NPASS Compound

Natural Product: NPC262796

Natural Product ID	NPC262796
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Symplocososide L
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,7R,8S,8aR,9R,10R,12aS,14aR,14bR)-10-[(2Z)-3,7-dimethylocta-2,6-dienoyl]oxy-7,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9-(2-methylpropanoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-acetyloxy-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	symplocososide L
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL498883
PubChem CID	16099389
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 185192 0 0 0 0 0 0 0 0999 V2000 14.1929 -0.4711 4.1541 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0985 -1.0941 3.3199 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0444 -0.4150 2.9045 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9093 -0.7839 2.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7636 -0.1466 0.7383 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8678 1.2962 0.8251 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8632 2.0906 0.5822 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5420 1.7162 0.2060 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7197 2.7161 0.0707 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9618 0.5067 -0.0417 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5550 0.4262 -0.3781 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5031 0.0089 -1.8383 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0738 -0.1924 -2.2928 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2243 -1.0291 -3.5833 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9627 -0.2663 -4.4727 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2215 -1.0106 -1.3789 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5179 -1.0092 0.0576 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9250 -0.6108 0.4318 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8460 -0.0992 1.8711 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8091 -1.8512 0.4565 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7942 -0.6780 -1.6471 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0093 -1.6584 -1.9950 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5664 -1.4725 -2.2973 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1441 -0.4059 -1.3170 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3364 -0.4578 -1.0498 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1732 -0.4051 -2.3063 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5942 -1.8127 -0.4181 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2510 -1.8182 0.8928 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3604 -0.8138 1.0471 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0084 0.5483 0.5846 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9070 1.4433 1.8351 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1159 1.1564 -0.2355 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6716 0.5724 -0.0420 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2151 1.9242 -0.5613 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3210 1.8513 -0.5574 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8125 0.8616 -1.6472 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3801 1.5220 -2.9356 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2887 0.7052 -1.5900 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8388 1.5723 -0.4992 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0318 1.2764 -2.8335 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5256 1.1064 -2.7288 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1652 2.2243 -2.1601 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8413 2.6422 -2.9648 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5183 -1.3534 0.4794 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3867 -1.8972 1.3911 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6584 -1.1461 1.6079 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7173 -2.2726 1.8189 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7653 -2.8853 0.3705 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4990 -3.6252 0.2486 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8764 -3.6596 -1.0934 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6828 -3.3847 -1.3197 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6304 -4.0179 -2.2303 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5657 -3.2634 1.2242 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9449 -3.5806 0.2423 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8158 -2.8126 -0.5435 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3741 -3.5130 -1.7392 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.6162 -2.6536 -2.0427 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8078 -1.9384 -0.7373 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4767 -0.4519 -0.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3202 0.1634 -1.7797 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9627 -2.4973 0.1993 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6907 -3.4759 -2.3725 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5193 -3.4940 -2.8384 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9577 -1.7978 2.1782 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6015 -2.3170 3.2914 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9922 -3.2330 3.9414 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9273 -1.8939 3.7797 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6765 -0.2911 2.6784 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3534 0.8956 2.4941 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4027 1.1149 3.5526 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9951 2.1799 4.5501 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8598 3.5155 3.8269 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3578 3.1464 2.4254 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6705 4.3653 1.8732 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6493 5.3836 1.8601 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5054 2.0321 2.5153 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0870 4.1413 3.8076 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8101 1.8815 5.1816 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6447 1.4152 3.0445 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1214 0.9461 -2.6655 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2430 0.7103 -3.4157 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8011 -0.4098 -3.3882 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8378 1.7657 -4.2885 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3641 2.9353 -3.5323 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7500 1.1440 -5.2800 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2270 1.8949 1.1454 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2633 -2.5369 2.9825 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7634 -0.3444 5.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4382 0.5418 3.7898 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0538 -1.1381 4.2542 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0566 0.6615 3.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8522 -1.9059 2.0118 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9646 -0.5340 2.6694 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6095 -0.6009 0.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8589 -0.5699 0.3122 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1143 3.1749 0.6911 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1098 1.4324 -0.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0332 -0.9614 -1.8747 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7343 -1.9580 -3.2578 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1850 -1.2027 -3.9240 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3547 -0.7821 -5.2179 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4135 -2.0967 -1.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7823 -0.4766 0.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4306 -2.0533 0.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6317 0.6453 2.0712 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8665 0.4432 2.0274 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8482 -0.9288 2.5882 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7543 -1.6777 -0.0923 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9568 -2.1371 1.5135 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2514 -2.6903 -0.0227 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3777 -2.6990 -2.0868 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0197 -2.3870 -2.2217 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4355 -1.1254 -3.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5869 -0.7268 -0.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0012 -1.1826 -2.2671 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7069 0.5271 -2.4768 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5515 -0.7345 -3.1700 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6325 -2.3912 -0.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1737 -2.4831 -1.1191 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7502 -2.8299 1.0110 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5474 -1.8005 1.7617 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5598 -0.8656 2.1812 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1750 2.4957 1.5813 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8626 1.4759 2.2149 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6149 1.1177 2.6238 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9908 1.4169 0.3616 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7566 1.9895 -0.8800 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4667 0.3655 -0.9332 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9506 0.3705 0.8165 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4372 2.7173 0.2097 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6463 2.2402 -1.4930 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5217 1.3302 0.4015 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7532 2.8391 -0.6652 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8295 1.1255 -3.8443 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7016 1.4932 -3.1216 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5645 2.6309 -2.7941 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4220 1.5024 0.4868 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6538 2.6338 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9188 1.5419 -0.3990 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7280 0.6745 -3.7063 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8565 1.2840 -3.8199 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6745 3.0568 -2.3556 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0380 2.8566 -3.9154 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8474 -1.8190 2.3996 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0800 -0.6076 0.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2622 -3.0392 2.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7607 -1.9695 -0.2536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7372 -4.7140 0.4963 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2309 -3.9341 -3.1618 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3176 -1.8783 -0.8759 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7096 -4.5391 -1.4827 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3313 -1.9442 -2.8147 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8824 -1.9712 -0.4081 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4476 -0.2647 -1.1617 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7055 0.0521 0.1376 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8277 0.9341 -2.1576 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3297 -4.1099 -3.0651 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6653 -2.7337 -3.4409 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9843 -1.9794 4.8760 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7047 -2.6066 3.3917 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2046 -0.9135 3.3875 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8376 0.8724 1.4974 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4943 0.1757 4.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7959 2.2838 5.2959 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0889 4.0925 4.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2341 2.8339 1.8289 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8273 4.6667 2.4943 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3918 4.2193 0.7887 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4160 6.1286 2.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7147 3.7917 4.5004 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4176 2.6576 5.6488 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3662 1.3150 3.7422 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9386 2.1613 -4.8626 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5901 3.2548 -2.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4721 3.7893 -4.2389 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2945 2.6502 -3.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7998 0.0345 -5.1777 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7736 1.5964 -5.2559 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3356 1.2833 -6.3242 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5387 2.4099 0.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1472 2.6004 1.9613 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9396 1.0708 1.2317 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7852 -3.1861 3.7470 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8022 -2.6870 1.9709 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3418 -2.7571 2.8872 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 14 15 1 0 13 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 16 21 1 0 21 22 2 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 6 36 38 1 0 38 39 1 1 38 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 29 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 49 53 1 0 48 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 56 63 1 0 47 64 1 0 64 65 1 0 65 66 2 0 65 67 1 0 46 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 72 77 1 0 71 78 1 0 70 79 1 0 12 80 1 0 80 81 1 0 81 82 2 0 81 83 1 0 83 84 1 0 83 85 1 0 6 86 1 0 2 87 1 0 18 11 1 0 38 21 1 0 53 45 1 0 61 55 1 0 76 69 1 0 41 13 1 0 36 24 1 0 33 25 1 0 1 88 1 0 1 89 1 0 1 90 1 0 3 91 1 0 4 92 1 0 4 93 1 0 5 94 1 0 5 95 1 0 7 96 1 0 11 97 1 6 12 98 1 1 14 99 1 0 14100 1 0 15101 1 0 16102 1 6 17103 1 0 17104 1 0 19105 1 0 19106 1 0 19107 1 0 20108 1 0 20109 1 0 20110 1 0 22111 1 0 23112 1 0 23113 1 0 24114 1 1 26115 1 0 26116 1 0 26117 1 0 27118 1 0 27119 1 0 28120 1 0 28121 1 0 29122 1 1 31123 1 0 31124 1 0 31125 1 0 32126 1 0 32127 1 0 32128 1 0 33129 1 1 34130 1 0 34131 1 0 35132 1 0 35133 1 0 37134 1 0 37135 1 0 37136 1 0 39137 1 0 39138 1 0 39139 1 0 40140 1 6 41141 1 6 42142 1 0 43143 1 0 45144 1 1 46145 1 6 47146 1 1 48147 1 6 49148 1 1 52149 1 0 55150 1 6 56151 1 1 57152 1 6 58153 1 1 59154 1 0 59155 1 0 60156 1 0 62157 1 0 63158 1 0 67159 1 0 67160 1 0 67161 1 0 69162 1 6 70163 1 1 71164 1 1 72165 1 1 73166 1 6 74167 1 0 74168 1 0 75169 1 0 77170 1 0 78171 1 0 79172 1 0 83173 1 0 84174 1 0 84175 1 0 84176 1 0 85177 1 0 85178 1 0 85179 1 0 86180 1 0 86181 1 0 86182 1 0 87183 1 0 87184 1 0 87185 1 0 M END

Standard InCHIKey	XPBNJNXKQVWGAY-XWVGWLPGSA-N
Standard InCHI	InChI=1S/C63H98O24/c1-28(2)15-14-16-30(5)23-39(68)83-51-52(87-54(78)29(3)4)63(27-66)33(24-58(51,7)8)32-17-18-37-60(11)21-20-38(59(9,10)36(60)19-22-61(37,12)62(32,13)49(74)50(63)75)82-57-48(86-56-44(73)42(71)40(69)34(25-64)80-56)46(79-31(6)67)45(47(85-57)53(76)77)84-55-43(72)41(70)35(26-65)81-55/h15,17,23,29,33-38,40-52,55-57,64-66,69-75H,14,16,18-22,24-27H2,1-13H3,(H,76,77)/b30-23-/t33-,34+,35-,36-,37+,38-,40+,41-,42-,43+,44+,45-,46-,47-,48+,49-,50+,51-,52-,55-,56-,57+,60-,61+,62-,63-/m0/s1
SMILES	CC(=CCC/C(=CC(=O)O[C@H]1[C@@H]([C@@]2(CO)[C@@H](CC1(C)C)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)[C@H]([C@H]2O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O[C@H]1[C@@H]([C@H]([C@H](CO)O1)O)O)OC(=O)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)C(C)C)/C)C

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	n.a.	n.a.	PMID[15620235]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	roots	Nanning City, Guangxi Province, People's Republic of China	1997-Jan	PMID[17190442]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8121	Symplocos chinensis	Species	Symplocaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT180	Cell line	HCT-8	Homo sapiens	IC50	=	1700.0	nM	PubChem BioAssay data set
NPT181	Cell line	Bel-7402	Homo sapiens	IC50	=	2700.0	nM	PubChem BioAssay data set
NPT547	Cell line	BGC-823	Homo sapiens	IC50	>	10000.0	nM	PubChem BioAssay data set
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[21868221]
NPT179	Cell line	A2780	Homo sapiens	IC50	=	2400.0	nM	PMID[22440015]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC262796 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21618
0.1-0.2	24297
0.2-0.3	3126
0.3-0.4	615
0.4-0.5	139
0.5-0.6	35
0.6-0.7	16
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC45346
0.9459	High Similarity	NPC475377
0.9459	High Similarity	NPC476074
0.8496	Intermediate Similarity	NPC264566
0.8361	Intermediate Similarity	NPC150893
0.7769	Intermediate Similarity	NPC484833
0.7583	Intermediate Similarity	NPC329923
0.7583	Intermediate Similarity	NPC475281
0.7583	Intermediate Similarity	NPC475167
0.752	Intermediate Similarity	NPC329960
0.6975	Remote Similarity	NPC329976
0.6825	Remote Similarity	NPC134914
0.6719	Remote Similarity	NPC329993
0.6718	Remote Similarity	NPC295408
0.6612	Remote Similarity	NPC477078
0.6565	Remote Similarity	NPC173435
0.6565	Remote Similarity	NPC172374
0.6565	Remote Similarity	NPC478064
0.6308	Remote Similarity	NPC178264
0.6308	Remote Similarity	NPC473755
0.6279	Remote Similarity	NPC46823
0.6231	Remote Similarity	NPC192765
0.6124	Remote Similarity	NPC478150
0.6119	Remote Similarity	NPC329657
0.608	Remote Similarity	NPC477077
0.6048	Remote Similarity	NPC470914
0.5985	Remote Similarity	NPC301639
0.5985	Remote Similarity	NPC478065
0.5984	Remote Similarity	NPC605294
0.5938	Remote Similarity	NPC25998
0.5814	Remote Similarity	NPC478152
0.5814	Remote Similarity	NPC478151
0.5789	Remote Similarity	NPC470912
0.5789	Remote Similarity	NPC473918
0.5785	Remote Similarity	NPC603026
0.576	Remote Similarity	NPC470913
0.5752	Remote Similarity	NPC473586
0.5748	Remote Similarity	NPC477075
0.5672	Remote Similarity	NPC277212
0.5672	Remote Similarity	NPC30279
0.563	Remote Similarity	NPC71391
0.563	Remote Similarity	NPC329828
0.562	Remote Similarity	NPC475513
0.562	Remote Similarity	NPC225791
0.5615	Remote Similarity	NPC606553
0.5597	Remote Similarity	NPC602995
0.5507	Remote Similarity	NPC312650
0.5435	Remote Similarity	NPC488308
0.5423	Remote Similarity	NPC488309
0.5417	Remote Similarity	NPC69425
0.5396	Remote Similarity	NPC271610
0.5299	Remote Similarity	NPC609119
0.5267	Remote Similarity	NPC477076
0.5224	Remote Similarity	NPC107536
0.5224	Remote Similarity	NPC280029
0.5224	Remote Similarity	NPC9470
0.5143	Remote Similarity	NPC470518
0.5039	Remote Similarity	NPC605226
0.5036	Remote Similarity	NPC478600
0.5036	Remote Similarity	NPC478599
0.5035	Remote Similarity	NPC478598

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC262796 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6897
0.1-0.2	2203
0.2-0.3	47
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data