NPASS Compound

Natural Product: NPC478150

Natural Product ID	NPC478150
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Xanifolia-Y0
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,4aS,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bS)-7,8-dihydroxy-8a-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-9-(2-methylpropanoyloxy)-2,3,4,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	Xanifolia-Y0
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44560532
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 164171 0 0 0 0 0 0 0 0999 V2000 10.7542 0.7516 2.2891 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9821 2.1905 2.0931 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0930 3.0184 1.5954 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4325 4.4715 1.4386 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7861 2.5375 1.1938 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9486 3.3566 0.7157 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3800 1.2185 1.2961 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0715 0.8147 0.8673 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2836 -0.2731 -0.1322 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9652 -0.7965 -0.7103 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1600 -1.3088 0.4128 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1951 -0.6154 1.7234 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3184 0.2917 2.0266 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7591 1.5170 2.7730 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2894 -0.3418 3.0374 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7022 -1.4704 0.0223 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1241 -2.5714 0.4386 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6724 -2.8766 0.1280 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0651 -1.5016 0.0335 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4333 -1.4732 0.1431 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7624 -2.1592 1.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9410 -1.6322 2.1729 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8806 -0.7227 1.4310 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2963 0.0893 0.3383 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7999 -0.0537 0.3499 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1227 0.9089 -0.5843 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7586 0.2984 -1.6092 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6505 -0.8007 -1.1565 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0515 -0.3878 -0.7996 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9406 -0.1714 -2.0375 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3588 0.0954 -1.6758 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6145 1.4644 -1.4940 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5497 1.0346 -2.6786 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0320 0.9258 -0.1058 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7987 -1.7526 -2.3556 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6153 1.5878 0.5109 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0631 -1.4090 1.0700 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1565 -1.0783 1.8624 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2977 -0.4410 1.1596 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4900 -0.2264 2.0247 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6564 -1.3665 3.0439 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7304 -2.5067 2.8024 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4441 -2.1042 2.7401 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0713 -3.3570 1.6418 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1609 -3.6349 0.7949 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3187 -3.8845 1.3915 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3795 -0.8289 4.3067 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6628 -0.3357 1.2439 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5593 0.6985 1.4952 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0898 1.2938 0.2424 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.4010 0.5520 0.0079 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.7588 0.1415 1.4018 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6351 0.0596 2.1512 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7749 1.0614 2.0643 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2490 2.3382 2.2234 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1394 -0.5915 -0.7606 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3631 2.6699 0.4319 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9013 0.7906 0.5994 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2006 0.9561 -0.7208 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6105 2.3358 -1.1013 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0317 2.3699 -2.5469 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6380 1.1437 -3.2949 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4502 0.4055 -2.7935 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0070 0.7442 -1.5276 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3064 0.4756 -3.8063 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2762 -0.3927 -3.4681 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3814 1.5529 -4.6275 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5531 3.5441 -3.1725 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4235 2.9992 -0.2297 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1671 -2.2491 -0.8724 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4438 -2.0499 -1.5048 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3767 -2.6668 -2.0966 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2404 0.0047 -1.1007 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3939 -0.7196 -1.2547 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5553 -1.6830 -0.4531 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4135 -0.4070 -2.3034 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7239 -0.4441 -3.6656 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5259 -1.4093 -2.3347 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7307 0.2817 2.5891 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0568 0.5269 3.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4983 0.2477 1.3318 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9476 2.6390 2.3687 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4897 5.0056 2.3983 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6566 4.9301 0.8180 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4417 4.5272 0.9417 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5732 1.7212 0.5110 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6747 -1.1553 0.4441 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5953 -2.3453 0.6168 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2333 -1.4306 2.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2306 -0.1169 1.9932 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5533 2.2763 1.9908 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7484 1.2458 3.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4425 1.8648 3.5593 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0924 -0.8933 2.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7386 0.4724 3.6387 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7192 -0.9851 3.7591 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6209 -3.3352 1.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5610 -3.4740 -0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2287 -3.4642 0.9438 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4058 -0.9927 0.9925 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8445 -3.2755 1.3136 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1219 -2.0749 2.1699 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5753 -2.5127 2.5103 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6496 -1.1804 3.1706 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2186 0.0058 2.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7115 -0.1694 -0.6730 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4658 0.2320 1.3846 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9618 1.4342 -1.1394 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3733 1.7497 -0.0630 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0767 -0.0827 -2.4329 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2595 1.1454 -2.1366 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9010 -1.0128 -2.7231 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9202 -0.0888 -2.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2966 1.9767 -2.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5886 0.8934 -3.6683 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6305 1.6817 -0.8115 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0325 1.3236 0.1605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4480 0.9712 0.8151 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8499 -2.2737 -2.5941 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6117 -2.4727 -2.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9573 -1.0962 -3.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7146 2.1157 0.9011 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8979 2.0644 -0.4433 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4402 1.7250 1.2241 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7547 -0.2604 2.5700 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6354 -1.0394 0.2753 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5117 0.7330 2.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6899 -1.7603 3.0130 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7969 -3.2248 3.7057 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4859 -4.6248 0.7093 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1131 -1.0426 4.9604 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1121 1.4492 2.2060 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4317 1.2118 -0.6344 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1532 1.1847 -0.4740 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2108 -0.8857 1.3090 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7226 1.0928 1.4924 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9041 0.6353 3.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8793 2.9232 2.6941 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2502 -0.9197 -0.5002 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7709 2.9488 1.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8861 0.1794 -1.0919 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6277 2.9427 -1.0815 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1388 2.4696 -2.5725 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5354 0.4715 -3.3612 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7369 -0.6882 -2.7215 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7181 0.1658 -4.7809 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9324 1.5175 -3.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6461 -1.2225 -3.0751 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8460 2.3768 -4.6580 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3822 4.2666 -2.5033 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5298 3.9399 -0.5148 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1419 -2.6078 -0.4216 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6127 -3.2255 -0.9948 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4327 -1.7862 -1.8086 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9005 -2.7700 -0.7648 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2502 -1.7605 -2.1895 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3647 -3.6219 -1.8990 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8192 0.6137 -2.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4363 -0.4498 -4.5015 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0990 -1.3540 -3.7568 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0790 0.4670 -3.7828 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4318 -2.2292 -1.6121 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5044 -0.8900 -2.1201 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6665 -1.8656 -3.3503 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 11 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 29 34 1 1 28 35 1 6 24 36 1 0 23 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 2 0 44 46 1 0 41 47 1 0 40 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 51 56 1 0 50 57 1 0 39 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 65 66 1 0 62 67 1 0 61 68 1 0 60 69 1 0 20 70 1 6 10 71 1 6 71 72 1 0 9 73 1 0 73 74 1 0 74 75 2 0 74 76 1 0 76 77 1 0 76 78 1 0 13 8 1 0 31 10 1 0 29 16 1 0 28 19 1 0 25 20 1 0 43 38 1 0 53 49 1 0 64 59 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 4 83 1 0 4 84 1 0 4 85 1 0 8 86 1 6 9 87 1 1 11 88 1 1 12 89 1 0 12 90 1 0 14 91 1 0 14 92 1 0 14 93 1 0 15 94 1 0 15 95 1 0 15 96 1 0 17 97 1 0 18 98 1 0 18 99 1 0 19100 1 1 21101 1 0 21102 1 0 22103 1 0 22104 1 0 23105 1 1 24106 1 6 25107 1 1 26108 1 0 26109 1 0 27110 1 0 27111 1 0 30112 1 6 31113 1 6 32114 1 0 33115 1 0 34116 1 0 34117 1 0 34118 1 0 35119 1 0 35120 1 0 35121 1 0 36122 1 0 36123 1 0 36124 1 0 38125 1 1 39126 1 6 40127 1 1 41128 1 1 42129 1 1 46130 1 0 47131 1 0 49132 1 1 50133 1 6 51134 1 6 52135 1 6 54136 1 0 54137 1 0 55138 1 0 56139 1 0 57140 1 0 59141 1 6 60142 1 6 61143 1 1 62144 1 6 63145 1 1 65146 1 0 65147 1 0 66148 1 0 67149 1 0 68150 1 0 69151 1 0 70152 1 0 70153 1 0 70154 1 0 71155 1 0 71156 1 0 72157 1 0 76158 1 0 77159 1 0 77160 1 0 77161 1 0 78162 1 0 78163 1 0 78164 1 0 M END

Standard InCHIKey	WQGCJSVCEJXKJA-JDJXESOBSA-N
Standard InCHI	InChI=1S/C55H86O23/c1-11-23(4)47(70)77-43-44(78-46(69)22(2)3)55(21-58)27(18-51(43,6)7)26-12-13-31-52(8)16-15-28(24(5)25(52)14-17-53(31,9)54(26,10)41(65)42(55)66)71-50-40(76-49-36(63)34(61)32(59)29(19-56)72-49)38(37(64)39(75-50)45(67)68)74-48-35(62)33(60)30(20-57)73-48/h11-12,22,24-25,27-44,48-50,56-66H,13-21H2,1-10H3,(H,67,68)/b23-11-/t24-,25-,27-,28-,29+,30-,31+,32-,33-,34-,35+,36+,37-,38-,39-,40+,41-,42+,43-,44-,48-,49-,50+,52-,53+,54-,55-/m0/s1
SMILES	C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@]2([C@@H](CC1(C)C)C3=CC[C@@H]4[C@]5(CC[C@@H]([C@H]([C@@H]5CC[C@]4([C@@]3([C@H]([C@H]2O)O)C)C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)C)CO)OC(=O)C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1114.56	Volume:	1080.377 ? Van der Waals volume.
Dense:	1.032	LogP:	1.102 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.153 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.183 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	47.0
TPSA:	367.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.045	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.011	Fsp³:	0.873
MCE-18:	180.893 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.745	Fluc inhibitor:	0.007 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.25	Promiscuous compounds:	0.23

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.398	MDCK Permeability:	-5.171
Pgp-inhibitor:	0.0	Pgp-substrate:	0.021
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.038
20% Bioavailability (F20%):	0.976	30% Bioavailability (F30%):	0.989
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.996
Plasma Protein Binding (PPB):	77.74%	Volume Distribution (VD):	-0.475
Fu:	13.858% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.008	BCRP inhibitor:	0.0
BSEP inhibitor:	0.003

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.091	CYP3A4-substrate:	0.131
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.187
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.027

Half-life (T1/2):

2.516

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.617	Drug-induced Liver Injury (DILI):	0.981
AMES Toxicity:	0.973	Rat Oral Acute Toxicity:	0.014
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.197	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.007
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.974	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.919	RPMI-8226 Immunitoxicity:	0.241
A549 Cytotoxicity:	0.99	Hek293 Cytotoxicity:	0.6
BCF:	0.356 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.378 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.357 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.104 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT377	Cell line	OVCAR-3	Homo sapiens	IC50	=	4200	nM	PMID[18549275]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478150 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22467
0.1-0.2	23377
0.2-0.3	3326
0.3-0.4	535
0.4-0.5	85
0.5-0.6	47
0.6-0.7	15
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9604	High Similarity	NPC478152
0.8182	Intermediate Similarity	NPC478155
0.7982	Intermediate Similarity	NPC329976
0.7838	Intermediate Similarity	NPC478151
0.7417	Intermediate Similarity	NPC478153
0.7	Intermediate Similarity	NPC46823
0.6942	Remote Similarity	NPC192765
0.6885	Remote Similarity	NPC178264
0.678	Remote Similarity	NPC25998
0.6695	Remote Similarity	NPC605294
0.6667	Remote Similarity	NPC478154
0.64	Remote Similarity	NPC329828
0.6328	Remote Similarity	NPC484833
0.632	Remote Similarity	NPC473918
0.624	Remote Similarity	NPC602995
0.6124	Remote Similarity	NPC262796
0.6124	Remote Similarity	NPC45346
0.6063	Remote Similarity	NPC277212
0.6063	Remote Similarity	NPC30279
0.6047	Remote Similarity	NPC476780
0.6016	Remote Similarity	NPC71391
0.5984	Remote Similarity	NPC477077
0.5948	Remote Similarity	NPC603026
0.592	Remote Similarity	NPC609119
0.5878	Remote Similarity	NPC271610
0.5873	Remote Similarity	NPC478600
0.5873	Remote Similarity	NPC478599
0.5846	Remote Similarity	NPC478598
0.582	Remote Similarity	NPC470914
0.5789	Remote Similarity	NPC475377
0.5789	Remote Similarity	NPC476074
0.5789	Remote Similarity	NPC476777
0.5656	Remote Similarity	NPC470913
0.5649	Remote Similarity	NPC329923
0.5649	Remote Similarity	NPC475281
0.5635	Remote Similarity	NPC477197
0.5547	Remote Similarity	NPC329960
0.5441	Remote Similarity	NPC329657
0.5354	Remote Similarity	NPC477078
0.5349	Remote Similarity	NPC107536
0.5349	Remote Similarity	NPC280029
0.5349	Remote Similarity	NPC9470
0.5338	Remote Similarity	NPC47995
0.5333	Remote Similarity	NPC488308
0.5333	Remote Similarity	NPC476774
0.5324	Remote Similarity	NPC488309
0.5294	Remote Similarity	NPC225791
0.5294	Remote Similarity	NPC312650
0.5255	Remote Similarity	NPC484059
0.5255	Remote Similarity	NPC484060
0.5245	Remote Similarity	NPC150893
0.5221	Remote Similarity	NPC265841
0.5217	Remote Similarity	NPC110700
0.5185	Remote Similarity	NPC475167
0.5185	Remote Similarity	NPC82380
0.5185	Remote Similarity	NPC244296
0.5161	Remote Similarity	NPC605226
0.5156	Remote Similarity	NPC477076
0.5147	Remote Similarity	NPC134914
0.5147	Remote Similarity	NPC473755
0.5147	Remote Similarity	NPC484061
0.5147	Remote Similarity	NPC484062
0.5145	Remote Similarity	NPC476779
0.5143	Remote Similarity	NPC476775
0.5072	Remote Similarity	NPC475513
0.5072	Remote Similarity	NPC329993
0.5037	Remote Similarity	NPC264566
0.5036	Remote Similarity	NPC470518

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478150 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7061
0.1-0.2	2030
0.2-0.3	57
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data