NPASS Compound

Natural Product: NPC313110

Natural Product ID	NPC313110
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-{[Alpha-L-Rhamnopyranosyl-(1->2)-Beta-D-Galactopyranosyl-(1->2)-Beta-D-Glucuronopyranosyl}-22-O-[Alpha-L-Rhamnopyranosyl-(1->2)-Alpha-L-Arabinopyranosyl]-3Beta,22Beta,24-Trihydroxyolean-12-Ene
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4R,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL510721
PubChem CID	44566980
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 10.2812 2.3901 1.0133 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8440 1.0311 0.7619 C 0 0 1 0 0 0 0 0 0 0 0 0 12.3667 1.0697 0.9145 C 0 0 1 0 0 0 0 0 0 0 0 0 12.9087 -0.3247 0.6171 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1533 -1.3706 1.3753 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6716 -1.1861 1.1727 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2895 0.0739 1.5865 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3117 -1.4120 -0.1376 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4980 -2.5130 -0.2824 C 0 0 2 0 0 0 0 0 0 0 0 0 10.1233 -3.6039 -1.1408 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1231 -4.7691 -1.1457 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8277 -4.2323 -1.7023 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3141 -3.3348 -0.7621 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1422 -2.1382 -0.7987 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4891 -1.2831 0.0288 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7816 -0.2535 -0.6184 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4037 1.0560 -0.2152 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6734 2.2684 -0.7217 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7155 3.3593 0.3429 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3325 2.7901 -1.9574 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1920 1.9819 -0.9455 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8074 0.9813 0.1210 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3604 0.9325 0.3602 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8849 1.5983 1.4036 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4732 1.6703 1.8037 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5914 1.0410 0.7554 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8386 0.9549 1.1596 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0957 0.4265 2.5360 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3171 2.4271 1.2266 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7660 2.5013 1.5223 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6275 1.6372 0.6476 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0943 0.3346 0.2293 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6685 -0.7625 1.0738 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6336 0.0757 -1.1972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2178 1.0644 -2.0727 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6038 0.2596 0.0742 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0760 -1.1100 -0.1263 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3557 -1.0698 -0.6135 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2346 -0.2220 0.2696 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6820 -1.0969 1.4268 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4495 0.1688 -0.5475 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0731 1.1546 -1.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0807 -1.0060 -1.1921 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5657 -0.9796 -1.3277 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3218 -0.3781 -0.1956 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2822 -1.2572 1.0334 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8484 1.5083 1.3625 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8801 2.1859 0.7708 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1962 1.5073 0.6976 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1752 2.3816 -0.0547 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9297 3.8393 0.0006 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7174 4.3094 0.7231 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0794 5.4924 1.5414 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6269 6.5158 1.0339 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8229 5.5029 2.8963 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1360 3.3661 1.5659 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8136 4.3120 -1.3338 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4571 2.1474 0.5112 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1993 0.2571 0.1025 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7296 -0.6637 0.9651 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9015 -1.4453 0.4409 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6525 -1.9319 1.6961 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6479 -2.7894 2.4451 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2867 -2.1889 2.5475 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3295 -3.3162 2.9435 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3186 -4.2350 1.8787 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7959 -1.6276 1.3866 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6435 -4.1120 1.9857 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7452 -2.7059 1.3583 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7185 -0.7572 -0.4105 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8673 -1.4337 -1.6368 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2877 -1.8664 -1.8479 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8102 -1.5699 -3.2254 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.3500 -0.2595 -3.7661 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.2026 0.3458 -3.0025 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4507 1.2781 -3.9645 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3316 -0.6606 -2.6300 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3890 0.6847 -3.8144 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5539 -2.6138 -4.1341 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4605 -3.2491 -1.6423 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9775 -5.1515 0.1900 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2542 -4.0835 -0.5389 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4602 -1.2819 2.7567 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2656 -0.3385 0.9304 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8765 1.9281 -0.0526 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4888 2.2936 1.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0592 3.1237 1.3534 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7773 2.8232 0.1320 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6514 0.7443 -0.3080 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6426 1.3585 1.9378 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7942 -0.4893 -0.4634 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4910 -2.3594 1.0459 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1505 -1.9569 1.8434 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4013 -2.9617 0.7450 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2759 -3.1935 -2.1451 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5264 -5.6134 -1.7399 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0308 -3.7511 -2.6794 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0963 -5.0491 -1.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1621 -1.8090 -1.8340 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9054 -0.3963 -1.7060 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6325 1.1079 0.8606 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4020 1.0724 -0.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8333 4.0253 0.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6146 4.0117 0.1710 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6501 2.9669 1.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1525 2.0952 -2.2962 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6401 2.8815 -2.8228 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7550 3.7964 -1.7887 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5784 2.8851 -0.8727 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0928 1.5935 -1.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3512 1.3116 1.0553 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5875 2.1589 2.0480 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3426 1.3094 2.8173 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2185 2.7707 1.8280 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6298 1.7537 -0.1245 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9258 -0.6301 2.6982 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6187 1.1105 3.2675 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2001 0.5805 2.7282 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9890 2.9994 0.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7807 2.8473 2.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0004 2.4091 2.6142 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0701 3.5756 1.3063 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8953 2.2522 -0.2413 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2487 -1.5198 0.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3806 -0.3973 1.8388 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9151 -1.3811 1.5991 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4533 -0.9449 -1.5270 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7455 0.1617 -1.0732 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0034 1.5011 -2.5004 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3696 0.8413 -0.8695 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6488 -1.6385 -0.9146 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0940 -1.7562 0.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3537 -0.7975 -1.6708 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7340 -2.1136 -0.5531 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0074 -0.5372 2.3067 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8363 -1.8098 1.6905 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5119 -1.7832 1.1739 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7434 0.9897 -2.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0504 1.0731 -1.9979 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2272 2.2039 -1.3174 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7651 -2.0053 -0.7775 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6832 -1.0686 -2.2560 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8487 -0.5227 -2.3020 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9103 -2.0530 -1.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6041 -0.8230 1.8112 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0540 -2.3014 0.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2954 -1.2329 1.5258 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5655 2.6365 -0.1989 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6193 1.4353 1.7485 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2878 2.0301 -1.1107 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8548 4.3816 0.3772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9245 4.6646 0.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3506 6.0839 3.5596 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8627 4.3782 -1.5984 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0131 2.9617 0.4158 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0472 -0.1571 1.9139 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5251 -2.3664 -0.0672 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9472 -1.0638 2.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0503 -2.8538 3.4993 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2618 -1.4670 3.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6614 -3.8204 3.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3283 -2.8708 3.0181 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6682 -4.9602 2.0365 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5105 -4.7351 2.7561 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5180 -2.6020 1.9683 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2631 -2.3879 -1.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9830 -1.3699 -1.1209 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9258 -1.5199 -3.1584 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0001 -0.3755 -4.8314 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5476 0.9215 -2.1242 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8970 0.6219 -4.6647 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8453 1.9987 -3.4228 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2318 1.8052 -4.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8193 0.7576 -2.9259 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6305 -2.8951 -3.9867 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7845 -3.7668 -2.1500 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0305 -5.3977 0.4053 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0927 -3.7438 -0.9190 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7923 -0.7386 3.2322 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4041 -0.9631 1.7092 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2390 1.4190 -0.8060 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 1 32 34 1 0 34 35 1 0 32 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 1 39 41 1 0 41 42 1 6 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 1 31 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 2 0 53 55 1 0 52 56 1 0 51 57 1 0 50 58 1 0 49 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 63 68 1 0 62 69 1 0 61 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 75 77 1 0 74 78 1 0 73 79 1 0 72 80 1 0 11 81 1 0 10 82 1 0 5 83 1 0 4 84 1 0 3 85 1 0 7 2 1 0 14 9 1 0 45 16 1 0 56 48 1 0 67 60 1 0 77 71 1 0 45 22 1 0 41 23 1 0 39 26 1 0 36 27 1 0 1 86 1 0 1 87 1 0 1 88 1 0 2 89 1 6 3 90 1 1 4 91 1 6 5 92 1 6 6 93 1 1 9 94 1 1 10 95 1 6 11 96 1 6 12 97 1 0 12 98 1 0 14 99 1 6 16100 1 6 17101 1 0 17102 1 0 19103 1 0 19104 1 0 19105 1 0 20106 1 0 20107 1 0 20108 1 0 21109 1 0 21110 1 0 22111 1 1 24112 1 0 25113 1 0 25114 1 0 26115 1 6 28116 1 0 28117 1 0 28118 1 0 29119 1 0 29120 1 0 30121 1 0 30122 1 0 31123 1 6 33124 1 0 33125 1 0 33126 1 0 34127 1 0 34128 1 0 35129 1 0 36130 1 6 37131 1 0 37132 1 0 38133 1 0 38134 1 0 40135 1 0 40136 1 0 40137 1 0 42138 1 0 42139 1 0 42140 1 0 43141 1 0 43142 1 0 44143 1 0 44144 1 0 46145 1 0 46146 1 0 46147 1 0 48148 1 6 49149 1 1 50150 1 6 51151 1 1 52152 1 6 55153 1 0 57154 1 0 58155 1 0 60156 1 1 61157 1 6 62158 1 1 63159 1 1 64160 1 1 65161 1 0 65162 1 0 66163 1 0 68164 1 0 69165 1 0 71166 1 1 72167 1 1 73168 1 1 74169 1 6 75170 1 1 76171 1 0 76172 1 0 76173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 M END

Standard InCHIKey	SOUGUYQVKJLLLQ-SNOIKZJBSA-N
Standard InCHI	InChI=1S/C59H96O26/c1-23-33(63)37(67)42(72)49(77-23)83-45-35(65)27(62)21-76-51(45)81-32-19-54(3,4)18-26-25-10-11-30-56(6)14-13-31(57(7,22-61)29(56)12-15-59(30,9)58(25,8)17-16-55(26,32)5)80-53-47(41(71)40(70)44(82-53)48(74)75)85-52-46(39(69)36(66)28(20-60)79-52)84-50-43(73)38(68)34(64)24(2)78-50/h10,23-24,26-47,49-53,60-73H,11-22H2,1-9H3,(H,74,75)/t23-,24-,26-,27-,28+,29+,30+,31-,32+,33-,34-,35-,36-,37+,38+,39-,40-,41-,42+,43+,44-,45+,46+,47+,49-,50-,51-,52-,53+,55+,56-,57-,58+,59+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1O[C@@H]1CC(C)(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H]([C@@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]12C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1220.62	Volume:	1166.728 ? Van der Waals volume.
Dense:	1.046	LogP:	0.737 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.708 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.834 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	57.0
TPSA:	412.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.07	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.308	Fsp³:	0.949
MCE-18:	219.826 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.69	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.404	Promiscuous compounds:	0.151

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.547	MDCK Permeability:	-5.075
Pgp-inhibitor:	0.0	Pgp-substrate:	0.825
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.989
20% Bioavailability (F20%):	0.807	30% Bioavailability (F30%):	0.943
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.75
Plasma Protein Binding (PPB):	54.305%	Volume Distribution (VD):	-0.367
Fu:	29.305% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.73	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.629

Half-life (T1/2):

3.976

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.634	Drug-induced Liver Injury (DILI):	0.989
AMES Toxicity:	0.968	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.007	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.871	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.391	RPMI-8226 Immunitoxicity:	0.342
A549 Cytotoxicity:	0.919	Hek293 Cytotoxicity:	0.252
BCF:	1.026 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.543 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.107 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.017 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32725	soybeans	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[12088420]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	6

Activity Type	# Activity
Cell line	1
Non-molecular	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT90	Cell line	DU-145	Homo sapiens	ED50	=	3.12	ug ml-1	PMID[18341287]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	3.53	ug ml-1	PMID[12088420]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	2.47	ug ml-1	PMID[12088420]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	2.39	ug ml-1	PMID[12088420]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	17.51	ug ml-1	PMID[12088420]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	27.5	ug ml-1	PMID[12088420]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC313110 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23660
0.1-0.2	22240
0.2-0.3	2700
0.3-0.4	701
0.4-0.5	371
0.5-0.6	147
0.6-0.7	17
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	4
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9394	High Similarity	NPC187618
0.9184	High Similarity	NPC131469
0.9091	High Similarity	NPC95437
0.9	High Similarity	NPC114692
0.785	Intermediate Similarity	NPC218954
0.7757	Intermediate Similarity	NPC236657
0.7615	Intermediate Similarity	NPC120116
0.7315	Intermediate Similarity	NPC118440
0.6609	Remote Similarity	NPC486564
0.6364	Remote Similarity	NPC174679
0.6364	Remote Similarity	NPC279554
0.6293	Remote Similarity	NPC486563
0.6273	Remote Similarity	NPC12288
0.624	Remote Similarity	NPC484061
0.624	Remote Similarity	NPC484062
0.6216	Remote Similarity	NPC59804
0.6186	Remote Similarity	NPC301449
0.6186	Remote Similarity	NPC601290
0.6174	Remote Similarity	NPC251768
0.6121	Remote Similarity	NPC162574
0.6094	Remote Similarity	NPC484059
0.6094	Remote Similarity	NPC484060
0.6068	Remote Similarity	NPC475504
0.6	Remote Similarity	NPC471550
0.6	Remote Similarity	NPC112352
0.5966	Remote Similarity	NPC276093
0.5909	Remote Similarity	NPC484063
0.5909	Remote Similarity	NPC484064
0.5891	Remote Similarity	NPC258617
0.5882	Remote Similarity	NPC302887
0.5877	Remote Similarity	NPC482748
0.5847	Remote Similarity	NPC482722
0.5847	Remote Similarity	NPC471963
0.5827	Remote Similarity	NPC277212
0.5827	Remote Similarity	NPC30279
0.5826	Remote Similarity	NPC472949
0.5814	Remote Similarity	NPC265841
0.5814	Remote Similarity	NPC476774
0.5806	Remote Similarity	NPC76972
0.5806	Remote Similarity	NPC469782
0.5806	Remote Similarity	NPC204414
0.5794	Remote Similarity	NPC482736
0.5794	Remote Similarity	NPC482738
0.5789	Remote Similarity	NPC25605
0.5789	Remote Similarity	NPC56713
0.5785	Remote Similarity	NPC477075
0.5763	Remote Similarity	NPC480475
0.575	Remote Similarity	NPC64715
0.5739	Remote Similarity	NPC127056
0.5736	Remote Similarity	NPC21691
0.5725	Remote Similarity	NPC476779
0.5714	Remote Similarity	NPC482739
0.5714	Remote Similarity	NPC139044
0.5692	Remote Similarity	NPC476780
0.569	Remote Similarity	NPC473884
0.5649	Remote Similarity	NPC225791
0.5625	Remote Similarity	NPC283417
0.5625	Remote Similarity	NPC200049
0.561	Remote Similarity	NPC160452
0.561	Remote Similarity	NPC480474
0.5597	Remote Similarity	NPC476775
0.5591	Remote Similarity	NPC284449
0.5591	Remote Similarity	NPC133818
0.5581	Remote Similarity	NPC47995
0.5556	Remote Similarity	NPC488561
0.5538	Remote Similarity	NPC71391
0.5528	Remote Similarity	NPC324875
0.5528	Remote Similarity	NPC292677
0.5522	Remote Similarity	NPC298034
0.5522	Remote Similarity	NPC71065
0.5508	Remote Similarity	NPC469946
0.5489	Remote Similarity	NPC293330
0.5484	Remote Similarity	NPC480473
0.5476	Remote Similarity	NPC471962
0.5462	Remote Similarity	NPC192791
0.5455	Remote Similarity	NPC63159
0.544	Remote Similarity	NPC187290
0.5426	Remote Similarity	NPC135904
0.542	Remote Similarity	NPC4749
0.542	Remote Similarity	NPC82380
0.542	Remote Similarity	NPC244296
0.5417	Remote Similarity	NPC160415
0.5407	Remote Similarity	NPC11577
0.5407	Remote Similarity	NPC141600
0.5405	Remote Similarity	NPC224121
0.5403	Remote Similarity	NPC23275
0.5403	Remote Similarity	NPC477076
0.5403	Remote Similarity	NPC477079
0.5391	Remote Similarity	NPC151543
0.5391	Remote Similarity	NPC164194
0.5378	Remote Similarity	NPC80843
0.5372	Remote Similarity	NPC164389
0.5372	Remote Similarity	NPC148603
0.5349	Remote Similarity	NPC323341
0.5344	Remote Similarity	NPC46823
0.5338	Remote Similarity	NPC473452
0.5338	Remote Similarity	NPC488308
0.5333	Remote Similarity	NPC202828
0.5333	Remote Similarity	NPC119592
0.5328	Remote Similarity	NPC475591
0.5328	Remote Similarity	NPC236870
0.5328	Remote Similarity	NPC471383
0.5317	Remote Similarity	NPC481078
0.5312	Remote Similarity	NPC60557
0.5312	Remote Similarity	NPC67857
0.5308	Remote Similarity	NPC219180
0.5299	Remote Similarity	NPC271610
0.5299	Remote Similarity	NPC312650
0.5285	Remote Similarity	NPC257468
0.5285	Remote Similarity	NPC123796
0.528	Remote Similarity	NPC481079
0.5276	Remote Similarity	NPC480939
0.5271	Remote Similarity	NPC79643
0.5263	Remote Similarity	NPC57484
0.5254	Remote Similarity	NPC309780
0.525	Remote Similarity	NPC475171
0.5246	Remote Similarity	NPC11551
0.5238	Remote Similarity	NPC477077
0.5238	Remote Similarity	NPC477078
0.5221	Remote Similarity	NPC110700
0.5221	Remote Similarity	NPC476777
0.52	Remote Similarity	NPC114484
0.5197	Remote Similarity	NPC469947
0.5197	Remote Similarity	NPC475486
0.5197	Remote Similarity	NPC480948
0.5194	Remote Similarity	NPC475287
0.5194	Remote Similarity	NPC610204
0.5191	Remote Similarity	NPC251263
0.5182	Remote Similarity	NPC302543
0.5167	Remote Similarity	NPC157868
0.5164	Remote Similarity	NPC114304
0.5159	Remote Similarity	NPC323359
0.5159	Remote Similarity	NPC482735
0.5154	Remote Similarity	NPC123522
0.5152	Remote Similarity	NPC269484
0.5152	Remote Similarity	NPC100639
0.5152	Remote Similarity	NPC470218
0.5152	Remote Similarity	NPC97918
0.5124	Remote Similarity	NPC263756
0.5124	Remote Similarity	NPC213674
0.5122	Remote Similarity	NPC173859
0.5116	Remote Similarity	NPC472267
0.5116	Remote Similarity	NPC115656
0.5116	Remote Similarity	NPC288205
0.5116	Remote Similarity	NPC51465
0.5109	Remote Similarity	NPC305981
0.5108	Remote Similarity	NPC488309
0.5082	Remote Similarity	NPC242840
0.5078	Remote Similarity	NPC609281
0.5077	Remote Similarity	NPC252657
0.5077	Remote Similarity	NPC88311
0.5076	Remote Similarity	NPC123199
0.5075	Remote Similarity	NPC192765
0.5072	Remote Similarity	NPC261506
0.5072	Remote Similarity	NPC4328
0.5071	Remote Similarity	NPC279915
0.5071	Remote Similarity	NPC476778
0.5042	Remote Similarity	NPC136877
0.5041	Remote Similarity	NPC295371
0.5041	Remote Similarity	NPC309714
0.504	Remote Similarity	NPC481082
0.504	Remote Similarity	NPC164419
0.504	Remote Similarity	NPC297263
0.5039	Remote Similarity	NPC482737
0.5039	Remote Similarity	NPC470915
0.5037	Remote Similarity	NPC470518
0.5037	Remote Similarity	NPC178264
0.5036	Remote Similarity	NPC471385
0.5036	Remote Similarity	NPC65105
0.5036	Remote Similarity	NPC161717
0.5035	Remote Similarity	NPC476776
0.5033	Remote Similarity	NPC485563

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC313110 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6927
0.1-0.2	2167
0.2-0.3	50
0.3-0.4	4
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data