NPASS Compound

Natural Product: NPC204414

Natural Product ID	NPC204414
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3Beta-O-[Beta-D-Quinovopyranosyl-(1->2)-Alpha-L-Arabinopyranosyl]Hederagenin 28-O-[Alpha-L-Rhamnopyranosyl(1->4)-Beta-D-Glucopyranosyl-(1->6)-Beta-D-Glucopyranosyl]Ester
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL451591
PubChem CID	44575198
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 9.6310 -0.5339 2.1908 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7601 -1.2470 2.5234 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3103 -2.0922 1.3894 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3343 -2.9922 1.0255 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7183 -2.7055 -0.1682 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1060 -1.5504 -0.2713 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8700 -1.2156 -0.4716 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8122 -1.4814 0.5350 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6214 -0.9453 0.0137 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4750 -1.6409 0.3324 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4542 -1.0024 -0.4626 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4311 -0.2946 0.1274 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3649 -0.2090 1.3599 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3685 0.4028 -0.7102 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2386 1.2053 -1.6703 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4888 2.3029 -2.3076 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0593 3.2459 -1.2411 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3236 2.6598 -0.0952 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5221 1.2261 0.1836 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8450 0.6540 0.4492 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3885 0.9826 1.6203 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7380 0.5047 2.0422 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4666 0.3242 0.7293 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8022 -0.7870 0.0132 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4901 -0.2136 -0.5743 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4926 -1.3073 -0.8638 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7085 -0.6591 -1.5054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8017 0.4888 -1.8602 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2739 -1.8535 0.9964 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5889 -1.5009 -1.0191 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0267 -1.1908 -1.1493 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4884 0.0803 -0.5011 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9620 0.2494 0.8848 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3907 -0.8240 1.8386 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4097 1.5754 1.4243 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4346 2.3144 0.6568 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5188 1.4307 0.0645 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9649 0.2889 -0.6983 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7773 -0.9755 -0.6367 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1039 0.7227 -2.1799 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4801 0.9493 -2.4412 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2387 0.9836 1.1578 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4992 1.5499 1.2994 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5479 2.3959 2.4067 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8626 2.5581 2.8006 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.3714 1.3302 3.5436 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6910 0.1066 2.9116 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5097 0.4706 1.4549 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.6858 0.6915 0.7836 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0104 -0.1815 -0.2094 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.2148 0.4386 -1.4435 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3665 -0.5094 -2.4259 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.3058 0.1869 -3.7913 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.7930 -1.0514 -2.2837 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.8016 -1.7879 -0.9514 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.3025 -0.8841 0.1569 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.0917 -1.6920 1.2805 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.0897 -2.1756 -0.6598 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.0940 -1.9447 -3.2927 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4499 -0.0156 3.5476 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8940 1.4140 4.8485 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3399 3.9237 -0.7239 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2616 4.3713 -1.9084 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4883 -3.0862 -0.0271 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8363 -3.7555 0.2080 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6431 -2.8274 1.0948 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9738 -2.6915 2.3485 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4020 -3.9895 -1.0225 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5483 -3.7550 0.7581 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7606 -2.9840 -1.2573 C 0 0 1 0 0 0 0 0 0 0 0 0 12.0110 -2.2400 -0.9167 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7766 -1.2716 0.2278 C 0 0 2 0 0 0 0 0 0 0 0 0 13.0048 -0.6422 0.4241 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9840 0.6960 0.1064 C 0 0 2 0 0 0 0 0 0 0 0 0 13.7413 0.8599 -1.0405 O 0 0 0 0 0 0 0 0 0 0 0 0 14.9867 1.3893 -0.8394 C 0 0 1 0 0 0 0 0 0 0 0 0 15.6579 1.4855 -2.2007 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9548 2.7812 -0.2534 C 0 0 1 0 0 0 0 0 0 0 0 0 13.6137 2.9979 0.4487 C 0 0 2 0 0 0 0 0 0 0 0 0 13.3042 1.6718 1.1658 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1848 1.9506 1.9531 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6515 3.1818 -0.5582 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9345 2.8444 0.7353 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5622 -1.5887 -2.0217 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0894 -4.3438 -1.2828 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8749 0.3119 1.7733 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5628 -0.6350 3.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4525 -1.9912 3.3177 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1786 -2.6443 1.8652 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9917 -3.5770 -0.3284 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8521 -0.0709 -0.6840 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4243 -1.5970 -1.4595 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0390 -0.7890 1.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2665 -1.5110 1.3997 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1302 1.6200 -1.1470 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6500 0.4568 -2.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7228 2.0064 -3.0386 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2400 2.8865 -2.9377 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7688 2.9414 -0.2429 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5812 3.3210 0.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0271 1.1885 1.2058 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8422 1.6145 2.2981 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1618 1.2861 2.6968 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7002 -0.4111 2.6602 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2805 1.2761 0.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1732 -1.8799 0.0217 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8787 -2.0494 -1.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4456 -1.5135 -1.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4599 -0.3894 -2.5363 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8818 0.7018 -2.0223 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2897 1.4350 -2.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5361 -0.1825 -2.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9925 -2.7111 0.3340 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0228 -2.1807 1.7079 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3957 -1.4883 1.5661 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0986 -1.2942 -2.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4366 -2.6240 -0.9379 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5777 -2.0204 -0.6130 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3656 -1.2514 -2.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0093 0.9176 -1.0818 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3709 -0.6044 2.2408 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3860 -1.8343 1.4357 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6865 -0.7957 2.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8404 1.4594 2.4733 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4964 2.2323 1.5741 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9257 2.8515 -0.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8731 3.1031 1.3006 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1723 2.1265 -0.4947 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4226 -1.7319 -1.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8390 -0.7879 -0.9782 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8356 -1.4680 0.3236 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5934 1.6704 -2.3561 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7481 -0.0309 -2.8753 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6298 1.8399 -2.8383 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6326 2.2234 0.4270 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9977 3.4670 3.4338 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4910 2.6874 1.9035 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4566 1.2469 3.5795 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2583 -0.7981 3.0955 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0827 -0.4655 0.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2727 -0.9913 -0.3760 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6748 -1.3533 -2.3727 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2843 0.7349 -3.8795 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4537 0.8995 -3.7288 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1756 -0.5654 -4.5741 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4634 -0.1800 -2.2333 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1367 -2.6696 -1.0364 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1211 -0.1705 0.3833 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1713 -2.0606 1.2513 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1201 -3.1440 -0.4859 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0615 -1.5021 -4.1713 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6156 -0.0640 4.5318 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5621 1.7125 5.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7310 3.3699 0.1679 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1078 3.9546 -1.5316 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0885 4.9348 -0.3944 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9376 5.0910 -2.4256 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3176 3.8737 -2.7317 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4320 4.8414 -1.2083 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1597 -3.2396 -1.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7078 -4.6970 0.7765 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5854 -3.2979 1.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7409 -3.5839 2.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1096 -4.8742 -1.3397 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7256 -4.7414 0.7321 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4002 -2.6352 -2.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8223 -2.9300 -0.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0069 -0.5870 -0.1013 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9232 0.9249 -0.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6272 0.6902 -0.2326 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7331 0.4530 -2.6537 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6485 1.9734 -2.1311 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9867 2.0687 -2.8708 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1165 3.5364 -1.0348 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6584 3.8458 1.1568 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1982 1.4556 1.7687 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4136 2.0982 1.3113 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0782 3.3450 -1.4442 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8888 3.7339 1.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3594 -2.1391 -2.8364 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3142 -4.9021 -1.4707 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 1 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 6 24 29 1 1 24 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 1 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 6 38 40 1 0 40 41 1 0 37 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 54 59 1 0 47 60 1 0 46 61 1 0 17 62 1 0 17 63 1 0 10 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 5 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 76 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 79 82 1 0 78 83 1 0 71 84 1 0 70 85 1 0 72 3 1 0 80 74 1 0 66 8 1 0 27 14 1 0 38 32 1 0 48 43 1 0 56 50 1 0 19 14 1 0 25 20 1 0 33 23 1 0 1 86 1 0 2 87 1 0 2 88 1 0 3 89 1 1 5 90 1 6 7 91 1 0 7 92 1 0 8 93 1 1 10 94 1 1 15 95 1 0 15 96 1 0 16 97 1 0 16 98 1 0 18 99 1 0 18100 1 0 19101 1 1 21102 1 0 22103 1 0 22104 1 0 23105 1 6 26106 1 0 26107 1 0 27108 1 0 27109 1 0 28110 1 0 28111 1 0 28112 1 0 29113 1 0 29114 1 0 29115 1 0 30116 1 0 30117 1 0 31118 1 0 31119 1 0 32120 1 6 34121 1 0 34122 1 0 34123 1 0 35124 1 0 35125 1 0 36126 1 0 36127 1 0 37128 1 6 39129 1 0 39130 1 0 39131 1 0 40132 1 0 40133 1 0 41134 1 0 43135 1 6 45136 1 0 45137 1 0 46138 1 1 47139 1 6 48140 1 6 50141 1 6 52142 1 6 53143 1 0 53144 1 0 53145 1 0 54146 1 1 55147 1 6 56148 1 1 57149 1 0 58150 1 0 59151 1 0 60152 1 0 61153 1 0 62154 1 0 62155 1 0 62156 1 0 63157 1 0 63158 1 0 63159 1 0 64160 1 6 65161 1 1 66162 1 1 67163 1 0 68164 1 0 69165 1 0 70166 1 6 71167 1 1 72168 1 6 74169 1 6 76170 1 1 77171 1 0 77172 1 0 77173 1 0 78174 1 6 79175 1 1 80176 1 1 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 M END

Standard InCHIKey	RYHDIBJJJRNDSX-WHGXSBMGSA-N
Standard InCHI	InChI=1S/C59H96O26/c1-24-34(63)38(67)42(71)49(78-24)83-46-29(20-60)80-48(45(74)41(46)70)77-22-30-37(66)40(69)44(73)51(81-30)85-53(75)59-17-15-54(3,4)19-27(59)26-9-10-32-55(5)13-12-33(56(6,23-61)31(55)11-14-58(32,8)57(26,7)16-18-59)82-52-47(36(65)28(62)21-76-52)84-50-43(72)39(68)35(64)25(2)79-50/h9,24-25,27-52,60-74H,10-23H2,1-8H3/t24-,25+,27-,28-,29+,30+,31+,32+,33-,34-,35+,36-,37+,38+,39-,40-,41+,42+,43+,44+,45+,46+,47+,48+,49-,50-,51-,52-,55-,56-,57+,58+,59-/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CCC(C[C@H]4C4=CC[C@H]5[C@@]([C@@]4(CC3)C)(C)CC[C@@H]3[C@]5(C)CC[C@@H]([C@@]3(C)CO)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@H](C)[C@H]([C@@H]([C@H]3O)O)O)O)O)(C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33015	trevesia palmata	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757708]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1886	Cell line	J774	Mus musculus	IC50	=	460.0	nM	DOI[10.1039/C2MD00317A]
NPT3470	Cell line	WEHI-164	Mus musculus	IC50	=	1900.0	nM	PMID[18183025]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC204414 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23565
0.1-0.2	22226
0.2-0.3	2784
0.3-0.4	726
0.4-0.5	325
0.5-0.6	110
0.6-0.7	44
0.7-0.8	0
0.8-0.85	13
0.85-0.9	8
0.9-0.95	2
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC76972
1.0	High Similarity	NPC469782
0.9216	High Similarity	NPC60557
0.9216	High Similarity	NPC67857
0.8991	High Similarity	NPC202828
0.8991	High Similarity	NPC119592
0.8952	High Similarity	NPC135904
0.8909	High Similarity	NPC298034
0.8909	High Similarity	NPC71065
0.8824	High Similarity	NPC241909
0.8598	High Similarity	NPC155410
0.8519	High Similarity	NPC100639
0.8319	Intermediate Similarity	NPC236638
0.8319	Intermediate Similarity	NPC294453
0.8319	Intermediate Similarity	NPC305981
0.8246	Intermediate Similarity	NPC261506
0.8246	Intermediate Similarity	NPC4328
0.823	Intermediate Similarity	NPC65105
0.8142	Intermediate Similarity	NPC41061
0.8142	Intermediate Similarity	NPC227551
0.8113	Intermediate Similarity	NPC295823
0.8113	Intermediate Similarity	NPC174720
0.8113	Intermediate Similarity	NPC475467
0.8073	Intermediate Similarity	NPC192600
0.8	Intermediate Similarity	NPC165204
0.7885	Intermediate Similarity	NPC102439
0.781	Intermediate Similarity	NPC63159
0.7788	Intermediate Similarity	NPC104071
0.7759	Intermediate Similarity	NPC293330
0.7607	Intermediate Similarity	NPC43550
0.7583	Intermediate Similarity	NPC250247
0.7524	Intermediate Similarity	NPC112352
0.7521	Intermediate Similarity	NPC258617
0.7478	Intermediate Similarity	NPC488560
0.7434	Intermediate Similarity	NPC79643
0.7333	Intermediate Similarity	NPC295371
0.7259	Intermediate Similarity	NPC469775
0.7241	Intermediate Similarity	NPC475160
0.7241	Intermediate Similarity	NPC473714
0.7155	Intermediate Similarity	NPC123199
0.7143	Intermediate Similarity	NPC110633
0.7119	Intermediate Similarity	NPC481080
0.7101	Intermediate Similarity	NPC469774
0.7073	Intermediate Similarity	NPC220160
0.7043	Intermediate Similarity	NPC475287
0.695	Remote Similarity	NPC100925
0.6937	Remote Similarity	NPC475504
0.6917	Remote Similarity	NPC476068
0.6917	Remote Similarity	NPC57484
0.6853	Remote Similarity	NPC469777
0.6792	Remote Similarity	NPC48499
0.6763	Remote Similarity	NPC469776
0.6754	Remote Similarity	NPC481079
0.6712	Remote Similarity	NPC469772
0.6696	Remote Similarity	NPC148417
0.6694	Remote Similarity	NPC481081
0.6667	Remote Similarity	NPC224381
0.6638	Remote Similarity	NPC481078
0.6622	Remote Similarity	NPC469773
0.662	Remote Similarity	NPC32723
0.6607	Remote Similarity	NPC101744
0.6607	Remote Similarity	NPC46665
0.6606	Remote Similarity	NPC473373
0.6573	Remote Similarity	NPC481323
0.6573	Remote Similarity	NPC469778
0.656	Remote Similarity	NPC136768
0.6542	Remote Similarity	NPC29069
0.6518	Remote Similarity	NPC309714
0.6483	Remote Similarity	NPC135334
0.6446	Remote Similarity	NPC475209
0.6438	Remote Similarity	NPC481324
0.6393	Remote Similarity	NPC471550
0.6349	Remote Similarity	NPC161717
0.6339	Remote Similarity	NPC469946
0.6328	Remote Similarity	NPC70809
0.632	Remote Similarity	NPC473452
0.6293	Remote Similarity	NPC134835
0.6267	Remote Similarity	NPC295941
0.626	Remote Similarity	NPC470218
0.6228	Remote Similarity	NPC160415
0.6212	Remote Similarity	NPC480422
0.6179	Remote Similarity	NPC480419
0.6174	Remote Similarity	NPC480475
0.6102	Remote Similarity	NPC73318
0.6068	Remote Similarity	NPC297263
0.6063	Remote Similarity	NPC480418
0.6053	Remote Similarity	NPC473343
0.6017	Remote Similarity	NPC486563
0.6	Remote Similarity	NPC187618
0.5968	Remote Similarity	NPC475899
0.5968	Remote Similarity	NPC133818
0.595	Remote Similarity	NPC31838
0.595	Remote Similarity	NPC187290
0.594	Remote Similarity	NPC480417
0.5932	Remote Similarity	NPC222580
0.5929	Remote Similarity	NPC174679
0.5929	Remote Similarity	NPC235405
0.5929	Remote Similarity	NPC279554
0.5917	Remote Similarity	NPC301449
0.5917	Remote Similarity	NPC218954
0.5917	Remote Similarity	NPC601290
0.5897	Remote Similarity	NPC251768
0.5891	Remote Similarity	NPC475514
0.5882	Remote Similarity	NPC601659
0.5877	Remote Similarity	NPC249848
0.5877	Remote Similarity	NPC107966
0.5847	Remote Similarity	NPC475591
0.5847	Remote Similarity	NPC236870
0.5847	Remote Similarity	NPC235438
0.5814	Remote Similarity	NPC286457
0.5806	Remote Similarity	NPC313110
0.5785	Remote Similarity	NPC486564
0.5763	Remote Similarity	NPC10607
0.5763	Remote Similarity	NPC164389
0.5763	Remote Similarity	NPC473459
0.5739	Remote Similarity	NPC150400
0.5738	Remote Similarity	NPC80986
0.5738	Remote Similarity	NPC480474
0.5727	Remote Similarity	NPC256798
0.5726	Remote Similarity	NPC192791
0.5725	Remote Similarity	NPC471385
0.5704	Remote Similarity	NPC102505
0.5704	Remote Similarity	NPC472268
0.5704	Remote Similarity	NPC488514
0.5701	Remote Similarity	NPC237503
0.569	Remote Similarity	NPC473884
0.5678	Remote Similarity	NPC109588
0.5678	Remote Similarity	NPC30735
0.5641	Remote Similarity	NPC161674
0.5634	Remote Similarity	NPC297950
0.563	Remote Similarity	NPC488526
0.561	Remote Similarity	NPC480473
0.5575	Remote Similarity	NPC90856
0.5575	Remote Similarity	NPC214484
0.5573	Remote Similarity	NPC13998
0.5565	Remote Similarity	NPC104137
0.5565	Remote Similarity	NPC26626
0.5565	Remote Similarity	NPC473826
0.5556	Remote Similarity	NPC39211
0.5547	Remote Similarity	NPC251263
0.5547	Remote Similarity	NPC309907
0.553	Remote Similarity	NPC470876
0.5522	Remote Similarity	NPC309223
0.5517	Remote Similarity	NPC139894
0.5517	Remote Similarity	NPC475516
0.5517	Remote Similarity	NPC59804
0.5514	Remote Similarity	NPC167383
0.5512	Remote Similarity	NPC123522
0.5508	Remote Similarity	NPC263756
0.5504	Remote Similarity	NPC191827
0.55	Remote Similarity	NPC173859
0.55	Remote Similarity	NPC148603
0.5484	Remote Similarity	NPC96641
0.5484	Remote Similarity	NPC163183
0.5461	Remote Similarity	NPC475368
0.5455	Remote Similarity	NPC68175
0.5455	Remote Similarity	NPC139044
0.5447	Remote Similarity	NPC114484
0.5439	Remote Similarity	NPC189884
0.5439	Remote Similarity	NPC138334
0.5426	Remote Similarity	NPC219180
0.5397	Remote Similarity	NPC815
0.5385	Remote Similarity	NPC283417
0.5385	Remote Similarity	NPC200049
0.5385	Remote Similarity	NPC56713
0.5379	Remote Similarity	NPC21691
0.5378	Remote Similarity	NPC76497
0.5378	Remote Similarity	NPC213674
0.5372	Remote Similarity	NPC473401
0.5345	Remote Similarity	NPC475208
0.5333	Remote Similarity	NPC223301
0.5333	Remote Similarity	NPC171544
0.5329	Remote Similarity	NPC472269
0.5328	Remote Similarity	NPC471383
0.5328	Remote Similarity	NPC162574
0.5323	Remote Similarity	NPC281148
0.5323	Remote Similarity	NPC104372
0.5323	Remote Similarity	NPC276093
0.5317	Remote Similarity	NPC36831
0.5315	Remote Similarity	NPC489208
0.5289	Remote Similarity	NPC471548
0.5285	Remote Similarity	NPC488517
0.5267	Remote Similarity	NPC480423
0.5263	Remote Similarity	NPC209894
0.525	Remote Similarity	NPC471547
0.5246	Remote Similarity	NPC40775
0.5246	Remote Similarity	NPC305267
0.5227	Remote Similarity	NPC47995
0.5227	Remote Similarity	NPC54636
0.521	Remote Similarity	NPC480420
0.5203	Remote Similarity	NPC45606
0.5194	Remote Similarity	NPC300419
0.5194	Remote Similarity	NPC268184
0.5188	Remote Similarity	NPC85154
0.5175	Remote Similarity	NPC128925
0.5169	Remote Similarity	NPC136877
0.5167	Remote Similarity	NPC470512
0.5167	Remote Similarity	NPC157868
0.5161	Remote Similarity	NPC131469

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC204414 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7595
0.1-0.2	1499
0.2-0.3	49
0.3-0.4	7
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data