	Intermediate Similarity	NPC473755
0.7	Intermediate Similarity	NPC329657
0.6842	Remote Similarity	NPC295408
0.6794	Remote Similarity	NPC484833
0.6719	Remote Similarity	NPC264566
0.656	Remote Similarity	NPC329976
0.6466	Remote Similarity	NPC475513
0.6364	Remote Similarity	NPC329923
0.6364	Remote Similarity	NPC475281
0.6364	Remote Similarity	NPC475167
0.6099	Remote Similarity	NPC69425
0.5956	Remote Similarity	NPC178264
0.5926	Remote Similarity	NPC46823
0.5882	Remote Similarity	NPC192765
0.5725	Remote Similarity	NPC134914
0.5725	Remote Similarity	NPC477077
0.5725	Remote Similarity	NPC477078
0.5692	Remote Similarity	NPC470914
0.5643	Remote Similarity	NPC329993
0.5639	Remote Similarity	NPC605294
0.5597	Remote Similarity	NPC25998
0.5556	Remote Similarity	NPC603026
0.5547	Remote Similarity	NPC478150
0.5538	Remote Similarity	NPC470913
0.5524	Remote Similarity	NPC173435
0.5524	Remote Similarity	NPC172374
0.5524	Remote Similarity	NPC478064
0.5481	Remote Similarity	NPC478152
0.5481	Remote Similarity	NPC478151
0.5468	Remote Similarity	NPC473918
0.5448	Remote Similarity	NPC488309
0.5407	Remote Similarity	NPC606553
0.5357	Remote Similarity	NPC277212
0.5357	Remote Similarity	NPC30279
0.5319	Remote Similarity	NPC71391
0.5319	Remote Similarity	NPC329828
0.5286	Remote Similarity	NPC602995
0.5248	Remote Similarity	NPC470912
0.5208	Remote Similarity	NPC225791
0.5175	Remote Similarity	NPC478598
0.5103	Remote Similarity	NPC271610
0.5103	Remote Similarity	NPC312650
0.5074	Remote Similarity	NPC477075
0.5034	Remote Similarity	NPC488308

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC329960 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4169
0.1-0.2	4910
0.2-0.3	69
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data