NPASS Compound

Natural Product: NPC482735

Natural Product ID	NPC482735
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CWRRYAWFDXCSDM-NHODMXMXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 146153 0 0 0 0 0 0 0 0999 V2000 5.7695 1.5702 4.5925 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9034 1.7923 3.0993 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8116 2.9725 2.8843 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0624 4.0554 2.1816 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3585 3.5315 0.9508 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9356 2.0784 1.1147 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6588 1.9251 2.4866 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9512 1.2087 0.7954 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5791 0.2782 -0.1705 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4721 0.3611 -1.3945 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6332 -0.5548 -1.2272 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0028 -0.7685 0.2335 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1373 -1.7315 0.2447 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0440 -2.8359 0.8486 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3408 -1.4582 -0.4040 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9753 -1.3176 0.9661 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7224 -1.1203 0.3818 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4546 -2.0090 -0.6220 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3645 -2.8455 -0.4257 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9732 -4.2533 -0.3825 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8395 -5.2526 -0.3577 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2923 -5.1932 -1.7972 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0121 -5.8797 -1.8288 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9279 -7.0309 -1.3327 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8940 -5.3119 -2.3820 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4026 -3.9641 -2.3227 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3842 -2.8452 -1.5845 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1563 -2.4387 -1.1128 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8114 -1.1280 -1.3190 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5069 -0.3394 -0.1045 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1878 -0.8107 0.4574 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8937 -1.0342 -0.5847 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0432 -2.5088 -0.6942 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4295 -0.3403 -1.8203 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5438 -0.2869 -2.8428 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5073 0.7693 -2.3374 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1019 0.2222 -1.0637 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1723 -0.7477 -1.5607 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 -0.3603 -0.1081 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9310 -1.1280 0.8874 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6531 -2.2533 1.3564 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1519 -0.4778 1.3528 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6267 0.6591 0.8078 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8611 1.3316 1.2665 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5218 0.6131 2.4068 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7461 1.3557 2.8365 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6391 1.8142 4.3054 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0593 2.5688 2.0255 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9523 2.4138 0.5507 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8084 1.4677 0.1287 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4739 0.1435 -0.1501 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1918 1.9549 -1.1591 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7321 2.1751 -1.1556 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8827 1.3131 -0.3177 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8711 2.2307 0.3879 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1791 2.0524 -0.0027 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8773 2.8530 -0.9099 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3106 3.9597 -1.2040 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1776 2.4669 -1.4994 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9862 0.4976 2.8349 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0201 0.7950 2.1858 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0166 -0.6789 3.5726 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8580 -0.8084 -2.4116 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7323 -1.7980 -3.5072 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4369 0.4633 -3.0879 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3601 -6.5114 -0.1384 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9264 -4.4214 0.5718 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7297 0.0183 -1.8522 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7213 -0.0577 -2.4876 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2260 4.3185 0.7574 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1828 4.7369 3.0249 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9429 2.6459 2.1219 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2549 0.5939 4.7078 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8128 1.5238 4.9950 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2325 2.4209 5.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4399 0.9051 2.6569 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1956 3.3867 3.8400 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8178 4.8189 1.8329 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0916 3.6278 0.1016 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9951 1.9012 0.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5241 0.4186 -0.4747 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7618 1.4107 -1.6170 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4721 -1.5613 -1.6656 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3993 0.1754 0.6844 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0575 -2.1529 -0.3879 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9646 -1.2579 1.1852 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9082 -2.5861 0.5426 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4766 -4.3550 -1.3828 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0325 -4.9778 0.3427 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0159 -5.8547 -2.3683 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0449 -5.4714 -2.0328 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7653 -1.9294 -2.1579 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7841 -0.6980 -1.7167 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3728 0.7270 -0.3833 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3075 -0.3342 0.6581 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3627 -1.7069 1.0908 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1374 0.0127 1.1653 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4666 -2.9967 0.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5719 -2.9234 -1.6168 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0810 -2.8890 -0.7655 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2581 0.7138 -1.5200 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1397 0.1283 -3.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0794 -1.2259 -2.9812 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0460 1.7530 -2.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2775 0.8327 -3.1393 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7609 -1.6825 -1.9737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9352 -1.0091 -0.8501 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7111 -0.2645 -2.4315 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7514 0.5068 0.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7197 -0.9220 2.1812 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6215 2.3597 1.6624 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8266 0.6139 3.3040 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7727 -0.4316 2.2432 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6760 0.8912 4.9289 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5688 2.3750 4.5175 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7755 2.4561 4.4843 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5140 3.4810 2.3884 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1401 2.8210 2.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6964 3.4174 0.1196 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5771 0.1546 -0.0048 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3763 -0.0394 -1.2672 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9956 -0.7262 0.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4927 1.2862 -2.0261 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7102 2.9107 -1.4158 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5830 3.2667 -0.8634 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4181 2.2018 -2.2418 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3240 3.2746 0.4341 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9477 2.3693 -0.1687 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7171 1.9736 1.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0336 2.6303 -0.8214 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1559 1.3788 -1.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3872 2.9895 -2.4464 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7350 -1.3992 3.4613 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1602 -2.7760 -3.3355 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3400 -1.9201 -3.7642 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1987 -1.4619 -4.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9836 0.5461 -4.0874 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5169 0.3414 -3.1986 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2284 1.3518 -2.4491 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1425 -6.6448 -0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4734 -5.2078 0.3642 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2358 -0.6964 -2.3100 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1251 0.1807 -3.3473 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4440 5.1925 0.3438 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8945 5.5454 2.5325 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7443 3.1240 2.3990 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 12 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 22 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 6 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 6 37 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 42 43 2 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 1 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 6 50 52 1 0 52 53 1 0 53 54 1 0 54 55 1 1 49 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 46 60 1 0 60 61 2 0 60 62 1 0 34 63 1 0 63 64 1 0 63 65 1 0 21 66 1 0 20 67 1 0 11 68 1 0 10 69 1 0 5 70 1 0 4 71 1 0 3 72 1 0 7 2 1 0 17 9 1 0 27 19 1 0 63 29 1 0 39 32 1 0 54 43 1 0 54 37 1 0 50 44 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 6 3 77 1 1 4 78 1 6 5 79 1 6 6 80 1 6 9 81 1 6 10 82 1 6 11 83 1 6 12 84 1 1 15 85 1 0 17 86 1 1 19 87 1 1 20 88 1 6 21 89 1 1 22 90 1 6 25 91 1 0 27 92 1 6 29 93 1 6 30 94 1 0 30 95 1 0 31 96 1 0 31 97 1 0 33 98 1 0 33 99 1 0 33100 1 0 34101 1 1 35102 1 0 35103 1 0 36104 1 0 36105 1 0 38106 1 0 38107 1 0 38108 1 0 39109 1 1 42110 1 0 44111 1 1 45112 1 0 45113 1 0 47114 1 0 47115 1 0 47116 1 0 48117 1 0 48118 1 0 49119 1 6 51120 1 0 51121 1 0 51122 1 0 52123 1 0 52124 1 0 53125 1 0 53126 1 0 55127 1 0 55128 1 0 55129 1 0 59130 1 0 59131 1 0 59132 1 0 62133 1 0 64134 1 0 64135 1 0 64136 1 0 65137 1 0 65138 1 0 65139 1 0 66140 1 0 67141 1 0 68142 1 0 69143 1 0 70144 1 0 71145 1 0 72146 1 0 M END

Standard InCHIKey	CWRRYAWFDXCSDM-NHODMXMXSA-N
Standard InCHI	InChI=1S/C50H74O22/c1-19-27(53)28(54)33(59)41(66-19)71-37-32(58)30(56)35(40(62)63)70-43(37)72-36-31(57)29(55)34(39(60)61)69-42(36)68-25-11-12-48(7)24(45(25,3)4)10-13-50(9)38(48)23(52)16-21-22-17-46(5,44(64)65)18-26(67-20(2)51)47(22,6)14-15-49(21,50)8/h16,19,22,24-38,41-43,53-59H,10-15,17-18H2,1-9H3,(H,60,61)(H,62,63)(H,64,65)/t19-,22+,24-,25-,26+,27-,28+,29+,30-,31+,32-,33+,34+,35-,36-,37+,38+,41-,42-,43-,46+,47+,48-,49+,50+/m1/s1
SMILES	C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O[C@H]1[C@@H]([C@H]([C@H](C(=O)O)O[C@@H]1O[C@@H]1[C@H]([C@@H]([C@@H](C(=O)O)O[C@H]1O[C@@H]1CC[C@]2(C)[C@H](CC[C@@]3(C)[C@H]2C(=O)C=C2[C@@H]4C[C@@](C)(C[C@@H]([C@@]4(C)CC[C@]32C)OC(=O)C)C(=O)O)C1(C)C)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1026.47	Volume:	982.47 ? Van der Waals volume.
Dense:	1.045	LogP:	1.206 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.712 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.931 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	49.0
TPSA:	352.26 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.106	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.618	Fsp³:	0.86
MCE-18:	185.72 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.752	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.049 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.237	Promiscuous compounds:	0.325

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.126	MDCK Permeability:	-5.139
Pgp-inhibitor:	0.0	Pgp-substrate:	0.057
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.037
20% Bioavailability (F20%):	0.025	30% Bioavailability (F30%):	0.023
50% Bioavailability (F50%):	0.891

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.975
Plasma Protein Binding (PPB):	53.46%	Volume Distribution (VD):	-0.552
Fu:	31.81% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.995
OATP1B3 inhibitor:	0.097	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.956
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.951
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.175

Half-life (T1/2):

4.661

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.497	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.101	Rat Oral Acute Toxicity:	0.011
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.006	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.005
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.993
Hematotoxicity:	0.25	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.933	RPMI-8226 Immunitoxicity:	0.146
A549 Cytotoxicity:	0.007	Hek293 Cytotoxicity:	0.006
BCF:	0.34 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.542 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.434 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.313 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11164-015-2099-x]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1134/S1021443711030101]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[16441081]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16675659]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	rhizome	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24479468]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	roots	n.a.	n.a.	PMID[24957203]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25445757]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25744461]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26841168]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32196343]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	1

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT742	Organism	Influenza A virus	Influenza A virus	Activity	=	47.0	%	PMID[26841168]
NPT742	Organism	Influenza A virus	Influenza A virus	IC50	=	39600.0	nM	PMID[26841168]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482735 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20768
0.1-0.2	24950
0.2-0.3	3283
0.3-0.4	668
0.4-0.5	131
0.5-0.6	21
0.6-0.7	13
0.7-0.8	1
0.8-0.85	1
0.85-0.9	5
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.93	High Similarity	NPC482739
0.9208	High Similarity	NPC482736
0.9208	High Similarity	NPC482738
0.898	High Similarity	NPC482737
0.8866	High Similarity	NPC482734
0.8866	High Similarity	NPC182342
0.8866	High Similarity	NPC482727
0.8866	High Similarity	NPC471964
0.8039	Intermediate Similarity	NPC482755
0.75	Intermediate Similarity	NPC482722
0.75	Intermediate Similarity	NPC471963
0.7196	Intermediate Similarity	NPC262199
0.717	Intermediate Similarity	NPC482744
0.7143	Intermediate Similarity	NPC471965
0.7143	Intermediate Similarity	NPC482749
0.713	Intermediate Similarity	NPC482740
0.7117	Intermediate Similarity	NPC471962
0.7115	Intermediate Similarity	NPC482747
0.7115	Intermediate Similarity	NPC202666
0.7115	Intermediate Similarity	NPC471961
0.7115	Intermediate Similarity	NPC242015
0.6981	Remote Similarity	NPC285091
0.6509	Remote Similarity	NPC482750
0.6422	Remote Similarity	NPC482741
0.6422	Remote Similarity	NPC482745
0.6422	Remote Similarity	NPC482743
0.6422	Remote Similarity	NPC146753
0.633	Remote Similarity	NPC482717
0.6306	Remote Similarity	NPC14617
0.625	Remote Similarity	NPC482729
0.625	Remote Similarity	NPC482742
0.6228	Remote Similarity	NPC247315
0.6228	Remote Similarity	NPC482728
0.619	Remote Similarity	NPC482752
0.5849	Remote Similarity	NPC471967
0.5752	Remote Similarity	NPC482746
0.5625	Remote Similarity	NPC309780
0.5378	Remote Similarity	NPC131469
0.5372	Remote Similarity	NPC477075
0.5372	Remote Similarity	NPC477079
0.5333	Remote Similarity	NPC95437
0.5328	Remote Similarity	NPC477077
0.5328	Remote Similarity	NPC477078
0.5289	Remote Similarity	NPC114692
0.5248	Remote Similarity	NPC74751
0.5246	Remote Similarity	NPC477076
0.521	Remote Similarity	NPC251768
0.5203	Remote Similarity	NPC187618
0.5159	Remote Similarity	NPC313110
0.5128	Remote Similarity	NPC472949
0.5082	Remote Similarity	NPC64715
0.5081	Remote Similarity	NPC120116
0.5043	Remote Similarity	NPC275343
0.5043	Remote Similarity	NPC482748
0.5038	Remote Similarity	NPC258617

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482735 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6557
0.1-0.2	2536
0.2-0.3	50
0.3-0.4	1
0.4-0.5	4
0.5-0.6	1
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7115	Intermediate Similarity	NPD8328	Phase 2
0.5248	Remote Similarity	NPD7748	Pre-clinical

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data