NPASS Compound

Natural Product: NPC478153

Natural Product ID	NPC478153
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	xanifolia-Y7
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,4aS,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bS)-7,8,9-trihydroxy-4,6a,6b,11,11,14b-hexamethyl-8a-(2-methylbutanoyloxymethyl)-10-[(Z)-2-methylbut-2-enoyl]oxy-2,3,4,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	xanifolia-Y7
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44560535
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 167174 0 0 0 0 0 0 0 0999 V2000 -8.6588 -2.0775 6.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6832 -1.5402 5.1082 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8715 -2.1683 3.7642 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6785 -3.6888 3.8705 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7713 -1.7338 2.8165 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9290 -0.9297 3.2590 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6913 -2.1915 1.5482 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8974 -2.0191 0.4877 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8851 -0.7507 -0.3409 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8549 -0.9666 -1.4288 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4779 -1.2175 -2.7459 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5481 -0.2930 -3.2106 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4552 0.1554 -2.1214 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2952 -0.5821 -0.8696 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1381 -0.0935 0.1593 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8218 0.1450 -2.5787 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5626 1.2697 -2.7807 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0076 2.3646 -2.5549 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9384 1.2761 -3.2374 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6061 2.3916 -3.4231 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0043 3.7381 -3.1788 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6628 0.0013 -3.5221 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9490 0.9153 -3.8949 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3584 -0.9758 -4.3420 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5841 -0.2455 -1.3450 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6987 -0.3157 -2.3717 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3834 0.3615 -2.4097 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8183 0.6217 -1.0651 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6486 0.3723 -0.8890 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3651 1.3946 -1.7947 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1820 2.3888 -1.0219 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1631 1.7679 -0.0728 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5532 0.5919 0.6479 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0482 0.7354 0.4989 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2874 0.0739 1.5881 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1830 0.3786 1.3981 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6705 0.0312 0.0422 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0953 0.5478 -0.1869 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0321 0.3269 0.9451 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4553 0.4087 0.4836 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6696 1.5576 -0.3295 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8593 1.4181 1.8357 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9939 2.0296 -0.3663 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6206 -1.4770 -0.0623 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9124 0.5679 2.1248 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3595 1.4276 -0.6990 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4517 2.0157 -0.1422 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5347 1.0205 0.1764 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4390 1.6998 1.1634 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1012 2.8415 0.3391 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9752 3.6773 -0.2153 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0845 2.9577 -1.0128 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6183 4.7045 -1.0941 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3280 4.8106 -2.3063 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5722 5.5846 -0.5772 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9091 3.6290 1.1202 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4415 0.8862 1.6735 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5477 0.9439 3.0387 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8010 -0.3277 3.7574 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2916 -0.5882 3.6652 C 0 0 2 0 0 0 0 0 0 0 0 0 10.7889 0.7350 3.0657 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7689 1.6394 3.2874 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0192 1.0920 3.8978 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4568 2.3767 3.5501 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5065 -1.6503 2.8239 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5146 -0.0878 5.1257 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0486 -0.2100 0.5344 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5086 -1.1539 -0.3732 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0130 -2.4223 0.1840 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4094 -3.3532 -0.9614 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1449 -3.5928 -1.7796 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6957 -2.2258 -2.2355 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3038 -1.5197 -1.0977 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5332 -2.3547 -3.1570 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0777 -1.0992 -3.5771 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3268 -4.4761 -2.8130 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6632 -4.5920 -0.3241 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1351 -2.3014 0.9952 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1732 -0.9518 -1.2705 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6452 -2.1873 5.6530 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2602 -3.0701 6.4774 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6413 -1.4214 7.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8016 -0.4501 5.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6629 -1.7579 5.5163 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8659 -1.9508 3.3861 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7991 -4.1409 2.8537 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5124 -4.0845 4.4811 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6813 -3.9003 4.3151 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8080 -2.1309 0.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9809 -2.9055 -0.2506 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4755 -2.0566 -1.1583 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0478 -2.2286 -2.6463 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7499 -1.4794 -3.5174 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2851 1.2385 -1.9748 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6951 -1.6280 -1.0392 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1735 0.9160 0.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6452 2.3543 -3.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1394 3.9303 -3.8640 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7291 3.8882 -2.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7476 4.5239 -3.4228 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0860 0.1092 -4.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9385 -0.8191 -3.4359 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4979 -0.1759 -2.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9481 1.1535 -3.4833 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7440 0.6757 -4.9803 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5804 1.8178 -3.8055 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9476 -1.8010 -3.9502 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8701 -0.2094 -4.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5750 -1.4140 -5.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0277 -0.9338 -3.1907 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7362 -0.2746 -3.0562 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5333 1.2896 -3.0304 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8578 1.7542 -0.9891 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0469 0.8962 -2.5166 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6570 1.9663 -2.4157 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8269 2.8882 -1.8132 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6033 3.2361 -0.6040 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4201 2.5029 0.7382 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9709 -0.3184 0.2169 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8465 1.8454 0.6174 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5201 -0.9750 1.7869 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5675 0.6157 2.5441 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7273 -0.3038 2.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3751 1.3839 1.7549 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8735 -0.5746 1.5195 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0952 0.6371 1.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2077 1.5173 -1.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2415 1.1579 2.6898 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0902 2.4575 0.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7749 2.6144 0.2269 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8921 2.3813 -1.4007 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3198 -1.8460 -1.0564 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5618 -1.9656 0.2971 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8712 -1.8569 0.6619 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4935 1.4154 2.6757 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9874 0.4153 2.2181 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4288 -0.3571 2.5342 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2282 2.6168 0.7676 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1664 0.9334 -0.7733 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8440 2.2327 1.9015 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6362 2.3045 -0.4644 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4577 4.1664 0.6229 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3594 5.9301 -1.1176 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7107 3.8588 0.5730 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7897 1.5963 3.5187 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1928 -1.1875 3.4821 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7053 -0.7723 4.6733 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0771 0.6019 2.0175 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8460 0.9776 4.9667 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8526 0.3968 3.6133 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4641 2.4409 2.5572 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8580 -2.4109 3.3785 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7648 -0.9081 5.6522 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1968 -0.7360 -1.1376 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1977 -3.0101 0.7166 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2542 -3.0026 -1.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3811 -3.9620 -1.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5763 -1.7303 -2.7148 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6409 -2.8120 -2.6338 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7333 -3.0456 -3.9990 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1027 -1.1847 -3.8196 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0698 -4.2271 -3.3927 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8343 -5.0954 -0.1595 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3067 -3.2242 1.3544 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2650 -0.8619 -1.5808 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2246 -1.6634 -0.4232 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7218 -1.4026 -2.1776 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 9 8 1 1 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 13 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 2 0 20 21 1 0 19 22 1 0 12 23 1 0 12 24 1 0 10 25 1 0 25 26 2 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 6 37 44 1 1 33 45 1 0 32 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 2 0 53 55 1 0 50 56 1 0 49 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 63 64 1 0 60 65 1 0 59 66 1 0 48 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 72 74 1 0 74 75 1 0 71 76 1 0 70 77 1 0 69 78 1 0 29 79 1 6 14 9 1 0 40 9 1 0 38 25 1 0 37 28 1 0 34 29 1 0 52 47 1 0 62 58 1 0 73 68 1 0 1 80 1 0 1 81 1 0 1 82 1 0 2 83 1 0 2 84 1 0 3 85 1 0 4 86 1 0 4 87 1 0 4 88 1 0 8 89 1 0 8 90 1 0 10 91 1 1 11 92 1 0 11 93 1 0 13 94 1 1 14 95 1 6 15 96 1 0 20 97 1 0 21 98 1 0 21 99 1 0 21100 1 0 22101 1 0 22102 1 0 22103 1 0 23104 1 0 23105 1 0 23106 1 0 24107 1 0 24108 1 0 24109 1 0 26110 1 0 27111 1 0 27112 1 0 28113 1 1 30114 1 0 30115 1 0 31116 1 0 31117 1 0 32118 1 1 33119 1 6 34120 1 6 35121 1 0 35122 1 0 36123 1 0 36124 1 0 39125 1 1 40126 1 1 41127 1 0 42128 1 0 43129 1 0 43130 1 0 43131 1 0 44132 1 0 44133 1 0 44134 1 0 45135 1 0 45136 1 0 45137 1 0 47138 1 1 48139 1 6 49140 1 1 50141 1 6 51142 1 1 55143 1 0 56144 1 0 58145 1 1 59146 1 6 60147 1 1 61148 1 6 63149 1 0 63150 1 0 64151 1 0 65152 1 0 66153 1 0 68154 1 6 69155 1 1 70156 1 6 71157 1 1 72158 1 6 74159 1 0 74160 1 0 75161 1 0 76162 1 0 77163 1 0 78164 1 0 79165 1 0 79166 1 0 79167 1 0 M END

Standard InCHIKey	QDLZZMIWQVFNSK-SHJOIDNASA-N
Standard InCHI	InChI=1S/C56H88O23/c1-11-23(3)47(70)72-22-56-28(19-52(6,7)45(44(56)67)79-48(71)24(4)12-2)27-13-14-32-53(8)17-16-29(25(5)26(53)15-18-54(32,9)55(27,10)42(65)43(56)66)73-51-41(78-50-37(63)35(61)33(59)30(20-57)74-50)39(38(64)40(77-51)46(68)69)76-49-36(62)34(60)31(21-58)75-49/h12-13,23,25-26,28-45,49-51,57-67H,11,14-22H2,1-10H3,(H,68,69)/b24-12-/t23?,25-,26-,28-,29-,30+,31-,32+,33+,34-,35-,36+,37+,38-,39-,40-,41+,42-,43+,44-,45-,49-,50-,51+,53-,54+,55-,56-/m0/s1
SMILES	CCC(C)C(=O)OC[C@@]12[C@@H](CC([C@H]([C@@H]1O)OC(=O)/C(=C\C)/C)(C)C)C3=CC[C@@H]4[C@]5(CC[C@@H]([C@H]([C@@H]5CC[C@]4([C@@]3([C@H]([C@H]2O)O)C)C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1128.57	Volume:	1097.673 ? Van der Waals volume.
Dense:	1.028	LogP:	1.357 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.414 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.941 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	47.0
TPSA:	367.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.044	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.073	Fsp³:	0.875
MCE-18:	180.038 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.73	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.225	Promiscuous compounds:	0.245

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.34	MDCK Permeability:	-5.171
Pgp-inhibitor:	0.0	Pgp-substrate:	0.091
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.161
20% Bioavailability (F20%):	0.895	30% Bioavailability (F30%):	0.984
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.929
Plasma Protein Binding (PPB):	76.944%	Volume Distribution (VD):	-0.525
Fu:	15.38% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.659	BCRP inhibitor:	0.001
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.343	CYP3A4-substrate:	0.248
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.007
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.163

Half-life (T1/2):

3.141

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.56	Drug-induced Liver Injury (DILI):	0.967
AMES Toxicity:	0.922	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.114	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.889	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.827	RPMI-8226 Immunitoxicity:	0.26
A549 Cytotoxicity:	0.897	Hek293 Cytotoxicity:	0.315
BCF:	0.379 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.351 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.231 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.005 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT377	Cell line	OVCAR-3	Homo sapiens	IC50	=	13100	nM	PMID[18549275]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478153 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22629
0.1-0.2	23353
0.2-0.3	3208
0.3-0.4	542
0.4-0.5	91
0.5-0.6	25
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7521	Intermediate Similarity	NPC478152
0.7417	Intermediate Similarity	NPC478150
0.686	Remote Similarity	NPC605294
0.6829	Remote Similarity	NPC478155
0.627	Remote Similarity	NPC478151
0.624	Remote Similarity	NPC329976
0.622	Remote Similarity	NPC609119
0.6103	Remote Similarity	NPC476775
0.5899	Remote Similarity	NPC476778
0.5857	Remote Similarity	NPC476776
0.5735	Remote Similarity	NPC476774
0.5682	Remote Similarity	NPC478154
0.5649	Remote Similarity	NPC25998
0.563	Remote Similarity	NPC473918
0.5588	Remote Similarity	NPC192765
0.5547	Remote Similarity	NPC178264
0.5515	Remote Similarity	NPC46823
0.5484	Remote Similarity	NPC603026
0.5474	Remote Similarity	NPC71391
0.5401	Remote Similarity	NPC252289
0.5401	Remote Similarity	NPC277212
0.5401	Remote Similarity	NPC30279
0.5401	Remote Similarity	NPC305793
0.5362	Remote Similarity	NPC329828
0.5328	Remote Similarity	NPC602995
0.5241	Remote Similarity	NPC279915
0.5177	Remote Similarity	NPC476780
0.5139	Remote Similarity	NPC11577
0.5139	Remote Similarity	NPC141600
0.5115	Remote Similarity	NPC611191
0.5105	Remote Similarity	NPC484833
0.5071	Remote Similarity	NPC47995
0.5035	Remote Similarity	NPC271610

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478153 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7131
0.1-0.2	1965
0.2-0.3	52
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data