NPASS Compound

Natural Product: NPC46823

Natural Product ID	NPC46823
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Yuchasaponin A
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bR)-7,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9,10-bis[[(E)-2-methylbut-2-enoyl]oxy]-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	Yuchasaponin A
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2087228
PubChem CID	25232481
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 192200 0 0 0 0 0 0 0 0999 V2000 -6.0510 -2.5227 3.0696 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8205 -3.7646 2.4547 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8241 -3.6071 0.9746 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8257 -2.6960 0.5838 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2839 -2.1530 -0.6343 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5054 -1.1505 -1.1367 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9964 0.1477 -0.9471 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9728 1.1296 -0.6298 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5563 2.4017 -0.5860 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6127 2.8511 -1.9100 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0238 1.7845 -2.8538 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6992 0.5913 -2.2538 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0262 0.9948 -2.0386 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9370 0.2165 -2.6611 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4852 0.9200 -3.7629 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5606 0.3132 -4.3364 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.5931 1.4007 -4.6453 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7240 0.8977 -5.2541 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1543 -0.9005 -3.7639 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8500 -1.2875 -2.3568 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0630 -0.1537 -1.7407 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6365 -0.3069 -0.4640 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1755 0.5707 0.4247 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2711 1.6090 0.7505 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0002 2.7686 1.0585 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0961 3.5496 -0.2640 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3869 2.5077 1.5346 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4225 1.2556 2.3794 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8354 0.0495 1.6543 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8519 -0.7960 1.3032 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6948 0.9435 2.7993 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7680 3.5795 2.3715 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9426 -1.6761 -1.6192 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5723 -0.7204 -3.8112 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9055 1.4178 -3.6380 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4950 4.0015 -1.9619 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0417 4.4433 -0.9019 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8046 4.6894 -3.1239 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2404 1.0693 0.5339 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8859 1.0890 0.3851 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2098 2.4177 0.6320 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3007 2.2848 0.3723 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9472 1.3514 1.3561 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2504 0.0615 1.3258 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2397 0.0106 1.1314 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6288 -1.3473 0.5013 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8251 -0.0622 2.5561 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7433 -0.7952 2.4375 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2031 -0.9934 2.4193 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0766 0.1135 1.8662 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3705 1.0122 0.9205 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1797 2.1720 0.5171 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5093 1.6886 0.0724 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0243 0.4927 0.3338 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2506 -0.5200 1.1443 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6265 -1.4474 0.0911 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1707 -1.3225 1.9995 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0592 -2.7126 1.6708 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5875 -0.9060 2.1520 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2046 0.0682 1.2433 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3569 0.1164 -0.0835 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6141 -1.0390 -0.9334 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9719 -1.6333 -0.9913 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8643 -3.1491 -1.2099 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6797 -1.1339 -2.2589 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8981 -1.4331 0.1524 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5723 -0.0512 0.7532 C 0 0 2 0 0 0 0 0 0 0 0 0 9.6513 0.6284 1.2675 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4826 1.5022 0.6786 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2191 1.6731 -0.5103 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5687 2.1835 1.3193 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8878 2.0512 2.5781 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0407 2.8112 3.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3835 3.1221 0.4672 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2211 -1.2293 -0.3808 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3103 -1.9816 0.0189 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1483 -2.8844 0.8725 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6525 -1.7761 -0.5091 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6593 -2.5196 -0.1101 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0212 -2.3109 -0.6491 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8812 -0.7022 -1.5130 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0780 1.4837 1.7885 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6625 2.4147 0.9329 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2824 -2.1478 2.2482 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6307 0.8211 3.0873 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0095 2.0960 2.6417 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5948 -3.2358 -1.6133 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0253 -4.5837 -1.1641 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5031 -4.8973 0.2460 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5963 -5.7520 0.2325 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6553 -4.6627 -1.3063 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9418 -3.4237 -1.8697 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7554 -1.7612 2.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8624 -4.1462 2.8736 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6572 -4.4099 2.8197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8291 -3.2220 0.6677 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2496 -1.6624 -0.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8433 0.0674 -0.2458 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2459 1.2072 -1.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5520 3.1711 -2.1497 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7815 2.2624 -3.5550 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6534 -0.2654 -2.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3857 -0.6628 -3.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1986 0.0210 -5.3886 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0907 2.0874 -5.3572 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8030 2.0218 -3.7457 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1461 1.6839 -5.7334 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9258 -1.7810 -4.4227 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1686 -2.1733 -2.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7389 0.7739 -1.7263 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9668 1.1435 -0.1655 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4808 3.4317 1.7660 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7473 4.5881 -0.1504 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4639 3.0776 -1.0356 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1444 3.4837 -0.6773 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1608 2.4223 0.7449 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8258 1.4157 3.3244 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1129 -0.4232 2.3689 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6770 -0.5641 1.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2150 1.7615 3.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4254 3.3517 3.2647 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5463 -0.9652 -1.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8472 -0.0526 -3.1313 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5088 2.2663 -3.9422 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9598 5.7003 -3.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7371 0.9378 -0.7290 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3850 2.8857 1.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5363 3.1268 -0.1553 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7296 3.3022 0.3745 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4580 1.8499 -0.6573 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5947 -0.4803 0.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4630 -1.7863 1.0282 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8458 -1.2608 -0.5646 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7575 -2.0645 0.5721 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3400 0.6489 3.2342 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8809 0.2467 2.4364 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8549 -1.1033 2.9082 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3322 -0.4966 3.4356 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2708 -1.8174 2.2857 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4862 -2.0100 2.0236 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4668 -1.1446 3.5239 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1732 0.4613 -0.0552 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7252 2.7390 -0.3495 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4144 2.9029 1.3392 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1510 2.3649 -0.5346 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7970 -1.0767 -0.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9687 -2.4788 0.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5273 -1.5183 0.1647 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6795 -1.3694 3.0184 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8884 -2.9996 1.2673 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7312 -0.5319 3.2111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8381 1.0188 -0.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9075 -1.9098 -0.8373 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3660 -0.7028 -1.9924 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7171 -3.5286 -1.7747 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9518 -3.6008 -0.1791 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8768 -3.4450 -1.5676 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2032 -1.5950 -3.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7166 -0.0277 -2.2803 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7222 -1.5334 -2.2207 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0209 -2.2266 0.8594 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5459 0.4937 -0.2855 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3261 1.3998 3.2144 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9832 2.4893 2.6634 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8082 3.8873 2.9572 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1098 2.6936 4.2325 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7343 3.9475 0.0604 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2521 3.5254 1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7544 2.5779 -0.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4745 -3.2871 0.6215 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4035 -1.2902 -0.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9831 -2.4601 -1.7439 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7063 -3.0384 -0.2088 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4615 0.2873 -1.1707 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3401 -0.9919 -2.4250 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9573 -0.5538 -1.6743 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0398 1.8305 1.9216 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5313 1.5467 2.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0914 3.2022 0.8072 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8584 -2.6353 3.0120 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6948 0.5453 3.2276 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6297 1.9107 3.0310 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1650 0.4711 4.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6675 2.9866 2.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0282 2.6361 2.8474 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1969 1.5421 3.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1133 -2.9923 -2.5766 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4767 -5.3476 -1.8243 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6818 -5.3895 0.7816 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3585 -5.2322 -0.1759 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3845 -3.9949 -2.0113 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1130 -3.7670 -2.7857 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 27 32 1 0 20 33 1 0 19 34 1 0 11 35 1 0 10 36 1 0 36 37 2 0 36 38 1 0 8 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 1 6 55 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 63 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 2 0 69 71 1 0 71 72 2 0 72 73 1 0 71 74 1 0 66 75 1 0 75 76 1 0 76 77 2 0 76 78 1 0 78 79 2 0 79 80 1 0 78 81 1 0 60 82 1 1 82 83 1 0 59 84 1 0 50 85 1 1 43 86 1 1 5 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 88 91 1 0 87 92 1 0 89 3 1 0 12 7 1 0 21 14 1 0 29 23 1 0 45 40 1 0 55 50 1 0 67 60 1 0 51 43 1 0 61 54 1 0 1 93 1 0 2 94 1 0 2 95 1 0 3 96 1 6 5 97 1 1 7 98 1 1 8 99 1 6 10100 1 6 11101 1 6 12102 1 6 14103 1 6 16104 1 6 17105 1 0 17106 1 0 18107 1 0 19108 1 6 20109 1 6 21110 1 1 23111 1 6 25112 1 1 26113 1 0 26114 1 0 26115 1 0 27116 1 6 28117 1 1 29118 1 1 30119 1 0 31120 1 0 32121 1 0 33122 1 0 34123 1 0 35124 1 0 38125 1 0 40126 1 6 41127 1 0 41128 1 0 42129 1 0 42130 1 0 44131 1 6 46132 1 0 46133 1 0 46134 1 0 47135 1 0 47136 1 0 47137 1 0 48138 1 0 48139 1 0 49140 1 0 49141 1 0 51142 1 6 52143 1 0 52144 1 0 53145 1 0 56146 1 0 56147 1 0 56148 1 0 57149 1 1 58150 1 0 59151 1 1 61152 1 6 62153 1 0 62154 1 0 64155 1 0 64156 1 0 64157 1 0 65158 1 0 65159 1 0 65160 1 0 66161 1 1 67162 1 6 72163 1 0 73164 1 0 73165 1 0 73166 1 0 74167 1 0 74168 1 0 74169 1 0 79170 1 0 80171 1 0 80172 1 0 80173 1 0 81174 1 0 81175 1 0 81176 1 0 82177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 85182 1 0 85183 1 0 86184 1 0 86185 1 0 86186 1 0 87187 1 6 88188 1 6 89189 1 1 90190 1 0 91191 1 0 92192 1 0 M END

Standard InCHIKey	MWOHZWYDIQDYSO-CAMGZPBRSA-N
Standard InCHI	InChI=1S/C64H100O28/c1-13-25(3)53(81)91-50-51(92-54(82)26(4)14-2)64(24-67)29(21-59(50,6)7)28-15-16-33-61(10)19-18-34(60(8,9)32(61)17-20-62(33,11)63(28,12)48(77)49(64)78)86-58-47(90-56-42(75)39(72)36(69)30(22-65)84-56)44(43(76)45(88-58)52(79)80)87-57-46(40(73)37(70)31(23-66)85-57)89-55-41(74)38(71)35(68)27(5)83-55/h13-15,27,29-51,55-58,65-78H,16-24H2,1-12H3,(H,79,80)/b25-13+,26-14+/t27-,29-,30+,31+,32-,33+,34-,35-,36+,37-,38+,39-,40-,41+,42+,43-,44-,45-,46+,47+,48-,49+,50-,51-,55-,56-,57-,58+,61-,62+,63-,64-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2O[C@H](CO)[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)[C@@H](O)[C@H]([C@@]2([C@H]3CC(C)(C)[C@H]([C@@H]2OC(=O)/C(=C/C)/C)OC(=O)/C(=C/C)/C)CO)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1316.64	Volume:	1268.799 ? Van der Waals volume.
Dense:	1.038	LogP:	0.147 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.487 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.371 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	55.0
TPSA:	446.96 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	15.0	Rings:	9.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.036	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.611	Fsp³:	0.859
MCE-18:	211.109 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.731	Fluc inhibitor:	0.009 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.0 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.319	Promiscuous compounds:	0.264

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.129	MDCK Permeability:	-5.179
Pgp-inhibitor:	0.0	Pgp-substrate:	0.546
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.972
20% Bioavailability (F20%):	0.994	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.973
Plasma Protein Binding (PPB):	70.906%	Volume Distribution (VD):	-0.446
Fu:	14.847% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.417	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.712
HLM stability:	0.023 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.463

Half-life (T1/2):

3.69

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.544	Drug-induced Liver Injury (DILI):	0.997
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.033	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.958	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.955	RPMI-8226 Immunitoxicity:	0.414
A549 Cytotoxicity:	0.99	Hek293 Cytotoxicity:	0.615
BCF:	0.326 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.38 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.35 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.997 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[16926516]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[22834923]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	Roots	n.a.	n.a.	PMID[30395460]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32569471]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39065796]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	4

Activity Type	# Activity
Non-molecular	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	16.8	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	49.4	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	16.6	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	45.3	%	PMID[22834923]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC46823 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22885
0.1-0.2	22943
0.2-0.3	2885
0.3-0.4	679
0.4-0.5	308
0.5-0.6	85
0.6-0.7	37
0.7-0.8	0
0.8-0.85	3
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8727	High Similarity	NPC277212
0.8727	High Similarity	NPC30279
0.8679	High Similarity	NPC329976
0.8482	Intermediate Similarity	NPC192765
0.8407	Intermediate Similarity	NPC178264
0.8073	Intermediate Similarity	NPC477077
0.7647	Intermediate Similarity	NPC225791
0.7607	Intermediate Similarity	NPC473918
0.7583	Intermediate Similarity	NPC484059
0.7583	Intermediate Similarity	NPC484060
0.7479	Intermediate Similarity	NPC484061
0.7479	Intermediate Similarity	NPC484062
0.7395	Intermediate Similarity	NPC71391
0.7391	Intermediate Similarity	NPC25998
0.7387	Intermediate Similarity	NPC470913
0.7304	Intermediate Similarity	NPC605294
0.7281	Intermediate Similarity	NPC477078
0.7257	Intermediate Similarity	NPC470914
0.7241	Intermediate Similarity	NPC478152
0.7241	Intermediate Similarity	NPC478151
0.7213	Intermediate Similarity	NPC271610
0.7083	Intermediate Similarity	NPC602995
0.7043	Intermediate Similarity	NPC477076
0.7016	Intermediate Similarity	NPC484833
0.7	Intermediate Similarity	NPC478150
0.6967	Remote Similarity	NPC329828
0.6723	Remote Similarity	NPC606553
0.672	Remote Similarity	NPC476780
0.6694	Remote Similarity	NPC329923
0.6694	Remote Similarity	NPC475281
0.6667	Remote Similarity	NPC484063
0.6667	Remote Similarity	NPC484064
0.6587	Remote Similarity	NPC488308
0.6562	Remote Similarity	NPC476777
0.6557	Remote Similarity	NPC478600
0.6557	Remote Similarity	NPC478599
0.6549	Remote Similarity	NPC603026
0.6535	Remote Similarity	NPC312650
0.648	Remote Similarity	NPC47995
0.6475	Remote Similarity	NPC609119
0.6457	Remote Similarity	NPC265841
0.6441	Remote Similarity	NPC302887
0.6434	Remote Similarity	NPC329657
0.6333	Remote Similarity	NPC477075
0.6288	Remote Similarity	NPC488309
0.6281	Remote Similarity	NPC160452
0.6279	Remote Similarity	NPC262796
0.6279	Remote Similarity	NPC45346
0.625	Remote Similarity	NPC470518
0.625	Remote Similarity	NPC478598
0.623	Remote Similarity	NPC469947
0.623	Remote Similarity	NPC480948
0.6198	Remote Similarity	NPC477079
0.6183	Remote Similarity	NPC475377
0.6183	Remote Similarity	NPC476074
0.6179	Remote Similarity	NPC480939
0.616	Remote Similarity	NPC478155
0.616	Remote Similarity	NPC478154
0.6094	Remote Similarity	NPC470912
0.6066	Remote Similarity	NPC23275
0.6047	Remote Similarity	NPC181066
0.6014	Remote Similarity	NPC477467
0.5972	Remote Similarity	NPC477470
0.5972	Remote Similarity	NPC477472
0.5954	Remote Similarity	NPC476774
0.594	Remote Similarity	NPC110700
0.5931	Remote Similarity	NPC477474
0.5926	Remote Similarity	NPC329960
0.592	Remote Similarity	NPC477197
0.5873	Remote Similarity	NPC107536
0.5873	Remote Similarity	NPC280029
0.5873	Remote Similarity	NPC9470
0.5865	Remote Similarity	NPC476779
0.584	Remote Similarity	NPC609281
0.5827	Remote Similarity	NPC150893
0.5802	Remote Similarity	NPC82380
0.5802	Remote Similarity	NPC244296
0.5758	Remote Similarity	NPC134914
0.5738	Remote Similarity	NPC475591
0.5738	Remote Similarity	NPC236870
0.5735	Remote Similarity	NPC476775
0.5702	Remote Similarity	NPC605226
0.5672	Remote Similarity	NPC475513
0.5672	Remote Similarity	NPC329993
0.5667	Remote Similarity	NPC22956
0.5656	Remote Similarity	NPC44716
0.5649	Remote Similarity	NPC283417
0.5649	Remote Similarity	NPC264566
0.5649	Remote Similarity	NPC200049
0.5564	Remote Similarity	NPC475167
0.5547	Remote Similarity	NPC173435
0.5547	Remote Similarity	NPC302543
0.5547	Remote Similarity	NPC172374
0.5547	Remote Similarity	NPC478064
0.5546	Remote Similarity	NPC25605
0.554	Remote Similarity	NPC476778
0.5522	Remote Similarity	NPC473755
0.5515	Remote Similarity	NPC478153
0.5512	Remote Similarity	NPC477193
0.55	Remote Similarity	NPC476776
0.5496	Remote Similarity	NPC477465
0.5469	Remote Similarity	NPC187290
0.5448	Remote Similarity	NPC478597
0.5426	Remote Similarity	NPC470915
0.5366	Remote Similarity	NPC478066
0.5354	Remote Similarity	NPC114692
0.5354	Remote Similarity	NPC78034
0.5352	Remote Similarity	NPC69425
0.5344	Remote Similarity	NPC313110
0.5338	Remote Similarity	NPC609305
0.5329	Remote Similarity	NPC477469
0.5329	Remote Similarity	NPC477471
0.5317	Remote Similarity	NPC470478
0.5317	Remote Similarity	NPC131469
0.5312	Remote Similarity	NPC606145
0.5308	Remote Similarity	NPC480936
0.5298	Remote Similarity	NPC477466
0.5294	Remote Similarity	NPC164194
0.5294	Remote Similarity	NPC21691
0.5276	Remote Similarity	NPC95437
0.5271	Remote Similarity	NPC120116
0.5263	Remote Similarity	NPC284449
0.5255	Remote Similarity	NPC478596
0.5248	Remote Similarity	NPC295408
0.5234	Remote Similarity	NPC236657
0.5231	Remote Similarity	NPC477194
0.5229	Remote Similarity	NPC477473
0.5227	Remote Similarity	NPC610461
0.5188	Remote Similarity	NPC151543
0.5159	Remote Similarity	NPC251768
0.5156	Remote Similarity	NPC64715
0.5154	Remote Similarity	NPC187618
0.5152	Remote Similarity	NPC470475
0.5152	Remote Similarity	NPC472267
0.5152	Remote Similarity	NPC115656
0.5138	Remote Similarity	NPC475263
0.5113	Remote Similarity	NPC268184
0.5113	Remote Similarity	NPC607904
0.5109	Remote Similarity	NPC301639
0.5109	Remote Similarity	NPC478065
0.5082	Remote Similarity	NPC12288
0.5081	Remote Similarity	NPC472949
0.5079	Remote Similarity	NPC480947
0.5079	Remote Similarity	NPC114304
0.5078	Remote Similarity	NPC123796
0.5077	Remote Similarity	NPC477191
0.5037	Remote Similarity	NPC470911

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC46823 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7117
0.1-0.2	1974
0.2-0.3	54
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data