NPASS Compound

Natural Product: NPC476775

Natural Product ID	NPC476775
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	theasaponins A2
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4R,6aR,6bS,8R,8aR,9R,10R,14bR)-8a-(acetyloxymethyl)-8,9-dihydroxy-4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	theasaponins A2
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44566251
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 178186 0 0 0 0 0 0 0 0999 V2000 12.0987 -3.2720 1.0211 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7087 -2.1903 1.8369 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9971 -1.1258 2.1311 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6890 -0.0777 2.9616 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6304 -0.9030 1.6963 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0604 0.1736 2.0690 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8897 -1.7629 0.9067 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5660 -1.4164 0.5548 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5539 -1.1535 -0.9447 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1949 -0.7886 -1.4489 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0956 0.6845 -1.7128 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7357 1.2669 -1.8260 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7545 0.8755 -0.7546 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8500 -0.6313 -0.7432 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8589 -1.3223 -1.0896 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5220 -0.8400 -1.5420 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5342 0.6246 -1.9248 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3689 1.3884 -0.9212 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6032 1.1521 0.3791 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1644 1.4623 0.3212 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5851 1.9033 -0.9923 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1573 1.1807 -2.1666 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1696 0.1881 -2.7352 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8790 -0.3207 -1.8406 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6794 0.7234 -1.1582 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9123 1.9232 -0.8878 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4972 3.0706 -1.7365 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2617 2.3815 0.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7734 3.6383 0.7911 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8611 0.9745 -1.9105 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9813 0.4045 -1.4231 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1508 1.2058 -0.9843 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2896 0.1812 -0.8781 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7647 0.1294 -2.3780 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4827 -0.2437 -3.1055 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4451 -0.6206 -2.3083 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1625 0.7420 -4.1695 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0511 1.1537 -4.9730 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8851 1.2137 -4.2859 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7926 -0.7370 -2.5607 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3227 0.4491 -0.0855 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9289 -0.6528 0.5211 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5391 -0.9646 1.9180 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4977 -0.4288 2.9234 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6373 0.2711 2.2413 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1703 -0.5387 1.1202 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2269 -0.8593 0.1682 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0934 1.4716 1.7068 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8604 0.5066 3.7671 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5249 -2.3739 2.1285 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3161 -2.8484 2.5526 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3958 -3.6820 3.8304 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5890 -5.1575 3.4524 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5479 -5.1787 2.2839 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9013 -4.4960 1.1099 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8384 -3.7410 1.5638 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9073 -6.4614 1.8932 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0484 -5.8252 4.5669 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1445 -3.6411 4.4883 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9918 1.8979 0.1912 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4943 3.2010 0.1155 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5157 4.3069 0.2346 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2595 5.6310 0.0131 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6295 5.5778 0.6533 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7113 4.4597 1.6594 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5434 3.2706 1.0180 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9613 4.5501 2.5084 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0472 5.7984 3.1078 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5559 5.2785 -0.3672 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3308 5.9791 -1.3220 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8541 4.4286 1.4290 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3273 2.2150 -3.2958 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5365 2.8549 -1.1941 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1846 -1.1346 -0.3734 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3161 -2.4979 0.1548 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6619 -2.5555 0.9131 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3448 -3.8903 0.6595 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3623 -2.4772 2.3900 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2697 1.4331 0.5702 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0016 1.3661 -0.9115 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9897 -1.4951 -2.7512 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0746 -2.8941 -2.6265 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9120 -3.7153 -3.7132 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6834 -3.2058 -4.8347 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0026 -5.1816 -3.5749 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4843 -0.1968 -1.2431 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8147 -4.0619 0.7990 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7942 -2.8267 0.0552 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2547 -3.7638 1.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7382 -2.3154 2.1686 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9982 0.7390 2.2410 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6038 -0.4518 3.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9884 0.4106 3.6519 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3458 -0.4607 1.0457 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9079 -2.1253 -1.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5535 0.8089 -2.7592 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3585 0.9035 -2.8468 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8565 2.3459 -1.9845 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9395 -2.4287 -1.0668 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8260 -1.1222 -0.7587 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2954 -1.4522 -2.4417 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1276 0.6654 -2.8796 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7335 0.0493 0.5919 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0724 1.6295 1.2612 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6068 0.5552 0.7263 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9546 2.2262 1.1213 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7911 2.9954 -1.0944 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6922 -0.6536 -3.2846 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4146 0.6421 -3.6108 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5549 -1.0696 -1.0922 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5935 -0.9065 -2.4985 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0958 0.2084 -0.2282 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0503 3.1523 -2.7196 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5189 4.0243 -1.1673 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5609 2.8059 -1.8974 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9824 1.6275 1.3017 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3616 2.4061 0.5497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0413 4.0218 1.6559 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6870 -0.2009 -0.4973 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4713 1.8903 -1.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8590 -0.8438 -0.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0452 1.1616 -2.6149 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7694 -1.1822 -3.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5162 1.4824 -5.2023 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5408 -0.3433 -3.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3632 -1.5136 -0.0412 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5171 -0.6294 2.1859 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9513 -1.2399 3.5575 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4123 0.5545 2.9964 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5401 -1.5045 1.5357 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0876 -0.0677 0.6510 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3077 1.7379 2.2797 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1143 0.0655 4.2524 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5088 -2.0952 2.6683 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2311 -3.4012 4.4775 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6080 -5.5678 3.0913 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4684 -4.6258 2.5912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5053 -5.1960 0.3375 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6508 -3.7872 0.6643 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8710 -6.4783 1.6427 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6970 -6.5397 4.3164 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2213 -4.1345 5.3469 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9719 3.3534 -0.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8340 4.2658 -0.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6844 6.4154 0.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9203 6.5258 1.1293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8608 4.6066 2.3722 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8868 3.8256 3.3681 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8918 4.3449 1.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2133 6.3120 3.1147 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4865 5.4019 -0.0392 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3057 5.2193 -1.9448 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1328 5.1293 1.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2740 2.0446 -3.8586 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3040 3.2421 -2.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5489 2.0948 -4.0869 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4765 3.1791 -2.2168 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5620 3.2517 -0.8673 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9040 3.4193 -0.4529 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5197 -0.4631 0.5004 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4794 -2.6648 0.8964 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2532 -3.3400 -0.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6322 -4.4089 1.6047 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6832 -4.5533 0.1034 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3140 -3.7018 0.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0636 -3.4497 2.8361 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5833 -1.7544 2.6311 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2762 -2.1517 2.9589 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8127 2.3992 0.8559 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0398 0.7376 1.4147 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3537 1.6638 0.5511 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4535 2.0963 -1.3774 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1215 -1.1471 -3.3218 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8786 -1.2093 -3.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9556 -5.5561 -3.3542 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7105 -5.5202 -2.8157 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3628 -5.5750 -4.5688 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8053 -0.2426 -2.1800 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 25 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 2 0 37 39 1 0 34 40 1 0 33 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 52 59 1 0 32 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 64 69 1 0 63 70 1 0 62 71 1 0 22 72 1 6 18 73 1 6 14 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 76 78 1 0 13 79 1 1 11 80 1 0 10 81 1 6 81 82 1 0 82 83 1 0 83 84 2 0 83 85 1 0 9 86 1 0 76 8 1 0 74 10 1 0 18 13 1 0 22 17 1 0 26 21 1 0 36 31 1 0 47 42 1 0 56 51 1 0 66 61 1 0 1 87 1 0 1 88 1 0 1 89 1 0 2 90 1 0 4 91 1 0 4 92 1 0 4 93 1 0 8 94 1 1 9 95 1 6 11 96 1 6 12 97 1 0 12 98 1 0 15 99 1 0 16100 1 0 16101 1 0 17102 1 0 19103 1 0 19104 1 0 20105 1 0 20106 1 0 21107 1 0 23108 1 0 23109 1 0 24110 1 0 24111 1 0 25112 1 1 27113 1 0 27114 1 0 27115 1 0 28116 1 0 28117 1 0 29118 1 0 31119 1 1 32120 1 6 33121 1 1 34122 1 6 35123 1 6 39124 1 0 40125 1 0 42126 1 6 43127 1 1 44128 1 1 45129 1 1 46130 1 0 46131 1 0 48132 1 0 49133 1 0 51134 1 1 52135 1 1 53136 1 6 54137 1 1 55138 1 0 55139 1 0 57140 1 0 58141 1 0 59142 1 0 61143 1 6 62144 1 6 63145 1 1 64146 1 1 65147 1 1 67148 1 0 67149 1 0 68150 1 0 69151 1 0 70152 1 0 71153 1 0 72154 1 0 72155 1 0 72156 1 0 73157 1 0 73158 1 0 73159 1 0 74160 1 0 75161 1 0 75162 1 0 77163 1 0 77164 1 0 77165 1 0 78166 1 0 78167 1 0 78168 1 0 79169 1 0 79170 1 0 79171 1 0 80172 1 0 81173 1 0 81174 1 0 85175 1 0 85176 1 0 85177 1 0 86178 1 0 M END

Standard InCHIKey	PRFTXYNGTPDAAH-SEBBEXHUSA-N
Standard InCHI	InChI=1S/C59H92O27/c1-10-24(2)49(76)86-47-46(73)59(23-79-25(3)62)27(17-54(47,4)5)26-11-12-32-55(6)15-14-34(56(7,22-61)31(55)13-16-57(32,8)58(26,9)18-33(59)65)81-53-45(85-51-40(71)38(69)37(68)30(19-60)80-51)42(41(72)43(83-53)48(74)75)82-52-44(36(67)29(64)21-78-52)84-50-39(70)35(66)28(63)20-77-50/h10-11,27-47,50-53,60-61,63-73H,12-23H2,1-9H3,(H,74,75)/b24-10-/t27?,28-,29+,30-,31?,32?,33-,34+,35+,36+,37+,38+,39-,40-,41+,42+,43+,44-,45-,46+,47+,50+,51-,52+,53-,55+,56+,57-,58-,59+/m1/s1
SMILES	C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@@]2([C@@H](C[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC[C@@H]([C@@]5(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@@H]9[C@@H]([C@H]([C@H]([C@H](O9)CO)O)O)O)C)C)C2CC1(C)C)C)O)COC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1232.58	Volume:	1176.165 ? Van der Waals volume.
Dense:	1.048	LogP:	0.754 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.73 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.019 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	54.0
TPSA:	426.73 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	14.0	Rings:	9.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.036	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.373	Fsp³:	0.881
MCE-18:	204.054 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.591	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.031 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.187	Promiscuous compounds:	0.149

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.288	MDCK Permeability:	-5.182
Pgp-inhibitor:	0.0	Pgp-substrate:	0.856
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.709
20% Bioavailability (F20%):	0.97	30% Bioavailability (F30%):	0.955
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.969
Plasma Protein Binding (PPB):	58.059%	Volume Distribution (VD):	-0.481
Fu:	26.09% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.751	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.023	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.03
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.5

Half-life (T1/2):

3.496

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.691	Drug-induced Liver Injury (DILI):	0.462
AMES Toxicity:	0.645	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.021	Skin Sensitization:	1.0
Carcinogencity:	0.011	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.289	Drug-induced Nephrotoxicity:	0.984
Genotoxicity:	0.267	RPMI-8226 Immunitoxicity:	0.145
A549 Cytotoxicity:	0.717	Hek293 Cytotoxicity:	0.375
BCF:	0.133 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.691 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.97 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.552 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 16712885]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.foodchem.2013.08.121]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Flowers	n.a.	n.a.	PMID[16180814]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	seeds	Shizuoka prefecture, Japan	n.a.	PMID[16499314]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18068204]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21434603]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	flower	n.a.	PMID[21922925]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[21925888]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	leaves	n.a.	n.a.	PMID[22377672]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[23265489]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaves	Bandung, West Java, Indonesia		PMID[23621359]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[37255739]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Stem	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Shoot	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Seed Oil	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaf Essent. Oil	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Cotyledon	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	54.7	%	PMID[16499314]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC476775 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23013
0.1-0.2	22622
0.2-0.3	3180
0.3-0.4	578
0.4-0.5	333
0.5-0.6	76
0.6-0.7	29
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9145	High Similarity	NPC476778
0.9068	High Similarity	NPC476776
0.887	High Similarity	NPC476774
0.8235	Intermediate Similarity	NPC476780
0.8211	Intermediate Similarity	NPC279915
0.7724	Intermediate Similarity	NPC271610
0.7686	Intermediate Similarity	NPC252289
0.7686	Intermediate Similarity	NPC305793
0.76	Intermediate Similarity	NPC476777
0.754	Intermediate Similarity	NPC11577
0.754	Intermediate Similarity	NPC141600
0.75	Intermediate Similarity	NPC265841
0.7381	Intermediate Similarity	NPC476779
0.7177	Intermediate Similarity	NPC602995
0.7165	Intermediate Similarity	NPC312650
0.7131	Intermediate Similarity	NPC609119
0.7087	Intermediate Similarity	NPC488308
0.7073	Intermediate Similarity	NPC1314
0.7073	Intermediate Similarity	NPC273878
0.7054	Intermediate Similarity	NPC110700
0.7034	Intermediate Similarity	NPC611191
0.7016	Intermediate Similarity	NPC284449
0.6875	Remote Similarity	NPC178264
0.6797	Remote Similarity	NPC71391
0.6797	Remote Similarity	NPC192765
0.6772	Remote Similarity	NPC283417
0.6772	Remote Similarity	NPC200049
0.6767	Remote Similarity	NPC488309
0.664	Remote Similarity	NPC472267
0.664	Remote Similarity	NPC115656
0.6562	Remote Similarity	NPC603137
0.6508	Remote Similarity	NPC25998
0.6385	Remote Similarity	NPC269484
0.6385	Remote Similarity	NPC97918
0.6328	Remote Similarity	NPC252657
0.6328	Remote Similarity	NPC88311
0.6299	Remote Similarity	NPC605294
0.6288	Remote Similarity	NPC82380
0.6288	Remote Similarity	NPC244296
0.6222	Remote Similarity	NPC484059
0.6222	Remote Similarity	NPC484060
0.6165	Remote Similarity	NPC329828
0.6124	Remote Similarity	NPC107536
0.6124	Remote Similarity	NPC280029
0.6124	Remote Similarity	NPC9470
0.6103	Remote Similarity	NPC478153
0.6032	Remote Similarity	NPC603832
0.6031	Remote Similarity	NPC478155
0.6031	Remote Similarity	NPC478154
0.6	Remote Similarity	NPC484061
0.6	Remote Similarity	NPC484062
0.5938	Remote Similarity	NPC477191
0.5906	Remote Similarity	NPC302887
0.5891	Remote Similarity	NPC187618
0.5882	Remote Similarity	NPC470518
0.584	Remote Similarity	NPC605226
0.5809	Remote Similarity	NPC4749
0.5786	Remote Similarity	NPC302543
0.5769	Remote Similarity	NPC160452
0.5735	Remote Similarity	NPC277212
0.5735	Remote Similarity	NPC30279
0.5735	Remote Similarity	NPC46823
0.5725	Remote Similarity	NPC329976
0.5725	Remote Similarity	NPC187290
0.5704	Remote Similarity	NPC609305
0.5669	Remote Similarity	NPC44716
0.5649	Remote Similarity	NPC477192
0.562	Remote Similarity	NPC47995
0.5597	Remote Similarity	NPC313110
0.5573	Remote Similarity	NPC218954
0.554	Remote Similarity	NPC21691
0.553	Remote Similarity	NPC477193
0.55	Remote Similarity	NPC473452
0.5486	Remote Similarity	NPC484063
0.5486	Remote Similarity	NPC484064
0.5462	Remote Similarity	NPC488517
0.5448	Remote Similarity	NPC477195
0.544	Remote Similarity	NPC59804
0.542	Remote Similarity	NPC64715
0.5407	Remote Similarity	NPC477196
0.5396	Remote Similarity	NPC473918
0.538	Remote Similarity	NPC485563
0.5373	Remote Similarity	NPC104137
0.5373	Remote Similarity	NPC207738
0.5373	Remote Similarity	NPC26626
0.5315	Remote Similarity	NPC484833
0.5294	Remote Similarity	NPC470475
0.5294	Remote Similarity	NPC478152
0.5294	Remote Similarity	NPC478151
0.5267	Remote Similarity	NPC475591
0.5267	Remote Similarity	NPC236870
0.5267	Remote Similarity	NPC118440
0.5259	Remote Similarity	NPC477194
0.5248	Remote Similarity	NPC478597
0.5231	Remote Similarity	NPC117714
0.5224	Remote Similarity	NPC301449
0.5224	Remote Similarity	NPC23275
0.5224	Remote Similarity	NPC601290
0.5221	Remote Similarity	NPC11242
0.5221	Remote Similarity	NPC815
0.52	Remote Similarity	NPC485562
0.5191	Remote Similarity	NPC232237
0.5175	Remote Similarity	NPC478596
0.5145	Remote Similarity	NPC607904
0.5143	Remote Similarity	NPC478150
0.5116	Remote Similarity	NPC603026
0.5115	Remote Similarity	NPC30289
0.5111	Remote Similarity	NPC477076
0.5111	Remote Similarity	NPC477079
0.5106	Remote Similarity	NPC475140
0.5077	Remote Similarity	NPC80843
0.5077	Remote Similarity	NPC22956
0.5076	Remote Similarity	NPC164389
0.5074	Remote Similarity	NPC477077
0.5072	Remote Similarity	NPC475119
0.5069	Remote Similarity	NPC286457
0.5067	Remote Similarity	NPC489209
0.5039	Remote Similarity	NPC127056
0.5037	Remote Similarity	NPC114692
0.5037	Remote Similarity	NPC236657
0.5037	Remote Similarity	NPC276093
0.5036	Remote Similarity	NPC469947
0.5036	Remote Similarity	NPC480948
0.5036	Remote Similarity	NPC610204
0.5035	Remote Similarity	NPC181066
0.5035	Remote Similarity	NPC85154
0.5034	Remote Similarity	NPC225791

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC476775 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7096
0.1-0.2	2013
0.2-0.3	37
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data