NPASS Compound

Natural Product: NPC470475

Natural Product ID	NPC470475
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Pachanoside I1
IUPAC Name	n.a.
Synonyms	pachanoside I1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2047207
PubChem CID	70694563
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001755] Diterpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143151 0 0 0 0 0 0 0 0999 V2000 -6.0974 4.1532 0.8841 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2992 4.9963 -0.1845 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7278 4.2155 -1.4001 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8379 3.2761 -1.8323 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0782 1.9714 -1.4635 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9001 1.7488 -0.1124 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8781 0.8445 0.1656 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7698 1.5615 0.9023 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3155 1.9925 2.1135 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8611 0.9958 2.8754 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7841 -0.3850 2.2738 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4510 -0.3230 0.9002 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2969 -1.5432 0.2330 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4859 -2.2112 0.0159 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4171 -3.4558 0.6564 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2274 -4.0563 0.1897 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4410 -4.3799 -1.2628 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7488 -3.8535 -1.7797 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8826 -2.3707 -1.4147 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2313 -1.9782 -1.6160 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8333 -3.9589 -3.1691 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4370 -5.7617 -1.4333 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6375 -1.1972 3.0695 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0671 0.9540 4.1570 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1299 1.7547 4.3757 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3719 0.0116 5.1237 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6602 0.8537 1.2002 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4378 1.2852 0.7735 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5728 1.8544 1.8697 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8949 1.6917 1.6796 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2960 0.2441 1.3959 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6310 -0.0391 0.0968 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7903 0.2919 -0.1002 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5589 -1.0382 -0.0870 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9753 0.7384 -1.5787 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0008 -1.4395 -0.3760 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4632 -1.3628 -0.6765 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3282 -1.0284 0.5408 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7914 0.2478 1.1211 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6009 0.6570 2.2845 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0039 0.8488 1.8143 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5337 0.1275 0.8701 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7671 -0.9415 0.1883 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4421 -2.1269 0.7270 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8489 -2.0594 0.8026 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5552 -2.7349 1.5474 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3605 -1.0273 -0.1728 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9434 0.2937 0.4858 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3153 1.5075 -0.2612 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6315 1.4346 -0.9606 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6937 2.2529 -0.2074 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4834 2.1582 -2.3119 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1928 0.1041 -1.2582 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8275 -0.9864 -0.2955 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4281 -2.1908 -0.7293 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3997 -2.8061 0.0550 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6937 -2.2223 1.1462 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0952 -4.0530 -0.2768 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6125 -1.3085 -1.4242 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1090 -1.0407 -1.2744 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7720 0.0907 -2.1549 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1550 -2.2364 1.4526 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9165 -0.5556 2.5735 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4415 1.4531 -1.8922 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3846 2.5860 -2.2786 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1498 3.6854 -1.2445 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1043 4.6866 -1.4287 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6968 2.1722 -2.1669 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2745 0.5901 -2.9847 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8075 4.1874 1.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1064 5.7087 0.1234 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3956 5.6025 -0.3673 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8105 4.9823 -2.2293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2980 1.3579 -2.0083 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5226 0.4842 -0.8291 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5868 2.4930 0.3121 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9090 1.2310 3.2113 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8006 -0.8321 2.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5458 -0.1826 1.0188 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2811 -1.5823 0.4915 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0497 -4.9492 0.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4214 -3.2788 0.3254 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6008 -3.9653 -1.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5651 -4.4341 -1.3260 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2831 -1.8191 -2.1424 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8183 -2.7370 -1.3554 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7145 -4.3312 -3.4736 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9955 -6.0084 -2.2001 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5482 -0.8319 2.8595 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8141 -0.1771 5.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6813 2.2015 0.1444 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8446 1.4911 2.8796 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7234 2.9745 1.9731 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3986 2.1401 2.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1974 2.2834 0.7761 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1980 0.6310 -0.6305 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2469 -1.7171 0.7072 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6117 -0.7853 0.1030 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5471 -1.5258 -1.0923 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6310 1.7829 -1.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3799 0.0730 -2.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0238 0.6586 -1.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4896 -1.5450 -1.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6578 -2.2439 0.2395 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5360 -0.4697 -1.3321 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7440 -2.3162 -1.1570 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9275 1.0202 0.3210 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6743 -0.1053 3.0920 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2957 1.5829 2.7919 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6083 1.6482 2.3097 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6296 0.2948 1.4006 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5311 1.9395 -0.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4190 2.3385 0.5125 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6595 2.0065 -0.6898 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6603 2.0788 0.8693 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4978 3.3384 -0.4602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9890 3.1297 -2.2101 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4768 2.2044 -2.8187 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8667 1.4787 -2.9338 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3197 0.1757 -1.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0006 -0.1884 -2.3325 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2621 -0.6998 0.6901 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0425 -3.9216 -0.8354 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4367 -4.7966 -0.7936 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3700 -4.5589 0.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8180 -2.3756 -1.6887 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0372 -0.7327 -2.2807 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6311 -1.9663 -1.6767 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1445 -0.1981 -3.0516 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6861 0.5134 -2.6891 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3774 1.0078 -1.6481 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1585 -2.6219 1.5425 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7276 -3.0501 0.9003 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7292 -2.1455 2.3979 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3971 0.0423 3.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8596 -0.8683 3.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2812 -1.4251 2.4355 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9482 0.8707 -1.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1353 2.9525 -3.3037 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2329 3.2378 -0.2466 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7955 5.4907 -0.9615 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3385 2.9016 -2.2122 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2541 1.1908 -3.7952 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 18 21 1 0 17 22 1 0 11 23 1 0 10 24 1 0 24 25 2 0 24 26 1 0 8 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 32 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 1 1 44 45 1 0 45 46 2 0 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 50 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 2 0 56 58 1 0 47 59 1 6 59 60 1 0 60 61 1 0 38 62 1 1 31 63 1 1 5 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 66 3 1 0 12 7 1 0 19 14 1 0 33 28 1 0 43 38 1 0 54 47 1 0 39 31 1 0 48 42 1 0 60 43 1 0 1 70 1 0 2 71 1 0 2 72 1 0 3 73 1 6 5 74 1 6 7 75 1 6 8 76 1 6 10 77 1 1 11 78 1 6 12 79 1 1 14 80 1 1 16 81 1 0 16 82 1 0 17 83 1 6 18 84 1 1 19 85 1 6 20 86 1 0 21 87 1 0 22 88 1 0 23 89 1 0 26 90 1 0 28 91 1 6 29 92 1 0 29 93 1 0 30 94 1 0 30 95 1 0 32 96 1 6 34 97 1 0 34 98 1 0 34 99 1 0 35100 1 0 35101 1 0 35102 1 0 36103 1 0 36104 1 0 37105 1 0 37106 1 0 39107 1 6 40108 1 0 40109 1 0 41110 1 0 48111 1 1 49112 1 0 49113 1 0 51114 1 0 51115 1 0 51116 1 0 52117 1 0 52118 1 0 52119 1 0 53120 1 0 53121 1 0 54122 1 1 58123 1 0 58124 1 0 58125 1 0 59126 1 0 59127 1 0 60128 1 6 61129 1 0 61130 1 0 61131 1 0 62132 1 0 62133 1 0 62134 1 0 63135 1 0 63136 1 0 63137 1 0 64138 1 1 65139 1 6 66140 1 1 67141 1 0 68142 1 0 69143 1 0 M END

Standard InCHIKey	OCEOACZZNIMSSM-GZNUJQFLSA-N
Standard InCHI	InChI=1S/C49H74O20/c1-20-15-48-23(16-44(3,4)17-29(48)63-21(2)51)22-9-10-27-46(7)13-12-28(45(5,6)26(46)11-14-47(27,8)49(20,22)69-43(48)61)65-42-38(68-41-34(57)32(55)31(54)25(18-50)64-41)36(35(58)37(67-42)39(59)60)66-40-33(56)30(53)24(52)19-62-40/h9,20,23-38,40-42,50,52-58H,10-19H2,1-8H3,(H,59,60)/t20-,23-,24+,25+,26-,27+,28-,29-,30-,31+,32-,33+,34+,35-,36-,37-,38+,40-,41-,42+,46-,47+,48-,49+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@]42OC(=O)[C@]2([C@H]3CC(C)(C)C[C@@H]2OC(=O)C)C[C@@H]4C)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	982.48	Volume:	944.31 ? Van der Waals volume.
Dense:	1.04	LogP:	0.812 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.688 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.7 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	50.0
TPSA:	307.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	9.0	Rings:	10.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.086	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.232	Fsp³:	0.898
MCE-18:	258.935 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.939	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.185	Promiscuous compounds:	0.188

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.109	MDCK Permeability:	-5.276
Pgp-inhibitor:	0.0	Pgp-substrate:	0.647
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.237
20% Bioavailability (F20%):	0.114	30% Bioavailability (F30%):	0.899
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.942
Plasma Protein Binding (PPB):	57.291%	Volume Distribution (VD):	-0.589
Fu:	32.38% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	0.005

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.01
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.055
HLM stability:	0.024 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.13

Half-life (T1/2):

3.03

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.002
Human Hepatotoxicity (H-HT):	0.636	Drug-induced Liver Injury (DILI):	0.941
AMES Toxicity:	0.828	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.188	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.52	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.887	RPMI-8226 Immunitoxicity:	0.066
A549 Cytotoxicity:	0.103	Hek293 Cytotoxicity:	0.094
BCF:	0.361 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.448 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.358 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.223 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32656	Stenocereus alamosensis	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22704889]
NPO32619	isolatocereus dumortieri	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22704889]
NPO32656	Stenocereus alamosensis	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO32619	isolatocereus dumortieri	Species	Cactaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT521	Cell line	RBL-2H3	Rattus norvegicus	IC50	>	200000.0	nM	PMID[19318257]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470475 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20352
0.1-0.2	24590
0.2-0.3	3647
0.3-0.4	916
0.4-0.5	282
0.5-0.6	60
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8857	High Similarity	NPC470476
0.6696	Remote Similarity	NPC187290
0.6341	Remote Similarity	NPC71391
0.6179	Remote Similarity	NPC283417
0.6179	Remote Similarity	NPC200049
0.6179	Remote Similarity	NPC602995
0.6174	Remote Similarity	NPC475591
0.6174	Remote Similarity	NPC236870
0.6111	Remote Similarity	NPC265841
0.5948	Remote Similarity	NPC44716
0.5923	Remote Similarity	NPC302543
0.5906	Remote Similarity	NPC178264
0.5827	Remote Similarity	NPC192765
0.5814	Remote Similarity	NPC271610
0.5814	Remote Similarity	NPC312650
0.5781	Remote Similarity	NPC484061
0.5781	Remote Similarity	NPC484062
0.5748	Remote Similarity	NPC473918
0.5736	Remote Similarity	NPC488308
0.5649	Remote Similarity	NPC476779
0.5625	Remote Similarity	NPC47995
0.5625	Remote Similarity	NPC277212
0.5625	Remote Similarity	NPC30279
0.561	Remote Similarity	NPC329976
0.5603	Remote Similarity	NPC603026
0.5574	Remote Similarity	NPC301449
0.5574	Remote Similarity	NPC601290
0.5565	Remote Similarity	NPC605294
0.5556	Remote Similarity	NPC22956
0.5537	Remote Similarity	NPC302887
0.5528	Remote Similarity	NPC160452
0.552	Remote Similarity	NPC25998
0.5481	Remote Similarity	NPC488309
0.5476	Remote Similarity	NPC609119
0.5462	Remote Similarity	NPC605226
0.5455	Remote Similarity	NPC225791
0.5414	Remote Similarity	NPC484059
0.5414	Remote Similarity	NPC484060
0.5391	Remote Similarity	NPC284449
0.5379	Remote Similarity	NPC476780
0.5373	Remote Similarity	NPC110700
0.5373	Remote Similarity	NPC476777
0.5344	Remote Similarity	NPC329828
0.5328	Remote Similarity	NPC470478
0.5328	Remote Similarity	NPC279915
0.5328	Remote Similarity	NPC476778
0.5317	Remote Similarity	NPC11242
0.5294	Remote Similarity	NPC263756
0.5294	Remote Similarity	NPC213674
0.5294	Remote Similarity	NPC476775
0.529	Remote Similarity	NPC476776
0.5285	Remote Similarity	NPC79718
0.5263	Remote Similarity	NPC476774
0.5255	Remote Similarity	NPC484063
0.5255	Remote Similarity	NPC484064
0.5227	Remote Similarity	NPC4749
0.5207	Remote Similarity	NPC117714
0.5207	Remote Similarity	NPC30289
0.5197	Remote Similarity	NPC480939
0.5175	Remote Similarity	NPC475368
0.5164	Remote Similarity	NPC251768
0.5161	Remote Similarity	NPC64715
0.5152	Remote Similarity	NPC46823
0.5118	Remote Similarity	NPC469947
0.5118	Remote Similarity	NPC480948
0.5118	Remote Similarity	NPC609281
0.5113	Remote Similarity	NPC181066
0.5079	Remote Similarity	NPC23275
0.5074	Remote Similarity	NPC484833

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470475 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6372
0.1-0.2	2703
0.2-0.3	69
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data